2855 lines
		
	
	
		
			97 KiB
		
	
	
	
		
			JavaScript
		
	
	
	
			
		
		
	
	
			2855 lines
		
	
	
		
			97 KiB
		
	
	
	
		
			JavaScript
		
	
	
	
| /* jquery.nicescroll
 | |
| -- version 3.1.4
 | |
| -- copyright 2011-12 InuYaksa*2012
 | |
| -- licensed under the MIT
 | |
| --
 | |
| -- http://areaaperta.com/nicescroll
 | |
| -- https://github.com/inuyaksa/jquery.nicescroll
 | |
| --
 | |
| */
 | |
| 
 | |
| (function(jQuery){
 | |
| 
 | |
|   // globals
 | |
|   var domfocus = false;
 | |
|   var mousefocus = false;
 | |
|   var zoomactive = false;
 | |
|   var tabindexcounter = 5000;
 | |
|   var ascrailcounter = 2000;
 | |
|   
 | |
|   var $ = jQuery;  // sandbox
 | |
|  
 | |
|   // http://stackoverflow.com/questions/2161159/get-script-path
 | |
|   function getScriptPath() {
 | |
|     var scripts=document.getElementsByTagName('script');
 | |
|     var path=scripts[scripts.length-1].src.split('?')[0];
 | |
|     return (path.split('/').length>0) ? path.split('/').slice(0,-1).join('/')+'/' : '';
 | |
|   }
 | |
|   var scriptpath = getScriptPath();
 | |
| 
 | |
|   // derived by http://blog.joelambert.co.uk/2011/06/01/a-better-settimeoutsetinterval/
 | |
|   var setAnimationFrame = (function(){
 | |
|     return  window.requestAnimationFrame       || 
 | |
|             window.webkitRequestAnimationFrame || 
 | |
|             window.mozRequestAnimationFrame    || 
 | |
|             window.oRequestAnimationFrame      || 
 | |
|             window.msRequestAnimationFrame     || 
 | |
|             false;
 | |
|   })();
 | |
|   var clearAnimationFrame = (function(){
 | |
|     return  window.cancelRequestAnimationFrame       || 
 | |
|             window.webkitCancelRequestAnimationFrame || 
 | |
|             window.mozCancelRequestAnimationFrame    || 
 | |
|             window.oCancelRequestAnimationFrame      || 
 | |
|             window.msCancelRequestAnimationFrame     || 
 | |
|             false;
 | |
|   })();  
 | |
|   
 | |
|   var browserdetected = false;
 | |
|   
 | |
|   var getBrowserDetection = function() {
 | |
|   
 | |
|     if (browserdetected) return browserdetected;
 | |
|   
 | |
|     var domtest = document.createElement('DIV');
 | |
| 
 | |
|     var d = {};
 | |
|     
 | |
| 		d.haspointerlock = "pointerLockElement" in document || "mozPointerLockElement" in document || "webkitPointerLockElement" in document;
 | |
| 		
 | |
|     d.isopera = ("opera" in window);
 | |
|     d.isopera12 = (d.isopera&&("getUserMedia" in navigator));
 | |
|     
 | |
|     d.isie = (("all" in document) && ("attachEvent" in domtest) && !d.isopera);
 | |
|     d.isieold = (d.isie && !("msInterpolationMode" in domtest.style));  // IE6 and older
 | |
|     d.isie7 = d.isie&&!d.isieold&&(!("documentMode" in document)||(document.documentMode==7));
 | |
|     d.isie8 = d.isie&&("documentMode" in document)&&(document.documentMode==8);
 | |
|     d.isie9 = d.isie&&("performance" in window)&&(document.documentMode>=9);
 | |
|     d.isie10 = d.isie&&("performance" in window)&&(document.documentMode>=10);
 | |
|     
 | |
|     d.isie9mobile = /iemobile.9/i.test(navigator.userAgent);  //wp 7.1 mango
 | |
|     if (d.isie9mobile) d.isie9 = false;
 | |
|     d.isie7mobile = (!d.isie9mobile&&d.isie7) && /iemobile/i.test(navigator.userAgent);  //wp 7.0
 | |
|     
 | |
|     d.ismozilla = ("MozAppearance" in domtest.style);
 | |
| 		
 | |
|     d.iswebkit = ("WebkitAppearance" in domtest.style);
 | |
|     
 | |
|     d.ischrome = ("chrome" in window);
 | |
| 		d.ischrome22 = (d.ischrome&&d.haspointerlock);
 | |
|     
 | |
|     d.cantouch = ("ontouchstart" in document.documentElement)||("ontouchstart" in window);  // detection for Chrome Touch Emulation
 | |
|     d.hasmstouch = (window.navigator.msPointerEnabled||false);  // IE10+ pointer events
 | |
| 		
 | |
|     d.ismac = /^mac$/i.test(navigator.platform);
 | |
|     
 | |
|     d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(navigator.platform));
 | |
|     d.isios4 = ((d.isios)&&!("seal" in Object));
 | |
|     
 | |
|     d.isandroid = (/android/i.test(navigator.userAgent));
 | |
|     
 | |
|     d.trstyle = false;
 | |
|     d.hastransform = false;
 | |
|     d.hastranslate3d = false;
 | |
|     d.transitionstyle = false;
 | |
|     d.hastransition = false;
 | |
|     d.transitionend = false;
 | |
|     
 | |
|     var check = ['transform','msTransform','webkitTransform','MozTransform','OTransform'];
 | |
|     for(var a=0;a<check.length;a++){
 | |
|       if (typeof domtest.style[check[a]] != "undefined") {
 | |
|         d.trstyle = check[a];
 | |
|         break;
 | |
|       }
 | |
|     }
 | |
|     d.hastransform = (d.trstyle != false);
 | |
|     if (d.hastransform) {
 | |
|       domtest.style[d.trstyle] = "translate3d(1px,2px,3px)";
 | |
|       d.hastranslate3d = /translate3d/.test(domtest.style[d.trstyle]);
 | |
|     }
 | |
|     
 | |
|     d.transitionstyle = false;
 | |
|     d.prefixstyle = '';
 | |
|     d.transitionend = false;
 | |
|     var check = ['transition','webkitTransition','MozTransition','OTransition','OTransition','msTransition','KhtmlTransition'];
 | |
|     var prefix = ['','-webkit-','-moz-','-o-','-o','-ms-','-khtml-'];
 | |
|     var evs = ['transitionend','webkitTransitionEnd','transitionend','otransitionend','oTransitionEnd','msTransitionEnd','KhtmlTransitionEnd'];
 | |
|     for(var a=0;a<check.length;a++) {
 | |
|       if (check[a] in domtest.style) {
 | |
|         d.transitionstyle = check[a];
 | |
|         d.prefixstyle = prefix[a];
 | |
|         d.transitionend = evs[a];
 | |
|         break;
 | |
|       }
 | |
|     }
 | |
|     d.hastransition = (d.transitionstyle);
 | |
|     
 | |
|     function detectCursorGrab() {      
 | |
|       var lst = ['-moz-grab','-webkit-grab','grab'];
 | |
|       if ((d.ischrome&&!d.ischrome22)||d.isie) lst=[];  // force setting for IE returns false positive and chrome cursor bug
 | |
|       for(var a=0;a<lst.length;a++) {
 | |
|         var p = lst[a];
 | |
|         domtest.style['cursor']=p;
 | |
|         if (domtest.style['cursor']==p) return p;
 | |
|       }
 | |
|       return 'url(http://www.google.com/intl/en_ALL/mapfiles/openhand.cur),n-resize';  // thank you google for custom cursor!
 | |
|     }
 | |
|     d.cursorgrabvalue = detectCursorGrab();
 | |
| 
 | |
|     d.hasmousecapture = ("setCapture" in domtest);
 | |
|     
 | |
|     domtest = null;  //memory released
 | |
| 
 | |
|     browserdetected = d;
 | |
|     
 | |
|     return d;  
 | |
|   }
 | |
|   
 | |
|   var NiceScrollClass = function(myopt,me) {
 | |
| 
 | |
|     var self = this;
 | |
| 
 | |
|     this.version = '3.1.4';
 | |
|     this.name = 'nicescroll';
 | |
|     
 | |
|     this.me = me;
 | |
|     
 | |
|     this.opt = {
 | |
|       doc:$("body"),
 | |
|       win:false,
 | |
|       zindex:9000,
 | |
|       cursoropacitymin:0,
 | |
|       cursoropacitymax:1,
 | |
|       cursorcolor:"#424242",
 | |
|       cursorwidth:"5px",
 | |
|       cursorborder:"1px solid #fff",
 | |
|       cursorborderradius:"5px",
 | |
|       scrollspeed:60,
 | |
|       mousescrollstep:8*3,
 | |
|       touchbehavior:false,
 | |
|       hwacceleration:true,
 | |
|       usetransition:true,
 | |
|       boxzoom:false,
 | |
|       dblclickzoom:true,
 | |
|       gesturezoom:true,
 | |
|       grabcursorenabled:true,
 | |
|       autohidemode:true,
 | |
|       background:"",
 | |
|       iframeautoresize:true,
 | |
|       cursorminheight:32,
 | |
|       preservenativescrolling:true,
 | |
|       railoffset:false,
 | |
|       bouncescroll:true,
 | |
|       spacebarenabled:true,
 | |
|       railpadding:{top:0,right:0,left:0,bottom:0},
 | |
|       disableoutline:true,
 | |
|       horizrailenabled:true,
 | |
|       railalign:"right",
 | |
|       railvalign:"bottom",
 | |
|       enabletranslate3d:true,
 | |
|       enablemousewheel:true,
 | |
|       enablekeyboard:true,
 | |
|       smoothscroll:true,
 | |
|       sensitiverail:true,
 | |
|       enablemouselockapi:true,
 | |
| //      cursormaxheight:false,
 | |
|       cursorfixedheight:false
 | |
|     };
 | |
|     
 | |
| // Options for internal use
 | |
|     this.opt.snapbackspeed = 80;
 | |
|     
 | |
|     if (myopt||false) {
 | |
|       for(var a in self.opt) {
 | |
|         if (typeof myopt[a] != "undefined") self.opt[a] = myopt[a];
 | |
|       }
 | |
|     }
 | |
|     
 | |
|     this.doc = self.opt.doc;
 | |
|     this.iddoc = (this.doc&&this.doc[0])?this.doc[0].id||'':'';    
 | |
|     this.ispage = /BODY|HTML/.test((self.opt.win)?self.opt.win[0].nodeName:this.doc[0].nodeName);
 | |
|     this.haswrapper = (self.opt.win!==false);
 | |
|     this.win = self.opt.win||(this.ispage?$(window):this.doc);
 | |
|     this.docscroll = (this.ispage&&!this.haswrapper)?$(window):this.win;
 | |
|     this.body = $("body");
 | |
|     this.viewport = false;
 | |
|     
 | |
|     this.isfixed = false;
 | |
|     
 | |
|     this.iframe = false;
 | |
|     this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME'));
 | |
|     
 | |
|     this.istextarea = (this.win[0].nodeName == 'TEXTAREA');
 | |
|     
 | |
|     this.forcescreen = false; //force to use screen position on events
 | |
| 
 | |
|     this.canshowonmouseevent = (self.opt.autohidemode!="scroll");
 | |
|     
 | |
| // Events jump table    
 | |
|     this.onmousedown = false;
 | |
|     this.onmouseup = false;
 | |
|     this.onmousemove = false;
 | |
|     this.onmousewheel = false;
 | |
|     this.onkeypress = false;
 | |
|     this.ongesturezoom = false;
 | |
|     this.onclick = false;
 | |
|     
 | |
| // Nicescroll custom events
 | |
|     this.onscrollstart = false;
 | |
|     this.onscrollend = false;
 | |
|     this.onscrollcancel = false;    
 | |
|     
 | |
|     this.onzoomin = false;
 | |
|     this.onzoomout = false;
 | |
|     
 | |
| // Let's start!  
 | |
|     this.view = false;
 | |
|     this.page = false;
 | |
|     
 | |
|     this.scroll = {x:0,y:0};
 | |
|     this.scrollratio = {x:0,y:0};    
 | |
|     this.cursorheight = 20;
 | |
|     this.scrollvaluemax = 0;
 | |
|     
 | |
|     this.scrollrunning = false;
 | |
|     
 | |
|     this.scrollmom = false;
 | |
|     
 | |
|     this.observer = false;
 | |
|     
 | |
|     do {
 | |
|       this.id = "ascrail"+(ascrailcounter++);
 | |
|     } while (document.getElementById(this.id));
 | |
|     
 | |
|     this.rail = false;
 | |
|     this.cursor = false;
 | |
|     this.cursorfreezed = false;  
 | |
|     
 | |
|     this.zoom = false;
 | |
|     this.zoomactive = false;
 | |
|     
 | |
|     this.hasfocus = false;
 | |
|     this.hasmousefocus = false;
 | |
|     
 | |
|     this.visibility = true;
 | |
|     this.locked = false;
 | |
|     this.hidden = false; // rails always hidden
 | |
|     this.cursoractive = true; // user can interact with cursors
 | |
|     
 | |
|     this.nativescrollingarea = false;
 | |
|     
 | |
|     this.events = [];  // event list for unbind
 | |
|     
 | |
|     this.saved = {};
 | |
|     
 | |
|     this.delaylist = {};
 | |
|     this.synclist = {};
 | |
|     
 | |
|     this.lastdeltax = 0;
 | |
|     this.lastdeltay = 0;
 | |
|     
 | |
|     this.detected = getBrowserDetection(); 
 | |
|     
 | |
|     var cap = $.extend({},this.detected);
 | |
|  
 | |
|     this.canhwscroll = (cap.hastransform&&self.opt.hwacceleration);
 | |
|     this.ishwscroll = (this.canhwscroll&&self.haswrapper);
 | |
|     
 | |
|     this.istouchcapable = false;  // desktop devices with touch screen support
 | |
|     
 | |
| //## Check Chrome desktop with touch support
 | |
|     if (cap.cantouch&&cap.ischrome&&!cap.isios&&!cap.isandroid) {
 | |
|       this.istouchcapable = true;
 | |
|       cap.cantouch = false;  // parse normal desktop events
 | |
|     }    
 | |
| 
 | |
| //## Firefox 18 nightly build (desktop) false positive (or desktop with touch support)
 | |
|     if (cap.cantouch&&cap.ismozilla&&!cap.isios) {
 | |
|       this.istouchcapable = true;
 | |
|       cap.cantouch = false;  // parse normal desktop events
 | |
|     }    
 | |
|     
 | |
| //## disable MouseLock API on user request
 | |
| 
 | |
|     if (!self.opt.enablemouselockapi) {
 | |
|       cap.hasmousecapture = false;
 | |
|       cap.haspointerlock = false;
 | |
|     }
 | |
|     
 | |
|     this.delayed = function(name,fn,tm,lazy) {
 | |
|       var dd = self.delaylist[name];
 | |
|       var nw = (new Date()).getTime();
 | |
|       if (!lazy&&dd&&dd.tt) return false;
 | |
|       if (dd&&dd.tt) clearTimeout(dd.tt);
 | |
|       if (dd&&dd.last+tm>nw&&!dd.tt) {      
 | |
|         self.delaylist[name] = {
 | |
|           last:nw+tm,
 | |
|           tt:setTimeout(function(){self.delaylist[name].tt=0;fn.call();},tm)
 | |
|         }
 | |
|       }
 | |
|       else if (!dd||!dd.tt) {
 | |
|         self.delaylist[name] = {
 | |
|           last:nw,
 | |
|           tt:0
 | |
|         }
 | |
|         setTimeout(function(){fn.call();},0);
 | |
|       }
 | |
|     };
 | |
|     
 | |
|     this.synched = function(name,fn) {
 | |
|     
 | |
|       function requestSync() {
 | |
|         if (self.onsync) return;
 | |
|         setAnimationFrame(function(){
 | |
|           self.onsync = false;
 | |
|           for(name in self.synclist){
 | |
|             var fn = self.synclist[name];
 | |
|             if (fn) fn.call(self);
 | |
|             self.synclist[name] = false;
 | |
|           }
 | |
|         });
 | |
|         self.onsync = true;
 | |
|       };    
 | |
|     
 | |
|       self.synclist[name] = fn;
 | |
|       requestSync();
 | |
|       return name;
 | |
|     };
 | |
|     
 | |
|     this.unsynched = function(name) {
 | |
|       if (self.synclist[name]) self.synclist[name] = false;
 | |
|     }
 | |
|     
 | |
|     this.css = function(el,pars) {  // save & set
 | |
|       for(var n in pars) {
 | |
|         self.saved.css.push([el,n,el.css(n)]);
 | |
|         el.css(n,pars[n]);
 | |
|       }
 | |
|     };
 | |
|     
 | |
|     this.scrollTop = function(val) {
 | |
|       return (typeof val == "undefined") ? self.getScrollTop() : self.setScrollTop(val);
 | |
|     };
 | |
| 
 | |
|     this.scrollLeft = function(val) {
 | |
|       return (typeof val == "undefined") ? self.getScrollLeft() : self.setScrollLeft(val);
 | |
|     };
 | |
|     
 | |
| // derived by by Dan Pupius www.pupius.net
 | |
|     BezierClass = function(st,ed,spd,p1,p2,p3,p4) {
 | |
|       this.st = st;
 | |
|       this.ed = ed;
 | |
|       this.spd = spd;
 | |
|       
 | |
|       this.p1 = p1||0;
 | |
|       this.p2 = p2||1;
 | |
|       this.p3 = p3||0;
 | |
|       this.p4 = p4||1;
 | |
|       
 | |
|       this.ts = (new Date()).getTime();
 | |
|       this.df = this.ed-this.st;
 | |
|     };
 | |
|     BezierClass.prototype = {
 | |
|       B2:function(t){ return 3*t*t*(1-t) },
 | |
|       B3:function(t){ return 3*t*(1-t)*(1-t) },
 | |
|       B4:function(t){ return (1-t)*(1-t)*(1-t) },
 | |
|       getNow:function(){
 | |
|         var nw = (new Date()).getTime();
 | |
|         var pc = 1-((nw-this.ts)/this.spd);
 | |
|         var bz = this.B2(pc) + this.B3(pc) + this.B4(pc);
 | |
|         return (pc<0) ? this.ed : this.st+Math.round(this.df*bz);
 | |
|       },
 | |
|       update:function(ed,spd){
 | |
|         this.st = this.getNow();
 | |
|         this.ed = ed;
 | |
|         this.spd = spd;
 | |
|         this.ts = (new Date()).getTime();
 | |
|         this.df = this.ed-this.st;
 | |
|         return this;
 | |
|       }
 | |
|     };
 | |
|     
 | |
|     if (this.ishwscroll) {  
 | |
|     // hw accelerated scroll
 | |
|       this.doc.translate = {x:0,y:0,tx:"0px",ty:"0px"};
 | |
|       
 | |
|       //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/
 | |
|       if (cap.hastranslate3d&&cap.isios) this.doc.css("-webkit-backface-visibility","hidden");  // prevent flickering http://stackoverflow.com/questions/3461441/      
 | |
|       
 | |
|       //derived from http://stackoverflow.com/questions/11236090/
 | |
|       function getMatrixValues() {
 | |
|         var tr = self.doc.css(cap.trstyle);
 | |
|         if (tr&&(tr.substr(0,6)=="matrix")) {
 | |
|           return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g,'').split(/, +/);
 | |
|         }
 | |
|         return false;
 | |
|       }
 | |
|       
 | |
|       this.getScrollTop = function(last) {
 | |
|         if (!last) {
 | |
|           var mtx = getMatrixValues();
 | |
|           if (mtx) return (mtx.length==16) ? -mtx[13] : -mtx[5];  //matrix3d 16 on IE10
 | |
|           if (self.timerscroll&&self.timerscroll.bz) return self.timerscroll.bz.getNow();
 | |
|         }
 | |
|         return self.doc.translate.y;
 | |
|       };
 | |
| 
 | |
|       this.getScrollLeft = function(last) {
 | |
|         if (!last) {
 | |
|           var mtx = getMatrixValues();          
 | |
|           if (mtx) return (mtx.length==16) ? -mtx[12] : -mtx[4];  //matrix3d 16 on IE10
 | |
|           if (self.timerscroll&&self.timerscroll.bh) return self.timerscroll.bh.getNow();
 | |
|         }
 | |
|         return self.doc.translate.x;
 | |
|       };
 | |
|       
 | |
|       if (document.createEvent) {
 | |
|         this.notifyScrollEvent = function(el) {
 | |
|           var e = document.createEvent("UIEvents");
 | |
|           e.initUIEvent("scroll", false, true, window, 1);
 | |
|           el.dispatchEvent(e);
 | |
|         };
 | |
|       }
 | |
|       else if (document.fireEvent) {
 | |
|         this.notifyScrollEvent = function(el) {
 | |
|           var e = document.createEventObject();
 | |
|           el.fireEvent("onscroll");
 | |
|           e.cancelBubble = true; 
 | |
|         };
 | |
|       }
 | |
|       else {
 | |
|         this.notifyScrollEvent = function(el,add) {}; //NOPE
 | |
|       }
 | |
|       
 | |
|       if (cap.hastranslate3d&&self.opt.enabletranslate3d) {
 | |
|         this.setScrollTop = function(val,silent) {
 | |
|           self.doc.translate.y = val;
 | |
|           self.doc.translate.ty = (val*-1)+"px";
 | |
|           self.doc.css(cap.trstyle,"translate3d("+self.doc.translate.tx+","+self.doc.translate.ty+",0px)");          
 | |
|           if (!silent) self.notifyScrollEvent(self.win[0]);
 | |
|         };
 | |
|         this.setScrollLeft = function(val,silent) {          
 | |
|           self.doc.translate.x = val;
 | |
|           self.doc.translate.tx = (val*-1)+"px";
 | |
|           self.doc.css(cap.trstyle,"translate3d("+self.doc.translate.tx+","+self.doc.translate.ty+",0px)");          
 | |
|           if (!silent) self.notifyScrollEvent(self.win[0]);
 | |
|         };
 | |
|       } else {
 | |
|         this.setScrollTop = function(val,silent) {
 | |
|           self.doc.translate.y = val;
 | |
|           self.doc.translate.ty = (val*-1)+"px";
 | |
|           self.doc.css(cap.trstyle,"translate("+self.doc.translate.tx+","+self.doc.translate.ty+")");
 | |
|           if (!silent) self.notifyScrollEvent(self.win[0]);          
 | |
|         };
 | |
|         this.setScrollLeft = function(val,silent) {        
 | |
|           self.doc.translate.x = val;
 | |
|           self.doc.translate.tx = (val*-1)+"px";
 | |
|           self.doc.css(cap.trstyle,"translate("+self.doc.translate.tx+","+self.doc.translate.ty+")");
 | |
|           if (!silent) self.notifyScrollEvent(self.win[0]);
 | |
|         };
 | |
|       }
 | |
|     } else {
 | |
|     // native scroll
 | |
|       this.getScrollTop = function() {
 | |
|         return self.docscroll.scrollTop();
 | |
|       };
 | |
|       this.setScrollTop = function(val) {        
 | |
|         return self.docscroll.scrollTop(val);
 | |
|       };
 | |
|       this.getScrollLeft = function() {
 | |
|         return self.docscroll.scrollLeft();
 | |
|       };
 | |
|       this.setScrollLeft = function(val) {
 | |
|         return self.docscroll.scrollLeft(val);
 | |
|       };
 | |
|     }
 | |
|     
 | |
|     this.getTarget = function(e) {
 | |
|       if (!e) return false;
 | |
|       if (e.target) return e.target;
 | |
|       if (e.srcElement) return e.srcElement;
 | |
|       return false;
 | |
|     };
 | |
|     
 | |
|     this.hasParent = function(e,id) {
 | |
|       if (!e) return false;
 | |
|       var el = e.target||e.srcElement||e||false;
 | |
|       while (el && el.id != id) {
 | |
|         el = el.parentNode||false;
 | |
|       }
 | |
|       return (el!==false);
 | |
|     };
 | |
|     
 | |
| //inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie
 | |
|     var _convertBorderWidth = {"thin":1,"medium":3,"thick":5};
 | |
|     function getWidthToPixel(dom,prop,chkheight) {
 | |
|       var wd = dom.css(prop);
 | |
|       var px = parseFloat(wd);
 | |
|       if (isNaN(px)) {
 | |
|         px = _convertBorderWidth[wd]||0;
 | |
|         var brd = (px==3) ? ((chkheight)?(self.win.outerHeight() - self.win.innerHeight()):(self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS
 | |
|         if (self.isie8&&px) px+=1;
 | |
|         return (brd) ? px : 0; 
 | |
|       }
 | |
|       return px;
 | |
|     };
 | |
|     
 | |
|     this.getOffset = function() {
 | |
|       if (self.isfixed) return {top:parseFloat(self.win.css('top')),left:parseFloat(self.win.css('left'))};
 | |
|       if (!self.viewport) return self.win.offset();
 | |
|       var ww = self.win.offset();
 | |
|       var vp = self.viewport.offset();
 | |
|       return {top:ww.top-vp.top+self.viewport.scrollTop(),left:ww.left-vp.left+self.viewport.scrollLeft()};
 | |
|     };
 | |
|     
 | |
|     this.updateScrollBar = function(len) {
 | |
|       if (self.ishwscroll) {
 | |
|         self.rail.css({height:self.win.innerHeight()});
 | |
|         if (self.railh) self.railh.css({width:self.win.innerWidth()});
 | |
|       } else {
 | |
|         var wpos = self.getOffset();
 | |
|         var pos = {top:wpos.top,left:wpos.left};
 | |
|         pos.top+= getWidthToPixel(self.win,'border-top-width',true);
 | |
|         var brd = (self.win.outerWidth() - self.win.innerWidth())/2;
 | |
|         pos.left+= (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win,'border-right-width') - self.rail.width : getWidthToPixel(self.win,'border-left-width');
 | |
|         
 | |
|         var off = self.opt.railoffset;
 | |
|         if (off) {
 | |
|           if (off.top) pos.top+=off.top;
 | |
|           if (self.rail.align&&off.left) pos.left+=off.left;
 | |
|         }
 | |
|         
 | |
| 				if (!self.locked) self.rail.css({top:pos.top,left:pos.left,height:(len)?len.h:self.win.innerHeight()});
 | |
| 				
 | |
| 				if (self.zoom) {				  
 | |
| 				  self.zoom.css({top:pos.top+1,left:(self.rail.align==1) ? pos.left-20 : pos.left+self.rail.width+4});
 | |
| 			  }
 | |
| 				
 | |
| 				if (self.railh&&!self.locked) {
 | |
| 					var pos = {top:wpos.top,left:wpos.left};
 | |
| 					var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win,'border-top-width',true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win,'border-top-width',true);
 | |
| 					var x = pos.left + getWidthToPixel(self.win,'border-left-width');
 | |
| 					self.railh.css({top:y,left:x,width:self.railh.width});
 | |
| 				}
 | |
| 		
 | |
| 				
 | |
|       }
 | |
|     };
 | |
|     
 | |
|     this.doRailClick = function(e,dbl,hr) {
 | |
| 
 | |
|       var fn,pg,cur,pos;
 | |
|       
 | |
|       if (self.rail.drag&&self.rail.drag.pt!=1) return;
 | |
|       if (self.locked) return;
 | |
|       if (self.rail.drag) return;
 | |
| 
 | |
|       self.cancelScroll();       
 | |
|       
 | |
|       self.cancelEvent(e);
 | |
|       
 | |
|       if (dbl) {
 | |
|         fn = (hr) ? self.doScrollLeft : self.doScrollTop;
 | |
|         cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth/2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight/2)) * self.scrollratio.y);
 | |
|         fn(cur);
 | |
|       } else {
 | |
|         fn = (hr) ? self.doScrollLeftBy : self.doScrollBy;
 | |
|         cur = (hr) ? self.scroll.x : self.scroll.y;
 | |
|         pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top;
 | |
|         pg = (hr) ? self.view.w : self.view.h;        
 | |
|         (cur>=pos) ? fn(pg) : fn(-pg);
 | |
|       }
 | |
|     
 | |
|     }
 | |
|     
 | |
|     self.hasanimationframe = (setAnimationFrame);
 | |
|     self.hascancelanimationframe = (clearAnimationFrame);
 | |
|     
 | |
|     if (!self.hasanimationframe) {
 | |
|       setAnimationFrame=function(fn){return setTimeout(fn,16)}; // 1000/60)};
 | |
|       clearAnimationFrame=clearInterval;
 | |
|     } 
 | |
|     else if (!self.hascancelanimationframe) clearAnimationFrame=function(){self.cancelAnimationFrame=true};
 | |
|     
 | |
|     this.init = function() {
 | |
| 
 | |
|       self.saved.css = [];
 | |
|       
 | |
|       if (cap.isie7mobile) return true; // SORRY, DO NOT WORK!
 | |
|       
 | |
|       if (cap.hasmstouch) self.css((self.ispage)?$("html"):self.win,{'-ms-touch-action':'none'});
 | |
|       
 | |
| /*      
 | |
|       self.ispage = true;
 | |
|       self.haswrapper = true;
 | |
| //      self.win = $(window);
 | |
|       self.docscroll = $("body");
 | |
| //      self.doc = $("body");
 | |
| */
 | |
|       
 | |
|       if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) {
 | |
|       
 | |
|         var cont = self.docscroll;
 | |
|         if (self.ispage) cont = (self.haswrapper)?self.win:self.doc;
 | |
|         
 | |
|         if (!cap.isie9mobile) self.css(cont,{'overflow-y':'hidden'});      
 | |
|         
 | |
|         if (self.ispage&&cap.isie7) {
 | |
|           if (self.doc[0].nodeName=='BODY') self.css($("html"),{'overflow-y':'hidden'});  //IE7 double scrollbar issue
 | |
|           else if (self.doc[0].nodeName=='HTML') self.css($("body"),{'overflow-y':'hidden'});  //IE7 double scrollbar issue
 | |
|         }
 | |
|         
 | |
|         if (cap.isios&&!self.ispage&&!self.haswrapper) self.css($("body"),{"-webkit-overflow-scrolling":"touch"});  //force hw acceleration
 | |
|         
 | |
|         var cursor = $(document.createElement('div'));
 | |
|         cursor.css({
 | |
|           position:"relative",top:0,"float":"right",width:self.opt.cursorwidth,height:"0px",
 | |
|           'background-color':self.opt.cursorcolor,
 | |
|           border:self.opt.cursorborder,
 | |
|           'background-clip':'padding-box',
 | |
|           '-webkit-border-radius':self.opt.cursorborderradius,
 | |
|           '-moz-border-radius':self.opt.cursorborderradius,
 | |
|           'border-radius':self.opt.cursorborderradius
 | |
|         });   
 | |
|         
 | |
|         cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight());        
 | |
|         self.cursor = cursor;        
 | |
|         
 | |
|         var rail = $(document.createElement('div'));
 | |
|         rail.attr('id',self.id);
 | |
|         
 | |
|         var v,a,kp = ["left","right"];  //"top","bottom"
 | |
|         for(var n in kp) {
 | |
|           a=kp[n];
 | |
|           v = self.opt.railpadding[a];
 | |
|           (v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0;
 | |
|         }
 | |
|         
 | |
|         rail.append(cursor);
 | |
|         
 | |
|         rail.width = Math.max(parseFloat(self.opt.cursorwidth),cursor.outerWidth()) + self.opt.railpadding['left'] + self.opt.railpadding['right'];
 | |
|         rail.css({width:rail.width+"px",'zIndex':(self.ispage)?self.opt.zindex:self.opt.zindex+2,"background":self.opt.background});        
 | |
|         
 | |
|         rail.visibility = true;
 | |
|         rail.scrollable = true;
 | |
|         
 | |
|         rail.align = (self.opt.railalign=="left") ? 0 : 1;
 | |
|         
 | |
|         self.rail = rail;
 | |
|         
 | |
|         self.rail.drag = false;
 | |
|         
 | |
|         var zoom = false;
 | |
|         if (self.opt.boxzoom&&!self.ispage&&!cap.isieold) {
 | |
|           zoom = document.createElement('div');          
 | |
|           self.bind(zoom,"click",self.doZoom);
 | |
|           self.zoom = $(zoom);
 | |
|           self.zoom.css({"cursor":"pointer",'z-index':self.opt.zindex,'backgroundImage':'url('+scriptpath+'zoomico.png)','height':18,'width':18,'backgroundPosition':'0px 0px'});
 | |
|           if (self.opt.dblclickzoom) self.bind(self.win,"dblclick",self.doZoom);
 | |
|           if (cap.cantouch&&self.opt.gesturezoom) {
 | |
|             self.ongesturezoom = function(e) {
 | |
|               if (e.scale>1.5) self.doZoomIn(e);
 | |
|               if (e.scale<0.8) self.doZoomOut(e);
 | |
|               return self.cancelEvent(e);
 | |
|             };
 | |
|             self.bind(self.win,"gestureend",self.ongesturezoom);             
 | |
|           }
 | |
|         }
 | |
|         
 | |
| // init HORIZ
 | |
| 
 | |
|         self.railh = false;
 | |
| 
 | |
|         if (self.opt.horizrailenabled) {
 | |
| 
 | |
|           self.css(cont,{'overflow-x':'hidden'});
 | |
| 
 | |
|           var cursor = $(document.createElement('div'));
 | |
|           cursor.css({
 | |
|             position:"relative",top:0,height:self.opt.cursorwidth,width:"0px",
 | |
|             'background-color':self.opt.cursorcolor,
 | |
|             border:self.opt.cursorborder,
 | |
|             'background-clip':'padding-box',
 | |
|             '-webkit-border-radius':self.opt.cursorborderradius,
 | |
|             '-moz-border-radius':self.opt.cursorborderradius,
 | |
|             'border-radius':self.opt.cursorborderradius
 | |
|           });   
 | |
|           
 | |
|           cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth());
 | |
|           self.cursorh = cursor;
 | |
|           
 | |
|           var railh = $(document.createElement('div'));
 | |
|           railh.attr('id',self.id+'-hr');
 | |
|           railh.height = 1+Math.max(parseFloat(self.opt.cursorwidth),cursor.outerHeight());
 | |
|           railh.css({height:railh.height+"px",'zIndex':(self.ispage)?self.opt.zindex:self.opt.zindex+2,"background":self.opt.background});
 | |
|           
 | |
|           railh.append(cursor);
 | |
|           
 | |
|           railh.visibility = true;
 | |
|           railh.scrollable = true;
 | |
|           
 | |
|           railh.align = (self.opt.railvalign=="top") ? 0 : 1;
 | |
|           
 | |
|           self.railh = railh;
 | |
|           
 | |
|           self.railh.drag = false;
 | |
|           
 | |
|         }
 | |
|         
 | |
| //        
 | |
|         
 | |
|         if (self.ispage) {
 | |
|           rail.css({position:"fixed",top:"0px",height:"100%"});
 | |
|           (rail.align) ? rail.css({right:"0px"}) : rail.css({left:"0px"});
 | |
|           self.body.append(rail);
 | |
|           if (self.railh) {
 | |
|             railh.css({position:"fixed",left:"0px",width:"100%"});
 | |
|             (railh.align) ? railh.css({bottom:"0px"}) : railh.css({top:"0px"});
 | |
|             self.body.append(railh);
 | |
|           }
 | |
|         } else {          
 | |
|           if (self.ishwscroll) {
 | |
|             if (self.win.css('position')=='static') self.css(self.win,{'position':'relative'});
 | |
|             var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win;
 | |
|             if (self.zoom) {
 | |
|               self.zoom.css({position:"absolute",top:1,right:0,"margin-right":rail.width+4});
 | |
|               bd.append(self.zoom);
 | |
|             }
 | |
|             rail.css({position:"absolute",top:0});
 | |
|             (rail.align) ? rail.css({right:0}) : rail.css({left:0});
 | |
|             bd.append(rail);
 | |
|             if (railh) {
 | |
|               railh.css({position:"absolute",left:0,bottom:0});
 | |
|               (railh.align) ? railh.css({bottom:0}) : railh.css({top:0});
 | |
|               bd.append(railh);
 | |
|             }
 | |
|           } else {
 | |
|             self.isfixed = (self.win.css("position")=="fixed");
 | |
|             var rlpos = (self.isfixed) ? "fixed" : "absolute";
 | |
|             
 | |
|             if (!self.isfixed) self.viewport = self.getViewport(self.win[0]);
 | |
|             if (self.viewport) self.body = self.viewport;
 | |
|             
 | |
|             rail.css({position:rlpos});
 | |
|             if (self.zoom) self.zoom.css({position:rlpos});
 | |
|             self.updateScrollBar();
 | |
|             self.body.append(rail);
 | |
|             if (self.zoom) self.body.append(self.zoom);
 | |
|             if (self.railh) {
 | |
|               railh.css({position:rlpos});
 | |
|               self.body.append(railh);           
 | |
|             }
 | |
|           }
 | |
|           
 | |
|           if (cap.isios) self.css(self.win,{'-webkit-tap-highlight-color':'rgba(0,0,0,0)','-webkit-touch-callout':'none'});  // prevent grey layer on click
 | |
|           
 | |
| 					if (cap.isie&&self.opt.disableoutline) self.win.attr("hideFocus","true");  // IE, prevent dotted rectangle on focused div
 | |
| 					if (cap.iswebkit&&self.opt.disableoutline) self.win.css({"outline":"none"});
 | |
|           
 | |
|         }
 | |
|         
 | |
|         if (self.opt.autohidemode===false) {
 | |
|           self.autohidedom = false;
 | |
|           self.rail.css({opacity:self.opt.cursoropacitymax});
 | |
|           if (self.railh) self.railh.css({opacity:self.opt.cursoropacitymax});
 | |
|         }
 | |
|         else if (self.opt.autohidemode===true) {
 | |
|           self.autohidedom = $().add(self.rail);
 | |
|           if (self.railh) self.autohidedom=self.autohidedom.add(self.railh);
 | |
|         }
 | |
|         else if (self.opt.autohidemode=="scroll") {
 | |
|           self.autohidedom = $().add(self.rail);
 | |
|           if (self.railh) self.autohidedom=self.autohidedom.add(self.railh);
 | |
|         }
 | |
|         else if (self.opt.autohidemode=="cursor") {
 | |
|           self.autohidedom = $().add(self.cursor);
 | |
|           if (self.railh) self.autohidedom=self.autohidedom.add(self.railh.cursor);
 | |
|         }
 | |
|         else if (self.opt.autohidemode=="hidden") {
 | |
|           self.autohidedom = false;
 | |
|           self.hide();
 | |
|           self.locked = false;
 | |
|         }
 | |
|         
 | |
|         if (cap.isie9mobile) {
 | |
| 
 | |
|           self.scrollmom = new ScrollMomentumClass2D(self);        
 | |
| 
 | |
|           /*
 | |
|           var trace = function(msg) {
 | |
|             var db = $("#debug");
 | |
|             if (isNaN(msg)&&(typeof msg != "string")) {
 | |
|               var x = [];
 | |
|               for(var a in msg) {
 | |
|                 x.push(a+":"+msg[a]);
 | |
|               }
 | |
|               msg ="{"+x.join(",")+"}";
 | |
|             }
 | |
|             if (db.children().length>0) {
 | |
|               db.children().eq(0).before("<div>"+msg+"</div>");
 | |
|             } else {
 | |
|               db.append("<div>"+msg+"</div>");
 | |
|             }
 | |
|           }
 | |
|           window.onerror = function(msg,url,ln) {
 | |
|             trace("ERR: "+msg+" at "+ln);
 | |
|           }
 | |
| */          
 | |
|   
 | |
|           self.onmangotouch = function(e) {
 | |
|             var py = self.getScrollTop();
 | |
|             var px = self.getScrollLeft();
 | |
|             
 | |
|             if ((py == self.scrollmom.lastscrolly)&&(px == self.scrollmom.lastscrollx)) return true;
 | |
| //            $("#debug").html('DRAG:'+py);
 | |
| 
 | |
|             var dfy = py-self.mangotouch.sy;
 | |
|             var dfx = px-self.mangotouch.sx;            
 | |
|             var df = Math.round(Math.sqrt(Math.pow(dfx,2)+Math.pow(dfy,2)));            
 | |
|             if (df==0) return;
 | |
|             
 | |
|             var dry = (dfy<0)?-1:1;
 | |
|             var drx = (dfx<0)?-1:1;
 | |
|             
 | |
|             var tm = +new Date();
 | |
|             if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy);
 | |
|             
 | |
|             if (((tm-self.mangotouch.tm)>80)||(self.mangotouch.dry!=dry)||(self.mangotouch.drx!=drx)) {
 | |
| //              trace('RESET+'+(tm-self.mangotouch.tm));
 | |
|               self.scrollmom.stop();
 | |
|               self.scrollmom.reset(px,py);
 | |
|               self.mangotouch.sy = py;
 | |
|               self.mangotouch.ly = py;
 | |
|               self.mangotouch.sx = px;
 | |
|               self.mangotouch.lx = px;
 | |
|               self.mangotouch.dry = dry;
 | |
|               self.mangotouch.drx = drx;
 | |
|               self.mangotouch.tm = tm;
 | |
|             } else {
 | |
|               
 | |
|               self.scrollmom.stop();
 | |
|               self.scrollmom.update(self.mangotouch.sx-dfx,self.mangotouch.sy-dfy);
 | |
|               var gap = tm - self.mangotouch.tm;              
 | |
|               self.mangotouch.tm = tm;
 | |
|               
 | |
| //              trace('MOVE:'+df+" - "+gap);
 | |
|               
 | |
|               var ds = Math.max(Math.abs(self.mangotouch.ly-py),Math.abs(self.mangotouch.lx-px));
 | |
|               self.mangotouch.ly = py;
 | |
|               self.mangotouch.lx = px;
 | |
|               
 | |
|               if (ds>2) {
 | |
|                 self.mangotouch.lazy = setTimeout(function(){
 | |
| //                  trace('END:'+ds+'+'+gap);                  
 | |
|                   self.mangotouch.lazy = false;
 | |
|                   self.mangotouch.dry = 0;
 | |
|                   self.mangotouch.drx = 0;
 | |
|                   self.mangotouch.tm = 0;                  
 | |
|                   self.scrollmom.doMomentum(30);
 | |
|                 },100);
 | |
|               }
 | |
|             }
 | |
|           }
 | |
|           
 | |
|           var top = self.getScrollTop();
 | |
|           var lef = self.getScrollLeft();
 | |
|           self.mangotouch = {sy:top,ly:top,dry:0,sx:lef,lx:lef,drx:0,lazy:false,tm:0};
 | |
|           
 | |
|           self.bind(self.docscroll,"scroll",self.onmangotouch);
 | |
|         
 | |
|         } else {
 | |
|         
 | |
|           if (cap.cantouch||self.istouchcapable||self.opt.touchbehavior||cap.hasmstouch) {
 | |
|           
 | |
|             self.scrollmom = new ScrollMomentumClass2D(self);
 | |
|           
 | |
|             self.ontouchstart = function(e) {
 | |
|               if (e.pointerType&&e.pointerType!=2) return false;
 | |
|               
 | |
|               if (!self.locked) {
 | |
|               
 | |
|                 if (cap.hasmstouch) {
 | |
|                   var tg = (e.target) ? e.target : false;
 | |
|                   while (tg) {
 | |
|                     var nc = $(tg).getNiceScroll();
 | |
|                     if ((nc.length>0)&&(nc[0].me == self.me)) break;
 | |
|                     if (nc.length>0) return false;
 | |
|                     if ((tg.nodeName=='DIV')&&(tg.id==self.id)) break;
 | |
|                     tg = (tg.parentNode) ? tg.parentNode : false;
 | |
|                   }
 | |
|                 }
 | |
|               
 | |
|                 self.cancelScroll();
 | |
|                 
 | |
|                 var tg = self.getTarget(e);
 | |
|                 
 | |
|                 if (tg) {
 | |
|                   var skp = (/INPUT/i.test(tg.nodeName))&&(/range/i.test(tg.type));
 | |
|                   if (skp) return self.stopPropagation(e);
 | |
|                 }
 | |
|                 
 | |
|                 if (!("clientX" in e) && ("changedTouches" in e)) {
 | |
|                   e.clientX = e.changedTouches[0].clientX;
 | |
|                   e.clientY = e.changedTouches[0].clientY;
 | |
|                 }
 | |
|                 
 | |
|                 if (self.forcescreen) {
 | |
|                   var le = e;
 | |
|                   var e = {"original":(e.original)?e.original:e};
 | |
|                   e.clientX = le.screenX;
 | |
|                   e.clientY = le.screenY;    
 | |
|                 }
 | |
|                 
 | |
|                 self.rail.drag = {x:e.clientX,y:e.clientY,sx:self.scroll.x,sy:self.scroll.y,st:self.getScrollTop(),sl:self.getScrollLeft(),pt:2};
 | |
|                 
 | |
|                 if (self.opt.touchbehavior&&self.isiframe&&cap.isie) {
 | |
|                   var wp = self.win.position();
 | |
|                   self.rail.drag.x+=wp.left;
 | |
|                   self.rail.drag.y+=wp.top;
 | |
|                 }
 | |
|                 
 | |
|                 self.hasmoving = false;
 | |
|                 self.lastmouseup = false;
 | |
|                 self.scrollmom.reset(e.clientX,e.clientY);
 | |
|                 if (!cap.cantouch&&!this.istouchcapable&&!cap.hasmstouch) {
 | |
|                   
 | |
|                   var ip = (tg)?/INPUT|SELECT|TEXTAREA/i.test(tg.nodeName):false;
 | |
|                   if (!ip) {
 | |
|                     if (!self.ispage&&cap.hasmousecapture) tg.setCapture();
 | |
|                     return self.cancelEvent(e);
 | |
|                   }
 | |
|                   if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {
 | |
|                     pc = {"tg":tg,"click":false};
 | |
|                     self.preventclick = pc;
 | |
|                   }
 | |
|                   
 | |
|                 }
 | |
|               }
 | |
|               
 | |
|             };
 | |
|             
 | |
|             self.ontouchend = function(e) {
 | |
|               if (e.pointerType&&e.pointerType!=2) return false;
 | |
|               if (self.rail.drag&&(self.rail.drag.pt==2)) {
 | |
|                 self.scrollmom.doMomentum();
 | |
|                 self.rail.drag = false;
 | |
|                 if (self.hasmoving) {
 | |
|                   self.hasmoving = false;
 | |
|                   self.lastmouseup = true;
 | |
|                   self.hideCursor();
 | |
|                   if (cap.hasmousecapture) document.releaseCapture();
 | |
|                   if (!cap.cantouch) return self.cancelEvent(e);
 | |
|                 }                            
 | |
|               }                        
 | |
|               
 | |
|             };
 | |
|             
 | |
|             var moveneedoffset = (self.opt.touchbehavior&&self.isiframe&&!cap.hasmousecapture);
 | |
|             
 | |
|             self.ontouchmove = function(e,byiframe) {
 | |
|               
 | |
|               if (e.pointerType&&e.pointerType!=2) return false;
 | |
|     
 | |
|               if (self.rail.drag&&(self.rail.drag.pt==2)) {
 | |
|                 if (cap.cantouch&&(typeof e.original == "undefined")) return true;  // prevent ios "ghost" events by clickable elements
 | |
|               
 | |
|                 self.hasmoving = true;
 | |
| 
 | |
|                 if (self.preventclick&&!self.preventclick.click) {
 | |
|                   self.preventclick.click = self.preventclick.tg.onclick||false;                
 | |
|                   self.preventclick.tg.onclick = self.onpreventclick;
 | |
|                 }
 | |
| 
 | |
|                 var ev = $.extend({"original":e},e);
 | |
|                 e = ev;
 | |
|                 
 | |
|                 if (("changedTouches" in e)) {
 | |
|                   e.clientX = e.changedTouches[0].clientX;
 | |
|                   e.clientY = e.changedTouches[0].clientY;
 | |
|                 }                
 | |
|                 
 | |
|                 if (self.forcescreen) {
 | |
|                   var le = e;
 | |
|                   var e = {"original":(e.original)?e.original:e};
 | |
|                   e.clientX = le.screenX;
 | |
|                   e.clientY = le.screenY;      
 | |
|                 }
 | |
|                 
 | |
|                 var ofx = ofy = 0;
 | |
|                 
 | |
|                 if (moveneedoffset&&!byiframe) {
 | |
|                   var wp = self.win.position();
 | |
|                   ofx=-wp.left;
 | |
|                   ofy=-wp.top;
 | |
|                 }                
 | |
|                 
 | |
|                 var fy = e.clientY + ofy;
 | |
|                 var my = (fy-self.rail.drag.y);
 | |
|                 
 | |
|                 var ny = self.rail.drag.st-my;
 | |
|                 
 | |
|                 if (self.ishwscroll&&self.opt.bouncescroll) {
 | |
|                   if (ny<0) {
 | |
|                     ny = Math.round(ny/2);
 | |
| //                    fy = 0;
 | |
|                   }
 | |
|                   else if (ny>self.page.maxh) {
 | |
|                     ny = self.page.maxh+Math.round((ny-self.page.maxh)/2);
 | |
| //                    fy = 0;
 | |
|                   }
 | |
|                 } else {
 | |
|                   if (ny<0) {ny=0;fy=0}
 | |
|                   if (ny>self.page.maxh) {ny=self.page.maxh;fy=0}
 | |
|                 }
 | |
|                   
 | |
|                 var fx = e.clientX + ofx;
 | |
|                   
 | |
|                 if (self.railh&&self.railh.scrollable) {
 | |
| 
 | |
|                   var mx = (fx-self.rail.drag.x);
 | |
|                   
 | |
|                   var nx = self.rail.drag.sl-mx;
 | |
|                   
 | |
|                   if (self.ishwscroll&&self.opt.bouncescroll) {                  
 | |
|                     if (nx<0) {
 | |
|                       nx = Math.round(nx/2);
 | |
| //                      fx = 0;
 | |
|                     }
 | |
|                     else if (nx>self.page.maxw) {
 | |
|                       nx = self.page.maxw+Math.round((nx-self.page.maxw)/2);
 | |
| //                      fx = 0;
 | |
|                     }
 | |
|                   } else {
 | |
|                     if (nx<0) {nx=0;fx=0}
 | |
|                     if (nx>self.page.maxw) {nx=self.page.maxw;fx=0}
 | |
|                   }
 | |
|                 
 | |
|                 }
 | |
|                               
 | |
|                 self.synched("touchmove",function(){
 | |
|                   if (self.rail.drag&&(self.rail.drag.pt==2)) {
 | |
|                     if (self.prepareTransition) self.prepareTransition(0);
 | |
|                     if (self.rail.scrollable) self.setScrollTop(ny);
 | |
|                     self.scrollmom.update(fx,fy);
 | |
|                     if (self.railh&&self.railh.scrollable) {
 | |
|                       self.setScrollLeft(nx);
 | |
|                       self.showCursor(ny,nx);
 | |
|                     } else {
 | |
|                       self.showCursor(ny);
 | |
|                     }
 | |
|                     if (cap.isie10) document.selection.clear();
 | |
|                   }
 | |
|                 });
 | |
|                 
 | |
|                 if (!cap.ischrome&&!self.istouchcapable) return self.cancelEvent(e);  //chrome touch emulation doesn't like!
 | |
|               }
 | |
|               
 | |
|             };
 | |
|           
 | |
|           }
 | |
|          
 | |
|           if (cap.cantouch||self.opt.touchbehavior) {
 | |
|           
 | |
|             self.onpreventclick = function(e) {
 | |
|               if (self.preventclick) {
 | |
|                 self.preventclick.tg.onclick = self.preventclick.click;
 | |
|                 self.preventclick = false;            
 | |
|                 return self.cancelEvent(e);
 | |
|               }
 | |
|             }
 | |
|           
 | |
|             self.onmousedown = self.ontouchstart;
 | |
|             
 | |
|             self.onmouseup = self.ontouchend;
 | |
| 
 | |
|             self.onclick = (cap.isios) ? false : function(e) { 
 | |
|               if (self.lastmouseup) {
 | |
|                 self.lastmouseup = false;
 | |
|                 return self.cancelEvent(e);
 | |
|               } else {
 | |
|                 return true;
 | |
|               }
 | |
|             }; 
 | |
|             
 | |
|             self.onmousemove = self.ontouchmove;
 | |
|             
 | |
|             if (cap.cursorgrabvalue) {
 | |
|               self.css((self.ispage)?self.doc:self.win,{'cursor':cap.cursorgrabvalue});            
 | |
|               self.css(self.rail,{'cursor':cap.cursorgrabvalue});
 | |
|             }
 | |
|             
 | |
|           } else {
 | |
|           
 | |
|             self.onmousedown = function(e,hronly) {       
 | |
|               if (self.rail.drag&&self.rail.drag.pt!=1) return;
 | |
|               if (self.locked) return self.cancelEvent(e);            
 | |
|               self.cancelScroll();              
 | |
|               self.rail.drag = {x:e.clientX,y:e.clientY,sx:self.scroll.x,sy:self.scroll.y,pt:1,hr:(!!hronly)};
 | |
|               var tg = self.getTarget(e);
 | |
|               if (!self.ispage&&cap.hasmousecapture) tg.setCapture();
 | |
|               if (self.isiframe&&!cap.hasmousecapture) {
 | |
|                 self.saved["csspointerevents"] = self.doc.css("pointer-events");
 | |
|                 self.css(self.doc,{"pointer-events":"none"});
 | |
|               }
 | |
|               return self.cancelEvent(e);
 | |
|             };
 | |
|             self.onmouseup = function(e) {
 | |
|               if (self.rail.drag) {
 | |
|                 if (cap.hasmousecapture) document.releaseCapture();
 | |
|                 if (self.isiframe&&!cap.hasmousecapture) self.doc.css("pointer-events",self.saved["csspointerevents"]);
 | |
|                 if(self.rail.drag.pt!=1)return;
 | |
|                 self.rail.drag = false;
 | |
|                 //if (!self.rail.active) self.hideCursor();
 | |
|                 return self.cancelEvent(e);
 | |
|               }
 | |
|             };        
 | |
|             self.onmousemove = function(e) {
 | |
| 
 | |
|               if (self.rail.drag) {
 | |
|                 if(self.rail.drag.pt!=1)return;
 | |
|                 
 | |
|                 if (cap.ischrome&&e.which==0) return self.onmouseup(e);
 | |
|                 
 | |
|                 self.cursorfreezed = true;
 | |
|                     
 | |
|                 if (self.rail.drag.hr) {
 | |
|                   self.scroll.x = self.rail.drag.sx + (e.clientX-self.rail.drag.x);
 | |
|                   if (self.scroll.x<0) self.scroll.x=0;
 | |
|                   var mw = self.scrollvaluemaxw;
 | |
|                   if (self.scroll.x>mw) self.scroll.x=mw;
 | |
|                 } else {                
 | |
|                   self.scroll.y = self.rail.drag.sy + (e.clientY-self.rail.drag.y);
 | |
|                   if (self.scroll.y<0) self.scroll.y=0;
 | |
|                   var my = self.scrollvaluemax;
 | |
|                   if (self.scroll.y>my) self.scroll.y=my;
 | |
|                 }
 | |
|                 
 | |
|                 self.synched('mousemove',function(){
 | |
|                   if (self.rail.drag&&(self.rail.drag.pt==1)) {
 | |
|                     self.showCursor();
 | |
|                     if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x*self.scrollratio.x));
 | |
|                     else self.doScrollTop(Math.round(self.scroll.y*self.scrollratio.y));
 | |
|                   }
 | |
|                 });
 | |
|                 return self.cancelEvent(e);
 | |
|               } else {
 | |
|                 self.checkarea = true;
 | |
|               }
 | |
|               
 | |
|             };
 | |
|           }
 | |
| 
 | |
|           if (cap.cantouch||self.opt.touchbehavior) {
 | |
|             self.bind(self.win,"mousedown",self.onmousedown);
 | |
|           }
 | |
|           
 | |
|           if (cap.hasmstouch) {
 | |
|             self.css(self.rail,{'-ms-touch-action':'none'});
 | |
|             self.css(self.cursor,{'-ms-touch-action':'none'});
 | |
|             
 | |
|             self.bind(self.win,"MSPointerDown",self.ontouchstart);
 | |
|             self.bind(document,"MSPointerUp",self.ontouchend);
 | |
|             self.bind(document,"MSPointerMove",self.ontouchmove);
 | |
|             self.bind(self.cursor,"MSGestureHold",function(e){e.preventDefault();});
 | |
|             self.bind(self.cursor,"contextmenu",function(e){e.preventDefault();});
 | |
|           }
 | |
| 
 | |
|           if (this.istouchcapable) {  //device with screen touch enabled
 | |
|             self.bind(self.win,"touchstart",self.ontouchstart);
 | |
|             self.bind(document,"touchend",self.ontouchend);
 | |
|             self.bind(document,"touchcancel",self.ontouchend);
 | |
|             self.bind(document,"touchmove",self.ontouchmove);            
 | |
|           }
 | |
|           
 | |
|           self.bind(self.cursor,"mousedown",self.onmousedown);
 | |
|           self.bind(self.cursor,"mouseup",self.onmouseup);      
 | |
| 
 | |
|           if (self.railh) {
 | |
|             self.bind(self.cursorh,"mousedown",function(e){self.onmousedown(e,true)});
 | |
|             self.bind(self.cursorh,"mouseup",function(e){
 | |
|               if (self.rail.drag&&self.rail.drag.pt==2) return;
 | |
|               self.rail.drag = false;
 | |
|               self.hasmoving = false;
 | |
|               self.hideCursor();
 | |
|               if (cap.hasmousecapture) document.releaseCapture();
 | |
|               return self.cancelEvent(e);
 | |
|             });
 | |
|           }
 | |
|           
 | |
|           self.bind(document,"mouseup",self.onmouseup);
 | |
|           if (cap.hasmousecapture) self.bind(self.win,"mouseup",self.onmouseup);
 | |
|           
 | |
|           self.bind(document,"mousemove",self.onmousemove);
 | |
|           if (self.onclick) self.bind(document,"click",self.onclick);
 | |
| 		
 | |
|           if (!cap.cantouch&&!self.opt.touchbehavior) {
 | |
| 					
 | |
|             self.jqbind(self.rail,"mouseenter",function() {
 | |
|               if (self.canshowonmouseevent) self.showCursor();
 | |
|               self.rail.active = true;
 | |
|             });
 | |
|             self.jqbind(self.rail,"mouseleave",function() { 
 | |
|               self.rail.active = false;
 | |
|               if (!self.rail.drag) self.hideCursor();
 | |
|             });
 | |
|             
 | |
|             if (self.opt.sensitiverail) {
 | |
|               self.bind(self.rail,"click",function(e){self.doRailClick(e,false,false)});
 | |
|               self.bind(self.rail,"dblclick",function(e){self.doRailClick(e,true,false)});
 | |
|               self.bind(self.cursor,"click",function(e){self.cancelEvent(e)});
 | |
|               self.bind(self.cursor,"dblclick",function(e){self.cancelEvent(e)});
 | |
|             }
 | |
|             
 | |
|             if (self.railh) {
 | |
|               self.jqbind(self.railh,"mouseenter",function() {
 | |
|                 if (self.canshowonmouseevent) self.showCursor();
 | |
|                 self.rail.active = true;
 | |
|               });          
 | |
|               self.jqbind(self.railh,"mouseleave",function() { 
 | |
|                 self.rail.active = false;
 | |
|                 if (!self.rail.drag) self.hideCursor();
 | |
|               });
 | |
|               
 | |
|               if (self.opt.sensitiverail) {
 | |
|                 self.bind(self.railh, "click", function(e){self.doRailClick(e,false,true)});
 | |
|                 self.bind(self.railh, "dblclick", function(e){self.doRailClick(e, true, true) });
 | |
|                 self.bind(self.cursorh, "click", function (e) { self.cancelEvent(e) });
 | |
|                 self.bind(self.cursorh, "dblclick", function (e) { self.cancelEvent(e) });
 | |
|               }
 | |
|               
 | |
|             }
 | |
| 
 | |
| 						if (self.zoom) {
 | |
| 							self.jqbind(self.zoom,"mouseenter",function() {
 | |
| 								if (self.canshowonmouseevent) self.showCursor();
 | |
| 								self.rail.active = true;
 | |
| 							});          
 | |
| 							self.jqbind(self.zoom,"mouseleave",function() { 
 | |
| 								self.rail.active = false;
 | |
| 								if (!self.rail.drag) self.hideCursor();
 | |
| 							});
 | |
| 						}
 | |
| 
 | |
|           }
 | |
| 						
 | |
| 					if (self.opt.enablemousewheel) {
 | |
| 						if (!self.isiframe) self.bind((cap.isie&&self.ispage) ? document : self.docscroll,"mousewheel",self.onmousewheel);
 | |
| 						self.bind(self.rail,"mousewheel",self.onmousewheel);
 | |
| 						if (self.railh) self.bind(self.railh,"mousewheel",self.onmousewheelhr);
 | |
| 					}						
 | |
| 						
 | |
|           if (!self.ispage&&!cap.cantouch&&!(/HTML|BODY/.test(self.win[0].nodeName))) {
 | |
|             if (!self.win.attr("tabindex")) self.win.attr({"tabindex":tabindexcounter++});
 | |
|             
 | |
|             self.jqbind(self.win,"focus",function(e) {
 | |
|               domfocus = (self.getTarget(e)).id||true;
 | |
|               self.hasfocus = true;
 | |
|               if (self.canshowonmouseevent) self.noticeCursor();
 | |
|             });
 | |
|             self.jqbind(self.win,"blur",function(e) {
 | |
|               domfocus = false;
 | |
|               self.hasfocus = false;
 | |
|             });
 | |
|             
 | |
|             self.jqbind(self.win,"mouseenter",function(e) {
 | |
|               mousefocus = (self.getTarget(e)).id||true;
 | |
|               self.hasmousefocus = true;
 | |
|               if (self.canshowonmouseevent) self.noticeCursor();
 | |
|             });
 | |
|             self.jqbind(self.win,"mouseleave",function() {
 | |
|               mousefocus = false;
 | |
|               self.hasmousefocus = false;
 | |
|             });
 | |
|             
 | |
|           };
 | |
|           
 | |
|         }  // !ie9mobile
 | |
|         
 | |
|         //Thanks to http://www.quirksmode.org !!
 | |
|         self.onkeypress = function(e) {
 | |
|           if (self.locked&&self.page.maxh==0) return true;
 | |
|           
 | |
|           e = (e) ? e : window.e;
 | |
|           var tg = self.getTarget(e);
 | |
|           if (tg&&/INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) {
 | |
|             var tp = tg.getAttribute('type')||tg.type||false;            
 | |
|             if ((!tp)||!(/submit|button|cancel/i.tp)) return true;
 | |
|           }
 | |
|           
 | |
|           if (self.hasfocus||(self.hasmousefocus&&!domfocus)||(self.ispage&&!domfocus&&!mousefocus)) {
 | |
|             var key = e.keyCode;
 | |
|             
 | |
|             if (self.locked&&key!=27) return self.cancelEvent(e);
 | |
| 
 | |
|             var ctrl = e.ctrlKey||false;
 | |
|             var shift = e.shiftKey || false;
 | |
|             
 | |
|             var ret = false;
 | |
|             switch (key) {
 | |
|               case 38:
 | |
|               case 63233: //safari
 | |
|                 self.doScrollBy(24*3);
 | |
|                 ret = true;
 | |
|                 break;
 | |
|               case 40:
 | |
|               case 63235: //safari
 | |
|                 self.doScrollBy(-24*3);
 | |
|                 ret = true;
 | |
|                 break;
 | |
|               case 37:
 | |
|               case 63232: //safari
 | |
|                 if (self.railh) {
 | |
|                   (ctrl) ? self.doScrollLeft(0) : self.doScrollLeftBy(24*3);
 | |
|                   ret = true;
 | |
|                 }
 | |
|                 break;
 | |
|               case 39:
 | |
|               case 63234: //safari
 | |
|                 if (self.railh) {
 | |
|                   (ctrl) ? self.doScrollLeft(self.page.maxw) : self.doScrollLeftBy(-24*3);
 | |
|                   ret = true;
 | |
|                 }
 | |
|                 break;
 | |
|               case 33:
 | |
|               case 63276: // safari
 | |
|                 self.doScrollBy(self.view.h);
 | |
|                 ret = true;
 | |
|                 break;
 | |
|               case 34:
 | |
|               case 63277: // safari
 | |
|                 self.doScrollBy(-self.view.h);
 | |
|                 ret = true;
 | |
|                 break;
 | |
|               case 36:
 | |
|               case 63273: // safari                
 | |
|                 (self.railh&&ctrl) ? self.doScrollPos(0,0) : self.doScrollTo(0);
 | |
|                 ret = true;
 | |
|                 break;
 | |
|               case 35:
 | |
|               case 63275: // safari
 | |
|                 (self.railh&&ctrl) ? self.doScrollPos(self.page.maxw,self.page.maxh) : self.doScrollTo(self.page.maxh);
 | |
|                 ret = true;
 | |
|                 break;
 | |
|               case 32:
 | |
|                 if (self.opt.spacebarenabled) {
 | |
|                   (shift) ? self.doScrollBy(self.view.h) : self.doScrollBy(-self.view.h);
 | |
|                   ret = true;
 | |
|                 }
 | |
|                 break;
 | |
|               case 27: // ESC
 | |
|                 if (self.zoomactive) {
 | |
|                   self.doZoom();
 | |
|                   ret = true;
 | |
|                 }
 | |
|                 break;
 | |
|             }
 | |
|             if (ret) return self.cancelEvent(e);
 | |
|           }
 | |
|         };
 | |
|         
 | |
|         if (self.opt.enablekeyboard) self.bind(document,(cap.isopera&&!cap.isopera12)?"keypress":"keydown",self.onkeypress);
 | |
|         
 | |
|         self.bind(window,'resize',self.resize);
 | |
|         self.bind(window,'orientationchange',self.resize);
 | |
|         
 | |
|         self.bind(window,"load",self.resize);
 | |
| 		
 | |
|         if (cap.ischrome&&!self.ispage&&!self.haswrapper) { //chrome void scrollbar bug
 | |
|           var tmp=self.win.attr("style");
 | |
| 					var ww = parseFloat(self.win.css("width"))+1;
 | |
|           self.win.css('width',ww);
 | |
|           self.synched("chromefix",function(){self.win.attr("style",tmp)});
 | |
|         }
 | |
|         
 | |
| // Trying a cross-browser implementation - good luck!
 | |
| 
 | |
|         self.onAttributeChange = function(e) {
 | |
|           self.lazyResize();
 | |
|         }
 | |
|         
 | |
|         if (!self.ispage&&!self.haswrapper) {
 | |
|           // thanks to Filip http://stackoverflow.com/questions/1882224/        
 | |
|           if ("WebKitMutationObserver" in window) {
 | |
|             self.observer = new WebKitMutationObserver(function(mutations) {
 | |
|               mutations.forEach(self.onAttributeChange);
 | |
|             });
 | |
|             self.observer.observe(self.win[0],{attributes:true,subtree:false});
 | |
|           } else {        
 | |
|             self.bind(self.win,(cap.isie&&!cap.isie9)?"propertychange":"DOMAttrModified",self.onAttributeChange);
 | |
|             if (cap.isie9) self.win[0].attachEvent("onpropertychange",self.onAttributeChange); //IE9 DOMAttrModified bug
 | |
|           }
 | |
|         }
 | |
|         
 | |
| //
 | |
| 
 | |
|         if (!self.ispage&&self.opt.boxzoom) self.bind(window,"resize",self.resizeZoom);
 | |
|         if (self.istextarea) self.bind(self.win,"mouseup",self.resize);
 | |
|         
 | |
|         self.resize();
 | |
|         
 | |
|       }
 | |
|       
 | |
|       if (this.doc[0].nodeName == 'IFRAME') {
 | |
|         function oniframeload(e) {
 | |
|           self.iframexd = false;
 | |
|           try {
 | |
|             var doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document;
 | |
|             var a = doc.domain;            
 | |
|           } catch(e){self.iframexd = true;doc=false};
 | |
|           
 | |
|           if (self.iframexd) {
 | |
|             if ("console" in window) console.log('NiceScroll error: policy restriced iframe');
 | |
|             return true;  //cross-domain - I can't manage this        
 | |
|           }
 | |
|           
 | |
|           self.forcescreen = true;
 | |
|           
 | |
|           if (self.isiframe) {            
 | |
|             self.iframe = {
 | |
|               "doc":$(doc),
 | |
|               "html":self.doc.contents().find('html')[0],
 | |
|               "body":self.doc.contents().find('body')[0]
 | |
|             };
 | |
|             self.getContentSize = function(){
 | |
|               return {
 | |
|                 w:Math.max(self.iframe.html.scrollWidth,self.iframe.body.scrollWidth),
 | |
|                 h:Math.max(self.iframe.html.scrollHeight,self.iframe.body.scrollHeight)
 | |
|               }
 | |
|             }            
 | |
|             self.docscroll = $(self.iframe.body);//$(this.contentWindow);
 | |
|           }
 | |
|           
 | |
|           if (!cap.isios&&self.opt.iframeautoresize&&!self.isiframe) {
 | |
|             self.win.scrollTop(0); // reset position
 | |
|             self.doc.height("");  //reset height to fix browser bug
 | |
|             var hh=Math.max(doc.getElementsByTagName('html')[0].scrollHeight,doc.body.scrollHeight);
 | |
|             self.doc.height(hh);          
 | |
|           }
 | |
|           self.resize();
 | |
|           
 | |
|           if (cap.isie7) self.css($(self.iframe.html),{'overflow-y':'hidden'});
 | |
|           //self.css($(doc.body),{'overflow-y':'hidden'});
 | |
|           self.css($(self.iframe.body),{'overflow-y':'hidden'});
 | |
|           
 | |
|           if ('contentWindow' in this) {
 | |
|             self.bind(this.contentWindow,"scroll",self.onscroll);  //IE8 & minor
 | |
|           } else {          
 | |
|             self.bind(doc,"scroll",self.onscroll);
 | |
|           }                    
 | |
|           
 | |
|           if (self.opt.enablemousewheel) {
 | |
|             self.bind(doc,"mousewheel",self.onmousewheel);
 | |
|           }
 | |
|           
 | |
|           if (self.opt.enablekeyboard) self.bind(doc,(cap.isopera)?"keypress":"keydown",self.onkeypress);
 | |
|           
 | |
|           if (cap.cantouch||self.opt.touchbehavior) {
 | |
|             self.bind(doc,"mousedown",self.onmousedown);
 | |
|             self.bind(doc,"mousemove",function(e){self.onmousemove(e,true)});
 | |
|             if (cap.cursorgrabvalue) self.css($(doc.body),{'cursor':cap.cursorgrabvalue});
 | |
|           }
 | |
|           
 | |
|           self.bind(doc,"mouseup",self.onmouseup);
 | |
|           
 | |
|           if (self.zoom) {
 | |
|             if (self.opt.dblclickzoom) self.bind(doc,'dblclick',self.doZoom);
 | |
|             if (self.ongesturezoom) self.bind(doc,"gestureend",self.ongesturezoom);             
 | |
|           }
 | |
|         };
 | |
|         
 | |
|         if (this.doc[0].readyState&&this.doc[0].readyState=="complete"){
 | |
|           setTimeout(function(){oniframeload.call(self.doc[0],false)},500);
 | |
|         }
 | |
|         self.bind(this.doc,"load",oniframeload);
 | |
|         
 | |
|       }
 | |
|       
 | |
|     };
 | |
|     
 | |
|     this.showCursor = function(py,px) {
 | |
|       if (self.cursortimeout) {
 | |
|         clearTimeout(self.cursortimeout);
 | |
|         self.cursortimeout = 0;
 | |
|       }
 | |
|       if (!self.rail) return;
 | |
|       if (self.autohidedom) {
 | |
|         self.autohidedom.stop().css({opacity:self.opt.cursoropacitymax});
 | |
|         self.cursoractive = true;
 | |
|       }
 | |
|       
 | |
|       if ((typeof py != "undefined")&&(py!==false)) {
 | |
|         self.scroll.y = Math.round(py * 1/self.scrollratio.y);
 | |
|       }
 | |
|       if (typeof px != "undefined") {
 | |
|         self.scroll.x = Math.round(px * 1/self.scrollratio.x);
 | |
|       }
 | |
| 
 | |
|       self.cursor.css({height:self.cursorheight,top:self.scroll.y}); 
 | |
|       if (self.cursorh) {
 | |
|         (!self.rail.align&&self.rail.visibility) ? self.cursorh.css({width:self.cursorwidth,left:self.scroll.x+self.rail.width}) : self.cursorh.css({width:self.cursorwidth,left:self.scroll.x});
 | |
|         self.cursoractive = true;
 | |
|       }
 | |
|       
 | |
|       if (self.zoom) self.zoom.stop().css({opacity:self.opt.cursoropacitymax});      
 | |
|     };
 | |
|     
 | |
|     this.hideCursor = function(tm) {
 | |
|       if (self.cursortimeout) return;
 | |
|       if (!self.rail) return;
 | |
|       if (!self.autohidedom) return;
 | |
|       self.cursortimeout = setTimeout(function() {
 | |
|          if (!self.rail.active||!self.showonmouseevent) {
 | |
|            self.autohidedom.stop().animate({opacity:self.opt.cursoropacitymin});
 | |
|            if (self.zoom) self.zoom.stop().animate({opacity:self.opt.cursoropacitymin});
 | |
|            self.cursoractive = false;
 | |
|          }
 | |
|          self.cursortimeout = 0;
 | |
|       },tm||400);
 | |
|     };
 | |
|     
 | |
|     this.noticeCursor = function(tm,py,px) {
 | |
|       self.showCursor(py,px);
 | |
|       if (!self.rail.active) self.hideCursor(tm);
 | |
|     };
 | |
|         
 | |
|     this.getContentSize = 
 | |
|       (self.ispage) ?
 | |
|         function(){
 | |
|           return {
 | |
|             w:Math.max(document.body.scrollWidth,document.documentElement.scrollWidth),
 | |
|             h:Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)
 | |
|           }
 | |
|         }
 | |
|       : (self.haswrapper) ?
 | |
|         function(){
 | |
|           return {
 | |
|             w:self.doc.outerWidth()+parseInt(self.win.css('paddingLeft'))+parseInt(self.win.css('paddingRight')),
 | |
|             h:self.doc.outerHeight()+parseInt(self.win.css('paddingTop'))+parseInt(self.win.css('paddingBottom'))
 | |
|           }
 | |
|         }
 | |
|       : function() {        
 | |
|         return {
 | |
|           w:self.docscroll[0].scrollWidth,
 | |
|           h:self.docscroll[0].scrollHeight
 | |
|         }
 | |
|       };
 | |
|   
 | |
|     this.onResize = function(e,page) {
 | |
|     
 | |
| 	  if (!self.win) return false;
 | |
| 	
 | |
|       if (!self.haswrapper&&!self.ispage) {        
 | |
|         if (self.win.css('display')=='none') {
 | |
|           if (self.visibility) self.hideRail().hideRailHr();
 | |
|           return false;
 | |
|         } else {          
 | |
|           if (!self.hidden&&!self.visibility) self.showRail().showRailHr();
 | |
|         }        
 | |
|       }
 | |
|     
 | |
|       var premaxh = self.page.maxh;
 | |
|       var premaxw = self.page.maxw;
 | |
| 
 | |
|       var preview = {h:self.view.h,w:self.view.w};   
 | |
|       
 | |
|       self.view = {
 | |
|         w:(self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth),
 | |
|         h:(self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight)
 | |
|       };
 | |
|       
 | |
|       self.page = (page) ? page : self.getContentSize();
 | |
|       
 | |
|       self.page.maxh = Math.max(0,self.page.h - self.view.h);
 | |
|       self.page.maxw = Math.max(0,self.page.w - self.view.w);
 | |
|       
 | |
|       if ((self.page.maxh==premaxh)&&(self.page.maxw==premaxw)&&(self.view.w==preview.w)) {
 | |
|         // test position        
 | |
|         if (!self.ispage) {
 | |
|           var pos = self.win.offset();
 | |
|           if (self.lastposition) {
 | |
|             var lst = self.lastposition;
 | |
|             if ((lst.top==pos.top)&&(lst.left==pos.left)) return self; //nothing to do            
 | |
|           }
 | |
|           self.lastposition = pos;
 | |
|         } else {
 | |
|           return self; //nothing to do
 | |
|         }
 | |
|       }
 | |
|       
 | |
|       if (self.page.maxh==0) {
 | |
|         self.hideRail();        
 | |
|         self.scrollvaluemax = 0;
 | |
|         self.scroll.y = 0;
 | |
|         self.scrollratio.y = 0;
 | |
|         self.cursorheight = 0;
 | |
|         self.setScrollTop(0);
 | |
|         self.rail.scrollable = false;
 | |
|       } else {       
 | |
|         self.rail.scrollable = true;
 | |
|       }
 | |
|       
 | |
|       if (self.page.maxw==0) {
 | |
|         self.hideRailHr();
 | |
|         self.scrollvaluemaxw = 0;
 | |
|         self.scroll.x = 0;
 | |
|         self.scrollratio.x = 0;
 | |
|         self.cursorwidth = 0;
 | |
|         self.setScrollLeft(0);
 | |
|         self.railh.scrollable = false;
 | |
|       } else {        
 | |
|         self.railh.scrollable = true;
 | |
|       }
 | |
|   
 | |
|       self.locked = (self.page.maxh==0)&&(self.page.maxw==0);
 | |
|       if (self.locked) {
 | |
| 				if (!self.ispage) self.updateScrollBar(self.view);
 | |
| 			  return false;
 | |
| 		  }
 | |
| 
 | |
|       if (!self.hidden&&!self.visibility) {
 | |
|         self.showRail().showRailHr();
 | |
|       }      
 | |
|       else if (!self.hidden&&!self.railh.visibility) self.showRailHr();
 | |
|       
 | |
|       if (self.istextarea&&self.win.css('resize')&&self.win.css('resize')!='none') self.view.h-=20;      
 | |
|       if (!self.ispage) self.updateScrollBar(self.view);
 | |
| 
 | |
|       self.cursorheight = Math.min(self.view.h,Math.round(self.view.h * (self.view.h / self.page.h)));
 | |
|       self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight,self.cursorheight);
 | |
| 
 | |
|       self.cursorwidth = Math.min(self.view.w,Math.round(self.view.w * (self.view.w / self.page.w)));
 | |
|       self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight,self.cursorwidth);
 | |
|       
 | |
|       self.scrollvaluemax = self.view.h-self.cursorheight-self.cursor.hborder;
 | |
|       
 | |
|       if (self.railh) {
 | |
|         self.railh.width = (self.page.maxh>0) ? (self.view.w-self.rail.width) : self.view.w;
 | |
|         self.scrollvaluemaxw = self.railh.width-self.cursorwidth-self.cursorh.wborder;
 | |
|       }
 | |
|       
 | |
|       self.scrollratio = {
 | |
|         x:(self.page.maxw/self.scrollvaluemaxw),
 | |
|         y:(self.page.maxh/self.scrollvaluemax)
 | |
|       };
 | |
|      
 | |
|       var sy = self.getScrollTop();
 | |
|       if (sy>self.page.maxh) {
 | |
|         self.doScrollTop(self.page.maxh);
 | |
|       } else {     
 | |
|         self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y));
 | |
|         self.scroll.x = Math.round(self.getScrollLeft() * (1/self.scrollratio.x));
 | |
|         if (self.cursoractive) self.noticeCursor();     
 | |
|       }      
 | |
|       
 | |
|       if (self.scroll.y&&(self.getScrollTop()==0)) self.doScrollTo(Math.floor(self.scroll.y*self.scrollratio.y));
 | |
|       
 | |
|       return self;
 | |
|     };
 | |
|     
 | |
|     this.resize = function(){self.delayed('resize',self.onResize,30);return self;} // event debounce
 | |
|     
 | |
|     this.lazyResize = function() {
 | |
|       self.delayed('resize',self.resize,250);
 | |
|     }
 | |
|    
 | |
|     this._bind = function(el,name,fn,bubble) {  // primitive bind
 | |
|       self.events.push({e:el,n:name,f:fn,b:bubble,q:false});
 | |
|       if (el.addEventListener) {
 | |
|         el.addEventListener(name,fn,bubble||false);
 | |
|       }
 | |
|       else if (el.attachEvent) {
 | |
|         el.attachEvent("on"+name,fn);
 | |
|       }
 | |
|       else {
 | |
|         el["on"+name] = fn;        
 | |
|       }        
 | |
|     };
 | |
|    
 | |
|     this.jqbind = function(dom,name,fn) {  // use jquery bind for non-native events (mouseenter/mouseleave)
 | |
|       self.events.push({e:dom,n:name,f:fn,q:true});
 | |
|       $(dom).bind(name,fn);
 | |
|     }
 | |
|    
 | |
|     this.bind = function(dom,name,fn,bubble) {  // touch-oriented & fixing jquery bind
 | |
|       var el = ("jquery" in dom) ? dom[0] : dom;
 | |
|       if (el.addEventListener) {
 | |
|         if (cap.cantouch && /mouseup|mousedown|mousemove/.test(name)) {  // touch device support
 | |
|           var tt=(name=='mousedown')?'touchstart':(name=='mouseup')?'touchend':'touchmove';
 | |
|           self._bind(el,tt,function(e){
 | |
|             if (e.touches) {
 | |
|               if (e.touches.length<2) {var ev=(e.touches.length)?e.touches[0]:e;ev.original=e;fn.call(this,ev);}
 | |
|             } 
 | |
|             else if (e.changedTouches) {var ev=e.changedTouches[0];ev.original=e;fn.call(this,ev);}  //blackberry
 | |
|           },bubble||false);
 | |
|         }
 | |
|         self._bind(el,name,fn,bubble||false);
 | |
|         if (name=='mousewheel') self._bind(el,"DOMMouseScroll",fn,bubble||false);
 | |
|         if (cap.cantouch && name=="mouseup") self._bind(el,"touchcancel",fn,bubble||false);
 | |
|       }
 | |
|       else {
 | |
|         self._bind(el,name,function(e) {
 | |
|           e = e||window.event||false;
 | |
|           if (e) {
 | |
|             if (e.srcElement) e.target=e.srcElement;
 | |
|           }
 | |
|           return ((fn.call(el,e)===false)||bubble===false) ? self.cancelEvent(e) : true;
 | |
|         });
 | |
|       } 
 | |
|     };
 | |
|     
 | |
|     this._unbind = function(el,name,fn,bub) {  // primitive unbind
 | |
|       if (el.removeEventListener) {
 | |
|         el.removeEventListener(name,fn,bub);
 | |
|       }
 | |
|       else if (el.detachEvent) {
 | |
|         el.detachEvent('on'+name,fn);
 | |
|       } else {
 | |
|         el['on'+name] = false;
 | |
|       }
 | |
|     };
 | |
|     
 | |
|     this.unbindAll = function() {
 | |
|       for(var a=0;a<self.events.length;a++) {
 | |
|         var r = self.events[a];        
 | |
|         (r.q) ? r.e.unbind(r.n,r.f) : self._unbind(r.e,r.n,r.f,r.b);
 | |
|       }
 | |
|     };
 | |
|     
 | |
|     // Thanks to http://www.switchonthecode.com !!
 | |
|     this.cancelEvent = function(e) {
 | |
|       var e = (e.original) ? e.original : (e) ? e : window.event||false;
 | |
|       if (!e) return false;      
 | |
|       if(e.preventDefault) e.preventDefault();
 | |
|       if(e.stopPropagation) e.stopPropagation();
 | |
|       if(e.preventManipulation) e.preventManipulation();  //IE10
 | |
|       e.cancelBubble = true;
 | |
|       e.cancel = true;
 | |
|       e.returnValue = false;
 | |
|       return false;
 | |
|     };
 | |
| 
 | |
|     this.stopPropagation = function(e) {
 | |
|       var e = (e.original) ? e.original : (e) ? e : window.event||false;
 | |
|       if (!e) return false;
 | |
|       if (e.stopPropagation) return e.stopPropagation();
 | |
|       if (e.cancelBubble) e.cancelBubble=true;
 | |
|       return false;
 | |
|     }
 | |
|     
 | |
|     this.showRail = function() {
 | |
|       if ((self.page.maxh!=0)&&(self.ispage||self.win.css('display')!='none')) {
 | |
|         self.visibility = true;
 | |
|         self.rail.visibility = true;
 | |
|         self.rail.css('display','block');
 | |
|       }
 | |
|       return self;
 | |
|     };
 | |
| 
 | |
|     this.showRailHr = function() {
 | |
|       if (!self.railh) return self;
 | |
|       if ((self.page.maxw!=0)&&(self.ispage||self.win.css('display')!='none')) {
 | |
|         self.railh.visibility = true;
 | |
|         self.railh.css('display','block');
 | |
|       }
 | |
|       return self;
 | |
|     };
 | |
|     
 | |
|     this.hideRail = function() {
 | |
|       self.visibility = false;
 | |
|       self.rail.visibility = false;
 | |
|       self.rail.css('display','none');
 | |
|       return self;
 | |
|     };
 | |
| 
 | |
|     this.hideRailHr = function() {
 | |
|       if (!self.railh) return self;
 | |
|       self.railh.visibility = false;
 | |
|       self.railh.css('display','none');
 | |
|       return self;
 | |
|     };
 | |
|     
 | |
|     this.show = function() {
 | |
|       self.hidden = false;
 | |
|       self.locked = false;
 | |
|       return self.showRail().showRailHr();
 | |
|     };
 | |
| 
 | |
|     this.hide = function() {
 | |
|       self.hidden = true;
 | |
|       self.locked = true;
 | |
|       return self.hideRail().hideRailHr();
 | |
|     };
 | |
|     
 | |
|     this.toggle = function() {
 | |
|       return (self.hidden) ? self.show() : self.hide();
 | |
|     };
 | |
|     
 | |
|     this.remove = function() {
 | |
|       self.stop();
 | |
|       if (self.cursortimeout) clearTimeout(self.cursortimeout);
 | |
|       self.doZoomOut();
 | |
|       self.unbindAll();      
 | |
|       if (self.observer !== false) self.observer.disconnect();      
 | |
|       self.events = [];
 | |
|       if (self.cursor) {
 | |
|         self.cursor.remove();
 | |
|         self.cursor = null;
 | |
|       }
 | |
|       if (self.cursorh) {
 | |
|         self.cursorh.remove();
 | |
|         self.cursorh = null;
 | |
|       }
 | |
|       if (self.rail) {
 | |
|         self.rail.remove();
 | |
|         self.rail = null;
 | |
|       }
 | |
|       if (self.railh) {
 | |
|         self.railh.remove();
 | |
|         self.railh = null;
 | |
|       }
 | |
|       if (self.zoom) {
 | |
|         self.zoom.remove();
 | |
|         self.zoom = null;
 | |
|       }
 | |
|       for(var a=0;a<self.saved.css.length;a++) {
 | |
|         var d=self.saved.css[a];
 | |
|         d[0].css(d[1],(typeof d[2]=="undefined") ? '' : d[2]);
 | |
|       }
 | |
|       self.saved = false;      
 | |
|       self.me.data('__nicescroll',''); //erase all traces
 | |
| 	  self.me = null;
 | |
| 	  self.doc = null;
 | |
| 	  self.docscroll = null;
 | |
| 	  self.win = null;
 | |
|       return self;
 | |
|     };
 | |
|     
 | |
|     this.scrollstart = function(fn) {
 | |
|       this.onscrollstart = fn;
 | |
|       return self;
 | |
|     }
 | |
|     this.scrollend = function(fn) {
 | |
|       this.onscrollend = fn;
 | |
|       return self;
 | |
|     }
 | |
|     this.scrollcancel = function(fn) {
 | |
|       this.onscrollcancel = fn;
 | |
|       return self;
 | |
|     }
 | |
|     
 | |
|     this.zoomin = function(fn) {
 | |
|       this.onzoomin = fn;
 | |
|       return self;
 | |
|     }
 | |
|     this.zoomout = function(fn) {
 | |
|       this.onzoomout = fn;
 | |
|       return self;
 | |
|     }
 | |
|     
 | |
|     this.isScrollable = function(e) {      
 | |
|       var dom = (e.target) ? e.target : e;
 | |
|       while (dom&&(dom.nodeType==1)&&!(/BODY|HTML/.test(dom.nodeName))) {
 | |
|         var dd = $(dom);
 | |
|         var ov = dd.css('overflowY')||dd.css('overflowX')||dd.css('overflow')||'';
 | |
|         if (/scroll|auto/.test(ov)) return (dom.clientHeight!=dom.scrollHeight);
 | |
|         dom = (dom.parentNode) ? dom.parentNode : false;        
 | |
|       }
 | |
|       return false;
 | |
|     };
 | |
| 
 | |
|     this.getViewport = function(me) {      
 | |
|       var dom = (me&&me.parentNode) ? me.parentNode : false;
 | |
|       while (dom&&(dom.nodeType==1)&&!(/BODY|HTML/.test(dom.nodeName))) {
 | |
|         var dd = $(dom);
 | |
|         var ov = dd.css('overflowY')||dd.css('overflowX')||dd.css('overflow')||'';
 | |
|         if ((/scroll|auto/.test(ov))&&(dom.clientHeight!=dom.scrollHeight)) return dd;
 | |
|         if (dd.getNiceScroll().length>0) return dd;
 | |
|         dom = (dom.parentNode) ? dom.parentNode : false;
 | |
|       }
 | |
|       return false;
 | |
|     };
 | |
|     
 | |
|     function execScrollWheel(e,hr) {
 | |
|       var px = 0;
 | |
|       var py = 0;
 | |
|       var rt = 1;
 | |
|       if ("wheelDeltaY" in e) {
 | |
|         rt = self.opt.mousescrollstep/(16*3);
 | |
|         px = Math.floor(e.wheelDeltaX*rt);
 | |
|         py = Math.floor(e.wheelDeltaY*rt);
 | |
|         if (hr&&(px==0)&&py) {  // classic vertical-only mousewheel + browser with x/y support 
 | |
|           px = py;
 | |
|           py = 0;
 | |
|         }
 | |
|       } else {
 | |
|         var delta = e.detail ? e.detail * -1 : e.wheelDelta / 40;
 | |
|         if (delta) {
 | |
|           (hr) ? px = Math.floor(delta*self.opt.mousescrollstep) : py = Math.floor(delta*self.opt.mousescrollstep);
 | |
|         }
 | |
|       }      
 | |
|       if (px) {
 | |
|         if (self.scrollmom) {self.scrollmom.stop()}
 | |
|         self.lastdeltax+=px;
 | |
|         self.synched("mousewheelx",function(){var dt=self.lastdeltax;self.lastdeltax=0;if(!self.rail.drag){self.doScrollLeftBy(dt)}});
 | |
|       }
 | |
|       if (py) {
 | |
|         if (self.scrollmom) {self.scrollmom.stop()}
 | |
|         self.lastdeltay+=py;
 | |
|         self.synched("mousewheely",function(){var dt=self.lastdeltay;self.lastdeltay=0;if(!self.rail.drag){self.doScrollBy(dt)}});
 | |
|       }          
 | |
|     };
 | |
|     
 | |
|     this.onmousewheel = function(e) {
 | |
|       if (self.locked) return true;
 | |
|       if (!self.rail.scrollable) {
 | |
|         if (self.railh&&self.railh.scrollable) {
 | |
|           return self.onmousewheelhr(e);
 | |
|         } else {
 | |
|           return true;
 | |
|         }
 | |
|       }
 | |
|       if (self.opt.preservenativescrolling&&self.checkarea) {
 | |
|         self.checkarea = false;
 | |
|         self.nativescrollingarea = self.isScrollable(e); 
 | |
|       }
 | |
|       if (self.nativescrollingarea) return true; // this isn't my business
 | |
|       if (self.locked) return self.cancelEvent(e);
 | |
|       if (self.rail.drag) return self.cancelEvent(e);
 | |
|       
 | |
|       execScrollWheel(e,false);
 | |
|       
 | |
|       return self.cancelEvent(e);
 | |
|     };
 | |
| 
 | |
|     this.onmousewheelhr = function(e) {
 | |
|       if (self.locked||!self.railh.scrollable) return true;
 | |
|       if (self.opt.preservenativescrolling&&self.checkarea) {
 | |
|         self.checkarea = false;
 | |
|         self.nativescrollingarea = self.isScrollable(e); 
 | |
|       }
 | |
|       if (self.nativescrollingarea) return true; // this isn't my business
 | |
|       if (self.locked) return self.cancelEvent(e);
 | |
|       if (self.rail.drag) return self.cancelEvent(e);
 | |
| 
 | |
|       execScrollWheel(e,true);
 | |
|       
 | |
|       return self.cancelEvent(e);
 | |
|     };
 | |
|     
 | |
|     this.stop = function() {
 | |
|       self.cancelScroll();
 | |
|       if (self.scrollmon) self.scrollmon.stop();
 | |
|       self.cursorfreezed = false;
 | |
|       self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y));      
 | |
|       self.noticeCursor();
 | |
|       return self;
 | |
|     };
 | |
|     
 | |
|     this.getTransitionSpeed = function(dif) {
 | |
|       var sp = Math.round(self.opt.scrollspeed*10);
 | |
|       var ex = Math.min(sp,Math.round((dif / 20) * self.opt.scrollspeed));
 | |
|       return (ex>20) ? ex : 0;
 | |
|     }
 | |
|     
 | |
|     if (!self.opt.smoothscroll) {
 | |
|       this.doScrollLeft = function(x,spd) {  //direct
 | |
|         var y = self.getScrollTop();
 | |
|         self.doScrollPos(x,y,spd);
 | |
|       }      
 | |
|       this.doScrollTop = function(y,spd) {   //direct
 | |
|         var x = self.getScrollLeft();
 | |
|         self.doScrollPos(x,y,spd);
 | |
|       }
 | |
|       this.doScrollPos = function(x,y,spd) {  //direct
 | |
|         var nx = (x>self.page.maxw) ? self.page.maxw : x;
 | |
|         if (nx<0) nx=0;
 | |
|         var ny = (y>self.page.maxh) ? self.page.maxh : y;
 | |
|         if (ny<0) ny=0;
 | |
|         self.synched('scroll',function(){
 | |
|           self.setScrollTop(ny);
 | |
|           self.setScrollLeft(nx);
 | |
|         });
 | |
|       }
 | |
|       this.cancelScroll = function() {}; // direct
 | |
|     } 
 | |
|     else if (self.ishwscroll&&cap.hastransition&&self.opt.usetransition) {
 | |
|       this.prepareTransition = function(dif,istime) {
 | |
|         var ex = (istime) ? ((dif>20)?dif:0) : self.getTransitionSpeed(dif);        
 | |
|         var trans = (ex) ? cap.prefixstyle+'transform '+ex+'ms ease-out' : '';
 | |
|         if (!self.lasttransitionstyle||self.lasttransitionstyle!=trans) {
 | |
|           self.lasttransitionstyle = trans;
 | |
|           self.doc.css(cap.transitionstyle,trans);
 | |
|         }
 | |
|         return ex;
 | |
|       };
 | |
|       
 | |
|       this.doScrollLeft = function(x,spd) {  //trans
 | |
|         var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
 | |
|         self.doScrollPos(x,y,spd);
 | |
|       }      
 | |
|       
 | |
|       this.doScrollTop = function(y,spd) {   //trans
 | |
|         var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
 | |
|         self.doScrollPos(x,y,spd);
 | |
|       }
 | |
|       
 | |
|       this.doScrollPos = function(x,y,spd) {  //trans
 | |
|    
 | |
|         var py = self.getScrollTop();
 | |
|         var px = self.getScrollLeft();        
 | |
|       
 | |
|         if (((self.newscrolly-py)*(y-py)<0)||((self.newscrollx-px)*(x-px)<0)) self.cancelScroll();  //inverted movement detection      
 | |
|         
 | |
|         if (self.opt.bouncescroll==false) {
 | |
|           if (y<0) y=0;
 | |
|           else if (y>self.page.maxh) y=self.page.maxh;
 | |
|           if (x<0) x=0;
 | |
|           else if (x>self.page.maxw) x=self.page.maxw;
 | |
|         }
 | |
|         
 | |
|         if (x==self.newscrollx&&y==self.newscrolly) return false;
 | |
|         
 | |
|         self.newscrolly = y;
 | |
|         self.newscrollx = x;
 | |
|         
 | |
|         self.newscrollspeed = spd||false;
 | |
|         
 | |
|         if (self.timer) return false;
 | |
|         
 | |
|         self.timer = setTimeout(function(){
 | |
|         
 | |
|           var top = self.getScrollTop();
 | |
|           var lft = self.getScrollLeft();
 | |
|           
 | |
|           var dst = {};
 | |
|           dst.x = x-lft;
 | |
|           dst.y = y-top;
 | |
|           dst.px = lft;
 | |
|           dst.py = top;
 | |
|           
 | |
|           var dd = Math.round(Math.sqrt(Math.pow(dst.x,2)+Math.pow(dst.y,2)));          
 | |
|           
 | |
|           var df = (self.newscrollspeed) ? self.newscrollspeed : dd;          
 | |
|           var ms = self.prepareTransition(df);
 | |
|           
 | |
|           if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm);    
 | |
|           
 | |
|           if (ms>0) {
 | |
|           
 | |
|             if (!self.scrollrunning&&self.onscrollstart) {
 | |
|               var info = {"type":"scrollstart","current":{"x":lft,"y":top},"request":{"x":x,"y":y},"end":{"x":self.newscrollx,"y":self.newscrolly},"speed":ms};
 | |
|               self.onscrollstart.call(self,info);
 | |
|             }
 | |
|             
 | |
|             if (cap.transitionend) {
 | |
|               if (!self.scrollendtrapped) {
 | |
|                 self.scrollendtrapped = true;
 | |
|                 self.bind(self.doc,cap.transitionend,self.onScrollEnd,false); //I have got to do something usefull!!
 | |
|               }
 | |
|             } else {              
 | |
|               if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);
 | |
|               self.scrollendtrapped = setTimeout(self.onScrollEnd,ms);  // simulate transitionend event
 | |
|             }
 | |
|             
 | |
|             var py = top;
 | |
|             var px = lft;
 | |
|             self.timerscroll = {
 | |
|               bz: new BezierClass(py,self.newscrolly,ms,0,0,0.58,1),
 | |
|               bh: new BezierClass(px,self.newscrollx,ms,0,0,0.58,1)
 | |
|             };            
 | |
|             if (!self.cursorfreezed) self.timerscroll.tm=setInterval(function(){self.showCursor(self.getScrollTop(),self.getScrollLeft())},60);
 | |
|             
 | |
|           }
 | |
|           
 | |
|           self.synched("doScroll-set",function(){
 | |
|             self.timer = 0;
 | |
|             if (self.scrollendtrapped) self.scrollrunning = true;
 | |
|             self.setScrollTop(self.newscrolly);
 | |
|             self.setScrollLeft(self.newscrollx);
 | |
|             if (!self.scrollendtrapped) self.onScrollEnd();
 | |
|           });
 | |
|           
 | |
|           
 | |
|         },50);
 | |
|         
 | |
|       };
 | |
|       
 | |
|       this.cancelScroll = function() {
 | |
|         if (!self.scrollendtrapped) return true;        
 | |
|         var py = self.getScrollTop();
 | |
|         var px = self.getScrollLeft();
 | |
|         self.scrollrunning = false;
 | |
|         if (!cap.transitionend) clearTimeout(cap.transitionend);
 | |
|         self.scrollendtrapped = false;
 | |
|         self._unbind(self.doc,cap.transitionend,self.onScrollEnd);        
 | |
|         self.prepareTransition(0);
 | |
|         self.setScrollTop(py); // fire event onscroll
 | |
|         if (self.railh) self.setScrollLeft(px);
 | |
|         if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm);
 | |
|         self.timerscroll = false;
 | |
|         
 | |
|         self.cursorfreezed = false;
 | |
| 
 | |
|         //self.noticeCursor(false,py,px);
 | |
|         self.showCursor(py,px);
 | |
|         return self;
 | |
|       };
 | |
|       this.onScrollEnd = function() {                
 | |
|         if (self.scrollendtrapped) self._unbind(self.doc,cap.transitionend,self.onScrollEnd);
 | |
|         self.scrollendtrapped = false;        
 | |
|         self.prepareTransition(0);
 | |
|         if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm);
 | |
|         self.timerscroll = false;        
 | |
|         var py = self.getScrollTop();
 | |
|         var px = self.getScrollLeft();
 | |
|         self.setScrollTop(py);  // fire event onscroll        
 | |
|         if (self.railh) self.setScrollLeft(px);  // fire event onscroll left
 | |
|         
 | |
|         self.noticeCursor(false,py,px);     
 | |
|         
 | |
|         self.cursorfreezed = false;
 | |
|         
 | |
|         if (py<0) py=0
 | |
|         else if (py>self.page.maxh) py=self.page.maxh;
 | |
|         if (px<0) px=0
 | |
|         else if (px>self.page.maxw) px=self.page.maxw;
 | |
|         if((py!=self.newscrolly)||(px!=self.newscrollx)) return self.doScrollPos(px,py,self.opt.snapbackspeed);
 | |
|         
 | |
|         if (self.onscrollend&&self.scrollrunning) {
 | |
|           var info = {"type":"scrollend","current":{"x":px,"y":py},"end":{"x":self.newscrollx,"y":self.newscrolly}};
 | |
|           self.onscrollend.call(self,info);
 | |
|         } 
 | |
|         self.scrollrunning = false;
 | |
|         
 | |
|       };
 | |
| 
 | |
|     } else {
 | |
| 
 | |
|       this.doScrollLeft = function(x) {  //no-trans
 | |
|         var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
 | |
|         self.doScrollPos(x,y);
 | |
|       }
 | |
| 
 | |
|       this.doScrollTop = function(y) {  //no-trans
 | |
|         var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
 | |
|         self.doScrollPos(x,y);
 | |
|       }
 | |
| 
 | |
|       this.doScrollPos = function(x,y) {  //no-trans
 | |
|         var y = ((typeof y == "undefined")||(y===false)) ? self.getScrollTop(true) : y;
 | |
|       
 | |
|         if  ((self.timer)&&(self.newscrolly==y)&&(self.newscrollx==x)) return true;
 | |
|       
 | |
|         if (self.timer) clearAnimationFrame(self.timer);
 | |
|         self.timer = 0;      
 | |
| 
 | |
|         var py = self.getScrollTop();
 | |
|         var px = self.getScrollLeft();
 | |
|         
 | |
|         if (((self.newscrolly-py)*(y-py)<0)||((self.newscrollx-px)*(x-px)<0)) self.cancelScroll();  //inverted movement detection
 | |
|         
 | |
|         self.newscrolly = y;
 | |
|         self.newscrollx = x;
 | |
|         
 | |
|         if (!self.bouncescroll||!self.rail.visibility) {
 | |
|           if (self.newscrolly<0) {
 | |
|             self.newscrolly = 0;
 | |
|           }
 | |
|           else if (self.newscrolly>self.page.maxh) {
 | |
|             self.newscrolly = self.page.maxh;
 | |
|           }
 | |
|         }
 | |
|         if (!self.bouncescroll||!self.railh.visibility) {
 | |
|           if (self.newscrollx<0) {
 | |
|             self.newscrollx = 0;
 | |
|           }
 | |
|           else if (self.newscrollx>self.page.maxw) {
 | |
|             self.newscrollx = self.page.maxw;
 | |
|           }
 | |
|         }
 | |
| 
 | |
|         self.dst = {};
 | |
|         self.dst.x = x-px;
 | |
|         self.dst.y = y-py;
 | |
|         self.dst.px = px;
 | |
|         self.dst.py = py;
 | |
|         
 | |
|         var dst = Math.round(Math.sqrt(Math.pow(self.dst.x,2)+Math.pow(self.dst.y,2)));
 | |
|         
 | |
|         self.dst.ax = self.dst.x / dst;
 | |
|         self.dst.ay = self.dst.y / dst;
 | |
|         
 | |
|         var pa = 0;
 | |
|         var pe = dst;
 | |
|         
 | |
|         if (self.dst.x==0) {
 | |
|           pa = py;
 | |
|           pe = y;
 | |
|           self.dst.ay = 1;
 | |
|           self.dst.py = 0;
 | |
|         } else if (self.dst.y==0) {
 | |
|           pa = px;
 | |
|           pe = x;
 | |
|           self.dst.ax = 1;
 | |
|           self.dst.px = 0;
 | |
|         }
 | |
| 
 | |
|         var ms = self.getTransitionSpeed(dst);
 | |
|         if (ms>0) {
 | |
|           self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe,ms) : new BezierClass(pa,pe,ms,0,1,0,1);
 | |
|         } else {
 | |
|           self.bzscroll = false;
 | |
|         }
 | |
|         
 | |
|         if (self.timer) return;
 | |
|         
 | |
|         if ((py==self.page.maxh&&y>=self.page.maxh)||(px==self.page.maxw&&x>=self.page.maxw)) self.checkContentSize();
 | |
|         
 | |
|         var sync = 1;
 | |
|         
 | |
|         function scrolling() {          
 | |
|           if (self.cancelAnimationFrame) return true;
 | |
|           
 | |
|           self.scrollrunning = true;
 | |
|           
 | |
|           sync = 1-sync;
 | |
|           if (sync) return (self.timer = setAnimationFrame(scrolling)||1);
 | |
| 
 | |
|           var done = 0;
 | |
|           
 | |
|           var sc = sy = self.getScrollTop();
 | |
|           if (self.dst.ay) {            
 | |
|             sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow()*self.dst.ay) : self.newscrolly;
 | |
|             var dr=sc-sy;          
 | |
|             if ((dr<0&&sc<self.newscrolly)||(dr>0&&sc>self.newscrolly)) sc = self.newscrolly;
 | |
|             self.setScrollTop(sc);
 | |
|             if (sc == self.newscrolly) done=1;
 | |
|           } else {
 | |
|             done=1;
 | |
|           }
 | |
|           
 | |
|           var scx = sx = self.getScrollLeft();
 | |
|           if (self.dst.ax) {            
 | |
|             scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow()*self.dst.ax) : self.newscrollx;            
 | |
|             var dr=scx-sx;
 | |
|             if ((dr<0&&scx<self.newscrollx)||(dr>0&&scx>self.newscrollx)) scx = self.newscrollx;
 | |
|             self.setScrollLeft(scx);
 | |
|             if (scx == self.newscrollx) done+=1;
 | |
|           } else {
 | |
|             done+=1;
 | |
|           }
 | |
|           
 | |
|           if (done==2) {
 | |
|             self.timer = 0;
 | |
|             self.cursorfreezed = false;
 | |
|             self.bzscroll = false;
 | |
|             self.scrollrunning = false;
 | |
|             if (sc<0) sc=0;
 | |
|             else if (sc>self.page.maxh) sc=self.page.maxh;
 | |
|             if (scx<0) scx=0;
 | |
|             else if (scx>self.page.maxw) scx=self.page.maxw;
 | |
|             if ((scx!=self.newscrollx)||(sc!=self.newscrolly)) self.doScrollPos(scx,sc);
 | |
|             else {
 | |
|               if (self.onscrollend) {
 | |
|                 var info = {"type":"scrollend","current":{"x":sx,"y":sy},"end":{"x":self.newscrollx,"y":self.newscrolly}};
 | |
|                 self.onscrollend.call(self,info);
 | |
|               }             
 | |
|             } 
 | |
|           } else {
 | |
|             self.timer = setAnimationFrame(scrolling)||1;
 | |
|           }
 | |
|         };
 | |
|         self.cancelAnimationFrame=false;
 | |
|         self.timer = 1;
 | |
| 
 | |
|         if (self.onscrollstart&&!self.scrollrunning) {
 | |
|           var info = {"type":"scrollstart","current":{"x":px,"y":py},"request":{"x":x,"y":y},"end":{"x":self.newscrollx,"y":self.newscrolly},"speed":ms};
 | |
|           self.onscrollstart.call(self,info);
 | |
|         }        
 | |
| 
 | |
|         scrolling();
 | |
|         
 | |
|         if ((py==self.page.maxh&&y>=py)||(px==self.page.maxw&&x>=px)) self.checkContentSize();
 | |
|         
 | |
|         self.noticeCursor();
 | |
|       };
 | |
|   
 | |
|       this.cancelScroll = function() {        
 | |
|         if (self.timer) clearAnimationFrame(self.timer);
 | |
|         self.timer = 0;
 | |
|         self.bzscroll = false;
 | |
|         self.scrollrunning = false;
 | |
|         return self;
 | |
|       };
 | |
|       
 | |
|     }
 | |
|     
 | |
|     this.doScrollBy = function(stp,relative) {
 | |
|       var ny = 0;
 | |
|       if (relative) {
 | |
|         ny = Math.floor((self.scroll.y-stp)*self.scrollratio.y)
 | |
|       } else {        
 | |
|         var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true);
 | |
|         ny = sy-stp;
 | |
|       }
 | |
|       if (self.bouncescroll) {
 | |
|         var haf = Math.round(self.view.h/2);
 | |
|         if (ny<-haf) ny=-haf
 | |
|         else if (ny>(self.page.maxh+haf)) ny = (self.page.maxh+haf);
 | |
|       }
 | |
|       self.cursorfreezed = false;      
 | |
| 
 | |
|       py = self.getScrollTop(true);
 | |
|       if (ny<0&&py<=0) return self.noticeCursor();      
 | |
|       else if (ny>self.page.maxh&&py>=self.page.maxh) {
 | |
|         self.checkContentSize();
 | |
|         return self.noticeCursor();
 | |
|       }
 | |
|       
 | |
|       self.doScrollTop(ny);
 | |
|     };
 | |
| 
 | |
|     this.doScrollLeftBy = function(stp,relative) {
 | |
|       var nx = 0;
 | |
|       if (relative) {
 | |
|         nx = Math.floor((self.scroll.x-stp)*self.scrollratio.x)
 | |
|       } else {
 | |
|         var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true);
 | |
|         nx = sx-stp;
 | |
|       }
 | |
|       if (self.bouncescroll) {
 | |
|         var haf = Math.round(self.view.w/2);
 | |
|         if (nx<-haf) nx=-haf
 | |
|         else if (nx>(self.page.maxw+haf)) nx = (self.page.maxw+haf);
 | |
|       }
 | |
|       self.cursorfreezed = false;    
 | |
| 
 | |
|       px = self.getScrollLeft(true);
 | |
|       if (nx<0&&px<=0) return self.noticeCursor();      
 | |
|       else if (nx>self.page.maxw&&px>=self.page.maxw) return self.noticeCursor();
 | |
|       
 | |
|       self.doScrollLeft(nx);
 | |
|     };
 | |
|     
 | |
|     this.doScrollTo = function(pos,relative) {
 | |
|       var ny = (relative) ? Math.round(pos*self.scrollratio.y) : pos;
 | |
|       if (ny<0) ny=0
 | |
|       else if (ny>self.page.maxh) ny = self.page.maxh;
 | |
|       self.cursorfreezed = false;
 | |
|       self.doScrollTop(pos);
 | |
|     };
 | |
|     
 | |
|     this.checkContentSize = function() {      
 | |
|       var pg = self.getContentSize();
 | |
|       if ((pg.h!=self.page.h)||(pg.w!=self.page.w)) self.resize(false,pg);
 | |
|     };
 | |
|     
 | |
|     self.onscroll = function(e) {    
 | |
|       if (self.rail.drag) return;
 | |
|       if (!self.cursorfreezed) {
 | |
|         self.synched('scroll',function(){
 | |
|           self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y));
 | |
|           if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1/self.scrollratio.x));
 | |
|           self.noticeCursor();
 | |
|         });
 | |
|       }
 | |
|     };
 | |
|     self.bind(self.docscroll,"scroll",self.onscroll);
 | |
|     
 | |
|     this.doZoomIn = function(e) {
 | |
|       if (self.zoomactive) return;
 | |
|       self.zoomactive = true;
 | |
|       
 | |
|       self.zoomrestore = {
 | |
|         style:{}
 | |
|       };
 | |
|       var lst = ['position','top','left','zIndex','backgroundColor','marginTop','marginBottom','marginLeft','marginRight'];
 | |
|       var win = self.win[0].style;
 | |
|       for(var a in lst) {
 | |
|         var pp = lst[a];
 | |
|         self.zoomrestore.style[pp] = (typeof win[pp]!='undefined') ? win[pp] : '';
 | |
|       }
 | |
|       
 | |
|       self.zoomrestore.style.width = self.win.css('width');
 | |
|       self.zoomrestore.style.height = self.win.css('height');
 | |
|       
 | |
|       self.zoomrestore.padding = {
 | |
|         w:self.win.outerWidth()-self.win.width(),
 | |
|         h:self.win.outerHeight()-self.win.height()
 | |
|       };
 | |
|       
 | |
|       if (cap.isios4) {
 | |
|         self.zoomrestore.scrollTop = $(window).scrollTop();
 | |
|         $(window).scrollTop(0);
 | |
|       }
 | |
|       
 | |
|       self.win.css({
 | |
|         "position":(cap.isios4)?"absolute":"fixed",
 | |
|         "top":0,
 | |
|         "left":0,
 | |
|         "z-index":self.opt.zindex+100,
 | |
|         "margin":"0px"
 | |
|       });
 | |
|       var bkg = self.win.css("backgroundColor");      
 | |
|       if (bkg==""||/transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor","#fff");
 | |
|       self.rail.css({"z-index":self.opt.zindex+110});
 | |
|       self.zoom.css({"z-index":self.opt.zindex+112});      
 | |
|       self.zoom.css('backgroundPosition','0px -18px');
 | |
|       self.resizeZoom();
 | |
|       
 | |
|       if (self.onzoomin) self.onzoomin.call(self);
 | |
|       
 | |
|       return self.cancelEvent(e);
 | |
|     };
 | |
| 
 | |
|     this.doZoomOut = function(e) {
 | |
|       if (!self.zoomactive) return;
 | |
|       self.zoomactive = false;
 | |
|       
 | |
|       self.win.css("margin","");
 | |
|       self.win.css(self.zoomrestore.style);
 | |
|       
 | |
|       if (cap.isios4) {
 | |
|         $(window).scrollTop(self.zoomrestore.scrollTop);
 | |
|       }
 | |
|       
 | |
|       self.rail.css({"z-index":(self.ispage)?self.opt.zindex:self.opt.zindex+2});
 | |
|       self.zoom.css({"z-index":self.opt.zindex});
 | |
|       self.zoomrestore = false;
 | |
|       self.zoom.css('backgroundPosition','0px 0px');
 | |
|       self.onResize();
 | |
|       
 | |
|       if (self.onzoomout) self.onzoomout.call(self);
 | |
|       
 | |
|       return self.cancelEvent(e);
 | |
|     };
 | |
|     
 | |
|     this.doZoom = function(e) {
 | |
|       return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e);
 | |
|     };
 | |
|     
 | |
|     this.resizeZoom = function() {
 | |
|       if (!self.zoomactive) return;
 | |
| 
 | |
|       var py = self.getScrollTop(); //preserve scrolling position
 | |
|       self.win.css({
 | |
|         width:$(window).width()-self.zoomrestore.padding.w+"px",
 | |
|         height:$(window).height()-self.zoomrestore.padding.h+"px"
 | |
|       });
 | |
|       self.onResize();
 | |
|       
 | |
|       console.log(py);
 | |
|       
 | |
|       self.setScrollTop(Math.min(self.page.maxh,py));
 | |
|     };
 | |
|    
 | |
|     this.init();
 | |
|     
 | |
|     $.nicescroll.push(this);
 | |
| 
 | |
|   };
 | |
|   
 | |
| // Inspired by the work of Kin Blas
 | |
| // http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js  
 | |
|   
 | |
|   
 | |
|   var ScrollMomentumClass2D = function(nc) {
 | |
|     var self = this;
 | |
|     this.nc = nc;
 | |
|     
 | |
|     this.lastx = 0;
 | |
|     this.lasty = 0;
 | |
|     this.speedx = 0;
 | |
|     this.speedy = 0;
 | |
|     this.lasttime = 0;
 | |
|     this.steptime = 0;
 | |
|     this.snapx = false;
 | |
|     this.snapy = false;
 | |
|     this.demulx = 0;
 | |
|     this.demuly = 0;
 | |
|     
 | |
|     this.lastscrollx = -1;
 | |
|     this.lastscrolly = -1;
 | |
|     
 | |
|     this.chkx = 0;
 | |
|     this.chky = 0;
 | |
|     
 | |
|     this.timer = 0;
 | |
|     
 | |
|     this.time = function() {
 | |
|       return +new Date();//beautifull hack
 | |
|     };
 | |
|     
 | |
|     this.reset = function(px,py) {
 | |
|       self.stop();
 | |
|       var now = self.time();
 | |
|       self.steptime = 0;
 | |
|       self.lasttime = now;
 | |
|       self.speedx = 0;
 | |
|       self.speedy = 0;
 | |
|       self.lastx = px;
 | |
|       self.lasty = py;
 | |
|       self.lastscrollx = -1;
 | |
|       self.lastscrolly = -1;
 | |
|     };
 | |
|     
 | |
|     this.update = function(px,py) {
 | |
|       var now = self.time();
 | |
|       self.steptime = now - self.lasttime;
 | |
|       self.lasttime = now;      
 | |
|       var dy = py - self.lasty;
 | |
|       var dx = px - self.lastx;
 | |
|       var sy = self.nc.getScrollTop();
 | |
|       var sx = self.nc.getScrollLeft();
 | |
|       var newy = sy + dy;
 | |
|       var newx = sx + dx;
 | |
|       self.snapx = (newx<0)||(newx>self.nc.page.maxw);
 | |
|       self.snapy = (newy<0)||(newy>self.nc.page.maxh);
 | |
|       self.speedx = dx;
 | |
|       self.speedy = dy;
 | |
|       self.lastx = px;
 | |
|       self.lasty = py;
 | |
|     };
 | |
|     
 | |
|     this.stop = function() {
 | |
|       self.nc.unsynched("domomentum2d");
 | |
|       if (self.timer) clearTimeout(self.timer);
 | |
|       self.timer = 0;
 | |
|       self.lastscrollx = -1;
 | |
|       self.lastscrolly = -1;
 | |
|     };
 | |
|     
 | |
|     this.doSnapy = function(nx,ny) {
 | |
|       var snap = false;
 | |
|       
 | |
|       if (ny<0) {
 | |
|         ny=0;
 | |
|         snap=true;        
 | |
|       } 
 | |
|       else if (ny>self.nc.page.maxh) {
 | |
|         ny=self.nc.page.maxh;
 | |
|         snap=true;
 | |
|       }
 | |
| 
 | |
|       if (nx<0) {
 | |
|         nx=0;
 | |
|         snap=true;        
 | |
|       } 
 | |
|       else if (nx>self.nc.page.maxw) {
 | |
|         nx=self.nc.page.maxw;
 | |
|         snap=true;
 | |
|       }
 | |
|       
 | |
|       if (snap) self.nc.doScrollPos(nx,ny,self.nc.opt.snapbackspeed);
 | |
|     };
 | |
|     
 | |
|     this.doMomentum = function(gp) {
 | |
|       var t = self.time();
 | |
|       var l = (gp) ? t+gp : self.lasttime;
 | |
| 
 | |
|       var sl = self.nc.getScrollLeft();
 | |
|       var st = self.nc.getScrollTop();
 | |
|       
 | |
|       var pageh = self.nc.page.maxh;
 | |
|       var pagew = self.nc.page.maxw;
 | |
|       
 | |
|       self.speedx = (pagew>0) ? Math.min(60,self.speedx) : 0;
 | |
|       self.speedy = (pageh>0) ? Math.min(60,self.speedy) : 0;
 | |
|       
 | |
|       var chk = l && (t - l) <= 50;
 | |
|       
 | |
|       if ((st<0)||(st>pageh)||(sl<0)||(sl>pagew)) chk = false;
 | |
|       
 | |
|       var sy = (self.speedy && chk) ? self.speedy : false;
 | |
|       var sx = (self.speedx && chk) ? self.speedx : false;
 | |
|       
 | |
|       if (sy||sx) {
 | |
|         var tm = Math.max(16,self.steptime); //timeout granularity
 | |
|         
 | |
|         if (tm>50) {  // do smooth
 | |
|           var xm = tm/50;
 | |
|           self.speedx*=xm;
 | |
|           self.speedy*=xm;
 | |
|           tm = 50;
 | |
|         }
 | |
|         
 | |
|         self.demulxy = 0;
 | |
| 
 | |
|         self.lastscrollx = self.nc.getScrollLeft();
 | |
|         self.chkx = self.lastscrollx;
 | |
|         self.lastscrolly = self.nc.getScrollTop();
 | |
|         self.chky = self.lastscrolly;
 | |
|         
 | |
|         var nx = self.lastscrollx;
 | |
|         var ny = self.lastscrolly;
 | |
|         
 | |
|         var onscroll = function(){
 | |
|           var df = ((self.time()-t)>600) ? 0.04 : 0.02;
 | |
|         
 | |
|           if (self.speedx) {
 | |
|             nx = Math.floor(self.lastscrollx - (self.speedx*(1-self.demulxy)));
 | |
|             self.lastscrollx = nx;
 | |
|             if ((nx<0)||(nx>pagew)) df=0.10;
 | |
|           }
 | |
| 
 | |
|           if (self.speedy) {
 | |
|             ny = Math.floor(self.lastscrolly - (self.speedy*(1-self.demulxy)));
 | |
|             self.lastscrolly = ny;
 | |
|             if ((ny<0)||(ny>pageh)) df=0.10;
 | |
|           }
 | |
|           
 | |
|           self.demulxy = Math.min(1,self.demulxy+df);
 | |
|           
 | |
|           self.nc.synched("domomentum2d",function(){
 | |
| 
 | |
|             if (self.speedx) {
 | |
|               var scx = self.nc.getScrollLeft();
 | |
|               if (scx!=self.chkx) self.stop();
 | |
|               self.chkx=nx;
 | |
|               self.nc.setScrollLeft(nx);
 | |
|             }
 | |
|           
 | |
|             if (self.speedy) {
 | |
|               var scy = self.nc.getScrollTop();
 | |
|               if (scy!=self.chky) self.stop();          
 | |
|               self.chky=ny;
 | |
|               self.nc.setScrollTop(ny);
 | |
|             }
 | |
|             
 | |
|             if(!self.timer) {
 | |
|               self.nc.hideCursor();
 | |
|               self.doSnapy(nx,ny);
 | |
|             }
 | |
|             
 | |
|           });
 | |
|           
 | |
|           if (self.demulxy<1) {            
 | |
|             self.timer = setTimeout(onscroll,tm);
 | |
|           } else {
 | |
|             self.stop();
 | |
|             self.nc.hideCursor();
 | |
|             self.doSnapy(nx,ny);
 | |
|           }
 | |
|         };
 | |
|         
 | |
|         onscroll();
 | |
|         
 | |
|       } else {
 | |
|         self.doSnapy(self.nc.getScrollLeft(),self.nc.getScrollTop());
 | |
|       }      
 | |
|       
 | |
|     }
 | |
|     
 | |
|   };
 | |
| 
 | |
|   
 | |
| // override jQuery scrollTop
 | |
|  
 | |
|   var _scrollTop = jQuery.fn.scrollTop; // preserve original function
 | |
|    
 | |
|   $.cssHooks["pageYOffset"] = {
 | |
|     get: function(elem,computed,extra) {      
 | |
|       var nice = $.data(elem,'__nicescroll')||false;
 | |
|       return (nice&&nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem);
 | |
|     },
 | |
|     set: function(elem,value) {
 | |
|       var nice = $.data(elem,'__nicescroll')||false;    
 | |
|       (nice&&nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call(elem,value);
 | |
|       return this;
 | |
|     }
 | |
|   };
 | |
| 
 | |
| /*  
 | |
|   $.fx.step["scrollTop"] = function(fx){    
 | |
|     $.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit );
 | |
|   };
 | |
| */  
 | |
|   
 | |
|   jQuery.fn.scrollTop = function(value) {
 | |
|     if (typeof value == "undefined") {
 | |
|       var nice = (this[0]) ? $.data(this[0],'__nicescroll')||false : false;
 | |
|       return (nice&&nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this);
 | |
|     } else {      
 | |
|       return this.each(function() {
 | |
|         var nice = $.data(this,'__nicescroll')||false;
 | |
|         (nice&&nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call($(this),value);
 | |
|       });
 | |
|     }
 | |
|   }
 | |
| 
 | |
| // override jQuery scrollLeft
 | |
|  
 | |
|   var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function
 | |
|    
 | |
|   $.cssHooks.pageXOffset = {
 | |
|     get: function(elem,computed,extra) {
 | |
|       var nice = $.data(elem,'__nicescroll')||false;
 | |
|       return (nice&&nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem);
 | |
|     },
 | |
|     set: function(elem,value) {
 | |
|       var nice = $.data(elem,'__nicescroll')||false;    
 | |
|       (nice&&nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call(elem,value);
 | |
|       return this;
 | |
|     }
 | |
|   };
 | |
|   
 | |
| /*  
 | |
|   $.fx.step["scrollLeft"] = function(fx){
 | |
|     $.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit );
 | |
|   };  
 | |
| */  
 | |
|  
 | |
|   jQuery.fn.scrollLeft = function(value) {    
 | |
|     if (typeof value == "undefined") {
 | |
|       var nice = (this[0]) ? $.data(this[0],'__nicescroll')||false : false;
 | |
|       return (nice&&nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this);
 | |
|     } else {
 | |
|       return this.each(function() {     
 | |
|         var nice = $.data(this,'__nicescroll')||false;
 | |
|         (nice&&nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call($(this),value);
 | |
|       });
 | |
|     }
 | |
|   }
 | |
|   
 | |
|   var NiceScrollArray = function(doms) {
 | |
|     var self = this;
 | |
|     this.length = 0;
 | |
|     this.name = "nicescrollarray";
 | |
|   
 | |
|     this.each = function(fn) {
 | |
|       for(var a=0;a<self.length;a++) fn.call(self[a]);
 | |
|       return self;
 | |
|     };
 | |
|     
 | |
|     this.push = function(nice) {
 | |
|       self[self.length]=nice;
 | |
|       self.length++;
 | |
|     };
 | |
|     
 | |
|     this.eq = function(idx) {
 | |
|       return self[idx];
 | |
|     };
 | |
|     
 | |
|     if (doms) {
 | |
|       for(a=0;a<doms.length;a++) {
 | |
|         var nice = $.data(doms[a],'__nicescroll')||false;
 | |
|         if (nice) {
 | |
|           this[this.length]=nice;
 | |
|           this.length++;
 | |
|         }
 | |
|       };
 | |
|     }
 | |
|     
 | |
|     return this;
 | |
|   };
 | |
|   
 | |
|   function mplex(el,lst,fn) {
 | |
|     for(var a=0;a<lst.length;a++) fn(el,lst[a]);
 | |
|   };  
 | |
|   mplex(
 | |
|     NiceScrollArray.prototype,
 | |
|     ['show','hide','toggle','onResize','resize','remove','stop','doScrollPos'],
 | |
|     function(e,n) {
 | |
|       e[n] = function(){
 | |
|         var args = arguments;
 | |
|         return this.each(function(){          
 | |
|           this[n].apply(this,args);
 | |
|         });
 | |
|       };
 | |
|     }
 | |
|   );  
 | |
|   
 | |
|   jQuery.fn.getNiceScroll = function(index) {
 | |
|     if (typeof index == "undefined") {
 | |
|       return new NiceScrollArray(this);
 | |
|     } else {
 | |
|       var nice = $.data(this[index],'__nicescroll')||false;
 | |
|       return nice;
 | |
|     }
 | |
|   };
 | |
|   
 | |
|   jQuery.extend(jQuery.expr[':'], {
 | |
|     nicescroll: function(a) {
 | |
|       return ($.data(a,'__nicescroll'))?true:false;
 | |
|     }
 | |
|   });  
 | |
|   
 | |
|   $.fn.niceScroll = function(wrapper,opt) {        
 | |
|     if (typeof opt=="undefined") {
 | |
|       if ((typeof wrapper=="object")&&!("jquery" in wrapper)) {
 | |
|         opt = wrapper;
 | |
|         wrapper = false;        
 | |
|       }
 | |
|     }
 | |
|     var ret = new NiceScrollArray();
 | |
|     if (typeof opt=="undefined") opt = {};
 | |
|     
 | |
|     if (wrapper||false) {      
 | |
|       opt.doc = $(wrapper);
 | |
|       opt.win = $(this);
 | |
|     }    
 | |
|     var docundef = !("doc" in opt);   
 | |
|     if (!docundef&&!("win" in opt)) opt.win = $(this);    
 | |
|     
 | |
|     this.each(function() {
 | |
|       var nice = $(this).data('__nicescroll')||false;
 | |
|       if (!nice) {
 | |
|         opt.doc = (docundef) ? $(this) : opt.doc;
 | |
|         nice = new NiceScrollClass(opt,$(this));        
 | |
|         $(this).data('__nicescroll',nice);
 | |
|       }
 | |
|       ret.push(nice);
 | |
|     });
 | |
|     return (ret.length==1) ? ret[0] : ret;
 | |
|   };
 | |
|   
 | |
|   window.NiceScroll = {
 | |
|     getjQuery:function(){return jQuery}
 | |
|   };
 | |
|   
 | |
|   if (!$.nicescroll) {
 | |
|    $.nicescroll = new NiceScrollArray();
 | |
|   }
 | |
|   
 | |
| })( jQuery );
 | |
|   
 |