' +
@@ -250,11 +458,9 @@ var AgendaView = function(calendar){
var head_template = '' +
'From ' +
- 'To ' +
- 'Show Events ' +
'
';
@@ -264,6 +470,7 @@ var AgendaView = function(calendar){
'' +
'
' +
' ' +
+ ''+
'';
// var month_template = '';
@@ -282,7 +489,7 @@ var AgendaView = function(calendar){
this.inflate = function(forceInflation){
loading(true);
- _calendar.calendar.hide();
+ _calendar.calendar_dom.hide();
_calendar.navigation.hide();
if(!forceInflation){
@@ -299,10 +506,12 @@ var AgendaView = function(calendar){
_calendar.rangeSelection.append(renderHead().html()).show();
_calendar.rangeSelection.find("button#show_events").click(function(){
show_event_clicked = true;
- start_month = parseInt($("select[name=start_month]").val());
- end_month = parseInt($("select[name=end_month]").val());
- start_year = parseInt($("select[name=start_year]").val());
- end_year = parseInt($("select[name=end_year]").val());
+ var starts = $("#agenda_start").val().split("/"),
+ ends = $("#agenda_end").val().split("/");
+ start_month = parseInt(starts[1]) - 1;
+ end_month = parseInt(ends[1]) - 1;
+ start_year = parseInt(starts[0]);
+ end_year = parseInt(ends[0]);
av.inflate(true);
})
}
@@ -336,7 +545,7 @@ var AgendaView = function(calendar){
_calendar.rangeSelection.hide();
agenda_space.hide();
_calendar.navigation.show();
- _calendar.calendar.show();
+ _calendar.calendar_dom.show();
}
this.show = function(){
@@ -347,7 +556,7 @@ var AgendaView = function(calendar){
return x.clone();
}
var eventsManager = function(){
- var url = "/xhr/calendars/agenda",
+ var url = "/xhr/property_hires/get_bookings?property_id="+_calendar.property_id,
sd = new Date(start_year,start_month,1),
ed = new Date(end_year,end_month+1,0),
usd = Math.round(sd/1000),
@@ -355,9 +564,39 @@ var AgendaView = function(calendar){
$.ajax({
type : "get",
url : url,
- data : {"agenda_start":sd.toLocaleString(),"agenda_end":ed.toLocaleString(),"page_id" : _calendar.page_id,"unix_start":usd,"unix_end":ued},
+ dataType : "json",
+ data : {"agenda_start":sd.toLocaleString(),"agenda_end":ed.toLocaleString(),"page_id" : _calendar.page_id,"start":usd,"end":ued},
success : function(data){
- $.each(data.events,function(i,e){
+ $("#agenda_start,#agenda_end").datepicker({
+ dateFormat: "yy/mm",
+ onChangeMonthYear: function( year, month, inst ){
+ $(this).val($.datepicker.formatDate('yy/mm', new Date(year, month-1, 1)));
+ },
+ gotoCurrent: true
+ });
+ $("#agenda_start,#agenda_end").on("focus",function(){
+ var input = this;
+ var inst = $(this).data("datepicker");
+ var year_month = $(input).val().split("/");
+ if(year_month.length == 2){
+ inst.selectedYear = parseInt(year_month[0]);
+ inst.selectedMonth = parseInt(year_month[1]) - 1;
+ inst.drawYear = inst.selectedYear;
+ inst.drawMonth = inst.selectedMonth;
+ inst.currentYear = inst.selectedYear;
+ inst.currentMonth = inst.selectedMonth;
+ }
+ $.datepicker._updateDatepicker(inst);
+ })
+ $("#agenda_start,#agenda_end").focus(function () {
+ $(".ui-datepicker-calendar").hide();
+ $("#ui-datepicker-div").position({
+ my: "center top",
+ at: "center bottom",
+ of: $(this)
+ });
+ });
+ $.each(data,function(i,e){
var ed = eventDom(e),
s = new Date(e.start),
e = new Date(e.end),
@@ -414,14 +653,16 @@ var AgendaView = function(calendar){
var e_t = $(event_template),
s = new Date(event.start),
e = new Date(event.end),
- dateFormat = "";
+ dateFormat = "",
+ hiring_person_name = event.hiring_person_name;
if(s.getDate() == e.getDate() && s.getMonth() == s.getMonth() && e.getFullYear() == e.getFullYear())
- dateFormat = $.fullCalendar.formatDate(s, "ddd dd");
+ dateFormat = getDateString(s, short_day,is_chinese);
else
- dateFormat = $.fullCalendar.formatDates(s, e, "ddd dd, MMM - {ddd dd, MMM}");
+ dateFormat = getDateString(s,short_date,is_chinese) + ' - ' + getDateString(e,short_date,is_chinese);
e_t.find("td:first").text(dateFormat);
- e_t.find("td.event_time").text((event.allDay ? "All Day" : $.fullCalendar.formatDate(s, "hh:mm")));
+ e_t.find("td.event_time").text((event.allDay ? "All Day" : (getDateString(s, "h:m b")+"~"+getDateString(e, "h:m b"))));
e_t.find("div.event").text(event.title).css("color",event.color);
+ e_t.find("td.Borrower").text(hiring_person_name);
return e_t;
}
diff --git a/app/assets/javascripts/property_hire_fullcalendar.js b/app/assets/javascripts/property_hire_fullcalendar.js
new file mode 100644
index 0000000..a1988a6
--- /dev/null
+++ b/app/assets/javascripts/property_hire_fullcalendar.js
@@ -0,0 +1,20319 @@
+/*!
+FullCalendar Scheduler v5.8.0
+Docs & License: https://fullcalendar.io/scheduler
+(c) 2021 Adam Shaw
+*/
+var ie_args = navigator && navigator.userAgent.match(/MSIE\s+(\d+)/);
+var is_below_es6 = false;
+if(ie_args){
+ var ie_ver = parseInt(ie_args[1]);
+ if(ie_ver <= 10 || !Object.__proto__){
+ Object.setPrototypeOf = function(obj, proto) {
+ obj.prototype = Object.create(proto.prototype);
+ obj.prototype.constructor = obj;
+ obj.__proto__ = proto;
+ var own_props = Object.getOwnPropertyNames(proto);
+ own_props.forEach(function(prop){
+ try{
+ if(prop == "caller" || prop == "length" || prop == "arguments")
+ return;
+ obj[prop] = proto[prop];
+ }catch(e){};
+ })
+ return obj;
+ }
+ var global = (((typeof(globalThis)).toLowerCase() == "undefined") ? window : globalThis);
+ if((typeof(DOMTokenList)).toLowerCase() == "undefined"){
+ /**
+ * Polyfill of DOMTokenList for IE < 9
+ * Monkey patch of .add, .remove for IE 10 / 11, Firefox < 26 to support multiple arguments
+ * Monkey patch of .toggle for IE 10 / 11, Firefox < 24 to support second argument
+ */
+ /*global define: false, module: false */
+ /*jslint nomen: true */
+ (function domTokenListModule(global, definition) { // non-exporting module magic dance
+ 'use strict';
+
+ var
+ amd = 'amd',
+ exports = 'exports'; // keeps the method names for CommonJS / AMD from being compiled to single character variable
+
+ if (typeof define === 'function' && define[amd]) {
+ define(function definer() {
+ return definition(global);
+ });
+ } else if (typeof module === 'function' && module[exports]) {
+ module[exports] = definition(global);
+ } else {
+ definition(global);
+ }
+ }(this, function domTokenListPolyfill(global) {
+ 'use strict';
+
+ if (!global.Element) {
+ return;
+ }
+
+ var
+ document = global.document,
+ id = 0,
+ lists = {},
+ test = document.createElement('_');
+
+ /**
+ * @private
+ */
+ function createMethod(method) {
+ var
+ original = this.prototype[method];
+
+ this.prototype[method] = function override() {
+ var
+ counter,
+ length,
+ token;
+
+ for (counter = 0, length = arguments.length; counter < length; counter += 1) {
+ token = arguments[counter];
+ original.call(this, token);
+ }
+ };
+ }
+
+ /**
+ * @private
+ * @param {string} token Token to search for
+ */
+ function indexOf(token) {
+ var
+ arrayPrototype = Array.prototype,
+ counter;
+
+ if (!!arrayPrototype.indexOf) {
+ return arrayPrototype.indexOf.call(this, token);
+ }
+
+ counter = this.length - 1;
+ while (counter > -1) {
+ if (this[counter] === token) {
+ return counter;
+ }
+
+ counter -= 1;
+ }
+
+ return -1;
+ }
+
+ /**
+ * @private
+ */
+ function newId() {
+ id += 1;
+
+ return id;
+ }
+
+ /**
+ * @private
+ */
+ function onchange() {
+ var
+ classes = this.classes,
+ classesString = classes.join(' ');
+
+ if (this.isSVG) {
+ this.setAttribute('class', classesString);
+ } else {
+ this.element.className = classesString;
+ }
+
+ this.list.length = classes.length;
+ }
+
+ /**
+ * @param {string} token Token to find
+ */
+ function contains(token) {
+ return indexOf.call(lists[this.id].classes, token) !== -1;
+ }
+
+ function add() {
+ var
+ counter = 0,
+ item = lists[this.id],
+ classes = item.classes,
+ length = arguments.length,
+ token,
+ updated = false;
+
+ while (counter < length) {
+ token = arguments[counter];
+ if (indexOf.call(classes, token) === -1) {
+ classes.push(token);
+ updated = true;
+ }
+
+ counter += 1;
+ }
+
+ if (updated) {
+ onchange.call(item);
+ }
+ }
+
+ /**
+ * @param {number} index Index of list to return value
+ */
+ function item(index) {
+ return lists[this.id].classes[index] || null;
+ }
+
+ function remove() {
+ var
+ counter = arguments.length - 1,
+ entry = lists[this.id],
+ classes = entry.classes,
+ index,
+ token,
+ updated = false;
+
+ while (counter > -1) {
+ token = arguments[counter];
+ index = indexOf.call(classes, token);
+ if (index !== -1) {
+ classes.splice(index, 1);
+ updated = true;
+ }
+
+ counter -= 1;
+ }
+
+ if (updated) {
+ onchange.call(entry);
+ }
+ }
+
+ function toString() {
+ var
+ entry = lists[this.id];
+
+ onchange.call(entry);
+ return entry.element.className;
+ }
+
+ /**
+ * @param {string} token Token to toggle
+ * @param {force=} force Flag to force toggle
+ */
+ function toggle(token, force) {
+ var
+ hasToken = indexOf.call(lists[this.id].classes, token) !== -1,
+ method;
+
+ if (hasToken) {
+ if (force !== true) {
+ method = 'remove';
+ }
+ } else {
+ if (force !== false) {
+ method = 'add';
+ }
+ }
+
+ if (method) {
+ this[method](token);
+ }
+
+ return (force === true || force === false) ? force : !hasToken;
+ }
+
+ /**
+ * @constructor
+ */
+ function DOMTokenList(element) {
+ var
+ className,
+ listId,
+ isSVG;
+
+ listId = element.domTokenListId;
+ if (listId && (listId in lists)) {
+ return lists[listId].list;
+ }
+
+ isSVG = typeof element.className === 'object';
+ className = element.className;
+ className = String(isSVG ? className.baseVal : className).replace(/^\s+|\s+$/, '');
+ listId = newId();
+
+ lists[listId] = {
+ classes: className.length !== 0 ? className.split(/\s+/) : [],
+ element: element,
+ list: this,
+ isSVG: isSVG
+ };
+ this.id = listId;
+ this.length = lists[listId].classes.length;
+ element.domTokenListId = listId; // apply id lookup reference to element
+ }
+
+ if (!('classList' in test)) {
+ (function () {
+ var
+ counter,
+ elementPrototype = global.Element.prototype,
+ methodList = [add, contains, item, remove, toString, toggle],
+ methods = ['add', 'contains', 'item', 'remove', 'toString', 'toggle'],
+ propertyDescriptor,
+ prototype = DOMTokenList.prototype;
+
+ function get() {
+ var
+ thisId = this.domTokenListId;
+
+ return thisId && (thisId in lists) ? lists[thisId].list : new DOMTokenList(this);
+ }
+
+ counter = methods.length - 1;
+ while (counter > -1) {
+ prototype[methods[counter]] = methodList[counter];
+ counter -= 1;
+ }
+
+ propertyDescriptor = {
+ get: get,
+ configurable: true,
+ enumerable: true
+ };
+
+ if (Object.defineProperty) {
+ try {
+ Object.defineProperty(elementPrototype, 'classList', propertyDescriptor);
+ } catch (ex) {
+ if (ex.number === -0x7FF5EC54) { // IE 8 doesn't like it to be enumerable
+ propertyDescriptor.enumerable = false;
+ Object.defineProperty(elementPrototype, 'classList', propertyDescriptor);
+ }
+ }
+ } else if (Object.prototype.__defineGetter__) {
+ elementPrototype.__defineGetter__('classList', propertyDescriptor);
+ }
+
+ global.DOMTokenList = DOMTokenList;
+ }());
+ } else {
+ test.classList.add('c1', 'c2');
+
+ if (!test.classList.contains('c2')) { // IE 10 / 11, Firefox < 26
+ createMethod.call(global.DOMTokenList, 'add');
+ createMethod.call(global.DOMTokenList, 'remove');
+ }
+
+ test.classList.toggle('c3', false);
+ if (test.classList.contains('c3')) { // IE 10 / 11, Firefox < 24
+ global.DOMTokenList.prototype.toggle = (function () {
+ var
+ original = global.DOMTokenList.prototype.toggle;
+
+ return function toggle(token, force) {
+ var
+ notForce = !force;
+
+ return (arguments.length > 1 && !(this.contains(token) === notForce)) ? force : original.call(this, token);
+ };
+ }());
+ }
+
+ test = null;
+ }
+ }));
+ }
+ is_below_es6 = true;
+ }
+}
+var FullCalendar = (function (exports) {
+ 'use strict';
+
+ /*! *****************************************************************************
+ Copyright (c) Microsoft Corporation.
+
+ Permission to use, copy, modify, and/or distribute this software for any
+ purpose with or without fee is hereby granted.
+
+ THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ PERFORMANCE OF THIS SOFTWARE.
+ ***************************************************************************** */
+ /* global Reflect, Promise */
+
+ var extendStatics = function(d, b) {
+ extendStatics = Object.setPrototypeOf ||
+ ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||
+ function (d, b) { for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p]; };
+ return extendStatics(d, b);
+ };
+
+ function __extends(d, b) {
+ if (typeof b !== "function" && b !== null)
+ throw new TypeError("Class extends value " + String(b) + " is not a constructor or null");
+ extendStatics(d, b);
+ d.__proto__ = b;
+ function __() { this.constructor = d; }
+ d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
+ }
+
+ var __assign = function() {
+ __assign = Object.assign || function __assign(t) {
+ for (var s, i = 1, n = arguments.length; i < n; i++) {
+ s = arguments[i];
+ for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];
+ }
+ return t;
+ };
+ return __assign.apply(this, arguments);
+ };
+
+ function __spreadArray(to, from) {
+ for (var i = 0, il = from.length, j = to.length; i < il; i++, j++)
+ to[j] = from[i];
+ return to;
+ }
+
+ var n,u,i$1,t,o,r$1={},f$1=[],e$1=/acit|ex(?:s|g|n|p|$)|rph|grid|ows|mnc|ntw|ine[ch]|zoo|^ord|itera/i;function c$1(n,l){for(var u in l)n[u]=l[u];return n}function s(n){var l=n.parentNode;l&&l.removeChild(n);}function a$1(n,l,u){var i,t,o,r=arguments,f={};for(o in l)"key"==o?i=l[o]:"ref"==o?t=l[o]:f[o]=l[o];if(arguments.length>3)for(u=[u],o=3;o0?v$1(k.type,k.props,k.key,null,k.__v):k)){if(k.__=u,k.__b=u.__b+1,null===(_=A[h])||_&&k.key==_.key&&k.type===_.type)A[h]=void 0;else for(p=0;p3;)e.pop()();if(e[1]>>1,1),t.i.removeChild(n);}}),N(a$1(T,{context:t.context},n.__v),t.l)):t.l&&t.componentWillUnmount();}function I(n,t){return a$1(j,{__v:n,i:t})}(F.prototype=new p).__e=function(n){var t=this,e=U(t.__v),r=t.o.get(n);return r[0]++,function(u){var o=function(){t.props.revealOrder?(r.push(u),M(t,n,r)):u();};e?e(o):o();}},F.prototype.render=function(n){this.u=null,this.o=new Map;var t=w$1(n.children);n.revealOrder&&"b"===n.revealOrder[0]&&t.reverse();for(var e=t.length;e--;)this.o.set(t[e],this.u=[1,0,this.u]);return n.children},F.prototype.componentDidUpdate=F.prototype.componentDidMount=function(){var n=this;this.o.forEach(function(t,e){M(n,e,t);});};var W="undefined"!=typeof Symbol&&Symbol.for&&Symbol.for("react.element")||60103,P=/^(?:accent|alignment|arabic|baseline|cap|clip(?!PathU)|color|fill|flood|font|glyph(?!R)|horiz|marker(?!H|W|U)|overline|paint|stop|strikethrough|stroke|text(?!L)|underline|unicode|units|v|vector|vert|word|writing|x(?!C))[A-Z]/,V=function(n){return ("undefined"!=typeof Symbol&&"symbol"==typeof Symbol()?/fil|che|rad/i:/fil|che|ra/i).test(n)};p.prototype.isReactComponent={},["componentWillMount","componentWillReceiveProps","componentWillUpdate"].forEach(function(n){Object.defineProperty(p.prototype,n,{configurable:!0,get:function(){return this["UNSAFE_"+n]},set:function(t){Object.defineProperty(this,n,{configurable:!0,writable:!0,value:t});}});});var H=n.event;function Z(){}function Y(){return this.cancelBubble}function $(){return this.defaultPrevented}n.event=function(n){return H&&(n=H(n)),n.persist=Z,n.isPropagationStopped=Y,n.isDefaultPrevented=$,n.nativeEvent=n};var G={configurable:!0,get:function(){return this.class}},J=n.vnode;n.vnode=function(n){var t=n.type,e=n.props,r=e;if("string"==typeof t){for(var u in r={},e){var o=e[u];"value"===u&&"defaultValue"in e&&null==o||("defaultValue"===u&&"value"in e&&null==e.value?u="value":"download"===u&&!0===o?o="":/ondoubleclick/i.test(u)?u="ondblclick":/^onchange(textarea|input)/i.test(u+t)&&!V(e.type)?u="oninput":/^on(Ani|Tra|Tou|BeforeInp)/.test(u)?u=u.toLowerCase():P.test(u)?u=u.replace(/[A-Z0-9]/,"-$&").toLowerCase():null===o&&(o=void 0),r[u]=o);}"select"==t&&r.multiple&&Array.isArray(r.value)&&(r.value=w$1(e.children).forEach(function(n){n.props.selected=-1!=r.value.indexOf(n.props.value);})),"select"==t&&null!=r.defaultValue&&(r.value=w$1(e.children).forEach(function(n){n.props.selected=r.multiple?-1!=r.defaultValue.indexOf(n.props.value):r.defaultValue==n.props.value;})),n.props=r;}t&&e.class!=e.className&&(G.enumerable="className"in e,null!=e.className&&(r.class=e.className),Object.defineProperty(r,"className",G)),n.$$typeof=W,J&&J(n);};var K=n.__r;n.__r=function(n){K&&K(n);};"object"==typeof performance&&"function"==typeof performance.now?performance.now.bind(performance):function(){return Date.now()};
+
+ var globalObj = typeof globalThis !== 'undefined' ? globalThis : window; // // TODO: streamline when killing IE11 support
+ if (globalObj.FullCalendarVDom) {
+ console.warn('FullCalendar VDOM already loaded');
+ }
+ else {
+ globalObj.FullCalendarVDom = {
+ Component: p,
+ createElement: a$1,
+ render: N,
+ createRef: h,
+ Fragment: y,
+ createContext: createContext$1,
+ createPortal: I,
+ flushToDom: flushToDom$1,
+ unmountComponentAtNode: unmountComponentAtNode$1,
+ };
+ }
+ // HACKS...
+ // TODO: lock version
+ // TODO: link gh issues
+ function flushToDom$1() {
+ var oldDebounceRendering = n.debounceRendering; // orig
+ var callbackQ = [];
+ function execCallbackSync(callback) {
+ callbackQ.push(callback);
+ }
+ n.debounceRendering = execCallbackSync;
+ N(a$1(FakeComponent, {}), document.createElement('div'));
+ while (callbackQ.length) {
+ callbackQ.shift()();
+ }
+ n.debounceRendering = oldDebounceRendering;
+ }
+ var FakeComponent = /** @class */ (function (_super) {
+ __extends(FakeComponent, _super);
+ function FakeComponent() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ FakeComponent.prototype.render = function () { return a$1('div', {}); };
+ FakeComponent.prototype.componentDidMount = function () { this.setState({}); };
+ return FakeComponent;
+ }(p));
+ function createContext$1(defaultValue) {
+ var ContextType = q(defaultValue);
+ var origProvider = ContextType.Provider;
+ ContextType.Provider = function () {
+ var _this = this;
+ var isNew = !this.getChildContext;
+ var children = origProvider.apply(this, arguments); // eslint-disable-line prefer-rest-params
+ if (isNew) {
+ var subs_1 = [];
+ this.shouldComponentUpdate = function (_props) {
+ if (_this.props.value !== _props.value) {
+ subs_1.forEach(function (c) {
+ c.context = _props.value;
+ c.forceUpdate();
+ });
+ }
+ };
+ this.sub = function (c) {
+ subs_1.push(c);
+ var old = c.componentWillUnmount;
+ c.componentWillUnmount = function () {
+ subs_1.splice(subs_1.indexOf(c), 1);
+ old && old.call(c);
+ };
+ };
+ }
+ return children;
+ };
+ return ContextType;
+ }
+ function unmountComponentAtNode$1(node) {
+ N(null, node);
+ }
+
+ // no public types yet. when there are, export from:
+ // import {} from './api-type-deps'
+ var EventSourceApi = /** @class */ (function () {
+ function EventSourceApi(context, internalEventSource) {
+ this.context = context;
+ this.internalEventSource = internalEventSource;
+ }
+ EventSourceApi.prototype.remove = function () {
+ this.context.dispatch({
+ type: 'REMOVE_EVENT_SOURCE',
+ sourceId: this.internalEventSource.sourceId,
+ });
+ };
+ EventSourceApi.prototype.refetch = function () {
+ this.context.dispatch({
+ type: 'FETCH_EVENT_SOURCES',
+ sourceIds: [this.internalEventSource.sourceId],
+ isRefetch: true,
+ });
+ };
+ Object.defineProperty(EventSourceApi.prototype, "id", {
+ get: function () {
+ return this.internalEventSource.publicId;
+ },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventSourceApi.prototype, "url", {
+ get: function () {
+ return this.internalEventSource.meta.url;
+ },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventSourceApi.prototype, "format", {
+ get: function () {
+ return this.internalEventSource.meta.format; // TODO: bad. not guaranteed
+ },
+ enumerable: false,
+ configurable: true
+ });
+ return EventSourceApi;
+ }());
+
+ function removeElement(el) {
+ if (el.parentNode) {
+ el.parentNode.removeChild(el);
+ }
+ }
+ // Querying
+ // ----------------------------------------------------------------------------------------------------------------
+ function elementClosest(el, selector) {
+ if (el.closest) {
+ return el.closest(selector);
+ // really bad fallback for IE
+ // from https://developer.mozilla.org/en-US/docs/Web/API/Element/closest
+ }
+ if (!document.documentElement.contains(el)) {
+ return null;
+ }
+ do {
+ if (elementMatches(el, selector)) {
+ return el;
+ }
+ el = (el.parentElement || el.parentNode);
+ } while (el !== null && el.nodeType === 1);
+ return null;
+ }
+ function elementMatches(el, selector) {
+ var method = el.matches || el.matchesSelector || el.msMatchesSelector;
+ return method.call(el, selector);
+ }
+ // accepts multiple subject els
+ // returns a real array. good for methods like forEach
+ // TODO: accept the document
+ function findElements(container, selector) {
+ var containers = container instanceof HTMLElement ? [container] : container;
+ var allMatches = [];
+ for (var i = 0; i < containers.length; i += 1) {
+ var matches = containers[i].querySelectorAll(selector);
+ for (var j = 0; j < matches.length; j += 1) {
+ allMatches.push(matches[j]);
+ }
+ }
+ return allMatches;
+ }
+ // accepts multiple subject els
+ // only queries direct child elements // TODO: rename to findDirectChildren!
+ function findDirectChildren(parent, selector) {
+ var parents = parent instanceof HTMLElement ? [parent] : parent;
+ var allMatches = [];
+ for (var i = 0; i < parents.length; i += 1) {
+ var childNodes = parents[i].children; // only ever elements
+ for (var j = 0; j < childNodes.length; j += 1) {
+ var childNode = childNodes[j];
+ if (!selector || elementMatches(childNode, selector)) {
+ allMatches.push(childNode);
+ }
+ }
+ }
+ return allMatches;
+ }
+ // Style
+ // ----------------------------------------------------------------------------------------------------------------
+ var PIXEL_PROP_RE = /(top|left|right|bottom|width|height)$/i;
+ function applyStyle(el, props) {
+ for (var propName in props) {
+ applyStyleProp(el, propName, props[propName]);
+ }
+ }
+ function applyStyleProp(el, name, val) {
+ if (val == null) {
+ el.style[name] = '';
+ }
+ else if (typeof val === 'number' && PIXEL_PROP_RE.test(name)) {
+ el.style[name] = val + "px";
+ }
+ else {
+ el.style[name] = val;
+ }
+ }
+ // Event Handling
+ // ----------------------------------------------------------------------------------------------------------------
+ // if intercepting bubbled events at the document/window/body level,
+ // and want to see originating element (the 'target'), use this util instead
+ // of `ev.target` because it goes within web-component boundaries.
+ function getEventTargetViaRoot(ev) {
+ var _a, _b;
+ return (_b = (_a = ev.composedPath) === null || _a === void 0 ? void 0 : _a.call(ev)[0]) !== null && _b !== void 0 ? _b : ev.target;
+ }
+
+ // Stops a mouse/touch event from doing it's native browser action
+ function preventDefault(ev) {
+ ev.preventDefault();
+ }
+ // Event Delegation
+ // ----------------------------------------------------------------------------------------------------------------
+ function buildDelegationHandler(selector, handler) {
+ return function (ev) {
+ var matchedChild = elementClosest(ev.target, selector);
+ if (matchedChild) {
+ handler.call(matchedChild, ev, matchedChild);
+ }
+ };
+ }
+ function listenBySelector(container, eventType, selector, handler) {
+ var attachedHandler = buildDelegationHandler(selector, handler);
+ container.addEventListener(eventType, attachedHandler);
+ return function () {
+ container.removeEventListener(eventType, attachedHandler);
+ };
+ }
+ function listenToHoverBySelector(container, selector, onMouseEnter, onMouseLeave) {
+ var currentMatchedChild;
+ return listenBySelector(container, 'mouseover', selector, function (mouseOverEv, matchedChild) {
+ if (matchedChild !== currentMatchedChild) {
+ currentMatchedChild = matchedChild;
+ onMouseEnter(mouseOverEv, matchedChild);
+ var realOnMouseLeave_1 = function (mouseLeaveEv) {
+ currentMatchedChild = null;
+ onMouseLeave(mouseLeaveEv, matchedChild);
+ matchedChild.removeEventListener('mouseleave', realOnMouseLeave_1);
+ };
+ // listen to the next mouseleave, and then unattach
+ matchedChild.addEventListener('mouseleave', realOnMouseLeave_1);
+ }
+ });
+ }
+ // Animation
+ // ----------------------------------------------------------------------------------------------------------------
+ var transitionEventNames = [
+ 'webkitTransitionEnd',
+ 'otransitionend',
+ 'oTransitionEnd',
+ 'msTransitionEnd',
+ 'transitionend',
+ ];
+ // triggered only when the next single subsequent transition finishes
+ function whenTransitionDone(el, callback) {
+ var realCallback = function (ev) {
+ callback(ev);
+ transitionEventNames.forEach(function (eventName) {
+ el.removeEventListener(eventName, realCallback);
+ });
+ };
+ transitionEventNames.forEach(function (eventName) {
+ el.addEventListener(eventName, realCallback); // cross-browser way to determine when the transition finishes
+ });
+ }
+
+ var guidNumber = 0;
+ function guid() {
+ guidNumber += 1;
+ return String(guidNumber);
+ }
+ /* FullCalendar-specific DOM Utilities
+ ----------------------------------------------------------------------------------------------------------------------*/
+ // Make the mouse cursor express that an event is not allowed in the current area
+ function disableCursor() {
+ document.body.classList.add('fc-not-allowed');
+ }
+ // Returns the mouse cursor to its original look
+ function enableCursor() {
+ document.body.classList.remove('fc-not-allowed');
+ }
+ /* Selection
+ ----------------------------------------------------------------------------------------------------------------------*/
+ function preventSelection(el) {
+ el.classList.add('fc-unselectable');
+ el.addEventListener('selectstart', preventDefault);
+ }
+ function allowSelection(el) {
+ el.classList.remove('fc-unselectable');
+ el.removeEventListener('selectstart', preventDefault);
+ }
+ /* Context Menu
+ ----------------------------------------------------------------------------------------------------------------------*/
+ function preventContextMenu(el) {
+ el.addEventListener('contextmenu', preventDefault);
+ }
+ function allowContextMenu(el) {
+ el.removeEventListener('contextmenu', preventDefault);
+ }
+ function parseFieldSpecs(input) {
+ var specs = [];
+ var tokens = [];
+ var i;
+ var token;
+ if (typeof input === 'string') {
+ tokens = input.split(/\s*,\s*/);
+ }
+ else if (typeof input === 'function') {
+ tokens = [input];
+ }
+ else if (Array.isArray(input)) {
+ tokens = input;
+ }
+ for (i = 0; i < tokens.length; i += 1) {
+ token = tokens[i];
+ if (typeof token === 'string') {
+ specs.push(token.charAt(0) === '-' ?
+ { field: token.substring(1), order: -1 } :
+ { field: token, order: 1 });
+ }
+ else if (typeof token === 'function') {
+ specs.push({ func: token });
+ }
+ }
+ return specs;
+ }
+ function compareByFieldSpecs(obj0, obj1, fieldSpecs) {
+ var i;
+ var cmp;
+ for (i = 0; i < fieldSpecs.length; i += 1) {
+ cmp = compareByFieldSpec(obj0, obj1, fieldSpecs[i]);
+ if (cmp) {
+ return cmp;
+ }
+ }
+ return 0;
+ }
+ function compareByFieldSpec(obj0, obj1, fieldSpec) {
+ if (fieldSpec.func) {
+ return fieldSpec.func(obj0, obj1);
+ }
+ return flexibleCompare(obj0[fieldSpec.field], obj1[fieldSpec.field])
+ * (fieldSpec.order || 1);
+ }
+ function flexibleCompare(a, b) {
+ if (!a && !b) {
+ return 0;
+ }
+ if (b == null) {
+ return -1;
+ }
+ if (a == null) {
+ return 1;
+ }
+ if (typeof a === 'string' || typeof b === 'string') {
+ return String(a).localeCompare(String(b));
+ }
+ return a - b;
+ }
+ /* String Utilities
+ ----------------------------------------------------------------------------------------------------------------------*/
+ function padStart(val, len) {
+ var s = String(val);
+ return '000'.substr(0, len - s.length) + s;
+ }
+ /* Number Utilities
+ ----------------------------------------------------------------------------------------------------------------------*/
+ function compareNumbers(a, b) {
+ return a - b;
+ }
+ function isInt(n) {
+ return n % 1 === 0;
+ }
+ /* FC-specific DOM dimension stuff
+ ----------------------------------------------------------------------------------------------------------------------*/
+ function computeSmallestCellWidth(cellEl) {
+ var allWidthEl = cellEl.querySelector('.fc-scrollgrid-shrink-frame');
+ var contentWidthEl = cellEl.querySelector('.fc-scrollgrid-shrink-cushion');
+ if (!allWidthEl) {
+ throw new Error('needs fc-scrollgrid-shrink-frame className'); // TODO: use const
+ }
+ if (!contentWidthEl) {
+ throw new Error('needs fc-scrollgrid-shrink-cushion className');
+ }
+ return cellEl.getBoundingClientRect().width - allWidthEl.getBoundingClientRect().width + // the cell padding+border
+ contentWidthEl.getBoundingClientRect().width;
+ }
+
+ var DAY_IDS = ['sun', 'mon', 'tue', 'wed', 'thu', 'fri', 'sat'];
+ // Adding
+ function addWeeks(m, n) {
+ var a = dateToUtcArray(m);
+ a[2] += n * 7;
+ return arrayToUtcDate(a);
+ }
+ function addDays(m, n) {
+ var a = dateToUtcArray(m);
+ a[2] += n;
+ return arrayToUtcDate(a);
+ }
+ function addMs(m, n) {
+ var a = dateToUtcArray(m);
+ a[6] += n;
+ return arrayToUtcDate(a);
+ }
+ // Diffing (all return floats)
+ // TODO: why not use ranges?
+ function diffWeeks(m0, m1) {
+ return diffDays(m0, m1) / 7;
+ }
+ function diffDays(m0, m1) {
+ return (m1.valueOf() - m0.valueOf()) / (1000 * 60 * 60 * 24);
+ }
+ function diffHours(m0, m1) {
+ return (m1.valueOf() - m0.valueOf()) / (1000 * 60 * 60);
+ }
+ function diffMinutes(m0, m1) {
+ return (m1.valueOf() - m0.valueOf()) / (1000 * 60);
+ }
+ function diffSeconds(m0, m1) {
+ return (m1.valueOf() - m0.valueOf()) / 1000;
+ }
+ function diffDayAndTime(m0, m1) {
+ var m0day = startOfDay(m0);
+ var m1day = startOfDay(m1);
+ return {
+ years: 0,
+ months: 0,
+ days: Math.round(diffDays(m0day, m1day)),
+ milliseconds: (m1.valueOf() - m1day.valueOf()) - (m0.valueOf() - m0day.valueOf()),
+ };
+ }
+ // Diffing Whole Units
+ function diffWholeWeeks(m0, m1) {
+ var d = diffWholeDays(m0, m1);
+ if (d !== null && d % 7 === 0) {
+ return d / 7;
+ }
+ return null;
+ }
+ function diffWholeDays(m0, m1) {
+ if (timeAsMs(m0) === timeAsMs(m1)) {
+ return Math.round(diffDays(m0, m1));
+ }
+ return null;
+ }
+ // Start-Of
+ function startOfDay(m) {
+ return arrayToUtcDate([
+ m.getUTCFullYear(),
+ m.getUTCMonth(),
+ m.getUTCDate(),
+ ]);
+ }
+ function startOfHour(m) {
+ return arrayToUtcDate([
+ m.getUTCFullYear(),
+ m.getUTCMonth(),
+ m.getUTCDate(),
+ m.getUTCHours(),
+ ]);
+ }
+ function startOfMinute(m) {
+ return arrayToUtcDate([
+ m.getUTCFullYear(),
+ m.getUTCMonth(),
+ m.getUTCDate(),
+ m.getUTCHours(),
+ m.getUTCMinutes(),
+ ]);
+ }
+ function startOfSecond(m) {
+ return arrayToUtcDate([
+ m.getUTCFullYear(),
+ m.getUTCMonth(),
+ m.getUTCDate(),
+ m.getUTCHours(),
+ m.getUTCMinutes(),
+ m.getUTCSeconds(),
+ ]);
+ }
+ // Week Computation
+ function weekOfYear(marker, dow, doy) {
+ var y = marker.getUTCFullYear();
+ var w = weekOfGivenYear(marker, y, dow, doy);
+ if (w < 1) {
+ return weekOfGivenYear(marker, y - 1, dow, doy);
+ }
+ var nextW = weekOfGivenYear(marker, y + 1, dow, doy);
+ if (nextW >= 1) {
+ return Math.min(w, nextW);
+ }
+ return w;
+ }
+ function weekOfGivenYear(marker, year, dow, doy) {
+ var firstWeekStart = arrayToUtcDate([year, 0, 1 + firstWeekOffset(year, dow, doy)]);
+ var dayStart = startOfDay(marker);
+ var days = Math.round(diffDays(firstWeekStart, dayStart));
+ return Math.floor(days / 7) + 1; // zero-indexed
+ }
+ // start-of-first-week - start-of-year
+ function firstWeekOffset(year, dow, doy) {
+ // first-week day -- which january is always in the first week (4 for iso, 1 for other)
+ var fwd = 7 + dow - doy;
+ // first-week day local weekday -- which local weekday is fwd
+ var fwdlw = (7 + arrayToUtcDate([year, 0, fwd]).getUTCDay() - dow) % 7;
+ return -fwdlw + fwd - 1;
+ }
+ // Array Conversion
+ function dateToLocalArray(date) {
+ return [
+ date.getFullYear(),
+ date.getMonth(),
+ date.getDate(),
+ date.getHours(),
+ date.getMinutes(),
+ date.getSeconds(),
+ date.getMilliseconds(),
+ ];
+ }
+ function arrayToLocalDate(a) {
+ return new Date(a[0], a[1] || 0, a[2] == null ? 1 : a[2], // day of month
+ a[3] || 0, a[4] || 0, a[5] || 0);
+ }
+ function dateToUtcArray(date) {
+ return [
+ date.getUTCFullYear(),
+ date.getUTCMonth(),
+ date.getUTCDate(),
+ date.getUTCHours(),
+ date.getUTCMinutes(),
+ date.getUTCSeconds(),
+ date.getUTCMilliseconds(),
+ ];
+ }
+ function arrayToUtcDate(a) {
+ // according to web standards (and Safari), a month index is required.
+ // massage if only given a year.
+ if (a.length === 1) {
+ a = a.concat([0]);
+ }
+ return new Date(Date.UTC.apply(Date, a));
+ }
+ // Other Utils
+ function isValidDate$1(m) {
+ return !isNaN(m.valueOf());
+ }
+ function timeAsMs(m) {
+ return m.getUTCHours() * 1000 * 60 * 60 +
+ m.getUTCMinutes() * 1000 * 60 +
+ m.getUTCSeconds() * 1000 +
+ m.getUTCMilliseconds();
+ }
+
+ function createEventInstance(defId, range, forcedStartTzo, forcedEndTzo) {
+ return {
+ instanceId: guid(),
+ defId: defId,
+ range: range,
+ forcedStartTzo: forcedStartTzo == null ? null : forcedStartTzo,
+ forcedEndTzo: forcedEndTzo == null ? null : forcedEndTzo,
+ };
+ }
+
+ var hasOwnProperty = Object.prototype.hasOwnProperty;
+ // Merges an array of objects into a single object.
+ // The second argument allows for an array of property names who's object values will be merged together.
+ function mergeProps(propObjs, complexPropsMap) {
+ var dest = {};
+ if (complexPropsMap) {
+ for (var name_1 in complexPropsMap) {
+ var complexObjs = [];
+ // collect the trailing object values, stopping when a non-object is discovered
+ for (var i = propObjs.length - 1; i >= 0; i -= 1) {
+ var val = propObjs[i][name_1];
+ if (typeof val === 'object' && val) { // non-null object
+ complexObjs.unshift(val);
+ }
+ else if (val !== undefined) {
+ dest[name_1] = val; // if there were no objects, this value will be used
+ break;
+ }
+ }
+ // if the trailing values were objects, use the merged value
+ if (complexObjs.length) {
+ dest[name_1] = mergeProps(complexObjs);
+ }
+ }
+ }
+ // copy values into the destination, going from last to first
+ for (var i = propObjs.length - 1; i >= 0; i -= 1) {
+ var props = propObjs[i];
+ for (var name_2 in props) {
+ if (!(name_2 in dest)) { // if already assigned by previous props or complex props, don't reassign
+ dest[name_2] = props[name_2];
+ }
+ }
+ }
+ return dest;
+ }
+ function filterHash(hash, func) {
+ var filtered = {};
+ for (var key in hash) {
+ if (func(hash[key], key)) {
+ filtered[key] = hash[key];
+ }
+ }
+ return filtered;
+ }
+ function mapHash(hash, func) {
+ var newHash = {};
+ for (var key in hash) {
+ newHash[key] = func(hash[key], key);
+ }
+ return newHash;
+ }
+ function arrayToHash(a) {
+ var hash = {};
+ for (var _i = 0, a_1 = a; _i < a_1.length; _i++) {
+ var item = a_1[_i];
+ hash[item] = true;
+ }
+ return hash;
+ }
+ function buildHashFromArray(a, func) {
+ var hash = {};
+ for (var i = 0; i < a.length; i += 1) {
+ var tuple = func(a[i], i);
+ hash[tuple[0]] = tuple[1];
+ }
+ return hash;
+ }
+ function hashValuesToArray(obj) {
+ var a = [];
+ for (var key in obj) {
+ a.push(obj[key]);
+ }
+ return a;
+ }
+ function isPropsEqual(obj0, obj1) {
+ if (obj0 === obj1) {
+ return true;
+ }
+ for (var key in obj0) {
+ if (hasOwnProperty.call(obj0, key)) {
+ if (!(key in obj1)) {
+ return false;
+ }
+ }
+ }
+ for (var key in obj1) {
+ if (hasOwnProperty.call(obj1, key)) {
+ if (obj0[key] !== obj1[key]) {
+ return false;
+ }
+ }
+ }
+ return true;
+ }
+ function getUnequalProps(obj0, obj1) {
+ var keys = [];
+ for (var key in obj0) {
+ if (hasOwnProperty.call(obj0, key)) {
+ if (!(key in obj1)) {
+ keys.push(key);
+ }
+ }
+ }
+ for (var key in obj1) {
+ if (hasOwnProperty.call(obj1, key)) {
+ if (obj0[key] !== obj1[key]) {
+ keys.push(key);
+ }
+ }
+ }
+ return keys;
+ }
+ function compareObjs(oldProps, newProps, equalityFuncs) {
+ if (equalityFuncs === void 0) { equalityFuncs = {}; }
+ if (oldProps === newProps) {
+ return true;
+ }
+ for (var key in newProps) {
+ if (key in oldProps && isObjValsEqual(oldProps[key], newProps[key], equalityFuncs[key])) ;
+ else {
+ return false;
+ }
+ }
+ // check for props that were omitted in the new
+ for (var key in oldProps) {
+ if (!(key in newProps)) {
+ return false;
+ }
+ }
+ return true;
+ }
+ /*
+ assumed "true" equality for handler names like "onReceiveSomething"
+ */
+ function isObjValsEqual(val0, val1, comparator) {
+ if (val0 === val1 || comparator === true) {
+ return true;
+ }
+ if (comparator) {
+ return comparator(val0, val1);
+ }
+ return false;
+ }
+ function collectFromHash(hash, startIndex, endIndex, step) {
+ if (startIndex === void 0) { startIndex = 0; }
+ if (step === void 0) { step = 1; }
+ var res = [];
+ if (endIndex == null) {
+ endIndex = Object.keys(hash).length;
+ }
+ for (var i = startIndex; i < endIndex; i += step) {
+ var val = hash[i];
+ if (val !== undefined) { // will disregard undefined for sparse arrays
+ res.push(val);
+ }
+ }
+ return res;
+ }
+
+ function parseRecurring(refined, defaultAllDay, dateEnv, recurringTypes) {
+ for (var i = 0; i < recurringTypes.length; i += 1) {
+ var parsed = recurringTypes[i].parse(refined, dateEnv);
+ if (parsed) {
+ var allDay = refined.allDay;
+ if (allDay == null) {
+ allDay = defaultAllDay;
+ if (allDay == null) {
+ allDay = parsed.allDayGuess;
+ if (allDay == null) {
+ allDay = false;
+ }
+ }
+ }
+ return {
+ allDay: allDay,
+ duration: parsed.duration,
+ typeData: parsed.typeData,
+ typeId: i,
+ };
+ }
+ }
+ return null;
+ }
+ function expandRecurring(eventStore, framingRange, context) {
+ var dateEnv = context.dateEnv, pluginHooks = context.pluginHooks, options = context.options;
+ var defs = eventStore.defs, instances = eventStore.instances;
+ // remove existing recurring instances
+ // TODO: bad. always expand events as a second step
+ instances = filterHash(instances, function (instance) { return !defs[instance.defId].recurringDef; });
+ for (var defId in defs) {
+ var def = defs[defId];
+ if (def.recurringDef) {
+ var duration = def.recurringDef.duration;
+ if (!duration) {
+ duration = def.allDay ?
+ options.defaultAllDayEventDuration :
+ options.defaultTimedEventDuration;
+ }
+ var starts = expandRecurringRanges(def, duration, framingRange, dateEnv, pluginHooks.recurringTypes);
+ for (var _i = 0, starts_1 = starts; _i < starts_1.length; _i++) {
+ var start = starts_1[_i];
+ var instance = createEventInstance(defId, {
+ start: start,
+ end: dateEnv.add(start, duration),
+ });
+ instances[instance.instanceId] = instance;
+ }
+ }
+ }
+ return { defs: defs, instances: instances };
+ }
+ /*
+ Event MUST have a recurringDef
+ */
+ function expandRecurringRanges(eventDef, duration, framingRange, dateEnv, recurringTypes) {
+ var typeDef = recurringTypes[eventDef.recurringDef.typeId];
+ var markers = typeDef.expand(eventDef.recurringDef.typeData, {
+ start: dateEnv.subtract(framingRange.start, duration),
+ end: framingRange.end,
+ }, dateEnv);
+ // the recurrence plugins don't guarantee that all-day events are start-of-day, so we have to
+ if (eventDef.allDay) {
+ markers = markers.map(startOfDay);
+ }
+ return markers;
+ }
+
+ var INTERNAL_UNITS = ['years', 'months', 'days', 'milliseconds'];
+ var PARSE_RE = /^(-?)(?:(\d+)\.)?(\d+):(\d\d)(?::(\d\d)(?:\.(\d\d\d))?)?/;
+ // Parsing and Creation
+ function createDuration(input, unit) {
+ var _a;
+ if (typeof input === 'string') {
+ return parseString(input);
+ }
+ if (typeof input === 'object' && input) { // non-null object
+ return parseObject(input);
+ }
+ if (typeof input === 'number') {
+ return parseObject((_a = {}, _a[unit || 'milliseconds'] = input, _a));
+ }
+ return null;
+ }
+ function parseString(s) {
+ var m = PARSE_RE.exec(s);
+ if (m) {
+ var sign = m[1] ? -1 : 1;
+ return {
+ years: 0,
+ months: 0,
+ days: sign * (m[2] ? parseInt(m[2], 10) : 0),
+ milliseconds: sign * ((m[3] ? parseInt(m[3], 10) : 0) * 60 * 60 * 1000 + // hours
+ (m[4] ? parseInt(m[4], 10) : 0) * 60 * 1000 + // minutes
+ (m[5] ? parseInt(m[5], 10) : 0) * 1000 + // seconds
+ (m[6] ? parseInt(m[6], 10) : 0) // ms
+ ),
+ };
+ }
+ return null;
+ }
+ function parseObject(obj) {
+ var duration = {
+ years: obj.years || obj.year || 0,
+ months: obj.months || obj.month || 0,
+ days: obj.days || obj.day || 0,
+ milliseconds: (obj.hours || obj.hour || 0) * 60 * 60 * 1000 + // hours
+ (obj.minutes || obj.minute || 0) * 60 * 1000 + // minutes
+ (obj.seconds || obj.second || 0) * 1000 + // seconds
+ (obj.milliseconds || obj.millisecond || obj.ms || 0), // ms
+ };
+ var weeks = obj.weeks || obj.week;
+ if (weeks) {
+ duration.days += weeks * 7;
+ duration.specifiedWeeks = true;
+ }
+ return duration;
+ }
+ // Equality
+ function durationsEqual(d0, d1) {
+ return d0.years === d1.years &&
+ d0.months === d1.months &&
+ d0.days === d1.days &&
+ d0.milliseconds === d1.milliseconds;
+ }
+ function asCleanDays(dur) {
+ if (!dur.years && !dur.months && !dur.milliseconds) {
+ return dur.days;
+ }
+ return 0;
+ }
+ // Simple Math
+ function addDurations(d0, d1) {
+ return {
+ years: d0.years + d1.years,
+ months: d0.months + d1.months,
+ days: d0.days + d1.days,
+ milliseconds: d0.milliseconds + d1.milliseconds,
+ };
+ }
+ function subtractDurations(d1, d0) {
+ return {
+ years: d1.years - d0.years,
+ months: d1.months - d0.months,
+ days: d1.days - d0.days,
+ milliseconds: d1.milliseconds - d0.milliseconds,
+ };
+ }
+ function multiplyDuration(d, n) {
+ return {
+ years: d.years * n,
+ months: d.months * n,
+ days: d.days * n,
+ milliseconds: d.milliseconds * n,
+ };
+ }
+ // Conversions
+ // "Rough" because they are based on average-case Gregorian months/years
+ function asRoughYears(dur) {
+ return asRoughDays(dur) / 365;
+ }
+ function asRoughMonths(dur) {
+ return asRoughDays(dur) / 30;
+ }
+ function asRoughDays(dur) {
+ return asRoughMs(dur) / 864e5;
+ }
+ function asRoughMinutes(dur) {
+ return asRoughMs(dur) / (1000 * 60);
+ }
+ function asRoughSeconds(dur) {
+ return asRoughMs(dur) / 1000;
+ }
+ function asRoughMs(dur) {
+ return dur.years * (365 * 864e5) +
+ dur.months * (30 * 864e5) +
+ dur.days * 864e5 +
+ dur.milliseconds;
+ }
+ // Advanced Math
+ function wholeDivideDurations(numerator, denominator) {
+ var res = null;
+ for (var i = 0; i < INTERNAL_UNITS.length; i += 1) {
+ var unit = INTERNAL_UNITS[i];
+ if (denominator[unit]) {
+ var localRes = numerator[unit] / denominator[unit];
+ if (!isInt(localRes) || (res !== null && res !== localRes)) {
+ return null;
+ }
+ res = localRes;
+ }
+ else if (numerator[unit]) {
+ // needs to divide by something but can't!
+ return null;
+ }
+ }
+ return res;
+ }
+ function greatestDurationDenominator(dur) {
+ var ms = dur.milliseconds;
+ if (ms) {
+ if (ms % 1000 !== 0) {
+ return { unit: 'millisecond', value: ms };
+ }
+ if (ms % (1000 * 60) !== 0) {
+ return { unit: 'second', value: ms / 1000 };
+ }
+ if (ms % (1000 * 60 * 60) !== 0) {
+ return { unit: 'minute', value: ms / (1000 * 60) };
+ }
+ if (ms) {
+ return { unit: 'hour', value: ms / (1000 * 60 * 60) };
+ }
+ }
+ if (dur.days) {
+ if (dur.specifiedWeeks && dur.days % 7 === 0) {
+ return { unit: 'week', value: dur.days / 7 };
+ }
+ return { unit: 'day', value: dur.days };
+ }
+ if (dur.months) {
+ return { unit: 'month', value: dur.months };
+ }
+ if (dur.years) {
+ return { unit: 'year', value: dur.years };
+ }
+ return { unit: 'millisecond', value: 0 };
+ }
+
+ // timeZoneOffset is in minutes
+ function buildIsoString(marker, timeZoneOffset, stripZeroTime) {
+ if (stripZeroTime === void 0) { stripZeroTime = false; }
+ var s = marker.toISOString();
+ s = s.replace('.000', '');
+ if (stripZeroTime) {
+ s = s.replace('T00:00:00Z', '');
+ }
+ if (s.length > 10) { // time part wasn't stripped, can add timezone info
+ if (timeZoneOffset == null) {
+ s = s.replace('Z', '');
+ }
+ else if (timeZoneOffset !== 0) {
+ s = s.replace('Z', formatTimeZoneOffset(timeZoneOffset, true));
+ }
+ // otherwise, its UTC-0 and we want to keep the Z
+ }
+ return s;
+ }
+ // formats the date, but with no time part
+ // TODO: somehow merge with buildIsoString and stripZeroTime
+ // TODO: rename. omit "string"
+ function formatDayString(marker) {
+ return marker.toISOString().replace(/T.*$/, '');
+ }
+ // TODO: use Date::toISOString and use everything after the T?
+ function formatIsoTimeString(marker) {
+ return padStart(marker.getUTCHours(), 2) + ':' +
+ padStart(marker.getUTCMinutes(), 2) + ':' +
+ padStart(marker.getUTCSeconds(), 2);
+ }
+ function formatTimeZoneOffset(minutes, doIso) {
+ if (doIso === void 0) { doIso = false; }
+ var sign = minutes < 0 ? '-' : '+';
+ var abs = Math.abs(minutes);
+ var hours = Math.floor(abs / 60);
+ var mins = Math.round(abs % 60);
+ if (doIso) {
+ return sign + padStart(hours, 2) + ":" + padStart(mins, 2);
+ }
+ return "GMT" + sign + hours + (mins ? ":" + padStart(mins, 2) : '');
+ }
+
+ // TODO: new util arrayify?
+ function removeExact(array, exactVal) {
+ var removeCnt = 0;
+ var i = 0;
+ while (i < array.length) {
+ if (array[i] === exactVal) {
+ array.splice(i, 1);
+ removeCnt += 1;
+ }
+ else {
+ i += 1;
+ }
+ }
+ return removeCnt;
+ }
+ function isArraysEqual(a0, a1, equalityFunc) {
+ if (a0 === a1) {
+ return true;
+ }
+ var len = a0.length;
+ var i;
+ if (len !== a1.length) { // not array? or not same length?
+ return false;
+ }
+ for (i = 0; i < len; i += 1) {
+ if (!(equalityFunc ? equalityFunc(a0[i], a1[i]) : a0[i] === a1[i])) {
+ return false;
+ }
+ }
+ return true;
+ }
+
+ function memoize(workerFunc, resEquality, teardownFunc) {
+ var currentArgs;
+ var currentRes;
+ return function () {
+ var newArgs = [];
+ for (var _i = 0; _i < arguments.length; _i++) {
+ newArgs[_i] = arguments[_i];
+ }
+ if (!currentArgs) {
+ currentRes = workerFunc.apply(this, newArgs);
+ }
+ else if (!isArraysEqual(currentArgs, newArgs)) {
+ if (teardownFunc) {
+ teardownFunc(currentRes);
+ }
+ var res = workerFunc.apply(this, newArgs);
+ if (!resEquality || !resEquality(res, currentRes)) {
+ currentRes = res;
+ }
+ }
+ currentArgs = newArgs;
+ return currentRes;
+ };
+ }
+ function memoizeObjArg(workerFunc, resEquality, teardownFunc) {
+ var _this = this;
+ var currentArg;
+ var currentRes;
+ return function (newArg) {
+ if (!currentArg) {
+ currentRes = workerFunc.call(_this, newArg);
+ }
+ else if (!isPropsEqual(currentArg, newArg)) {
+ if (teardownFunc) {
+ teardownFunc(currentRes);
+ }
+ var res = workerFunc.call(_this, newArg);
+ if (!resEquality || !resEquality(res, currentRes)) {
+ currentRes = res;
+ }
+ }
+ currentArg = newArg;
+ return currentRes;
+ };
+ }
+ function memoizeArraylike(// used at all?
+ workerFunc, resEquality, teardownFunc) {
+ var _this = this;
+ var currentArgSets = [];
+ var currentResults = [];
+ return function (newArgSets) {
+ var currentLen = currentArgSets.length;
+ var newLen = newArgSets.length;
+ var i = 0;
+ for (; i < currentLen; i += 1) {
+ if (!newArgSets[i]) { // one of the old sets no longer exists
+ if (teardownFunc) {
+ teardownFunc(currentResults[i]);
+ }
+ }
+ else if (!isArraysEqual(currentArgSets[i], newArgSets[i])) {
+ if (teardownFunc) {
+ teardownFunc(currentResults[i]);
+ }
+ var res = workerFunc.apply(_this, newArgSets[i]);
+ if (!resEquality || !resEquality(res, currentResults[i])) {
+ currentResults[i] = res;
+ }
+ }
+ }
+ for (; i < newLen; i += 1) {
+ currentResults[i] = workerFunc.apply(_this, newArgSets[i]);
+ }
+ currentArgSets = newArgSets;
+ currentResults.splice(newLen); // remove excess
+ return currentResults;
+ };
+ }
+ function memoizeHashlike(// used?
+ workerFunc, resEquality, teardownFunc) {
+ var _this = this;
+ var currentArgHash = {};
+ var currentResHash = {};
+ return function (newArgHash) {
+ var newResHash = {};
+ for (var key in newArgHash) {
+ if (!currentResHash[key]) {
+ newResHash[key] = workerFunc.apply(_this, newArgHash[key]);
+ }
+ else if (!isArraysEqual(currentArgHash[key], newArgHash[key])) {
+ if (teardownFunc) {
+ teardownFunc(currentResHash[key]);
+ }
+ var res = workerFunc.apply(_this, newArgHash[key]);
+ newResHash[key] = (resEquality && resEquality(res, currentResHash[key]))
+ ? currentResHash[key]
+ : res;
+ }
+ else {
+ newResHash[key] = currentResHash[key];
+ }
+ }
+ currentArgHash = newArgHash;
+ currentResHash = newResHash;
+ return newResHash;
+ };
+ }
+
+ var EXTENDED_SETTINGS_AND_SEVERITIES = {
+ week: 3,
+ separator: 0,
+ omitZeroMinute: 0,
+ meridiem: 0,
+ omitCommas: 0,
+ };
+ var STANDARD_DATE_PROP_SEVERITIES = {
+ timeZoneName: 7,
+ era: 6,
+ year: 5,
+ month: 4,
+ day: 2,
+ weekday: 2,
+ hour: 1,
+ minute: 1,
+ second: 1,
+ };
+ var MERIDIEM_RE = /\s*([ap])\.?m\.?/i; // eats up leading spaces too
+ var COMMA_RE = /,/g; // we need re for globalness
+ var MULTI_SPACE_RE = /\s+/g;
+ var LTR_RE = /\u200e/g; // control character
+ var UTC_RE = /UTC|GMT/;
+ var NativeFormatter = /** @class */ (function () {
+ function NativeFormatter(formatSettings) {
+ var standardDateProps = {};
+ var extendedSettings = {};
+ var severity = 0;
+ for (var name_1 in formatSettings) {
+ if (name_1 in EXTENDED_SETTINGS_AND_SEVERITIES) {
+ extendedSettings[name_1] = formatSettings[name_1];
+ severity = Math.max(EXTENDED_SETTINGS_AND_SEVERITIES[name_1], severity);
+ }
+ else {
+ standardDateProps[name_1] = formatSettings[name_1];
+ if (name_1 in STANDARD_DATE_PROP_SEVERITIES) { // TODO: what about hour12? no severity
+ severity = Math.max(STANDARD_DATE_PROP_SEVERITIES[name_1], severity);
+ }
+ }
+ }
+ this.standardDateProps = standardDateProps;
+ this.extendedSettings = extendedSettings;
+ this.severity = severity;
+ this.buildFormattingFunc = memoize(buildFormattingFunc);
+ }
+ NativeFormatter.prototype.format = function (date, context) {
+ return this.buildFormattingFunc(this.standardDateProps, this.extendedSettings, context)(date);
+ };
+ NativeFormatter.prototype.formatRange = function (start, end, context, betterDefaultSeparator) {
+ var _a = this, standardDateProps = _a.standardDateProps, extendedSettings = _a.extendedSettings;
+ var diffSeverity = computeMarkerDiffSeverity(start.marker, end.marker, context.calendarSystem);
+ if (!diffSeverity) {
+ return this.format(start, context);
+ }
+ var biggestUnitForPartial = diffSeverity;
+ if (biggestUnitForPartial > 1 && // the two dates are different in a way that's larger scale than time
+ (standardDateProps.year === 'numeric' || standardDateProps.year === '2-digit') &&
+ (standardDateProps.month === 'numeric' || standardDateProps.month === '2-digit') &&
+ (standardDateProps.day === 'numeric' || standardDateProps.day === '2-digit')) {
+ biggestUnitForPartial = 1; // make it look like the dates are only different in terms of time
+ }
+ var full0 = this.format(start, context);
+ var full1 = this.format(end, context);
+ if (full0 === full1) {
+ return full0;
+ }
+ var partialDateProps = computePartialFormattingOptions(standardDateProps, biggestUnitForPartial);
+ var partialFormattingFunc = buildFormattingFunc(partialDateProps, extendedSettings, context);
+ var partial0 = partialFormattingFunc(start);
+ var partial1 = partialFormattingFunc(end);
+ var insertion = findCommonInsertion(full0, partial0, full1, partial1);
+ var separator = extendedSettings.separator || betterDefaultSeparator || context.defaultSeparator || '';
+ if (insertion) {
+ return insertion.before + partial0 + separator + partial1 + insertion.after;
+ }
+ return full0 + separator + full1;
+ };
+ NativeFormatter.prototype.getLargestUnit = function () {
+ switch (this.severity) {
+ case 7:
+ case 6:
+ case 5:
+ return 'year';
+ case 4:
+ return 'month';
+ case 3:
+ return 'week';
+ case 2:
+ return 'day';
+ default:
+ return 'time'; // really?
+ }
+ };
+ return NativeFormatter;
+ }());
+ function buildFormattingFunc(standardDateProps, extendedSettings, context) {
+ var standardDatePropCnt = Object.keys(standardDateProps).length;
+ if (standardDatePropCnt === 1 && standardDateProps.timeZoneName === 'short') {
+ return function (date) { return (formatTimeZoneOffset(date.timeZoneOffset)); };
+ }
+ if (standardDatePropCnt === 0 && extendedSettings.week) {
+ return function (date) { return (formatWeekNumber(context.computeWeekNumber(date.marker), context.weekText, context.locale, extendedSettings.week)); };
+ }
+ return buildNativeFormattingFunc(standardDateProps, extendedSettings, context);
+ }
+ function buildNativeFormattingFunc(standardDateProps, extendedSettings, context) {
+ standardDateProps = __assign({}, standardDateProps); // copy
+ extendedSettings = __assign({}, extendedSettings); // copy
+ sanitizeSettings(standardDateProps, extendedSettings);
+ standardDateProps.timeZone = 'UTC'; // we leverage the only guaranteed timeZone for our UTC markers
+ var normalFormat = new Intl.DateTimeFormat(context.locale.codes, standardDateProps);
+ var zeroFormat; // needed?
+ if (extendedSettings.omitZeroMinute) {
+ var zeroProps = __assign({}, standardDateProps);
+ delete zeroProps.minute; // seconds and ms were already considered in sanitizeSettings
+ zeroFormat = new Intl.DateTimeFormat(context.locale.codes, zeroProps);
+ }
+ return function (date) {
+ var marker = date.marker;
+ var format;
+ if (zeroFormat && !marker.getUTCMinutes()) {
+ format = zeroFormat;
+ }
+ else {
+ format = normalFormat;
+ }
+ var s = format.format(marker);
+ return postProcess(s, date, standardDateProps, extendedSettings, context);
+ };
+ }
+ function sanitizeSettings(standardDateProps, extendedSettings) {
+ // deal with a browser inconsistency where formatting the timezone
+ // requires that the hour/minute be present.
+ if (standardDateProps.timeZoneName) {
+ if (!standardDateProps.hour) {
+ standardDateProps.hour = '2-digit';
+ }
+ if (!standardDateProps.minute) {
+ standardDateProps.minute = '2-digit';
+ }
+ }
+ // only support short timezone names
+ if (standardDateProps.timeZoneName === 'long') {
+ standardDateProps.timeZoneName = 'short';
+ }
+ // if requesting to display seconds, MUST display minutes
+ if (extendedSettings.omitZeroMinute && (standardDateProps.second || standardDateProps.millisecond)) {
+ delete extendedSettings.omitZeroMinute;
+ }
+ }
+ function postProcess(s, date, standardDateProps, extendedSettings, context) {
+ s = s.replace(LTR_RE, ''); // remove left-to-right control chars. do first. good for other regexes
+ if (standardDateProps.timeZoneName === 'short') {
+ s = injectTzoStr(s, (context.timeZone === 'UTC' || date.timeZoneOffset == null) ?
+ 'UTC' : // important to normalize for IE, which does "GMT"
+ formatTimeZoneOffset(date.timeZoneOffset));
+ }
+ if (extendedSettings.omitCommas) {
+ s = s.replace(COMMA_RE, '').trim();
+ }
+ if (extendedSettings.omitZeroMinute) {
+ s = s.replace(':00', ''); // zeroFormat doesn't always achieve this
+ }
+ // ^ do anything that might create adjacent spaces before this point,
+ // because MERIDIEM_RE likes to eat up loading spaces
+ if (extendedSettings.meridiem === false) {
+ s = s.replace(MERIDIEM_RE, '').trim();
+ }
+ else if (extendedSettings.meridiem === 'narrow') { // a/p
+ s = s.replace(MERIDIEM_RE, function (m0, m1) { return m1.toLocaleLowerCase(); });
+ }
+ else if (extendedSettings.meridiem === 'short') { // am/pm
+ s = s.replace(MERIDIEM_RE, function (m0, m1) { return m1.toLocaleLowerCase() + "m"; });
+ }
+ else if (extendedSettings.meridiem === 'lowercase') { // other meridiem transformers already converted to lowercase
+ s = s.replace(MERIDIEM_RE, function (m0) { return m0.toLocaleLowerCase(); });
+ }
+ s = s.replace(MULTI_SPACE_RE, ' ');
+ s = s.trim();
+ return s;
+ }
+ function injectTzoStr(s, tzoStr) {
+ var replaced = false;
+ s = s.replace(UTC_RE, function () {
+ replaced = true;
+ return tzoStr;
+ });
+ // IE11 doesn't include UTC/GMT in the original string, so append to end
+ if (!replaced) {
+ s += " " + tzoStr;
+ }
+ return s;
+ }
+ function formatWeekNumber(num, weekText, locale, display) {
+ var parts = [];
+ if (display === 'narrow') {
+ parts.push(weekText);
+ }
+ else if (display === 'short') {
+ parts.push(weekText, ' ');
+ }
+ // otherwise, considered 'numeric'
+ parts.push(locale.simpleNumberFormat.format(num));
+ if (locale.options.direction === 'rtl') { // TODO: use control characters instead?
+ parts.reverse();
+ }
+ return parts.join('');
+ }
+ // Range Formatting Utils
+ // 0 = exactly the same
+ // 1 = different by time
+ // and bigger
+ function computeMarkerDiffSeverity(d0, d1, ca) {
+ if (ca.getMarkerYear(d0) !== ca.getMarkerYear(d1)) {
+ return 5;
+ }
+ if (ca.getMarkerMonth(d0) !== ca.getMarkerMonth(d1)) {
+ return 4;
+ }
+ if (ca.getMarkerDay(d0) !== ca.getMarkerDay(d1)) {
+ return 2;
+ }
+ if (timeAsMs(d0) !== timeAsMs(d1)) {
+ return 1;
+ }
+ return 0;
+ }
+ function computePartialFormattingOptions(options, biggestUnit) {
+ var partialOptions = {};
+ for (var name_2 in options) {
+ if (!(name_2 in STANDARD_DATE_PROP_SEVERITIES) || // not a date part prop (like timeZone)
+ STANDARD_DATE_PROP_SEVERITIES[name_2] <= biggestUnit) {
+ partialOptions[name_2] = options[name_2];
+ }
+ }
+ return partialOptions;
+ }
+ function findCommonInsertion(full0, partial0, full1, partial1) {
+ var i0 = 0;
+ while (i0 < full0.length) {
+ var found0 = full0.indexOf(partial0, i0);
+ if (found0 === -1) {
+ break;
+ }
+ var before0 = full0.substr(0, found0);
+ i0 = found0 + partial0.length;
+ var after0 = full0.substr(i0);
+ var i1 = 0;
+ while (i1 < full1.length) {
+ var found1 = full1.indexOf(partial1, i1);
+ if (found1 === -1) {
+ break;
+ }
+ var before1 = full1.substr(0, found1);
+ i1 = found1 + partial1.length;
+ var after1 = full1.substr(i1);
+ if (before0 === before1 && after0 === after1) {
+ return {
+ before: before0,
+ after: after0,
+ };
+ }
+ }
+ }
+ return null;
+ }
+
+ function expandZonedMarker(dateInfo, calendarSystem) {
+ var a = calendarSystem.markerToArray(dateInfo.marker);
+ return {
+ marker: dateInfo.marker,
+ timeZoneOffset: dateInfo.timeZoneOffset,
+ array: a,
+ year: a[0],
+ month: a[1],
+ day: a[2],
+ hour: a[3],
+ minute: a[4],
+ second: a[5],
+ millisecond: a[6],
+ };
+ }
+
+ function createVerboseFormattingArg(start, end, context, betterDefaultSeparator) {
+ var startInfo = expandZonedMarker(start, context.calendarSystem);
+ var endInfo = end ? expandZonedMarker(end, context.calendarSystem) : null;
+ return {
+ date: startInfo,
+ start: startInfo,
+ end: endInfo,
+ timeZone: context.timeZone,
+ localeCodes: context.locale.codes,
+ defaultSeparator: betterDefaultSeparator || context.defaultSeparator,
+ };
+ }
+
+ /*
+ TODO: fix the terminology of "formatter" vs "formatting func"
+ */
+ /*
+ At the time of instantiation, this object does not know which cmd-formatting system it will use.
+ It receives this at the time of formatting, as a setting.
+ */
+ var CmdFormatter = /** @class */ (function () {
+ function CmdFormatter(cmdStr) {
+ this.cmdStr = cmdStr;
+ }
+ CmdFormatter.prototype.format = function (date, context, betterDefaultSeparator) {
+ return context.cmdFormatter(this.cmdStr, createVerboseFormattingArg(date, null, context, betterDefaultSeparator));
+ };
+ CmdFormatter.prototype.formatRange = function (start, end, context, betterDefaultSeparator) {
+ return context.cmdFormatter(this.cmdStr, createVerboseFormattingArg(start, end, context, betterDefaultSeparator));
+ };
+ return CmdFormatter;
+ }());
+
+ var FuncFormatter = /** @class */ (function () {
+ function FuncFormatter(func) {
+ this.func = func;
+ }
+ FuncFormatter.prototype.format = function (date, context, betterDefaultSeparator) {
+ return this.func(createVerboseFormattingArg(date, null, context, betterDefaultSeparator));
+ };
+ FuncFormatter.prototype.formatRange = function (start, end, context, betterDefaultSeparator) {
+ return this.func(createVerboseFormattingArg(start, end, context, betterDefaultSeparator));
+ };
+ return FuncFormatter;
+ }());
+
+ function createFormatter(input) {
+ if (typeof input === 'object' && input) { // non-null object
+ return new NativeFormatter(input);
+ }
+ if (typeof input === 'string') {
+ return new CmdFormatter(input);
+ }
+ if (typeof input === 'function') {
+ return new FuncFormatter(input);
+ }
+ return null;
+ }
+
+ // base options
+ // ------------
+ var BASE_OPTION_REFINERS = {
+ navLinkDayClick: identity,
+ navLinkWeekClick: identity,
+ duration: createDuration,
+ bootstrapFontAwesome: identity,
+ buttonIcons: identity,
+ customButtons: identity,
+ defaultAllDayEventDuration: createDuration,
+ defaultTimedEventDuration: createDuration,
+ nextDayThreshold: createDuration,
+ scrollTime: createDuration,
+ scrollTimeReset: Boolean,
+ slotMinTime: createDuration,
+ slotMaxTime: createDuration,
+ dayPopoverFormat: createFormatter,
+ slotDuration: createDuration,
+ snapDuration: createDuration,
+ headerToolbar: identity,
+ footerToolbar: identity,
+ defaultRangeSeparator: String,
+ titleRangeSeparator: String,
+ forceEventDuration: Boolean,
+ dayHeaders: Boolean,
+ dayHeaderFormat: createFormatter,
+ dayHeaderClassNames: identity,
+ dayHeaderContent: identity,
+ dayHeaderDidMount: identity,
+ dayHeaderWillUnmount: identity,
+ dayCellClassNames: identity,
+ dayCellContent: identity,
+ dayCellDidMount: identity,
+ dayCellWillUnmount: identity,
+ initialView: String,
+ aspectRatio: Number,
+ weekends: Boolean,
+ weekNumberCalculation: identity,
+ weekNumbers: Boolean,
+ weekNumberClassNames: identity,
+ weekNumberContent: identity,
+ weekNumberDidMount: identity,
+ weekNumberWillUnmount: identity,
+ editable: Boolean,
+ viewClassNames: identity,
+ viewDidMount: identity,
+ viewWillUnmount: identity,
+ nowIndicator: Boolean,
+ nowIndicatorClassNames: identity,
+ nowIndicatorContent: identity,
+ nowIndicatorDidMount: identity,
+ nowIndicatorWillUnmount: identity,
+ showNonCurrentDates: Boolean,
+ lazyFetching: Boolean,
+ startParam: String,
+ endParam: String,
+ timeZoneParam: String,
+ timeZone: String,
+ locales: identity,
+ locale: identity,
+ themeSystem: String,
+ dragRevertDuration: Number,
+ dragScroll: Boolean,
+ allDayMaintainDuration: Boolean,
+ unselectAuto: Boolean,
+ dropAccept: identity,
+ eventOrder: parseFieldSpecs,
+ eventOrderStrict: Boolean,
+ handleWindowResize: Boolean,
+ windowResizeDelay: Number,
+ longPressDelay: Number,
+ eventDragMinDistance: Number,
+ expandRows: Boolean,
+ height: identity,
+ contentHeight: identity,
+ direction: String,
+ weekNumberFormat: createFormatter,
+ eventResizableFromStart: Boolean,
+ displayEventTime: Boolean,
+ displayEventEnd: Boolean,
+ weekText: String,
+ progressiveEventRendering: Boolean,
+ businessHours: identity,
+ initialDate: identity,
+ now: identity,
+ eventDataTransform: identity,
+ stickyHeaderDates: identity,
+ stickyFooterScrollbar: identity,
+ viewHeight: identity,
+ defaultAllDay: Boolean,
+ eventSourceFailure: identity,
+ eventSourceSuccess: identity,
+ eventDisplay: String,
+ eventStartEditable: Boolean,
+ eventDurationEditable: Boolean,
+ eventOverlap: identity,
+ eventConstraint: identity,
+ eventAllow: identity,
+ eventBackgroundColor: String,
+ eventBorderColor: String,
+ eventTextColor: String,
+ eventColor: String,
+ eventClassNames: identity,
+ eventContent: identity,
+ eventDidMount: identity,
+ eventWillUnmount: identity,
+ selectConstraint: identity,
+ selectOverlap: identity,
+ selectAllow: identity,
+ droppable: Boolean,
+ unselectCancel: String,
+ slotLabelFormat: identity,
+ slotLaneClassNames: identity,
+ slotLaneContent: identity,
+ slotLaneDidMount: identity,
+ slotLaneWillUnmount: identity,
+ slotLabelClassNames: identity,
+ slotLabelContent: identity,
+ slotLabelDidMount: identity,
+ slotLabelWillUnmount: identity,
+ dayMaxEvents: identity,
+ dayMaxEventRows: identity,
+ dayMinWidth: Number,
+ slotLabelInterval: createDuration,
+ allDayText: String,
+ allDayClassNames: identity,
+ allDayContent: identity,
+ allDayDidMount: identity,
+ allDayWillUnmount: identity,
+ slotMinWidth: Number,
+ navLinks: Boolean,
+ eventTimeFormat: createFormatter,
+ rerenderDelay: Number,
+ moreLinkText: identity,
+ selectMinDistance: Number,
+ selectable: Boolean,
+ selectLongPressDelay: Number,
+ eventLongPressDelay: Number,
+ selectMirror: Boolean,
+ eventMaxStack: Number,
+ eventMinHeight: Number,
+ eventMinWidth: Number,
+ eventShortHeight: Number,
+ slotEventOverlap: Boolean,
+ plugins: identity,
+ firstDay: Number,
+ dayCount: Number,
+ dateAlignment: String,
+ dateIncrement: createDuration,
+ hiddenDays: identity,
+ monthMode: Boolean,
+ fixedWeekCount: Boolean,
+ validRange: identity,
+ visibleRange: identity,
+ titleFormat: identity,
+ // only used by list-view, but languages define the value, so we need it in base options
+ noEventsText: String,
+ moreLinkClick: identity,
+ moreLinkClassNames: identity,
+ moreLinkContent: identity,
+ moreLinkDidMount: identity,
+ moreLinkWillUnmount: identity,
+ };
+ // do NOT give a type here. need `typeof BASE_OPTION_DEFAULTS` to give real results.
+ // raw values.
+ var BASE_OPTION_DEFAULTS = {
+ eventDisplay: 'auto',
+ defaultRangeSeparator: ' - ',
+ titleRangeSeparator: ' \u2013 ',
+ defaultTimedEventDuration: '01:00:00',
+ defaultAllDayEventDuration: { day: 1 },
+ forceEventDuration: false,
+ nextDayThreshold: '00:00:00',
+ dayHeaders: true,
+ initialView: '',
+ aspectRatio: 1.35,
+ headerToolbar: {
+ start: 'title',
+ center: '',
+ end: 'today prev,next',
+ },
+ weekends: true,
+ weekNumbers: false,
+ weekNumberCalculation: 'local',
+ editable: false,
+ nowIndicator: false,
+ scrollTime: '06:00:00',
+ scrollTimeReset: true,
+ slotMinTime: '00:00:00',
+ slotMaxTime: '24:00:00',
+ showNonCurrentDates: true,
+ lazyFetching: true,
+ startParam: 'start',
+ endParam: 'end',
+ timeZoneParam: 'timeZone',
+ timeZone: 'local',
+ locales: [],
+ locale: '',
+ themeSystem: 'standard',
+ dragRevertDuration: 500,
+ dragScroll: true,
+ allDayMaintainDuration: false,
+ unselectAuto: true,
+ dropAccept: '*',
+ eventOrder: 'start,-duration,allDay,title',
+ dayPopoverFormat: { month: 'long', day: 'numeric', year: 'numeric' },
+ handleWindowResize: true,
+ windowResizeDelay: 100,
+ longPressDelay: 1000,
+ eventDragMinDistance: 5,
+ expandRows: false,
+ navLinks: false,
+ selectable: false,
+ eventMinHeight: 15,
+ eventMinWidth: 30,
+ eventShortHeight: 30,
+ };
+ // calendar listeners
+ // ------------------
+ var CALENDAR_LISTENER_REFINERS = {
+ datesSet: identity,
+ eventsSet: identity,
+ eventAdd: identity,
+ eventChange: identity,
+ eventRemove: identity,
+ windowResize: identity,
+ eventClick: identity,
+ eventMouseEnter: identity,
+ eventMouseLeave: identity,
+ select: identity,
+ unselect: identity,
+ loading: identity,
+ // internal
+ _unmount: identity,
+ _beforeprint: identity,
+ _afterprint: identity,
+ _noEventDrop: identity,
+ _noEventResize: identity,
+ _resize: identity,
+ _scrollRequest: identity,
+ };
+ // calendar-specific options
+ // -------------------------
+ var CALENDAR_OPTION_REFINERS = {
+ buttonText: identity,
+ views: identity,
+ plugins: identity,
+ initialEvents: identity,
+ events: identity,
+ eventSources: identity,
+ };
+ var COMPLEX_OPTION_COMPARATORS = {
+ headerToolbar: isBoolComplexEqual,
+ footerToolbar: isBoolComplexEqual,
+ buttonText: isBoolComplexEqual,
+ buttonIcons: isBoolComplexEqual,
+ };
+ function isBoolComplexEqual(a, b) {
+ if (typeof a === 'object' && typeof b === 'object' && a && b) { // both non-null objects
+ return isPropsEqual(a, b);
+ }
+ return a === b;
+ }
+ // view-specific options
+ // ---------------------
+ var VIEW_OPTION_REFINERS = {
+ type: String,
+ component: identity,
+ buttonText: String,
+ buttonTextKey: String,
+ dateProfileGeneratorClass: identity,
+ usesMinMaxTime: Boolean,
+ classNames: identity,
+ content: identity,
+ didMount: identity,
+ willUnmount: identity,
+ };
+ // util funcs
+ // ----------------------------------------------------------------------------------------------------
+ function mergeRawOptions(optionSets) {
+ return mergeProps(optionSets, COMPLEX_OPTION_COMPARATORS);
+ }
+ function refineProps(input, refiners) {
+ var refined = {};
+ var extra = {};
+ for (var propName in refiners) {
+ if (propName in input) {
+ refined[propName] = refiners[propName](input[propName]);
+ }
+ }
+ for (var propName in input) {
+ if (!(propName in refiners)) {
+ extra[propName] = input[propName];
+ }
+ }
+ return { refined: refined, extra: extra };
+ }
+ function identity(raw) {
+ return raw;
+ }
+
+ function parseEvents(rawEvents, eventSource, context, allowOpenRange) {
+ var eventStore = createEmptyEventStore();
+ var eventRefiners = buildEventRefiners(context);
+ for (var _i = 0, rawEvents_1 = rawEvents; _i < rawEvents_1.length; _i++) {
+ var rawEvent = rawEvents_1[_i];
+ var tuple = parseEvent(rawEvent, eventSource, context, allowOpenRange, eventRefiners);
+ if (tuple) {
+ eventTupleToStore(tuple, eventStore);
+ }
+ }
+ return eventStore;
+ }
+ function eventTupleToStore(tuple, eventStore) {
+ if (eventStore === void 0) { eventStore = createEmptyEventStore(); }
+ eventStore.defs[tuple.def.defId] = tuple.def;
+ if (tuple.instance) {
+ eventStore.instances[tuple.instance.instanceId] = tuple.instance;
+ }
+ return eventStore;
+ }
+ // retrieves events that have the same groupId as the instance specified by `instanceId`
+ // or they are the same as the instance.
+ // why might instanceId not be in the store? an event from another calendar?
+ function getRelevantEvents(eventStore, instanceId) {
+ var instance = eventStore.instances[instanceId];
+ if (instance) {
+ var def_1 = eventStore.defs[instance.defId];
+ // get events/instances with same group
+ var newStore = filterEventStoreDefs(eventStore, function (lookDef) { return isEventDefsGrouped(def_1, lookDef); });
+ // add the original
+ // TODO: wish we could use eventTupleToStore or something like it
+ newStore.defs[def_1.defId] = def_1;
+ newStore.instances[instance.instanceId] = instance;
+ return newStore;
+ }
+ return createEmptyEventStore();
+ }
+ function isEventDefsGrouped(def0, def1) {
+ return Boolean(def0.groupId && def0.groupId === def1.groupId);
+ }
+ function createEmptyEventStore() {
+ return { defs: {}, instances: {} };
+ }
+ function mergeEventStores(store0, store1) {
+ return {
+ defs: __assign(__assign({}, store0.defs), store1.defs),
+ instances: __assign(__assign({}, store0.instances), store1.instances),
+ };
+ }
+ function filterEventStoreDefs(eventStore, filterFunc) {
+ var defs = filterHash(eventStore.defs, filterFunc);
+ var instances = filterHash(eventStore.instances, function (instance) { return (defs[instance.defId] // still exists?
+ ); });
+ return { defs: defs, instances: instances };
+ }
+ function excludeSubEventStore(master, sub) {
+ var defs = master.defs, instances = master.instances;
+ var filteredDefs = {};
+ var filteredInstances = {};
+ for (var defId in defs) {
+ if (!sub.defs[defId]) { // not explicitly excluded
+ filteredDefs[defId] = defs[defId];
+ }
+ }
+ for (var instanceId in instances) {
+ if (!sub.instances[instanceId] && // not explicitly excluded
+ filteredDefs[instances[instanceId].defId] // def wasn't filtered away
+ ) {
+ filteredInstances[instanceId] = instances[instanceId];
+ }
+ }
+ return {
+ defs: filteredDefs,
+ instances: filteredInstances,
+ };
+ }
+
+ function normalizeConstraint(input, context) {
+ if (Array.isArray(input)) {
+ return parseEvents(input, null, context, true); // allowOpenRange=true
+ }
+ if (typeof input === 'object' && input) { // non-null object
+ return parseEvents([input], null, context, true); // allowOpenRange=true
+ }
+ if (input != null) {
+ return String(input);
+ }
+ return null;
+ }
+
+ function parseClassNames(raw) {
+ if (Array.isArray(raw)) {
+ return raw;
+ }
+ if (typeof raw === 'string') {
+ return raw.split(/\s+/);
+ }
+ return [];
+ }
+
+ // TODO: better called "EventSettings" or "EventConfig"
+ // TODO: move this file into structs
+ // TODO: separate constraint/overlap/allow, because selection uses only that, not other props
+ var EVENT_UI_REFINERS = {
+ display: String,
+ editable: Boolean,
+ startEditable: Boolean,
+ durationEditable: Boolean,
+ constraint: identity,
+ overlap: identity,
+ allow: identity,
+ className: parseClassNames,
+ classNames: parseClassNames,
+ color: String,
+ backgroundColor: String,
+ borderColor: String,
+ textColor: String,
+ };
+ var EMPTY_EVENT_UI = {
+ display: null,
+ startEditable: null,
+ durationEditable: null,
+ constraints: [],
+ overlap: null,
+ allows: [],
+ backgroundColor: '',
+ borderColor: '',
+ textColor: '',
+ classNames: [],
+ };
+ function createEventUi(refined, context) {
+ var constraint = normalizeConstraint(refined.constraint, context);
+ return {
+ display: refined.display || null,
+ startEditable: refined.startEditable != null ? refined.startEditable : refined.editable,
+ durationEditable: refined.durationEditable != null ? refined.durationEditable : refined.editable,
+ constraints: constraint != null ? [constraint] : [],
+ overlap: refined.overlap != null ? refined.overlap : null,
+ allows: refined.allow != null ? [refined.allow] : [],
+ backgroundColor: refined.backgroundColor || refined.color || '',
+ borderColor: refined.borderColor || refined.color || '',
+ textColor: refined.textColor || '',
+ classNames: (refined.className || []).concat(refined.classNames || []), // join singular and plural
+ };
+ }
+ // TODO: prevent against problems with <2 args!
+ function combineEventUis(uis) {
+ return uis.reduce(combineTwoEventUis, EMPTY_EVENT_UI);
+ }
+ function combineTwoEventUis(item0, item1) {
+ return {
+ display: item1.display != null ? item1.display : item0.display,
+ startEditable: item1.startEditable != null ? item1.startEditable : item0.startEditable,
+ durationEditable: item1.durationEditable != null ? item1.durationEditable : item0.durationEditable,
+ constraints: item0.constraints.concat(item1.constraints),
+ overlap: typeof item1.overlap === 'boolean' ? item1.overlap : item0.overlap,
+ allows: item0.allows.concat(item1.allows),
+ backgroundColor: item1.backgroundColor || item0.backgroundColor,
+ borderColor: item1.borderColor || item0.borderColor,
+ textColor: item1.textColor || item0.textColor,
+ classNames: item0.classNames.concat(item1.classNames),
+ };
+ }
+
+ var EVENT_NON_DATE_REFINERS = {
+ id: String,
+ groupId: String,
+ title: String,
+ url: String,
+ };
+ var EVENT_DATE_REFINERS = {
+ start: identity,
+ end: identity,
+ date: identity,
+ allDay: Boolean,
+ };
+ var EVENT_REFINERS$1 = __assign(__assign(__assign({}, EVENT_NON_DATE_REFINERS), EVENT_DATE_REFINERS), { extendedProps: identity });
+ function parseEvent(raw, eventSource, context, allowOpenRange, refiners) {
+ if (refiners === void 0) { refiners = buildEventRefiners(context); }
+ var _a = refineEventDef(raw, context, refiners), refined = _a.refined, extra = _a.extra;
+ var defaultAllDay = computeIsDefaultAllDay(eventSource, context);
+ var recurringRes = parseRecurring(refined, defaultAllDay, context.dateEnv, context.pluginHooks.recurringTypes);
+ if (recurringRes) {
+ var def = parseEventDef(refined, extra, eventSource ? eventSource.sourceId : '', recurringRes.allDay, Boolean(recurringRes.duration), context);
+ def.recurringDef = {
+ typeId: recurringRes.typeId,
+ typeData: recurringRes.typeData,
+ duration: recurringRes.duration,
+ };
+ return { def: def, instance: null };
+ }
+ var singleRes = parseSingle(refined, defaultAllDay, context, allowOpenRange);
+ if (singleRes) {
+ var def = parseEventDef(refined, extra, eventSource ? eventSource.sourceId : '', singleRes.allDay, singleRes.hasEnd, context);
+ var instance = createEventInstance(def.defId, singleRes.range, singleRes.forcedStartTzo, singleRes.forcedEndTzo);
+ return { def: def, instance: instance };
+ }
+ return null;
+ }
+ function refineEventDef(raw, context, refiners) {
+ if (refiners === void 0) { refiners = buildEventRefiners(context); }
+ return refineProps(raw, refiners);
+ }
+ function buildEventRefiners(context) {
+ return __assign(__assign(__assign({}, EVENT_UI_REFINERS), EVENT_REFINERS$1), context.pluginHooks.eventRefiners);
+ }
+ /*
+ Will NOT populate extendedProps with the leftover properties.
+ Will NOT populate date-related props.
+ */
+ function parseEventDef(refined, extra, sourceId, allDay, hasEnd, context) {
+ var def = {
+ title: refined.title || '',
+ groupId: refined.groupId || '',
+ publicId: refined.id || '',
+ url: refined.url || '',
+ recurringDef: null,
+ defId: guid(),
+ sourceId: sourceId,
+ allDay: allDay,
+ hasEnd: hasEnd,
+ ui: createEventUi(refined, context),
+ extendedProps: __assign(__assign({}, (refined.extendedProps || {})), extra),
+ };
+ for (var _i = 0, _a = context.pluginHooks.eventDefMemberAdders; _i < _a.length; _i++) {
+ var memberAdder = _a[_i];
+ __assign(def, memberAdder(refined));
+ }
+ // help out EventApi from having user modify props
+ Object.freeze(def.ui.classNames);
+ Object.freeze(def.extendedProps);
+ return def;
+ }
+ function parseSingle(refined, defaultAllDay, context, allowOpenRange) {
+ var allDay = refined.allDay;
+ var startMeta;
+ var startMarker = null;
+ var hasEnd = false;
+ var endMeta;
+ var endMarker = null;
+ var startInput = refined.start != null ? refined.start : refined.date;
+ startMeta = context.dateEnv.createMarkerMeta(startInput);
+ if (startMeta) {
+ startMarker = startMeta.marker;
+ }
+ else if (!allowOpenRange) {
+ return null;
+ }
+ if (refined.end != null) {
+ endMeta = context.dateEnv.createMarkerMeta(refined.end);
+ }
+ if (allDay == null) {
+ if (defaultAllDay != null) {
+ allDay = defaultAllDay;
+ }
+ else {
+ // fall back to the date props LAST
+ allDay = (!startMeta || startMeta.isTimeUnspecified) &&
+ (!endMeta || endMeta.isTimeUnspecified);
+ }
+ }
+ if (allDay && startMarker) {
+ startMarker = startOfDay(startMarker);
+ }
+ if (endMeta) {
+ endMarker = endMeta.marker;
+ if (allDay) {
+ endMarker = startOfDay(endMarker);
+ }
+ if (startMarker && endMarker <= startMarker) {
+ endMarker = null;
+ }
+ }
+ if (endMarker) {
+ hasEnd = true;
+ }
+ else if (!allowOpenRange) {
+ hasEnd = context.options.forceEventDuration || false;
+ endMarker = context.dateEnv.add(startMarker, allDay ?
+ context.options.defaultAllDayEventDuration :
+ context.options.defaultTimedEventDuration);
+ }
+ return {
+ allDay: allDay,
+ hasEnd: hasEnd,
+ range: { start: startMarker, end: endMarker },
+ forcedStartTzo: startMeta ? startMeta.forcedTzo : null,
+ forcedEndTzo: endMeta ? endMeta.forcedTzo : null,
+ };
+ }
+ function computeIsDefaultAllDay(eventSource, context) {
+ var res = null;
+ if (eventSource) {
+ res = eventSource.defaultAllDay;
+ }
+ if (res == null) {
+ res = context.options.defaultAllDay;
+ }
+ return res;
+ }
+
+ /* Date stuff that doesn't belong in datelib core
+ ----------------------------------------------------------------------------------------------------------------------*/
+ // given a timed range, computes an all-day range that has the same exact duration,
+ // but whose start time is aligned with the start of the day.
+ function computeAlignedDayRange(timedRange) {
+ var dayCnt = Math.floor(diffDays(timedRange.start, timedRange.end)) || 1;
+ var start = startOfDay(timedRange.start);
+ var end = addDays(start, dayCnt);
+ return { start: start, end: end };
+ }
+ // given a timed range, computes an all-day range based on how for the end date bleeds into the next day
+ // TODO: give nextDayThreshold a default arg
+ function computeVisibleDayRange(timedRange, nextDayThreshold) {
+ if (nextDayThreshold === void 0) { nextDayThreshold = createDuration(0); }
+ var startDay = null;
+ var endDay = null;
+ if (timedRange.end) {
+ endDay = startOfDay(timedRange.end);
+ var endTimeMS = timedRange.end.valueOf() - endDay.valueOf(); // # of milliseconds into `endDay`
+ // If the end time is actually inclusively part of the next day and is equal to or
+ // beyond the next day threshold, adjust the end to be the exclusive end of `endDay`.
+ // Otherwise, leaving it as inclusive will cause it to exclude `endDay`.
+ if (endTimeMS && endTimeMS >= asRoughMs(nextDayThreshold)) {
+ endDay = addDays(endDay, 1);
+ }
+ }
+ if (timedRange.start) {
+ startDay = startOfDay(timedRange.start); // the beginning of the day the range starts
+ // If end is within `startDay` but not past nextDayThreshold, assign the default duration of one day.
+ if (endDay && endDay <= startDay) {
+ endDay = addDays(startDay, 1);
+ }
+ }
+ return { start: startDay, end: endDay };
+ }
+ // spans from one day into another?
+ function isMultiDayRange(range) {
+ var visibleRange = computeVisibleDayRange(range);
+ return diffDays(visibleRange.start, visibleRange.end) > 1;
+ }
+ function diffDates(date0, date1, dateEnv, largeUnit) {
+ if (largeUnit === 'year') {
+ return createDuration(dateEnv.diffWholeYears(date0, date1), 'year');
+ }
+ if (largeUnit === 'month') {
+ return createDuration(dateEnv.diffWholeMonths(date0, date1), 'month');
+ }
+ return diffDayAndTime(date0, date1); // returns a duration
+ }
+
+ function parseRange(input, dateEnv) {
+ var start = null;
+ var end = null;
+ if (input.start) {
+ start = dateEnv.createMarker(input.start);
+ }
+ if (input.end) {
+ end = dateEnv.createMarker(input.end);
+ }
+ if (!start && !end) {
+ return null;
+ }
+ if (start && end && end < start) {
+ return null;
+ }
+ return { start: start, end: end };
+ }
+ // SIDE-EFFECT: will mutate ranges.
+ // Will return a new array result.
+ function invertRanges(ranges, constraintRange) {
+ var invertedRanges = [];
+ var start = constraintRange.start; // the end of the previous range. the start of the new range
+ var i;
+ var dateRange;
+ // ranges need to be in order. required for our date-walking algorithm
+ ranges.sort(compareRanges);
+ for (i = 0; i < ranges.length; i += 1) {
+ dateRange = ranges[i];
+ // add the span of time before the event (if there is any)
+ if (dateRange.start > start) { // compare millisecond time (skip any ambig logic)
+ invertedRanges.push({ start: start, end: dateRange.start });
+ }
+ if (dateRange.end > start) {
+ start = dateRange.end;
+ }
+ }
+ // add the span of time after the last event (if there is any)
+ if (start < constraintRange.end) { // compare millisecond time (skip any ambig logic)
+ invertedRanges.push({ start: start, end: constraintRange.end });
+ }
+ return invertedRanges;
+ }
+ function compareRanges(range0, range1) {
+ return range0.start.valueOf() - range1.start.valueOf(); // earlier ranges go first
+ }
+ function intersectRanges(range0, range1) {
+ var start = range0.start, end = range0.end;
+ var newRange = null;
+ if (range1.start !== null) {
+ if (start === null) {
+ start = range1.start;
+ }
+ else {
+ start = new Date(Math.max(start.valueOf(), range1.start.valueOf()));
+ }
+ }
+ if (range1.end != null) {
+ if (end === null) {
+ end = range1.end;
+ }
+ else {
+ end = new Date(Math.min(end.valueOf(), range1.end.valueOf()));
+ }
+ }
+ if (start === null || end === null || start < end) {
+ newRange = { start: start, end: end };
+ }
+ return newRange;
+ }
+ function rangesEqual(range0, range1) {
+ return (range0.start === null ? null : range0.start.valueOf()) === (range1.start === null ? null : range1.start.valueOf()) &&
+ (range0.end === null ? null : range0.end.valueOf()) === (range1.end === null ? null : range1.end.valueOf());
+ }
+ function rangesIntersect(range0, range1) {
+ return (range0.end === null || range1.start === null || range0.end > range1.start) &&
+ (range0.start === null || range1.end === null || range0.start < range1.end);
+ }
+ function rangeContainsRange(outerRange, innerRange) {
+ return (outerRange.start === null || (innerRange.start !== null && innerRange.start >= outerRange.start)) &&
+ (outerRange.end === null || (innerRange.end !== null && innerRange.end <= outerRange.end));
+ }
+ function rangeContainsMarker(range, date) {
+ return (range.start === null || date >= range.start) &&
+ (range.end === null || date < range.end);
+ }
+ // If the given date is not within the given range, move it inside.
+ // (If it's past the end, make it one millisecond before the end).
+ function constrainMarkerToRange(date, range) {
+ if (range.start != null && date < range.start) {
+ return range.start;
+ }
+ if (range.end != null && date >= range.end) {
+ return new Date(range.end.valueOf() - 1);
+ }
+ return date;
+ }
+
+ /*
+ Specifying nextDayThreshold signals that all-day ranges should be sliced.
+ */
+ function sliceEventStore(eventStore, eventUiBases, framingRange, nextDayThreshold) {
+ var inverseBgByGroupId = {};
+ var inverseBgByDefId = {};
+ var defByGroupId = {};
+ var bgRanges = [];
+ var fgRanges = [];
+ var eventUis = compileEventUis(eventStore.defs, eventUiBases);
+ for (var defId in eventStore.defs) {
+ var def = eventStore.defs[defId];
+ var ui = eventUis[def.defId];
+ if (ui.display === 'inverse-background') {
+ if (def.groupId) {
+ inverseBgByGroupId[def.groupId] = [];
+ if (!defByGroupId[def.groupId]) {
+ defByGroupId[def.groupId] = def;
+ }
+ }
+ else {
+ inverseBgByDefId[defId] = [];
+ }
+ }
+ }
+ for (var instanceId in eventStore.instances) {
+ var instance = eventStore.instances[instanceId];
+ var def = eventStore.defs[instance.defId];
+ var ui = eventUis[def.defId];
+ var origRange = instance.range;
+ var normalRange = (!def.allDay && nextDayThreshold) ?
+ computeVisibleDayRange(origRange, nextDayThreshold) :
+ origRange;
+ var slicedRange = intersectRanges(normalRange, framingRange);
+ if (slicedRange) {
+ if (ui.display === 'inverse-background') {
+ if (def.groupId) {
+ inverseBgByGroupId[def.groupId].push(slicedRange);
+ }
+ else {
+ inverseBgByDefId[instance.defId].push(slicedRange);
+ }
+ }
+ else if (ui.display !== 'none') {
+ (ui.display === 'background' ? bgRanges : fgRanges).push({
+ def: def,
+ ui: ui,
+ instance: instance,
+ range: slicedRange,
+ isStart: normalRange.start && normalRange.start.valueOf() === slicedRange.start.valueOf(),
+ isEnd: normalRange.end && normalRange.end.valueOf() === slicedRange.end.valueOf(),
+ });
+ }
+ }
+ }
+ for (var groupId in inverseBgByGroupId) { // BY GROUP
+ var ranges = inverseBgByGroupId[groupId];
+ var invertedRanges = invertRanges(ranges, framingRange);
+ for (var _i = 0, invertedRanges_1 = invertedRanges; _i < invertedRanges_1.length; _i++) {
+ var invertedRange = invertedRanges_1[_i];
+ var def = defByGroupId[groupId];
+ var ui = eventUis[def.defId];
+ bgRanges.push({
+ def: def,
+ ui: ui,
+ instance: null,
+ range: invertedRange,
+ isStart: false,
+ isEnd: false,
+ });
+ }
+ }
+ for (var defId in inverseBgByDefId) {
+ var ranges = inverseBgByDefId[defId];
+ var invertedRanges = invertRanges(ranges, framingRange);
+ for (var _a = 0, invertedRanges_2 = invertedRanges; _a < invertedRanges_2.length; _a++) {
+ var invertedRange = invertedRanges_2[_a];
+ bgRanges.push({
+ def: eventStore.defs[defId],
+ ui: eventUis[defId],
+ instance: null,
+ range: invertedRange,
+ isStart: false,
+ isEnd: false,
+ });
+ }
+ }
+ return { bg: bgRanges, fg: fgRanges };
+ }
+ function hasBgRendering(def) {
+ return def.ui.display === 'background' || def.ui.display === 'inverse-background';
+ }
+ function setElSeg(el, seg) {
+ el.fcSeg = seg;
+ }
+ function getElSeg(el) {
+ return el.fcSeg ||
+ el.parentNode.fcSeg || // for the harness
+ null;
+ }
+ // event ui computation
+ function compileEventUis(eventDefs, eventUiBases) {
+ return mapHash(eventDefs, function (eventDef) { return compileEventUi(eventDef, eventUiBases); });
+ }
+ function compileEventUi(eventDef, eventUiBases) {
+ var uis = [];
+ if (eventUiBases['']) {
+ uis.push(eventUiBases['']);
+ }
+ if (eventUiBases[eventDef.defId]) {
+ uis.push(eventUiBases[eventDef.defId]);
+ }
+ uis.push(eventDef.ui);
+ return combineEventUis(uis);
+ }
+ function sortEventSegs(segs, eventOrderSpecs) {
+ var objs = segs.map(buildSegCompareObj);
+ objs.sort(function (obj0, obj1) { return compareByFieldSpecs(obj0, obj1, eventOrderSpecs); });
+ return objs.map(function (c) { return c._seg; });
+ }
+ // returns a object with all primitive props that can be compared
+ function buildSegCompareObj(seg) {
+ var eventRange = seg.eventRange;
+ var eventDef = eventRange.def;
+ var range = eventRange.instance ? eventRange.instance.range : eventRange.range;
+ var start = range.start ? range.start.valueOf() : 0; // TODO: better support for open-range events
+ var end = range.end ? range.end.valueOf() : 0; // "
+ return __assign(__assign(__assign({}, eventDef.extendedProps), eventDef), { id: eventDef.publicId, start: start,
+ end: end, duration: end - start, allDay: Number(eventDef.allDay), _seg: seg });
+ }
+ function computeSegDraggable(seg, context) {
+ var pluginHooks = context.pluginHooks;
+ var transformers = pluginHooks.isDraggableTransformers;
+ var _a = seg.eventRange, def = _a.def, ui = _a.ui;
+ var val = ui.startEditable;
+ for (var _i = 0, transformers_1 = transformers; _i < transformers_1.length; _i++) {
+ var transformer = transformers_1[_i];
+ val = transformer(val, def, ui, context);
+ }
+ return val;
+ }
+ function computeSegStartResizable(seg, context) {
+ return seg.isStart && seg.eventRange.ui.durationEditable && context.options.eventResizableFromStart;
+ }
+ function computeSegEndResizable(seg, context) {
+ return seg.isEnd && seg.eventRange.ui.durationEditable;
+ }
+ function buildSegTimeText(seg, timeFormat, context, defaultDisplayEventTime, // defaults to true
+ defaultDisplayEventEnd, // defaults to true
+ startOverride, endOverride) {
+ var dateEnv = context.dateEnv, options = context.options;
+ var displayEventTime = options.displayEventTime, displayEventEnd = options.displayEventEnd;
+ var eventDef = seg.eventRange.def;
+ var eventInstance = seg.eventRange.instance;
+ if (displayEventTime == null) {
+ displayEventTime = defaultDisplayEventTime !== false;
+ }
+ if (displayEventEnd == null) {
+ displayEventEnd = defaultDisplayEventEnd !== false;
+ }
+ var wholeEventStart = eventInstance.range.start;
+ var wholeEventEnd = eventInstance.range.end;
+ var segStart = startOverride || seg.start || seg.eventRange.range.start;
+ var segEnd = endOverride || seg.end || seg.eventRange.range.end;
+ var isStartDay = startOfDay(wholeEventStart).valueOf() === startOfDay(segStart).valueOf();
+ var isEndDay = startOfDay(addMs(wholeEventEnd, -1)).valueOf() === startOfDay(addMs(segEnd, -1)).valueOf();
+ if (displayEventTime && !eventDef.allDay && (isStartDay || isEndDay)) {
+ segStart = isStartDay ? wholeEventStart : segStart;
+ segEnd = isEndDay ? wholeEventEnd : segEnd;
+ if (displayEventEnd && eventDef.hasEnd) {
+ return dateEnv.formatRange(segStart, segEnd, timeFormat, {
+ forcedStartTzo: startOverride ? null : eventInstance.forcedStartTzo,
+ forcedEndTzo: endOverride ? null : eventInstance.forcedEndTzo,
+ });
+ }
+ return dateEnv.format(segStart, timeFormat, {
+ forcedTzo: startOverride ? null : eventInstance.forcedStartTzo, // nooooo, same
+ });
+ }
+ return '';
+ }
+ function getSegMeta(seg, todayRange, nowDate) {
+ var segRange = seg.eventRange.range;
+ return {
+ isPast: segRange.end < (nowDate || todayRange.start),
+ isFuture: segRange.start >= (nowDate || todayRange.end),
+ isToday: todayRange && rangeContainsMarker(todayRange, segRange.start),
+ };
+ }
+ function getEventClassNames(props) {
+ var classNames = ['fc-event'];
+ if (props.isMirror) {
+ classNames.push('fc-event-mirror');
+ }
+ if (props.isDraggable) {
+ classNames.push('fc-event-draggable');
+ }
+ if (props.isStartResizable || props.isEndResizable) {
+ classNames.push('fc-event-resizable');
+ }
+ if (props.isDragging) {
+ classNames.push('fc-event-dragging');
+ }
+ if (props.isResizing) {
+ classNames.push('fc-event-resizing');
+ }
+ if (props.isSelected) {
+ classNames.push('fc-event-selected');
+ }
+ if (props.isStart) {
+ classNames.push('fc-event-start');
+ }
+ if (props.isEnd) {
+ classNames.push('fc-event-end');
+ }
+ if (props.isPast) {
+ classNames.push('fc-event-past');
+ }
+ if (props.isToday) {
+ classNames.push('fc-event-today');
+ }
+ if (props.isFuture) {
+ classNames.push('fc-event-future');
+ }
+ return classNames;
+ }
+ function buildEventRangeKey(eventRange) {
+ return eventRange.instance
+ ? eventRange.instance.instanceId
+ : eventRange.def.defId + ":" + eventRange.range.start.toISOString();
+ // inverse-background events don't have specific instances. TODO: better solution
+ }
+
+ var STANDARD_PROPS = {
+ start: identity,
+ end: identity,
+ allDay: Boolean,
+ };
+ function parseDateSpan(raw, dateEnv, defaultDuration) {
+ var span = parseOpenDateSpan(raw, dateEnv);
+ var range = span.range;
+ if (!range.start) {
+ return null;
+ }
+ if (!range.end) {
+ if (defaultDuration == null) {
+ return null;
+ }
+ range.end = dateEnv.add(range.start, defaultDuration);
+ }
+ return span;
+ }
+ /*
+ TODO: somehow combine with parseRange?
+ Will return null if the start/end props were present but parsed invalidly.
+ */
+ function parseOpenDateSpan(raw, dateEnv) {
+ var _a = refineProps(raw, STANDARD_PROPS), standardProps = _a.refined, extra = _a.extra;
+ var startMeta = standardProps.start ? dateEnv.createMarkerMeta(standardProps.start) : null;
+ var endMeta = standardProps.end ? dateEnv.createMarkerMeta(standardProps.end) : null;
+ var allDay = standardProps.allDay;
+ if (allDay == null) {
+ allDay = (startMeta && startMeta.isTimeUnspecified) &&
+ (!endMeta || endMeta.isTimeUnspecified);
+ }
+ return __assign({ range: {
+ start: startMeta ? startMeta.marker : null,
+ end: endMeta ? endMeta.marker : null,
+ }, allDay: allDay }, extra);
+ }
+ function isDateSpansEqual(span0, span1) {
+ return rangesEqual(span0.range, span1.range) &&
+ span0.allDay === span1.allDay &&
+ isSpanPropsEqual(span0, span1);
+ }
+ // the NON-DATE-RELATED props
+ function isSpanPropsEqual(span0, span1) {
+ for (var propName in span1) {
+ if (propName !== 'range' && propName !== 'allDay') {
+ if (span0[propName] !== span1[propName]) {
+ return false;
+ }
+ }
+ }
+ // are there any props that span0 has that span1 DOESN'T have?
+ // both have range/allDay, so no need to special-case.
+ for (var propName in span0) {
+ if (!(propName in span1)) {
+ return false;
+ }
+ }
+ return true;
+ }
+ function buildDateSpanApi(span, dateEnv) {
+ return __assign(__assign({}, buildRangeApi(span.range, dateEnv, span.allDay)), { allDay: span.allDay });
+ }
+ function buildRangeApiWithTimeZone(range, dateEnv, omitTime) {
+ return __assign(__assign({}, buildRangeApi(range, dateEnv, omitTime)), { timeZone: dateEnv.timeZone });
+ }
+ function buildRangeApi(range, dateEnv, omitTime) {
+ return {
+ start: dateEnv.toDate(range.start),
+ end: dateEnv.toDate(range.end),
+ startStr: dateEnv.formatIso(range.start, { omitTime: omitTime }),
+ endStr: dateEnv.formatIso(range.end, { omitTime: omitTime }),
+ };
+ }
+ function fabricateEventRange(dateSpan, eventUiBases, context) {
+ var res = refineEventDef({ editable: false }, context);
+ var def = parseEventDef(res.refined, res.extra, '', // sourceId
+ dateSpan.allDay, true, // hasEnd
+ context);
+ return {
+ def: def,
+ ui: compileEventUi(def, eventUiBases),
+ instance: createEventInstance(def.defId, dateSpan.range),
+ range: dateSpan.range,
+ isStart: true,
+ isEnd: true,
+ };
+ }
+
+ function triggerDateSelect(selection, pev, context) {
+ context.emitter.trigger('select', __assign(__assign({}, buildDateSpanApiWithContext(selection, context)), { jsEvent: pev ? pev.origEvent : null, view: context.viewApi || context.calendarApi.view }));
+ }
+ function triggerDateUnselect(pev, context) {
+ context.emitter.trigger('unselect', {
+ jsEvent: pev ? pev.origEvent : null,
+ view: context.viewApi || context.calendarApi.view,
+ });
+ }
+ function buildDateSpanApiWithContext(dateSpan, context) {
+ var props = {};
+ for (var _i = 0, _a = context.pluginHooks.dateSpanTransforms; _i < _a.length; _i++) {
+ var transform = _a[_i];
+ __assign(props, transform(dateSpan, context));
+ }
+ __assign(props, buildDateSpanApi(dateSpan, context.dateEnv));
+ return props;
+ }
+ // Given an event's allDay status and start date, return what its fallback end date should be.
+ // TODO: rename to computeDefaultEventEnd
+ function getDefaultEventEnd(allDay, marker, context) {
+ var dateEnv = context.dateEnv, options = context.options;
+ var end = marker;
+ if (allDay) {
+ end = startOfDay(end);
+ end = dateEnv.add(end, options.defaultAllDayEventDuration);
+ }
+ else {
+ end = dateEnv.add(end, options.defaultTimedEventDuration);
+ }
+ return end;
+ }
+
+ // applies the mutation to ALL defs/instances within the event store
+ function applyMutationToEventStore(eventStore, eventConfigBase, mutation, context) {
+ var eventConfigs = compileEventUis(eventStore.defs, eventConfigBase);
+ var dest = createEmptyEventStore();
+ for (var defId in eventStore.defs) {
+ var def = eventStore.defs[defId];
+ dest.defs[defId] = applyMutationToEventDef(def, eventConfigs[defId], mutation, context);
+ }
+ for (var instanceId in eventStore.instances) {
+ var instance = eventStore.instances[instanceId];
+ var def = dest.defs[instance.defId]; // important to grab the newly modified def
+ dest.instances[instanceId] = applyMutationToEventInstance(instance, def, eventConfigs[instance.defId], mutation, context);
+ }
+ return dest;
+ }
+ function applyMutationToEventDef(eventDef, eventConfig, mutation, context) {
+ var standardProps = mutation.standardProps || {};
+ // if hasEnd has not been specified, guess a good value based on deltas.
+ // if duration will change, there's no way the default duration will persist,
+ // and thus, we need to mark the event as having a real end
+ if (standardProps.hasEnd == null &&
+ eventConfig.durationEditable &&
+ (mutation.startDelta || mutation.endDelta)) {
+ standardProps.hasEnd = true; // TODO: is this mutation okay?
+ }
+ var copy = __assign(__assign(__assign({}, eventDef), standardProps), { ui: __assign(__assign({}, eventDef.ui), standardProps.ui) });
+ if (mutation.extendedProps) {
+ copy.extendedProps = __assign(__assign({}, copy.extendedProps), mutation.extendedProps);
+ }
+ for (var _i = 0, _a = context.pluginHooks.eventDefMutationAppliers; _i < _a.length; _i++) {
+ var applier = _a[_i];
+ applier(copy, mutation, context);
+ }
+ if (!copy.hasEnd && context.options.forceEventDuration) {
+ copy.hasEnd = true;
+ }
+ return copy;
+ }
+ function applyMutationToEventInstance(eventInstance, eventDef, // must first be modified by applyMutationToEventDef
+ eventConfig, mutation, context) {
+ var dateEnv = context.dateEnv;
+ var forceAllDay = mutation.standardProps && mutation.standardProps.allDay === true;
+ var clearEnd = mutation.standardProps && mutation.standardProps.hasEnd === false;
+ var copy = __assign({}, eventInstance);
+ if (forceAllDay) {
+ copy.range = computeAlignedDayRange(copy.range);
+ }
+ if (mutation.datesDelta && eventConfig.startEditable) {
+ copy.range = {
+ start: dateEnv.add(copy.range.start, mutation.datesDelta),
+ end: dateEnv.add(copy.range.end, mutation.datesDelta),
+ };
+ }
+ if (mutation.startDelta && eventConfig.durationEditable) {
+ copy.range = {
+ start: dateEnv.add(copy.range.start, mutation.startDelta),
+ end: copy.range.end,
+ };
+ }
+ if (mutation.endDelta && eventConfig.durationEditable) {
+ copy.range = {
+ start: copy.range.start,
+ end: dateEnv.add(copy.range.end, mutation.endDelta),
+ };
+ }
+ if (clearEnd) {
+ copy.range = {
+ start: copy.range.start,
+ end: getDefaultEventEnd(eventDef.allDay, copy.range.start, context),
+ };
+ }
+ // in case event was all-day but the supplied deltas were not
+ // better util for this?
+ if (eventDef.allDay) {
+ copy.range = {
+ start: startOfDay(copy.range.start),
+ end: startOfDay(copy.range.end),
+ };
+ }
+ // handle invalid durations
+ if (copy.range.end < copy.range.start) {
+ copy.range.end = getDefaultEventEnd(eventDef.allDay, copy.range.start, context);
+ }
+ return copy;
+ }
+
+ // no public types yet. when there are, export from:
+ // import {} from './api-type-deps'
+ var ViewApi = /** @class */ (function () {
+ function ViewApi(type, getCurrentData, dateEnv) {
+ this.type = type;
+ this.getCurrentData = getCurrentData;
+ this.dateEnv = dateEnv;
+ }
+ Object.defineProperty(ViewApi.prototype, "calendar", {
+ get: function () {
+ return this.getCurrentData().calendarApi;
+ },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(ViewApi.prototype, "title", {
+ get: function () {
+ return this.getCurrentData().viewTitle;
+ },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(ViewApi.prototype, "activeStart", {
+ get: function () {
+ return this.dateEnv.toDate(this.getCurrentData().dateProfile.activeRange.start);
+ },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(ViewApi.prototype, "activeEnd", {
+ get: function () {
+ return this.dateEnv.toDate(this.getCurrentData().dateProfile.activeRange.end);
+ },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(ViewApi.prototype, "currentStart", {
+ get: function () {
+ return this.dateEnv.toDate(this.getCurrentData().dateProfile.currentRange.start);
+ },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(ViewApi.prototype, "currentEnd", {
+ get: function () {
+ return this.dateEnv.toDate(this.getCurrentData().dateProfile.currentRange.end);
+ },
+ enumerable: false,
+ configurable: true
+ });
+ ViewApi.prototype.getOption = function (name) {
+ return this.getCurrentData().options[name]; // are the view-specific options
+ };
+ return ViewApi;
+ }());
+
+ var EVENT_SOURCE_REFINERS$1 = {
+ id: String,
+ defaultAllDay: Boolean,
+ url: String,
+ format: String,
+ events: identity,
+ eventDataTransform: identity,
+ // for any network-related sources
+ success: identity,
+ failure: identity,
+ };
+ function parseEventSource(raw, context, refiners) {
+ if (refiners === void 0) { refiners = buildEventSourceRefiners(context); }
+ var rawObj;
+ if (typeof raw === 'string') {
+ rawObj = { url: raw };
+ }
+ else if (typeof raw === 'function' || Array.isArray(raw)) {
+ rawObj = { events: raw };
+ }
+ else if (typeof raw === 'object' && raw) { // not null
+ rawObj = raw;
+ }
+ if (rawObj) {
+ var _a = refineProps(rawObj, refiners), refined = _a.refined, extra = _a.extra;
+ var metaRes = buildEventSourceMeta(refined, context);
+ if (metaRes) {
+ return {
+ _raw: raw,
+ isFetching: false,
+ latestFetchId: '',
+ fetchRange: null,
+ defaultAllDay: refined.defaultAllDay,
+ eventDataTransform: refined.eventDataTransform,
+ success: refined.success,
+ failure: refined.failure,
+ publicId: refined.id || '',
+ sourceId: guid(),
+ sourceDefId: metaRes.sourceDefId,
+ meta: metaRes.meta,
+ ui: createEventUi(refined, context),
+ extendedProps: extra,
+ };
+ }
+ }
+ return null;
+ }
+ function buildEventSourceRefiners(context) {
+ return __assign(__assign(__assign({}, EVENT_UI_REFINERS), EVENT_SOURCE_REFINERS$1), context.pluginHooks.eventSourceRefiners);
+ }
+ function buildEventSourceMeta(raw, context) {
+ var defs = context.pluginHooks.eventSourceDefs;
+ for (var i = defs.length - 1; i >= 0; i -= 1) { // later-added plugins take precedence
+ var def = defs[i];
+ var meta = def.parseMeta(raw);
+ if (meta) {
+ return { sourceDefId: i, meta: meta };
+ }
+ }
+ return null;
+ }
+
+ function reduceCurrentDate(currentDate, action) {
+ switch (action.type) {
+ case 'CHANGE_DATE':
+ return action.dateMarker;
+ default:
+ return currentDate;
+ }
+ }
+ function getInitialDate(options, dateEnv) {
+ var initialDateInput = options.initialDate;
+ // compute the initial ambig-timezone date
+ if (initialDateInput != null) {
+ return dateEnv.createMarker(initialDateInput);
+ }
+ return getNow(options.now, dateEnv); // getNow already returns unzoned
+ }
+ function getNow(nowInput, dateEnv) {
+ if (typeof nowInput === 'function') {
+ nowInput = nowInput();
+ }
+ if (nowInput == null) {
+ return dateEnv.createNowMarker();
+ }
+ return dateEnv.createMarker(nowInput);
+ }
+
+ var CalendarApi = /** @class */ (function () {
+ function CalendarApi() {
+ }
+ CalendarApi.prototype.getCurrentData = function () {
+ return this.currentDataManager.getCurrentData();
+ };
+ CalendarApi.prototype.dispatch = function (action) {
+ return this.currentDataManager.dispatch(action);
+ };
+ Object.defineProperty(CalendarApi.prototype, "view", {
+ get: function () { return this.getCurrentData().viewApi; } // for public API
+ ,
+ enumerable: false,
+ configurable: true
+ });
+ CalendarApi.prototype.batchRendering = function (callback) {
+ callback();
+ };
+ CalendarApi.prototype.updateSize = function () {
+ this.trigger('_resize', true);
+ };
+ // Options
+ // -----------------------------------------------------------------------------------------------------------------
+ CalendarApi.prototype.setOption = function (name, val) {
+ this.dispatch({
+ type: 'SET_OPTION',
+ optionName: name,
+ rawOptionValue: val,
+ });
+ };
+ CalendarApi.prototype.getOption = function (name) {
+ return this.currentDataManager.currentCalendarOptionsInput[name];
+ };
+ CalendarApi.prototype.getAvailableLocaleCodes = function () {
+ return Object.keys(this.getCurrentData().availableRawLocales);
+ };
+ // Trigger
+ // -----------------------------------------------------------------------------------------------------------------
+ CalendarApi.prototype.on = function (handlerName, handler) {
+ var currentDataManager = this.currentDataManager;
+ if (currentDataManager.currentCalendarOptionsRefiners[handlerName]) {
+ currentDataManager.emitter.on(handlerName, handler);
+ }
+ else {
+ console.warn("Unknown listener name '" + handlerName + "'");
+ }
+ };
+ CalendarApi.prototype.off = function (handlerName, handler) {
+ this.currentDataManager.emitter.off(handlerName, handler);
+ };
+ // not meant for public use
+ CalendarApi.prototype.trigger = function (handlerName) {
+ var _a;
+ var args = [];
+ for (var _i = 1; _i < arguments.length; _i++) {
+ args[_i - 1] = arguments[_i];
+ }
+ (_a = this.currentDataManager.emitter).trigger.apply(_a, __spreadArray([handlerName], args));
+ };
+ // View
+ // -----------------------------------------------------------------------------------------------------------------
+ CalendarApi.prototype.changeView = function (viewType, dateOrRange) {
+ var _this = this;
+ this.batchRendering(function () {
+ _this.unselect();
+ if (dateOrRange) {
+ if (dateOrRange.start && dateOrRange.end) { // a range
+ _this.dispatch({
+ type: 'CHANGE_VIEW_TYPE',
+ viewType: viewType,
+ });
+ _this.dispatch({
+ type: 'SET_OPTION',
+ optionName: 'visibleRange',
+ rawOptionValue: dateOrRange,
+ });
+ }
+ else {
+ var dateEnv = _this.getCurrentData().dateEnv;
+ _this.dispatch({
+ type: 'CHANGE_VIEW_TYPE',
+ viewType: viewType,
+ dateMarker: dateEnv.createMarker(dateOrRange),
+ });
+ }
+ }
+ else {
+ _this.dispatch({
+ type: 'CHANGE_VIEW_TYPE',
+ viewType: viewType,
+ });
+ }
+ });
+ };
+ // Forces navigation to a view for the given date.
+ // `viewType` can be a specific view name or a generic one like "week" or "day".
+ // needs to change
+ CalendarApi.prototype.zoomTo = function (dateMarker, viewType) {
+ var state = this.getCurrentData();
+ var spec;
+ viewType = viewType || 'day'; // day is default zoom
+ spec = state.viewSpecs[viewType] || this.getUnitViewSpec(viewType);
+ this.unselect();
+ if (spec) {
+ this.dispatch({
+ type: 'CHANGE_VIEW_TYPE',
+ viewType: spec.type,
+ dateMarker: dateMarker,
+ });
+ }
+ else {
+ this.dispatch({
+ type: 'CHANGE_DATE',
+ dateMarker: dateMarker,
+ });
+ }
+ };
+ // Given a duration singular unit, like "week" or "day", finds a matching view spec.
+ // Preference is given to views that have corresponding buttons.
+ CalendarApi.prototype.getUnitViewSpec = function (unit) {
+ var _a = this.getCurrentData(), viewSpecs = _a.viewSpecs, toolbarConfig = _a.toolbarConfig;
+ var viewTypes = [].concat(toolbarConfig.viewsWithButtons);
+ var i;
+ var spec;
+ for (var viewType in viewSpecs) {
+ viewTypes.push(viewType);
+ }
+ for (i = 0; i < viewTypes.length; i += 1) {
+ spec = viewSpecs[viewTypes[i]];
+ if (spec) {
+ if (spec.singleUnit === unit) {
+ return spec;
+ }
+ }
+ }
+ return null;
+ };
+ // Current Date
+ // -----------------------------------------------------------------------------------------------------------------
+ CalendarApi.prototype.prev = function () {
+ this.unselect();
+ this.dispatch({ type: 'PREV' });
+ };
+ CalendarApi.prototype.next = function () {
+ this.unselect();
+ this.dispatch({ type: 'NEXT' });
+ };
+ CalendarApi.prototype.prevYear = function () {
+ var state = this.getCurrentData();
+ this.unselect();
+ this.dispatch({
+ type: 'CHANGE_DATE',
+ dateMarker: state.dateEnv.addYears(state.currentDate, -1),
+ });
+ };
+ CalendarApi.prototype.nextYear = function () {
+ var state = this.getCurrentData();
+ this.unselect();
+ this.dispatch({
+ type: 'CHANGE_DATE',
+ dateMarker: state.dateEnv.addYears(state.currentDate, 1),
+ });
+ };
+ CalendarApi.prototype.today = function () {
+ var state = this.getCurrentData();
+ this.unselect();
+ this.dispatch({
+ type: 'CHANGE_DATE',
+ dateMarker: getNow(state.calendarOptions.now, state.dateEnv),
+ });
+ };
+ CalendarApi.prototype.gotoDate = function (zonedDateInput) {
+ var state = this.getCurrentData();
+ this.unselect();
+ this.dispatch({
+ type: 'CHANGE_DATE',
+ dateMarker: state.dateEnv.createMarker(zonedDateInput),
+ });
+ };
+ CalendarApi.prototype.incrementDate = function (deltaInput) {
+ var state = this.getCurrentData();
+ var delta = createDuration(deltaInput);
+ if (delta) { // else, warn about invalid input?
+ this.unselect();
+ this.dispatch({
+ type: 'CHANGE_DATE',
+ dateMarker: state.dateEnv.add(state.currentDate, delta),
+ });
+ }
+ };
+ // for external API
+ CalendarApi.prototype.getDate = function () {
+ var state = this.getCurrentData();
+ return state.dateEnv.toDate(state.currentDate);
+ };
+ // Date Formatting Utils
+ // -----------------------------------------------------------------------------------------------------------------
+ CalendarApi.prototype.formatDate = function (d, formatter) {
+ var dateEnv = this.getCurrentData().dateEnv;
+ return dateEnv.format(dateEnv.createMarker(d), createFormatter(formatter));
+ };
+ // `settings` is for formatter AND isEndExclusive
+ CalendarApi.prototype.formatRange = function (d0, d1, settings) {
+ var dateEnv = this.getCurrentData().dateEnv;
+ return dateEnv.formatRange(dateEnv.createMarker(d0), dateEnv.createMarker(d1), createFormatter(settings), settings);
+ };
+ CalendarApi.prototype.formatIso = function (d, omitTime) {
+ var dateEnv = this.getCurrentData().dateEnv;
+ return dateEnv.formatIso(dateEnv.createMarker(d), { omitTime: omitTime });
+ };
+ // Date Selection / Event Selection / DayClick
+ // -----------------------------------------------------------------------------------------------------------------
+ // this public method receives start/end dates in any format, with any timezone
+ // NOTE: args were changed from v3
+ CalendarApi.prototype.select = function (dateOrObj, endDate) {
+ var selectionInput;
+ if (endDate == null) {
+ if (dateOrObj.start != null) {
+ selectionInput = dateOrObj;
+ }
+ else {
+ selectionInput = {
+ start: dateOrObj,
+ end: null,
+ };
+ }
+ }
+ else {
+ selectionInput = {
+ start: dateOrObj,
+ end: endDate,
+ };
+ }
+ var state = this.getCurrentData();
+ var selection = parseDateSpan(selectionInput, state.dateEnv, createDuration({ days: 1 }));
+ if (selection) { // throw parse error otherwise?
+ this.dispatch({ type: 'SELECT_DATES', selection: selection });
+ triggerDateSelect(selection, null, state);
+ }
+ };
+ // public method
+ CalendarApi.prototype.unselect = function (pev) {
+ var state = this.getCurrentData();
+ if (state.dateSelection) {
+ this.dispatch({ type: 'UNSELECT_DATES' });
+ triggerDateUnselect(pev, state);
+ }
+ };
+ // Public Events API
+ // -----------------------------------------------------------------------------------------------------------------
+ CalendarApi.prototype.addEvent = function (eventInput, sourceInput) {
+ if (eventInput instanceof EventApi) {
+ var def = eventInput._def;
+ var instance = eventInput._instance;
+ var currentData = this.getCurrentData();
+ // not already present? don't want to add an old snapshot
+ if (!currentData.eventStore.defs[def.defId]) {
+ this.dispatch({
+ type: 'ADD_EVENTS',
+ eventStore: eventTupleToStore({ def: def, instance: instance }), // TODO: better util for two args?
+ });
+ this.triggerEventAdd(eventInput);
+ }
+ return eventInput;
+ }
+ var state = this.getCurrentData();
+ var eventSource;
+ if (sourceInput instanceof EventSourceApi) {
+ eventSource = sourceInput.internalEventSource;
+ }
+ else if (typeof sourceInput === 'boolean') {
+ if (sourceInput) { // true. part of the first event source
+ eventSource = hashValuesToArray(state.eventSources)[0];
+ }
+ }
+ else if (sourceInput != null) { // an ID. accepts a number too
+ var sourceApi = this.getEventSourceById(sourceInput); // TODO: use an internal function
+ if (!sourceApi) {
+ console.warn("Could not find an event source with ID \"" + sourceInput + "\""); // TODO: test
+ return null;
+ }
+ eventSource = sourceApi.internalEventSource;
+ }
+ var tuple = parseEvent(eventInput, eventSource, state, false);
+ if (tuple) {
+ var newEventApi = new EventApi(state, tuple.def, tuple.def.recurringDef ? null : tuple.instance);
+ this.dispatch({
+ type: 'ADD_EVENTS',
+ eventStore: eventTupleToStore(tuple),
+ });
+ this.triggerEventAdd(newEventApi);
+ return newEventApi;
+ }
+ return null;
+ };
+ CalendarApi.prototype.triggerEventAdd = function (eventApi) {
+ var _this = this;
+ var emitter = this.getCurrentData().emitter;
+ emitter.trigger('eventAdd', {
+ event: eventApi,
+ relatedEvents: [],
+ revert: function () {
+ _this.dispatch({
+ type: 'REMOVE_EVENTS',
+ eventStore: eventApiToStore(eventApi),
+ });
+ },
+ });
+ };
+ // TODO: optimize
+ CalendarApi.prototype.getEventById = function (id) {
+ var state = this.getCurrentData();
+ var _a = state.eventStore, defs = _a.defs, instances = _a.instances;
+ id = String(id);
+ for (var defId in defs) {
+ var def = defs[defId];
+ if (def.publicId === id) {
+ if (def.recurringDef) {
+ return new EventApi(state, def, null);
+ }
+ for (var instanceId in instances) {
+ var instance = instances[instanceId];
+ if (instance.defId === def.defId) {
+ return new EventApi(state, def, instance);
+ }
+ }
+ }
+ }
+ return null;
+ };
+ CalendarApi.prototype.getEvents = function () {
+ var currentData = this.getCurrentData();
+ return buildEventApis(currentData.eventStore, currentData);
+ };
+ CalendarApi.prototype.removeAllEvents = function () {
+ this.dispatch({ type: 'REMOVE_ALL_EVENTS' });
+ };
+ // Public Event Sources API
+ // -----------------------------------------------------------------------------------------------------------------
+ CalendarApi.prototype.getEventSources = function () {
+ var state = this.getCurrentData();
+ var sourceHash = state.eventSources;
+ var sourceApis = [];
+ for (var internalId in sourceHash) {
+ sourceApis.push(new EventSourceApi(state, sourceHash[internalId]));
+ }
+ return sourceApis;
+ };
+ CalendarApi.prototype.getEventSourceById = function (id) {
+ var state = this.getCurrentData();
+ var sourceHash = state.eventSources;
+ id = String(id);
+ for (var sourceId in sourceHash) {
+ if (sourceHash[sourceId].publicId === id) {
+ return new EventSourceApi(state, sourceHash[sourceId]);
+ }
+ }
+ return null;
+ };
+ CalendarApi.prototype.addEventSource = function (sourceInput) {
+ var state = this.getCurrentData();
+ if (sourceInput instanceof EventSourceApi) {
+ // not already present? don't want to add an old snapshot
+ if (!state.eventSources[sourceInput.internalEventSource.sourceId]) {
+ this.dispatch({
+ type: 'ADD_EVENT_SOURCES',
+ sources: [sourceInput.internalEventSource],
+ });
+ }
+ return sourceInput;
+ }
+ var eventSource = parseEventSource(sourceInput, state);
+ if (eventSource) { // TODO: error otherwise?
+ this.dispatch({ type: 'ADD_EVENT_SOURCES', sources: [eventSource] });
+ return new EventSourceApi(state, eventSource);
+ }
+ return null;
+ };
+ CalendarApi.prototype.removeAllEventSources = function () {
+ this.dispatch({ type: 'REMOVE_ALL_EVENT_SOURCES' });
+ };
+ CalendarApi.prototype.refetchEvents = function () {
+ this.dispatch({ type: 'FETCH_EVENT_SOURCES', isRefetch: true });
+ };
+ // Scroll
+ // -----------------------------------------------------------------------------------------------------------------
+ CalendarApi.prototype.scrollToTime = function (timeInput) {
+ var time = createDuration(timeInput);
+ if (time) {
+ this.trigger('_scrollRequest', { time: time });
+ }
+ };
+ return CalendarApi;
+ }());
+
+ var EventApi = /** @class */ (function () {
+ // instance will be null if expressing a recurring event that has no current instances,
+ // OR if trying to validate an incoming external event that has no dates assigned
+ function EventApi(context, def, instance) {
+ this._context = context;
+ this._def = def;
+ this._instance = instance || null;
+ }
+ /*
+ TODO: make event struct more responsible for this
+ */
+ EventApi.prototype.setProp = function (name, val) {
+ var _a, _b;
+ if (name in EVENT_DATE_REFINERS) {
+ console.warn('Could not set date-related prop \'name\'. Use one of the date-related methods instead.');
+ // TODO: make proper aliasing system?
+ }
+ else if (name === 'id') {
+ val = EVENT_NON_DATE_REFINERS[name](val);
+ this.mutate({
+ standardProps: { publicId: val }, // hardcoded internal name
+ });
+ }
+ else if (name in EVENT_NON_DATE_REFINERS) {
+ val = EVENT_NON_DATE_REFINERS[name](val);
+ this.mutate({
+ standardProps: (_a = {}, _a[name] = val, _a),
+ });
+ }
+ else if (name in EVENT_UI_REFINERS) {
+ var ui = EVENT_UI_REFINERS[name](val);
+ if (name === 'color') {
+ ui = { backgroundColor: val, borderColor: val };
+ }
+ else if (name === 'editable') {
+ ui = { startEditable: val, durationEditable: val };
+ }
+ else {
+ ui = (_b = {}, _b[name] = val, _b);
+ }
+ this.mutate({
+ standardProps: { ui: ui },
+ });
+ }
+ else {
+ console.warn("Could not set prop '" + name + "'. Use setExtendedProp instead.");
+ }
+ };
+ EventApi.prototype.setExtendedProp = function (name, val) {
+ var _a;
+ this.mutate({
+ extendedProps: (_a = {}, _a[name] = val, _a),
+ });
+ };
+ EventApi.prototype.setStart = function (startInput, options) {
+ if (options === void 0) { options = {}; }
+ var dateEnv = this._context.dateEnv;
+ var start = dateEnv.createMarker(startInput);
+ if (start && this._instance) { // TODO: warning if parsed bad
+ var instanceRange = this._instance.range;
+ var startDelta = diffDates(instanceRange.start, start, dateEnv, options.granularity); // what if parsed bad!?
+ if (options.maintainDuration) {
+ this.mutate({ datesDelta: startDelta });
+ }
+ else {
+ this.mutate({ startDelta: startDelta });
+ }
+ }
+ };
+ EventApi.prototype.setEnd = function (endInput, options) {
+ if (options === void 0) { options = {}; }
+ var dateEnv = this._context.dateEnv;
+ var end;
+ if (endInput != null) {
+ end = dateEnv.createMarker(endInput);
+ if (!end) {
+ return; // TODO: warning if parsed bad
+ }
+ }
+ if (this._instance) {
+ if (end) {
+ var endDelta = diffDates(this._instance.range.end, end, dateEnv, options.granularity);
+ this.mutate({ endDelta: endDelta });
+ }
+ else {
+ this.mutate({ standardProps: { hasEnd: false } });
+ }
+ }
+ };
+ EventApi.prototype.setDates = function (startInput, endInput, options) {
+ if (options === void 0) { options = {}; }
+ var dateEnv = this._context.dateEnv;
+ var standardProps = { allDay: options.allDay };
+ var start = dateEnv.createMarker(startInput);
+ var end;
+ if (!start) {
+ return; // TODO: warning if parsed bad
+ }
+ if (endInput != null) {
+ end = dateEnv.createMarker(endInput);
+ if (!end) { // TODO: warning if parsed bad
+ return;
+ }
+ }
+ if (this._instance) {
+ var instanceRange = this._instance.range;
+ // when computing the diff for an event being converted to all-day,
+ // compute diff off of the all-day values the way event-mutation does.
+ if (options.allDay === true) {
+ instanceRange = computeAlignedDayRange(instanceRange);
+ }
+ var startDelta = diffDates(instanceRange.start, start, dateEnv, options.granularity);
+ if (end) {
+ var endDelta = diffDates(instanceRange.end, end, dateEnv, options.granularity);
+ if (durationsEqual(startDelta, endDelta)) {
+ this.mutate({ datesDelta: startDelta, standardProps: standardProps });
+ }
+ else {
+ this.mutate({ startDelta: startDelta, endDelta: endDelta, standardProps: standardProps });
+ }
+ }
+ else { // means "clear the end"
+ standardProps.hasEnd = false;
+ this.mutate({ datesDelta: startDelta, standardProps: standardProps });
+ }
+ }
+ };
+ EventApi.prototype.moveStart = function (deltaInput) {
+ var delta = createDuration(deltaInput);
+ if (delta) { // TODO: warning if parsed bad
+ this.mutate({ startDelta: delta });
+ }
+ };
+ EventApi.prototype.moveEnd = function (deltaInput) {
+ var delta = createDuration(deltaInput);
+ if (delta) { // TODO: warning if parsed bad
+ this.mutate({ endDelta: delta });
+ }
+ };
+ EventApi.prototype.moveDates = function (deltaInput) {
+ var delta = createDuration(deltaInput);
+ if (delta) { // TODO: warning if parsed bad
+ this.mutate({ datesDelta: delta });
+ }
+ };
+ EventApi.prototype.setAllDay = function (allDay, options) {
+ if (options === void 0) { options = {}; }
+ var standardProps = { allDay: allDay };
+ var maintainDuration = options.maintainDuration;
+ if (maintainDuration == null) {
+ maintainDuration = this._context.options.allDayMaintainDuration;
+ }
+ if (this._def.allDay !== allDay) {
+ standardProps.hasEnd = maintainDuration;
+ }
+ this.mutate({ standardProps: standardProps });
+ };
+ EventApi.prototype.formatRange = function (formatInput) {
+ var dateEnv = this._context.dateEnv;
+ var instance = this._instance;
+ var formatter = createFormatter(formatInput);
+ if (this._def.hasEnd) {
+ return dateEnv.formatRange(instance.range.start, instance.range.end, formatter, {
+ forcedStartTzo: instance.forcedStartTzo,
+ forcedEndTzo: instance.forcedEndTzo,
+ });
+ }
+ return dateEnv.format(instance.range.start, formatter, {
+ forcedTzo: instance.forcedStartTzo,
+ });
+ };
+ EventApi.prototype.mutate = function (mutation) {
+ var instance = this._instance;
+ if (instance) {
+ var def = this._def;
+ var context_1 = this._context;
+ var eventStore_1 = context_1.getCurrentData().eventStore;
+ var relevantEvents = getRelevantEvents(eventStore_1, instance.instanceId);
+ var eventConfigBase = {
+ '': {
+ display: '',
+ startEditable: true,
+ durationEditable: true,
+ constraints: [],
+ overlap: null,
+ allows: [],
+ backgroundColor: '',
+ borderColor: '',
+ textColor: '',
+ classNames: [],
+ },
+ };
+ relevantEvents = applyMutationToEventStore(relevantEvents, eventConfigBase, mutation, context_1);
+ var oldEvent = new EventApi(context_1, def, instance); // snapshot
+ this._def = relevantEvents.defs[def.defId];
+ this._instance = relevantEvents.instances[instance.instanceId];
+ context_1.dispatch({
+ type: 'MERGE_EVENTS',
+ eventStore: relevantEvents,
+ });
+ context_1.emitter.trigger('eventChange', {
+ oldEvent: oldEvent,
+ event: this,
+ relatedEvents: buildEventApis(relevantEvents, context_1, instance),
+ revert: function () {
+ context_1.dispatch({
+ type: 'RESET_EVENTS',
+ eventStore: eventStore_1,
+ });
+ },
+ });
+ }
+ };
+ EventApi.prototype.remove = function () {
+ var context = this._context;
+ var asStore = eventApiToStore(this);
+ context.dispatch({
+ type: 'REMOVE_EVENTS',
+ eventStore: asStore,
+ });
+ context.emitter.trigger('eventRemove', {
+ event: this,
+ relatedEvents: [],
+ revert: function () {
+ context.dispatch({
+ type: 'MERGE_EVENTS',
+ eventStore: asStore,
+ });
+ },
+ });
+ };
+ Object.defineProperty(EventApi.prototype, "source", {
+ get: function () {
+ var sourceId = this._def.sourceId;
+ if (sourceId) {
+ return new EventSourceApi(this._context, this._context.getCurrentData().eventSources[sourceId]);
+ }
+ return null;
+ },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "start", {
+ get: function () {
+ return this._instance ?
+ this._context.dateEnv.toDate(this._instance.range.start) :
+ null;
+ },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "end", {
+ get: function () {
+ return (this._instance && this._def.hasEnd) ?
+ this._context.dateEnv.toDate(this._instance.range.end) :
+ null;
+ },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "startStr", {
+ get: function () {
+ var instance = this._instance;
+ if (instance) {
+ return this._context.dateEnv.formatIso(instance.range.start, {
+ omitTime: this._def.allDay,
+ forcedTzo: instance.forcedStartTzo,
+ });
+ }
+ return '';
+ },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "endStr", {
+ get: function () {
+ var instance = this._instance;
+ if (instance && this._def.hasEnd) {
+ return this._context.dateEnv.formatIso(instance.range.end, {
+ omitTime: this._def.allDay,
+ forcedTzo: instance.forcedEndTzo,
+ });
+ }
+ return '';
+ },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "id", {
+ // computable props that all access the def
+ // TODO: find a TypeScript-compatible way to do this at scale
+ get: function () { return this._def.publicId; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "groupId", {
+ get: function () { return this._def.groupId; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "allDay", {
+ get: function () { return this._def.allDay; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "title", {
+ get: function () { return this._def.title; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "url", {
+ get: function () { return this._def.url; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "display", {
+ get: function () { return this._def.ui.display || 'auto'; } // bad. just normalize the type earlier
+ ,
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "startEditable", {
+ get: function () { return this._def.ui.startEditable; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "durationEditable", {
+ get: function () { return this._def.ui.durationEditable; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "constraint", {
+ get: function () { return this._def.ui.constraints[0] || null; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "overlap", {
+ get: function () { return this._def.ui.overlap; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "allow", {
+ get: function () { return this._def.ui.allows[0] || null; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "backgroundColor", {
+ get: function () { return this._def.ui.backgroundColor; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "borderColor", {
+ get: function () { return this._def.ui.borderColor; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "textColor", {
+ get: function () { return this._def.ui.textColor; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "classNames", {
+ // NOTE: user can't modify these because Object.freeze was called in event-def parsing
+ get: function () { return this._def.ui.classNames; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(EventApi.prototype, "extendedProps", {
+ get: function () { return this._def.extendedProps; },
+ enumerable: false,
+ configurable: true
+ });
+ EventApi.prototype.toPlainObject = function (settings) {
+ if (settings === void 0) { settings = {}; }
+ var def = this._def;
+ var ui = def.ui;
+ var _a = this, startStr = _a.startStr, endStr = _a.endStr;
+ var res = {};
+ if (def.title) {
+ res.title = def.title;
+ }
+ if (startStr) {
+ res.start = startStr;
+ }
+ if (endStr) {
+ res.end = endStr;
+ }
+ if (def.publicId) {
+ res.id = def.publicId;
+ }
+ if (def.groupId) {
+ res.groupId = def.groupId;
+ }
+ if (def.url) {
+ res.url = def.url;
+ }
+ if (ui.display && ui.display !== 'auto') {
+ res.display = ui.display;
+ }
+ // TODO: what about recurring-event properties???
+ // TODO: include startEditable/durationEditable/constraint/overlap/allow
+ if (settings.collapseColor && ui.backgroundColor && ui.backgroundColor === ui.borderColor) {
+ res.color = ui.backgroundColor;
+ }
+ else {
+ if (ui.backgroundColor) {
+ res.backgroundColor = ui.backgroundColor;
+ }
+ if (ui.borderColor) {
+ res.borderColor = ui.borderColor;
+ }
+ }
+ if (ui.textColor) {
+ res.textColor = ui.textColor;
+ }
+ if (ui.classNames.length) {
+ res.classNames = ui.classNames;
+ }
+ if (Object.keys(def.extendedProps).length) {
+ if (settings.collapseExtendedProps) {
+ __assign(res, def.extendedProps);
+ }
+ else {
+ res.extendedProps = def.extendedProps;
+ }
+ }
+ return res;
+ };
+ EventApi.prototype.toJSON = function () {
+ return this.toPlainObject();
+ };
+ return EventApi;
+ }());
+ function eventApiToStore(eventApi) {
+ var _a, _b;
+ var def = eventApi._def;
+ var instance = eventApi._instance;
+ return {
+ defs: (_a = {}, _a[def.defId] = def, _a),
+ instances: instance
+ ? (_b = {}, _b[instance.instanceId] = instance, _b) : {},
+ };
+ }
+ function buildEventApis(eventStore, context, excludeInstance) {
+ var defs = eventStore.defs, instances = eventStore.instances;
+ var eventApis = [];
+ var excludeInstanceId = excludeInstance ? excludeInstance.instanceId : '';
+ for (var id in instances) {
+ var instance = instances[id];
+ var def = defs[instance.defId];
+ if (instance.instanceId !== excludeInstanceId) {
+ eventApis.push(new EventApi(context, def, instance));
+ }
+ }
+ return eventApis;
+ }
+
+ var calendarSystemClassMap = {};
+ function registerCalendarSystem(name, theClass) {
+ calendarSystemClassMap[name] = theClass;
+ }
+ function createCalendarSystem(name) {
+ return new calendarSystemClassMap[name]();
+ }
+ var GregorianCalendarSystem = /** @class */ (function () {
+ function GregorianCalendarSystem() {
+ }
+ GregorianCalendarSystem.prototype.getMarkerYear = function (d) {
+ return d.getUTCFullYear();
+ };
+ GregorianCalendarSystem.prototype.getMarkerMonth = function (d) {
+ return d.getUTCMonth();
+ };
+ GregorianCalendarSystem.prototype.getMarkerDay = function (d) {
+ return d.getUTCDate();
+ };
+ GregorianCalendarSystem.prototype.arrayToMarker = function (arr) {
+ return arrayToUtcDate(arr);
+ };
+ GregorianCalendarSystem.prototype.markerToArray = function (marker) {
+ return dateToUtcArray(marker);
+ };
+ return GregorianCalendarSystem;
+ }());
+ registerCalendarSystem('gregory', GregorianCalendarSystem);
+
+ var ISO_RE = /^\s*(\d{4})(-?(\d{2})(-?(\d{2})([T ](\d{2}):?(\d{2})(:?(\d{2})(\.(\d+))?)?(Z|(([-+])(\d{2})(:?(\d{2}))?))?)?)?)?$/;
+ function parse(str) {
+ var m = ISO_RE.exec(str);
+ if (m) {
+ var marker = new Date(Date.UTC(Number(m[1]), m[3] ? Number(m[3]) - 1 : 0, Number(m[5] || 1), Number(m[7] || 0), Number(m[8] || 0), Number(m[10] || 0), m[12] ? Number("0." + m[12]) * 1000 : 0));
+ if (isValidDate$1(marker)) {
+ var timeZoneOffset = null;
+ if (m[13]) {
+ timeZoneOffset = (m[15] === '-' ? -1 : 1) * (Number(m[16] || 0) * 60 +
+ Number(m[18] || 0));
+ }
+ return {
+ marker: marker,
+ isTimeUnspecified: !m[6],
+ timeZoneOffset: timeZoneOffset,
+ };
+ }
+ }
+ return null;
+ }
+
+ var DateEnv = /** @class */ (function () {
+ function DateEnv(settings) {
+ var timeZone = this.timeZone = settings.timeZone;
+ var isNamedTimeZone = timeZone !== 'local' && timeZone !== 'UTC';
+ if (settings.namedTimeZoneImpl && isNamedTimeZone) {
+ this.namedTimeZoneImpl = new settings.namedTimeZoneImpl(timeZone);
+ }
+ this.canComputeOffset = Boolean(!isNamedTimeZone || this.namedTimeZoneImpl);
+ this.calendarSystem = createCalendarSystem(settings.calendarSystem);
+ this.locale = settings.locale;
+ this.weekDow = settings.locale.week.dow;
+ this.weekDoy = settings.locale.week.doy;
+ if (settings.weekNumberCalculation === 'ISO') {
+ this.weekDow = 1;
+ this.weekDoy = 4;
+ }
+ if (typeof settings.firstDay === 'number') {
+ this.weekDow = settings.firstDay;
+ }
+ if (typeof settings.weekNumberCalculation === 'function') {
+ this.weekNumberFunc = settings.weekNumberCalculation;
+ }
+ this.weekText = settings.weekText != null ? settings.weekText : settings.locale.options.weekText;
+ this.cmdFormatter = settings.cmdFormatter;
+ this.defaultSeparator = settings.defaultSeparator;
+ }
+ // Creating / Parsing
+ DateEnv.prototype.createMarker = function (input) {
+ var meta = this.createMarkerMeta(input);
+ if (meta === null) {
+ return null;
+ }
+ return meta.marker;
+ };
+ DateEnv.prototype.createNowMarker = function () {
+ if (this.canComputeOffset) {
+ return this.timestampToMarker(new Date().valueOf());
+ }
+ // if we can't compute the current date val for a timezone,
+ // better to give the current local date vals than UTC
+ return arrayToUtcDate(dateToLocalArray(new Date()));
+ };
+ DateEnv.prototype.createMarkerMeta = function (input) {
+ if (typeof input === 'string') {
+ return this.parse(input);
+ }
+ var marker = null;
+ if (typeof input === 'number') {
+ marker = this.timestampToMarker(input);
+ }
+ else if (input instanceof Date) {
+ input = input.valueOf();
+ if (!isNaN(input)) {
+ marker = this.timestampToMarker(input);
+ }
+ }
+ else if (Array.isArray(input)) {
+ marker = arrayToUtcDate(input);
+ }
+ if (marker === null || !isValidDate$1(marker)) {
+ return null;
+ }
+ return { marker: marker, isTimeUnspecified: false, forcedTzo: null };
+ };
+ DateEnv.prototype.parse = function (s) {
+ var parts = parse(s);
+ if (parts === null) {
+ return null;
+ }
+ var marker = parts.marker;
+ var forcedTzo = null;
+ if (parts.timeZoneOffset !== null) {
+ if (this.canComputeOffset) {
+ marker = this.timestampToMarker(marker.valueOf() - parts.timeZoneOffset * 60 * 1000);
+ }
+ else {
+ forcedTzo = parts.timeZoneOffset;
+ }
+ }
+ return { marker: marker, isTimeUnspecified: parts.isTimeUnspecified, forcedTzo: forcedTzo };
+ };
+ // Accessors
+ DateEnv.prototype.getYear = function (marker) {
+ return this.calendarSystem.getMarkerYear(marker);
+ };
+ DateEnv.prototype.getMonth = function (marker) {
+ return this.calendarSystem.getMarkerMonth(marker);
+ };
+ // Adding / Subtracting
+ DateEnv.prototype.add = function (marker, dur) {
+ var a = this.calendarSystem.markerToArray(marker);
+ a[0] += dur.years;
+ a[1] += dur.months;
+ a[2] += dur.days;
+ a[6] += dur.milliseconds;
+ return this.calendarSystem.arrayToMarker(a);
+ };
+ DateEnv.prototype.subtract = function (marker, dur) {
+ var a = this.calendarSystem.markerToArray(marker);
+ a[0] -= dur.years;
+ a[1] -= dur.months;
+ a[2] -= dur.days;
+ a[6] -= dur.milliseconds;
+ return this.calendarSystem.arrayToMarker(a);
+ };
+ DateEnv.prototype.addYears = function (marker, n) {
+ var a = this.calendarSystem.markerToArray(marker);
+ a[0] += n;
+ return this.calendarSystem.arrayToMarker(a);
+ };
+ DateEnv.prototype.addMonths = function (marker, n) {
+ var a = this.calendarSystem.markerToArray(marker);
+ a[1] += n;
+ return this.calendarSystem.arrayToMarker(a);
+ };
+ // Diffing Whole Units
+ DateEnv.prototype.diffWholeYears = function (m0, m1) {
+ var calendarSystem = this.calendarSystem;
+ if (timeAsMs(m0) === timeAsMs(m1) &&
+ calendarSystem.getMarkerDay(m0) === calendarSystem.getMarkerDay(m1) &&
+ calendarSystem.getMarkerMonth(m0) === calendarSystem.getMarkerMonth(m1)) {
+ return calendarSystem.getMarkerYear(m1) - calendarSystem.getMarkerYear(m0);
+ }
+ return null;
+ };
+ DateEnv.prototype.diffWholeMonths = function (m0, m1) {
+ var calendarSystem = this.calendarSystem;
+ if (timeAsMs(m0) === timeAsMs(m1) &&
+ calendarSystem.getMarkerDay(m0) === calendarSystem.getMarkerDay(m1)) {
+ return (calendarSystem.getMarkerMonth(m1) - calendarSystem.getMarkerMonth(m0)) +
+ (calendarSystem.getMarkerYear(m1) - calendarSystem.getMarkerYear(m0)) * 12;
+ }
+ return null;
+ };
+ // Range / Duration
+ DateEnv.prototype.greatestWholeUnit = function (m0, m1) {
+ var n = this.diffWholeYears(m0, m1);
+ if (n !== null) {
+ return { unit: 'year', value: n };
+ }
+ n = this.diffWholeMonths(m0, m1);
+ if (n !== null) {
+ return { unit: 'month', value: n };
+ }
+ n = diffWholeWeeks(m0, m1);
+ if (n !== null) {
+ return { unit: 'week', value: n };
+ }
+ n = diffWholeDays(m0, m1);
+ if (n !== null) {
+ return { unit: 'day', value: n };
+ }
+ n = diffHours(m0, m1);
+ if (isInt(n)) {
+ return { unit: 'hour', value: n };
+ }
+ n = diffMinutes(m0, m1);
+ if (isInt(n)) {
+ return { unit: 'minute', value: n };
+ }
+ n = diffSeconds(m0, m1);
+ if (isInt(n)) {
+ return { unit: 'second', value: n };
+ }
+ return { unit: 'millisecond', value: m1.valueOf() - m0.valueOf() };
+ };
+ DateEnv.prototype.countDurationsBetween = function (m0, m1, d) {
+ // TODO: can use greatestWholeUnit
+ var diff;
+ if (d.years) {
+ diff = this.diffWholeYears(m0, m1);
+ if (diff !== null) {
+ return diff / asRoughYears(d);
+ }
+ }
+ if (d.months) {
+ diff = this.diffWholeMonths(m0, m1);
+ if (diff !== null) {
+ return diff / asRoughMonths(d);
+ }
+ }
+ if (d.days) {
+ diff = diffWholeDays(m0, m1);
+ if (diff !== null) {
+ return diff / asRoughDays(d);
+ }
+ }
+ return (m1.valueOf() - m0.valueOf()) / asRoughMs(d);
+ };
+ // Start-Of
+ // these DON'T return zoned-dates. only UTC start-of dates
+ DateEnv.prototype.startOf = function (m, unit) {
+ if (unit === 'year') {
+ return this.startOfYear(m);
+ }
+ if (unit === 'month') {
+ return this.startOfMonth(m);
+ }
+ if (unit === 'week') {
+ return this.startOfWeek(m);
+ }
+ if (unit === 'day') {
+ return startOfDay(m);
+ }
+ if (unit === 'hour') {
+ return startOfHour(m);
+ }
+ if (unit === 'minute') {
+ return startOfMinute(m);
+ }
+ if (unit === 'second') {
+ return startOfSecond(m);
+ }
+ return null;
+ };
+ DateEnv.prototype.startOfYear = function (m) {
+ return this.calendarSystem.arrayToMarker([
+ this.calendarSystem.getMarkerYear(m),
+ ]);
+ };
+ DateEnv.prototype.startOfMonth = function (m) {
+ return this.calendarSystem.arrayToMarker([
+ this.calendarSystem.getMarkerYear(m),
+ this.calendarSystem.getMarkerMonth(m),
+ ]);
+ };
+ DateEnv.prototype.startOfWeek = function (m) {
+ return this.calendarSystem.arrayToMarker([
+ this.calendarSystem.getMarkerYear(m),
+ this.calendarSystem.getMarkerMonth(m),
+ m.getUTCDate() - ((m.getUTCDay() - this.weekDow + 7) % 7),
+ ]);
+ };
+ // Week Number
+ DateEnv.prototype.computeWeekNumber = function (marker) {
+ if (this.weekNumberFunc) {
+ return this.weekNumberFunc(this.toDate(marker));
+ }
+ return weekOfYear(marker, this.weekDow, this.weekDoy);
+ };
+ // TODO: choke on timeZoneName: long
+ DateEnv.prototype.format = function (marker, formatter, dateOptions) {
+ if (dateOptions === void 0) { dateOptions = {}; }
+ return formatter.format({
+ marker: marker,
+ timeZoneOffset: dateOptions.forcedTzo != null ?
+ dateOptions.forcedTzo :
+ this.offsetForMarker(marker),
+ }, this);
+ };
+ DateEnv.prototype.formatRange = function (start, end, formatter, dateOptions) {
+ if (dateOptions === void 0) { dateOptions = {}; }
+ if (dateOptions.isEndExclusive) {
+ end = addMs(end, -1);
+ }
+ return formatter.formatRange({
+ marker: start,
+ timeZoneOffset: dateOptions.forcedStartTzo != null ?
+ dateOptions.forcedStartTzo :
+ this.offsetForMarker(start),
+ }, {
+ marker: end,
+ timeZoneOffset: dateOptions.forcedEndTzo != null ?
+ dateOptions.forcedEndTzo :
+ this.offsetForMarker(end),
+ }, this, dateOptions.defaultSeparator);
+ };
+ /*
+ DUMB: the omitTime arg is dumb. if we omit the time, we want to omit the timezone offset. and if we do that,
+ might as well use buildIsoString or some other util directly
+ */
+ DateEnv.prototype.formatIso = function (marker, extraOptions) {
+ if (extraOptions === void 0) { extraOptions = {}; }
+ var timeZoneOffset = null;
+ if (!extraOptions.omitTimeZoneOffset) {
+ if (extraOptions.forcedTzo != null) {
+ timeZoneOffset = extraOptions.forcedTzo;
+ }
+ else {
+ timeZoneOffset = this.offsetForMarker(marker);
+ }
+ }
+ return buildIsoString(marker, timeZoneOffset, extraOptions.omitTime);
+ };
+ // TimeZone
+ DateEnv.prototype.timestampToMarker = function (ms) {
+ if (this.timeZone === 'local') {
+ return arrayToUtcDate(dateToLocalArray(new Date(ms)));
+ }
+ if (this.timeZone === 'UTC' || !this.namedTimeZoneImpl) {
+ return new Date(ms);
+ }
+ return arrayToUtcDate(this.namedTimeZoneImpl.timestampToArray(ms));
+ };
+ DateEnv.prototype.offsetForMarker = function (m) {
+ if (this.timeZone === 'local') {
+ return -arrayToLocalDate(dateToUtcArray(m)).getTimezoneOffset(); // convert "inverse" offset to "normal" offset
+ }
+ if (this.timeZone === 'UTC') {
+ return 0;
+ }
+ if (this.namedTimeZoneImpl) {
+ return this.namedTimeZoneImpl.offsetForArray(dateToUtcArray(m));
+ }
+ return null;
+ };
+ // Conversion
+ DateEnv.prototype.toDate = function (m, forcedTzo) {
+ if (this.timeZone === 'local') {
+ return arrayToLocalDate(dateToUtcArray(m));
+ }
+ if (this.timeZone === 'UTC') {
+ return new Date(m.valueOf()); // make sure it's a copy
+ }
+ if (!this.namedTimeZoneImpl) {
+ return new Date(m.valueOf() - (forcedTzo || 0));
+ }
+ return new Date(m.valueOf() -
+ this.namedTimeZoneImpl.offsetForArray(dateToUtcArray(m)) * 1000 * 60);
+ };
+ return DateEnv;
+ }());
+
+ var globalLocales = [];
+
+ var RAW_EN_LOCALE = {
+ code: 'en',
+ week: {
+ dow: 0,
+ doy: 4, // 4 days need to be within the year to be considered the first week
+ },
+ direction: 'ltr',
+ buttonText: {
+ prev: 'prev',
+ next: 'next',
+ prevYear: 'prev year',
+ nextYear: 'next year',
+ year: 'year',
+ today: 'today',
+ month: 'month',
+ week: 'week',
+ day: 'day',
+ list: 'list',
+ },
+ weekText: 'W',
+ allDayText: 'all-day',
+ moreLinkText: 'more',
+ noEventsText: 'No events to display',
+ };
+ function organizeRawLocales(explicitRawLocales) {
+ var defaultCode = explicitRawLocales.length > 0 ? explicitRawLocales[0].code : 'en';
+ var allRawLocales = globalLocales.concat(explicitRawLocales);
+ var rawLocaleMap = {
+ en: RAW_EN_LOCALE, // necessary?
+ };
+ for (var _i = 0, allRawLocales_1 = allRawLocales; _i < allRawLocales_1.length; _i++) {
+ var rawLocale = allRawLocales_1[_i];
+ rawLocaleMap[rawLocale.code] = rawLocale;
+ }
+ return {
+ map: rawLocaleMap,
+ defaultCode: defaultCode,
+ };
+ }
+ function buildLocale(inputSingular, available) {
+ if (typeof inputSingular === 'object' && !Array.isArray(inputSingular)) {
+ return parseLocale(inputSingular.code, [inputSingular.code], inputSingular);
+ }
+ return queryLocale(inputSingular, available);
+ }
+ function queryLocale(codeArg, available) {
+ var codes = [].concat(codeArg || []); // will convert to array
+ var raw = queryRawLocale(codes, available) || RAW_EN_LOCALE;
+ return parseLocale(codeArg, codes, raw);
+ }
+ function queryRawLocale(codes, available) {
+ for (var i = 0; i < codes.length; i += 1) {
+ var parts = codes[i].toLocaleLowerCase().split('-');
+ for (var j = parts.length; j > 0; j -= 1) {
+ var simpleId = parts.slice(0, j).join('-');
+ if (available[simpleId]) {
+ return available[simpleId];
+ }
+ }
+ }
+ return null;
+ }
+ function parseLocale(codeArg, codes, raw) {
+ var merged = mergeProps([RAW_EN_LOCALE, raw], ['buttonText']);
+ delete merged.code; // don't want this part of the options
+ var week = merged.week;
+ delete merged.week;
+ return {
+ codeArg: codeArg,
+ codes: codes,
+ week: week,
+ simpleNumberFormat: new Intl.NumberFormat(codeArg),
+ options: merged,
+ };
+ }
+
+ function formatDate(dateInput, options) {
+ if (options === void 0) { options = {}; }
+ var dateEnv = buildDateEnv$1(options);
+ var formatter = createFormatter(options);
+ var dateMeta = dateEnv.createMarkerMeta(dateInput);
+ if (!dateMeta) { // TODO: warning?
+ return '';
+ }
+ return dateEnv.format(dateMeta.marker, formatter, {
+ forcedTzo: dateMeta.forcedTzo,
+ });
+ }
+ function formatRange(startInput, endInput, options) {
+ var dateEnv = buildDateEnv$1(typeof options === 'object' && options ? options : {}); // pass in if non-null object
+ var formatter = createFormatter(options);
+ var startMeta = dateEnv.createMarkerMeta(startInput);
+ var endMeta = dateEnv.createMarkerMeta(endInput);
+ if (!startMeta || !endMeta) { // TODO: warning?
+ return '';
+ }
+ return dateEnv.formatRange(startMeta.marker, endMeta.marker, formatter, {
+ forcedStartTzo: startMeta.forcedTzo,
+ forcedEndTzo: endMeta.forcedTzo,
+ isEndExclusive: options.isEndExclusive,
+ defaultSeparator: BASE_OPTION_DEFAULTS.defaultRangeSeparator,
+ });
+ }
+ // TODO: more DRY and optimized
+ function buildDateEnv$1(settings) {
+ var locale = buildLocale(settings.locale || 'en', organizeRawLocales([]).map); // TODO: don't hardcode 'en' everywhere
+ return new DateEnv(__assign(__assign({ timeZone: BASE_OPTION_DEFAULTS.timeZone, calendarSystem: 'gregory' }, settings), { locale: locale }));
+ }
+
+ var DEF_DEFAULTS = {
+ startTime: '09:00',
+ endTime: '17:00',
+ daysOfWeek: [1, 2, 3, 4, 5],
+ display: 'inverse-background',
+ classNames: 'fc-non-business',
+ groupId: '_businessHours', // so multiple defs get grouped
+ };
+ /*
+ TODO: pass around as EventDefHash!!!
+ */
+ function parseBusinessHours(input, context) {
+ return parseEvents(refineInputs(input), null, context);
+ }
+ function refineInputs(input) {
+ var rawDefs;
+ if (input === true) {
+ rawDefs = [{}]; // will get DEF_DEFAULTS verbatim
+ }
+ else if (Array.isArray(input)) {
+ // if specifying an array, every sub-definition NEEDS a day-of-week
+ rawDefs = input.filter(function (rawDef) { return rawDef.daysOfWeek; });
+ }
+ else if (typeof input === 'object' && input) { // non-null object
+ rawDefs = [input];
+ }
+ else { // is probably false
+ rawDefs = [];
+ }
+ rawDefs = rawDefs.map(function (rawDef) { return (__assign(__assign({}, DEF_DEFAULTS), rawDef)); });
+ return rawDefs;
+ }
+
+ function pointInsideRect(point, rect) {
+ return point.left >= rect.left &&
+ point.left < rect.right &&
+ point.top >= rect.top &&
+ point.top < rect.bottom;
+ }
+ // Returns a new rectangle that is the intersection of the two rectangles. If they don't intersect, returns false
+ function intersectRects(rect1, rect2) {
+ var res = {
+ left: Math.max(rect1.left, rect2.left),
+ right: Math.min(rect1.right, rect2.right),
+ top: Math.max(rect1.top, rect2.top),
+ bottom: Math.min(rect1.bottom, rect2.bottom),
+ };
+ if (res.left < res.right && res.top < res.bottom) {
+ return res;
+ }
+ return false;
+ }
+ function translateRect(rect, deltaX, deltaY) {
+ return {
+ left: rect.left + deltaX,
+ right: rect.right + deltaX,
+ top: rect.top + deltaY,
+ bottom: rect.bottom + deltaY,
+ };
+ }
+ // Returns a new point that will have been moved to reside within the given rectangle
+ function constrainPoint(point, rect) {
+ return {
+ left: Math.min(Math.max(point.left, rect.left), rect.right),
+ top: Math.min(Math.max(point.top, rect.top), rect.bottom),
+ };
+ }
+ // Returns a point that is the center of the given rectangle
+ function getRectCenter(rect) {
+ return {
+ left: (rect.left + rect.right) / 2,
+ top: (rect.top + rect.bottom) / 2,
+ };
+ }
+ // Subtracts point2's coordinates from point1's coordinates, returning a delta
+ function diffPoints(point1, point2) {
+ return {
+ left: point1.left - point2.left,
+ top: point1.top - point2.top,
+ };
+ }
+
+ var canVGrowWithinCell;
+ function getCanVGrowWithinCell() {
+ if (canVGrowWithinCell == null) {
+ canVGrowWithinCell = computeCanVGrowWithinCell();
+ }
+ return canVGrowWithinCell;
+ }
+ function computeCanVGrowWithinCell() {
+ // for SSR, because this function is call immediately at top-level
+ // TODO: just make this logic execute top-level, immediately, instead of doing lazily
+ if (typeof document === 'undefined') {
+ return true;
+ }
+ var el = document.createElement('div');
+ el.style.position = 'absolute';
+ el.style.top = '0px';
+ el.style.left = '0px';
+ el.innerHTML = '';
+ el.querySelector('table').style.height = '100px';
+ el.querySelector('div').style.height = '100%';
+ document.body.appendChild(el);
+ var div = el.querySelector('div');
+ var possible = div.offsetHeight > 0;
+ document.body.removeChild(el);
+ return possible;
+ }
+
+ var EMPTY_EVENT_STORE = createEmptyEventStore(); // for purecomponents. TODO: keep elsewhere
+ var Splitter = /** @class */ (function () {
+ function Splitter() {
+ this.getKeysForEventDefs = memoize(this._getKeysForEventDefs);
+ this.splitDateSelection = memoize(this._splitDateSpan);
+ this.splitEventStore = memoize(this._splitEventStore);
+ this.splitIndividualUi = memoize(this._splitIndividualUi);
+ this.splitEventDrag = memoize(this._splitInteraction);
+ this.splitEventResize = memoize(this._splitInteraction);
+ this.eventUiBuilders = {}; // TODO: typescript protection
+ }
+ Splitter.prototype.splitProps = function (props) {
+ var _this = this;
+ var keyInfos = this.getKeyInfo(props);
+ var defKeys = this.getKeysForEventDefs(props.eventStore);
+ var dateSelections = this.splitDateSelection(props.dateSelection);
+ var individualUi = this.splitIndividualUi(props.eventUiBases, defKeys); // the individual *bases*
+ var eventStores = this.splitEventStore(props.eventStore, defKeys);
+ var eventDrags = this.splitEventDrag(props.eventDrag);
+ var eventResizes = this.splitEventResize(props.eventResize);
+ var splitProps = {};
+ this.eventUiBuilders = mapHash(keyInfos, function (info, key) { return _this.eventUiBuilders[key] || memoize(buildEventUiForKey); });
+ for (var key in keyInfos) {
+ var keyInfo = keyInfos[key];
+ var eventStore = eventStores[key] || EMPTY_EVENT_STORE;
+ var buildEventUi = this.eventUiBuilders[key];
+ splitProps[key] = {
+ businessHours: keyInfo.businessHours || props.businessHours,
+ dateSelection: dateSelections[key] || null,
+ eventStore: eventStore,
+ eventUiBases: buildEventUi(props.eventUiBases[''], keyInfo.ui, individualUi[key]),
+ eventSelection: eventStore.instances[props.eventSelection] ? props.eventSelection : '',
+ eventDrag: eventDrags[key] || null,
+ eventResize: eventResizes[key] || null,
+ };
+ }
+ return splitProps;
+ };
+ Splitter.prototype._splitDateSpan = function (dateSpan) {
+ var dateSpans = {};
+ if (dateSpan) {
+ var keys = this.getKeysForDateSpan(dateSpan);
+ for (var _i = 0, keys_1 = keys; _i < keys_1.length; _i++) {
+ var key = keys_1[_i];
+ dateSpans[key] = dateSpan;
+ }
+ }
+ return dateSpans;
+ };
+ Splitter.prototype._getKeysForEventDefs = function (eventStore) {
+ var _this = this;
+ return mapHash(eventStore.defs, function (eventDef) { return _this.getKeysForEventDef(eventDef); });
+ };
+ Splitter.prototype._splitEventStore = function (eventStore, defKeys) {
+ var defs = eventStore.defs, instances = eventStore.instances;
+ var splitStores = {};
+ for (var defId in defs) {
+ for (var _i = 0, _a = defKeys[defId]; _i < _a.length; _i++) {
+ var key = _a[_i];
+ if (!splitStores[key]) {
+ splitStores[key] = createEmptyEventStore();
+ }
+ splitStores[key].defs[defId] = defs[defId];
+ }
+ }
+ for (var instanceId in instances) {
+ var instance = instances[instanceId];
+ for (var _b = 0, _c = defKeys[instance.defId]; _b < _c.length; _b++) {
+ var key = _c[_b];
+ if (splitStores[key]) { // must have already been created
+ splitStores[key].instances[instanceId] = instance;
+ }
+ }
+ }
+ return splitStores;
+ };
+ Splitter.prototype._splitIndividualUi = function (eventUiBases, defKeys) {
+ var splitHashes = {};
+ for (var defId in eventUiBases) {
+ if (defId) { // not the '' key
+ for (var _i = 0, _a = defKeys[defId]; _i < _a.length; _i++) {
+ var key = _a[_i];
+ if (!splitHashes[key]) {
+ splitHashes[key] = {};
+ }
+ splitHashes[key][defId] = eventUiBases[defId];
+ }
+ }
+ }
+ return splitHashes;
+ };
+ Splitter.prototype._splitInteraction = function (interaction) {
+ var splitStates = {};
+ if (interaction) {
+ var affectedStores_1 = this._splitEventStore(interaction.affectedEvents, this._getKeysForEventDefs(interaction.affectedEvents));
+ // can't rely on defKeys because event data is mutated
+ var mutatedKeysByDefId = this._getKeysForEventDefs(interaction.mutatedEvents);
+ var mutatedStores_1 = this._splitEventStore(interaction.mutatedEvents, mutatedKeysByDefId);
+ var populate = function (key) {
+ if (!splitStates[key]) {
+ splitStates[key] = {
+ affectedEvents: affectedStores_1[key] || EMPTY_EVENT_STORE,
+ mutatedEvents: mutatedStores_1[key] || EMPTY_EVENT_STORE,
+ isEvent: interaction.isEvent,
+ };
+ }
+ };
+ for (var key in affectedStores_1) {
+ populate(key);
+ }
+ for (var key in mutatedStores_1) {
+ populate(key);
+ }
+ }
+ return splitStates;
+ };
+ return Splitter;
+ }());
+ function buildEventUiForKey(allUi, eventUiForKey, individualUi) {
+ var baseParts = [];
+ if (allUi) {
+ baseParts.push(allUi);
+ }
+ if (eventUiForKey) {
+ baseParts.push(eventUiForKey);
+ }
+ var stuff = {
+ '': combineEventUis(baseParts),
+ };
+ if (individualUi) {
+ __assign(stuff, individualUi);
+ }
+ return stuff;
+ }
+
+ function getDateMeta(date, todayRange, nowDate, dateProfile) {
+ return {
+ dow: date.getUTCDay(),
+ isDisabled: Boolean(dateProfile && !rangeContainsMarker(dateProfile.activeRange, date)),
+ isOther: Boolean(dateProfile && !rangeContainsMarker(dateProfile.currentRange, date)),
+ isToday: Boolean(todayRange && rangeContainsMarker(todayRange, date)),
+ isPast: Boolean(nowDate ? (date < nowDate) : todayRange ? (date < todayRange.start) : false),
+ isFuture: Boolean(nowDate ? (date > nowDate) : todayRange ? (date >= todayRange.end) : false),
+ };
+ }
+ function getDayClassNames(meta, theme) {
+ var classNames = [
+ 'fc-day',
+ "fc-day-" + DAY_IDS[meta.dow],
+ ];
+ if (meta.isDisabled) {
+ classNames.push('fc-day-disabled');
+ }
+ else {
+ if (meta.isToday) {
+ classNames.push('fc-day-today');
+ classNames.push(theme.getClass('today'));
+ }
+ if (meta.isPast) {
+ classNames.push('fc-day-past');
+ }
+ if (meta.isFuture) {
+ classNames.push('fc-day-future');
+ }
+ if (meta.isOther) {
+ classNames.push('fc-day-other');
+ }
+ }
+ return classNames;
+ }
+ function getSlotClassNames(meta, theme) {
+ var classNames = [
+ 'fc-slot',
+ "fc-slot-" + DAY_IDS[meta.dow],
+ ];
+ if (meta.isDisabled) {
+ classNames.push('fc-slot-disabled');
+ }
+ else {
+ if (meta.isToday) {
+ classNames.push('fc-slot-today');
+ classNames.push(theme.getClass('today'));
+ }
+ if (meta.isPast) {
+ classNames.push('fc-slot-past');
+ }
+ if (meta.isFuture) {
+ classNames.push('fc-slot-future');
+ }
+ }
+ return classNames;
+ }
+
+ function buildNavLinkData(date, type) {
+ if (type === void 0) { type = 'day'; }
+ return JSON.stringify({
+ date: formatDayString(date),
+ type: type,
+ });
+ }
+
+ var _isRtlScrollbarOnLeft = null;
+ function getIsRtlScrollbarOnLeft() {
+ if (_isRtlScrollbarOnLeft === null) {
+ _isRtlScrollbarOnLeft = computeIsRtlScrollbarOnLeft();
+ }
+ return _isRtlScrollbarOnLeft;
+ }
+ function computeIsRtlScrollbarOnLeft() {
+ var outerEl = document.createElement('div');
+ applyStyle(outerEl, {
+ position: 'absolute',
+ top: -1000,
+ left: 0,
+ border: 0,
+ padding: 0,
+ overflow: 'scroll',
+ direction: 'rtl',
+ });
+ outerEl.innerHTML = '
';
+ document.body.appendChild(outerEl);
+ var innerEl = outerEl.firstChild;
+ var res = innerEl.getBoundingClientRect().left > outerEl.getBoundingClientRect().left;
+ removeElement(outerEl);
+ return res;
+ }
+
+ var _scrollbarWidths;
+ function getScrollbarWidths() {
+ if (!_scrollbarWidths) {
+ _scrollbarWidths = computeScrollbarWidths();
+ }
+ return _scrollbarWidths;
+ }
+ function computeScrollbarWidths() {
+ var el = document.createElement('div');
+ el.style.overflow = 'scroll';
+ el.style.position = 'absolute';
+ el.style.top = '-9999px';
+ el.style.left = '-9999px';
+ document.body.appendChild(el);
+ var res = computeScrollbarWidthsForEl(el);
+ document.body.removeChild(el);
+ return res;
+ }
+ // WARNING: will include border
+ function computeScrollbarWidthsForEl(el) {
+ return {
+ x: el.offsetHeight - el.clientHeight,
+ y: el.offsetWidth - el.clientWidth,
+ };
+ }
+
+ function computeEdges(el, getPadding) {
+ if (getPadding === void 0) { getPadding = false; }
+ var computedStyle = window.getComputedStyle(el);
+ var borderLeft = parseInt(computedStyle.borderLeftWidth, 10) || 0;
+ var borderRight = parseInt(computedStyle.borderRightWidth, 10) || 0;
+ var borderTop = parseInt(computedStyle.borderTopWidth, 10) || 0;
+ var borderBottom = parseInt(computedStyle.borderBottomWidth, 10) || 0;
+ var badScrollbarWidths = computeScrollbarWidthsForEl(el); // includes border!
+ var scrollbarLeftRight = badScrollbarWidths.y - borderLeft - borderRight;
+ var scrollbarBottom = badScrollbarWidths.x - borderTop - borderBottom;
+ var res = {
+ borderLeft: borderLeft,
+ borderRight: borderRight,
+ borderTop: borderTop,
+ borderBottom: borderBottom,
+ scrollbarBottom: scrollbarBottom,
+ scrollbarLeft: 0,
+ scrollbarRight: 0,
+ };
+ if (getIsRtlScrollbarOnLeft() && computedStyle.direction === 'rtl') { // is the scrollbar on the left side?
+ res.scrollbarLeft = scrollbarLeftRight;
+ }
+ else {
+ res.scrollbarRight = scrollbarLeftRight;
+ }
+ if (getPadding) {
+ res.paddingLeft = parseInt(computedStyle.paddingLeft, 10) || 0;
+ res.paddingRight = parseInt(computedStyle.paddingRight, 10) || 0;
+ res.paddingTop = parseInt(computedStyle.paddingTop, 10) || 0;
+ res.paddingBottom = parseInt(computedStyle.paddingBottom, 10) || 0;
+ }
+ return res;
+ }
+ function computeInnerRect(el, goWithinPadding, doFromWindowViewport) {
+ if (goWithinPadding === void 0) { goWithinPadding = false; }
+ var outerRect = doFromWindowViewport ? el.getBoundingClientRect() : computeRect(el);
+ var edges = computeEdges(el, goWithinPadding);
+ var res = {
+ left: outerRect.left + edges.borderLeft + edges.scrollbarLeft,
+ right: outerRect.right - edges.borderRight - edges.scrollbarRight,
+ top: outerRect.top + edges.borderTop,
+ bottom: outerRect.bottom - edges.borderBottom - edges.scrollbarBottom,
+ };
+ if (goWithinPadding) {
+ res.left += edges.paddingLeft;
+ res.right -= edges.paddingRight;
+ res.top += edges.paddingTop;
+ res.bottom -= edges.paddingBottom;
+ }
+ return res;
+ }
+ function computeRect(el) {
+ var rect = el.getBoundingClientRect();
+ return {
+ left: rect.left + window.pageXOffset,
+ top: rect.top + window.pageYOffset,
+ right: rect.right + window.pageXOffset,
+ bottom: rect.bottom + window.pageYOffset,
+ };
+ }
+ function computeClippedClientRect(el) {
+ var clippingParents = getClippingParents(el);
+ var rect = el.getBoundingClientRect();
+ for (var _i = 0, clippingParents_1 = clippingParents; _i < clippingParents_1.length; _i++) {
+ var clippingParent = clippingParents_1[_i];
+ var intersection = intersectRects(rect, clippingParent.getBoundingClientRect());
+ if (intersection) {
+ rect = intersection;
+ }
+ else {
+ return null;
+ }
+ }
+ return rect;
+ }
+ function computeHeightAndMargins(el) {
+ return el.getBoundingClientRect().height + computeVMargins(el);
+ }
+ function computeVMargins(el) {
+ var computed = window.getComputedStyle(el);
+ return parseInt(computed.marginTop, 10) +
+ parseInt(computed.marginBottom, 10);
+ }
+ // does not return window
+ function getClippingParents(el) {
+ var parents = [];
+ while (el instanceof HTMLElement) { // will stop when gets to document or null
+ var computedStyle = window.getComputedStyle(el);
+ if (computedStyle.position === 'fixed') {
+ break;
+ }
+ if ((/(auto|scroll)/).test(computedStyle.overflow + computedStyle.overflowY + computedStyle.overflowX)) {
+ parents.push(el);
+ }
+ el = el.parentNode;
+ }
+ return parents;
+ }
+
+ // given a function that resolves a result asynchronously.
+ // the function can either call passed-in success and failure callbacks,
+ // or it can return a promise.
+ // if you need to pass additional params to func, bind them first.
+ function unpromisify(func, success, failure) {
+ // guard against success/failure callbacks being called more than once
+ // and guard against a promise AND callback being used together.
+ var isResolved = false;
+ var wrappedSuccess = function () {
+ if (!isResolved) {
+ isResolved = true;
+ success.apply(this, arguments); // eslint-disable-line prefer-rest-params
+ }
+ };
+ var wrappedFailure = function () {
+ if (!isResolved) {
+ isResolved = true;
+ if (failure) {
+ failure.apply(this, arguments); // eslint-disable-line prefer-rest-params
+ }
+ }
+ };
+ var res = func(wrappedSuccess, wrappedFailure);
+ if (res && typeof res.then === 'function') {
+ res.then(wrappedSuccess, wrappedFailure);
+ }
+ }
+
+ var Emitter = /** @class */ (function () {
+ function Emitter() {
+ this.handlers = {};
+ this.thisContext = null;
+ }
+ Emitter.prototype.setThisContext = function (thisContext) {
+ this.thisContext = thisContext;
+ };
+ Emitter.prototype.setOptions = function (options) {
+ this.options = options;
+ };
+ Emitter.prototype.on = function (type, handler) {
+ addToHash(this.handlers, type, handler);
+ };
+ Emitter.prototype.off = function (type, handler) {
+ removeFromHash(this.handlers, type, handler);
+ };
+ Emitter.prototype.trigger = function (type) {
+ var args = [];
+ for (var _i = 1; _i < arguments.length; _i++) {
+ args[_i - 1] = arguments[_i];
+ }
+ var attachedHandlers = this.handlers[type] || [];
+ var optionHandler = this.options && this.options[type];
+ var handlers = [].concat(optionHandler || [], attachedHandlers);
+ for (var _a = 0, handlers_1 = handlers; _a < handlers_1.length; _a++) {
+ var handler = handlers_1[_a];
+ handler.apply(this.thisContext, args);
+ }
+ };
+ Emitter.prototype.hasHandlers = function (type) {
+ return (this.handlers[type] && this.handlers[type].length) ||
+ (this.options && this.options[type]);
+ };
+ return Emitter;
+ }());
+ function addToHash(hash, type, handler) {
+ (hash[type] || (hash[type] = []))
+ .push(handler);
+ }
+ function removeFromHash(hash, type, handler) {
+ if (handler) {
+ if (hash[type]) {
+ hash[type] = hash[type].filter(function (func) { return func !== handler; });
+ }
+ }
+ else {
+ delete hash[type]; // remove all handler funcs for this type
+ }
+ }
+
+ /*
+ Records offset information for a set of elements, relative to an origin element.
+ Can record the left/right OR the top/bottom OR both.
+ Provides methods for querying the cache by position.
+ */
+ var PositionCache = /** @class */ (function () {
+ function PositionCache(originEl, els, isHorizontal, isVertical) {
+ this.els = els;
+ var originClientRect = this.originClientRect = originEl.getBoundingClientRect(); // relative to viewport top-left
+ if (isHorizontal) {
+ this.buildElHorizontals(originClientRect.left);
+ }
+ if (isVertical) {
+ this.buildElVerticals(originClientRect.top);
+ }
+ }
+ // Populates the left/right internal coordinate arrays
+ PositionCache.prototype.buildElHorizontals = function (originClientLeft) {
+ var lefts = [];
+ var rights = [];
+ for (var _i = 0, _a = this.els; _i < _a.length; _i++) {
+ var el = _a[_i];
+ var rect = el.getBoundingClientRect();
+ lefts.push(rect.left - originClientLeft);
+ rights.push(rect.right - originClientLeft);
+ }
+ this.lefts = lefts;
+ this.rights = rights;
+ };
+ // Populates the top/bottom internal coordinate arrays
+ PositionCache.prototype.buildElVerticals = function (originClientTop) {
+ var tops = [];
+ var bottoms = [];
+ for (var _i = 0, _a = this.els; _i < _a.length; _i++) {
+ var el = _a[_i];
+ var rect = el.getBoundingClientRect();
+ tops.push(rect.top - originClientTop);
+ bottoms.push(rect.bottom - originClientTop);
+ }
+ this.tops = tops;
+ this.bottoms = bottoms;
+ };
+ // Given a left offset (from document left), returns the index of the el that it horizontally intersects.
+ // If no intersection is made, returns undefined.
+ PositionCache.prototype.leftToIndex = function (leftPosition) {
+ var _a = this, lefts = _a.lefts, rights = _a.rights;
+ var len = lefts.length;
+ var i;
+ for (i = 0; i < len; i += 1) {
+ if (leftPosition >= lefts[i] && leftPosition < rights[i]) {
+ return i;
+ }
+ }
+ return undefined; // TODO: better
+ };
+ // Given a top offset (from document top), returns the index of the el that it vertically intersects.
+ // If no intersection is made, returns undefined.
+ PositionCache.prototype.topToIndex = function (topPosition) {
+ var _a = this, tops = _a.tops, bottoms = _a.bottoms;
+ var len = tops.length;
+ var i;
+ for (i = 0; i < len; i += 1) {
+ if (topPosition >= tops[i] && topPosition < bottoms[i]) {
+ return i;
+ }
+ }
+ return undefined; // TODO: better
+ };
+ // Gets the width of the element at the given index
+ PositionCache.prototype.getWidth = function (leftIndex) {
+ return this.rights[leftIndex] - this.lefts[leftIndex];
+ };
+ // Gets the height of the element at the given index
+ PositionCache.prototype.getHeight = function (topIndex) {
+ return this.bottoms[topIndex] - this.tops[topIndex];
+ };
+ return PositionCache;
+ }());
+
+ /* eslint max-classes-per-file: "off" */
+ /*
+ An object for getting/setting scroll-related information for an element.
+ Internally, this is done very differently for window versus DOM element,
+ so this object serves as a common interface.
+ */
+ var ScrollController = /** @class */ (function () {
+ function ScrollController() {
+ }
+ ScrollController.prototype.getMaxScrollTop = function () {
+ return this.getScrollHeight() - this.getClientHeight();
+ };
+ ScrollController.prototype.getMaxScrollLeft = function () {
+ return this.getScrollWidth() - this.getClientWidth();
+ };
+ ScrollController.prototype.canScrollVertically = function () {
+ return this.getMaxScrollTop() > 0;
+ };
+ ScrollController.prototype.canScrollHorizontally = function () {
+ return this.getMaxScrollLeft() > 0;
+ };
+ ScrollController.prototype.canScrollUp = function () {
+ return this.getScrollTop() > 0;
+ };
+ ScrollController.prototype.canScrollDown = function () {
+ return this.getScrollTop() < this.getMaxScrollTop();
+ };
+ ScrollController.prototype.canScrollLeft = function () {
+ return this.getScrollLeft() > 0;
+ };
+ ScrollController.prototype.canScrollRight = function () {
+ return this.getScrollLeft() < this.getMaxScrollLeft();
+ };
+ return ScrollController;
+ }());
+ var ElementScrollController = /** @class */ (function (_super) {
+ __extends(ElementScrollController, _super);
+ function ElementScrollController(el) {
+ var _this = _super.call(this) || this;
+ _this.el = el;
+ return _this;
+ }
+ ElementScrollController.prototype.getScrollTop = function () {
+ return this.el.scrollTop;
+ };
+ ElementScrollController.prototype.getScrollLeft = function () {
+ return this.el.scrollLeft;
+ };
+ ElementScrollController.prototype.setScrollTop = function (top) {
+ this.el.scrollTop = top;
+ };
+ ElementScrollController.prototype.setScrollLeft = function (left) {
+ this.el.scrollLeft = left;
+ };
+ ElementScrollController.prototype.getScrollWidth = function () {
+ return this.el.scrollWidth;
+ };
+ ElementScrollController.prototype.getScrollHeight = function () {
+ return this.el.scrollHeight;
+ };
+ ElementScrollController.prototype.getClientHeight = function () {
+ return this.el.clientHeight;
+ };
+ ElementScrollController.prototype.getClientWidth = function () {
+ return this.el.clientWidth;
+ };
+ return ElementScrollController;
+ }(ScrollController));
+ var WindowScrollController = /** @class */ (function (_super) {
+ __extends(WindowScrollController, _super);
+ function WindowScrollController() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ WindowScrollController.prototype.getScrollTop = function () {
+ return window.pageYOffset;
+ };
+ WindowScrollController.prototype.getScrollLeft = function () {
+ return window.pageXOffset;
+ };
+ WindowScrollController.prototype.setScrollTop = function (n) {
+ window.scroll(window.pageXOffset, n);
+ };
+ WindowScrollController.prototype.setScrollLeft = function (n) {
+ window.scroll(n, window.pageYOffset);
+ };
+ WindowScrollController.prototype.getScrollWidth = function () {
+ return document.documentElement.scrollWidth;
+ };
+ WindowScrollController.prototype.getScrollHeight = function () {
+ return document.documentElement.scrollHeight;
+ };
+ WindowScrollController.prototype.getClientHeight = function () {
+ return document.documentElement.clientHeight;
+ };
+ WindowScrollController.prototype.getClientWidth = function () {
+ return document.documentElement.clientWidth;
+ };
+ return WindowScrollController;
+ }(ScrollController));
+
+ var Theme = /** @class */ (function () {
+ function Theme(calendarOptions) {
+ if (this.iconOverrideOption) {
+ this.setIconOverride(calendarOptions[this.iconOverrideOption]);
+ }
+ }
+ Theme.prototype.setIconOverride = function (iconOverrideHash) {
+ var iconClassesCopy;
+ var buttonName;
+ if (typeof iconOverrideHash === 'object' && iconOverrideHash) { // non-null object
+ iconClassesCopy = __assign({}, this.iconClasses);
+ for (buttonName in iconOverrideHash) {
+ iconClassesCopy[buttonName] = this.applyIconOverridePrefix(iconOverrideHash[buttonName]);
+ }
+ this.iconClasses = iconClassesCopy;
+ }
+ else if (iconOverrideHash === false) {
+ this.iconClasses = {};
+ }
+ };
+ Theme.prototype.applyIconOverridePrefix = function (className) {
+ var prefix = this.iconOverridePrefix;
+ if (prefix && className.indexOf(prefix) !== 0) { // if not already present
+ className = prefix + className;
+ }
+ return className;
+ };
+ Theme.prototype.getClass = function (key) {
+ return this.classes[key] || '';
+ };
+ Theme.prototype.getIconClass = function (buttonName, isRtl) {
+ var className;
+ if (isRtl && this.rtlIconClasses) {
+ className = this.rtlIconClasses[buttonName] || this.iconClasses[buttonName];
+ }
+ else {
+ className = this.iconClasses[buttonName];
+ }
+ if (className) {
+ return this.baseIconClass + " " + className;
+ }
+ return '';
+ };
+ Theme.prototype.getCustomButtonIconClass = function (customButtonProps) {
+ var className;
+ if (this.iconOverrideCustomButtonOption) {
+ className = customButtonProps[this.iconOverrideCustomButtonOption];
+ if (className) {
+ return this.baseIconClass + " " + this.applyIconOverridePrefix(className);
+ }
+ }
+ return '';
+ };
+ return Theme;
+ }());
+ Theme.prototype.classes = {};
+ Theme.prototype.iconClasses = {};
+ Theme.prototype.baseIconClass = '';
+ Theme.prototype.iconOverridePrefix = '';
+
+ /// arg. otherwise, will default to any???
+ var RenderHook = /** @class */ (function (_super) {
+ __extends(RenderHook, _super);
+ function RenderHook() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.rootElRef = createRef();
+ _this.handleRootEl = function (el) {
+ setRef(_this.rootElRef, el);
+ if (_this.props.elRef) {
+ setRef(_this.props.elRef, el);
+ }
+ };
+ return _this;
+ }
+ RenderHook.prototype.render = function () {
+ var _this = this;
+ var props = this.props;
+ var hookProps = props.hookProps;
+ return (createElement(MountHook, { hookProps: hookProps, didMount: props.didMount, willUnmount: props.willUnmount, elRef: this.handleRootEl }, function (rootElRef) { return (createElement(ContentHook, { hookProps: hookProps, content: props.content, defaultContent: props.defaultContent, backupElRef: _this.rootElRef }, function (innerElRef, innerContent) { return props.children(rootElRef, normalizeClassNames(props.classNames, hookProps), innerElRef, innerContent); })); }));
+ };
+ return RenderHook;
+ }(BaseComponent));
+ // TODO: rename to be about function, not default. use in above type
+ // for forcing rerender of components that use the ContentHook
+ var CustomContentRenderContext = createContext(0);
+ function ContentHook(props) {
+ return (createElement(CustomContentRenderContext.Consumer, null, function (renderId) { return (createElement(ContentHookInner, __assign({ renderId: renderId }, props))); }));
+ }
+ var ContentHookInner = /** @class */ (function (_super) {
+ __extends(ContentHookInner, _super);
+ function ContentHookInner() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.innerElRef = createRef();
+ return _this;
+ }
+ ContentHookInner.prototype.render = function () {
+ return this.props.children(this.innerElRef, this.renderInnerContent());
+ };
+ ContentHookInner.prototype.componentDidMount = function () {
+ this.updateCustomContent();
+ };
+ ContentHookInner.prototype.componentDidUpdate = function () {
+ this.updateCustomContent();
+ };
+ ContentHookInner.prototype.componentWillUnmount = function () {
+ if (this.customContentInfo && this.customContentInfo.destroy) {
+ this.customContentInfo.destroy();
+ }
+ };
+ ContentHookInner.prototype.renderInnerContent = function () {
+ var contentTypeHandlers = this.context.pluginHooks.contentTypeHandlers;
+ var _a = this, props = _a.props, customContentInfo = _a.customContentInfo;
+ var rawVal = props.content;
+ var innerContent = normalizeContent(rawVal, props.hookProps);
+ var innerContentVDom = null;
+ if (innerContent === undefined) { // use the default
+ innerContent = normalizeContent(props.defaultContent, props.hookProps);
+ }
+ if (innerContent !== undefined) { // we allow custom content handlers to return nothing
+ if (customContentInfo) {
+ customContentInfo.contentVal = innerContent[customContentInfo.contentKey];
+ }
+ else if (typeof innerContent === 'object') {
+ // look for a prop that would indicate a custom content handler is needed
+ for (var contentKey in contentTypeHandlers) {
+ if (innerContent[contentKey] !== undefined) {
+ var stuff = contentTypeHandlers[contentKey]();
+ customContentInfo = this.customContentInfo = __assign({ contentKey: contentKey, contentVal: innerContent[contentKey] }, stuff);
+ break;
+ }
+ }
+ }
+ if (customContentInfo) {
+ innerContentVDom = []; // signal that something was specified
+ }
+ else {
+ innerContentVDom = innerContent; // assume a [p]react vdom node. use it
+ }
+ }
+ return innerContentVDom;
+ };
+ ContentHookInner.prototype.updateCustomContent = function () {
+ if (this.customContentInfo) {
+ this.customContentInfo.render(this.innerElRef.current || this.props.backupElRef.current, // the element to render into
+ this.customContentInfo.contentVal);
+ }
+ };
+ return ContentHookInner;
+ }(BaseComponent));
+ var MountHook = /** @class */ (function (_super) {
+ __extends(MountHook, _super);
+ function MountHook() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.handleRootEl = function (rootEl) {
+ _this.rootEl = rootEl;
+ if (_this.props.elRef) {
+ setRef(_this.props.elRef, rootEl);
+ }
+ };
+ return _this;
+ }
+ MountHook.prototype.render = function () {
+ return this.props.children(this.handleRootEl);
+ };
+ MountHook.prototype.componentDidMount = function () {
+ var callback = this.props.didMount;
+ if (callback) {
+ callback(__assign(__assign({}, this.props.hookProps), { el: this.rootEl }));
+ }
+ };
+ MountHook.prototype.componentWillUnmount = function () {
+ var callback = this.props.willUnmount;
+ if (callback) {
+ callback(__assign(__assign({}, this.props.hookProps), { el: this.rootEl }));
+ }
+ };
+ return MountHook;
+ }(BaseComponent));
+ function buildClassNameNormalizer() {
+ var currentGenerator;
+ var currentHookProps;
+ var currentClassNames = [];
+ return function (generator, hookProps) {
+ if (!currentHookProps || !isPropsEqual(currentHookProps, hookProps) || generator !== currentGenerator) {
+ currentGenerator = generator;
+ currentHookProps = hookProps;
+ currentClassNames = normalizeClassNames(generator, hookProps);
+ }
+ return currentClassNames;
+ };
+ }
+ function normalizeClassNames(classNames, hookProps) {
+ if (typeof classNames === 'function') {
+ classNames = classNames(hookProps);
+ }
+ return parseClassNames(classNames);
+ }
+ function normalizeContent(input, hookProps) {
+ if (typeof input === 'function') {
+ return input(hookProps, createElement); // give the function the vdom-creation func
+ }
+ return input;
+ }
+
+ var ViewRoot = /** @class */ (function (_super) {
+ __extends(ViewRoot, _super);
+ function ViewRoot() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.normalizeClassNames = buildClassNameNormalizer();
+ return _this;
+ }
+ ViewRoot.prototype.render = function () {
+ var _a = this, props = _a.props, context = _a.context;
+ var options = context.options;
+ var hookProps = { view: context.viewApi };
+ var customClassNames = this.normalizeClassNames(options.viewClassNames, hookProps);
+ return (createElement(MountHook, { hookProps: hookProps, didMount: options.viewDidMount, willUnmount: options.viewWillUnmount, elRef: props.elRef }, function (rootElRef) { return props.children(rootElRef, ["fc-" + props.viewSpec.type + "-view", 'fc-view'].concat(customClassNames)); }));
+ };
+ return ViewRoot;
+ }(BaseComponent));
+
+ function parseViewConfigs(inputs) {
+ return mapHash(inputs, parseViewConfig);
+ }
+ function parseViewConfig(input) {
+ var rawOptions = typeof input === 'function' ?
+ { component: input } :
+ input;
+ var component = rawOptions.component;
+ if (rawOptions.content) {
+ component = createViewHookComponent(rawOptions);
+ // TODO: remove content/classNames/didMount/etc from options?
+ }
+ return {
+ superType: rawOptions.type,
+ component: component,
+ rawOptions: rawOptions,
+ };
+ }
+ function createViewHookComponent(options) {
+ return function (viewProps) { return (createElement(ViewContextType.Consumer, null, function (context) { return (createElement(ViewRoot, { viewSpec: context.viewSpec }, function (viewElRef, viewClassNames) {
+ var hookProps = __assign(__assign({}, viewProps), { nextDayThreshold: context.options.nextDayThreshold });
+ return (createElement(RenderHook, { hookProps: hookProps, classNames: options.classNames, content: options.content, didMount: options.didMount, willUnmount: options.willUnmount, elRef: viewElRef }, function (rootElRef, customClassNames, innerElRef, innerContent) { return (createElement("div", { className: viewClassNames.concat(customClassNames).join(' '), ref: rootElRef }, innerContent)); }));
+ })); })); };
+ }
+
+ function buildViewSpecs(defaultInputs, optionOverrides, dynamicOptionOverrides, localeDefaults) {
+ var defaultConfigs = parseViewConfigs(defaultInputs);
+ var overrideConfigs = parseViewConfigs(optionOverrides.views);
+ var viewDefs = compileViewDefs(defaultConfigs, overrideConfigs);
+ return mapHash(viewDefs, function (viewDef) { return buildViewSpec(viewDef, overrideConfigs, optionOverrides, dynamicOptionOverrides, localeDefaults); });
+ }
+ function buildViewSpec(viewDef, overrideConfigs, optionOverrides, dynamicOptionOverrides, localeDefaults) {
+ var durationInput = viewDef.overrides.duration ||
+ viewDef.defaults.duration ||
+ dynamicOptionOverrides.duration ||
+ optionOverrides.duration;
+ var duration = null;
+ var durationUnit = '';
+ var singleUnit = '';
+ var singleUnitOverrides = {};
+ if (durationInput) {
+ duration = createDurationCached(durationInput);
+ if (duration) { // valid?
+ var denom = greatestDurationDenominator(duration);
+ durationUnit = denom.unit;
+ if (denom.value === 1) {
+ singleUnit = durationUnit;
+ singleUnitOverrides = overrideConfigs[durationUnit] ? overrideConfigs[durationUnit].rawOptions : {};
+ }
+ }
+ }
+ var queryButtonText = function (optionsSubset) {
+ var buttonTextMap = optionsSubset.buttonText || {};
+ var buttonTextKey = viewDef.defaults.buttonTextKey;
+ if (buttonTextKey != null && buttonTextMap[buttonTextKey] != null) {
+ return buttonTextMap[buttonTextKey];
+ }
+ if (buttonTextMap[viewDef.type] != null) {
+ return buttonTextMap[viewDef.type];
+ }
+ if (buttonTextMap[singleUnit] != null) {
+ return buttonTextMap[singleUnit];
+ }
+ return null;
+ };
+ return {
+ type: viewDef.type,
+ component: viewDef.component,
+ duration: duration,
+ durationUnit: durationUnit,
+ singleUnit: singleUnit,
+ optionDefaults: viewDef.defaults,
+ optionOverrides: __assign(__assign({}, singleUnitOverrides), viewDef.overrides),
+ buttonTextOverride: queryButtonText(dynamicOptionOverrides) ||
+ queryButtonText(optionOverrides) || // constructor-specified buttonText lookup hash takes precedence
+ viewDef.overrides.buttonText,
+ buttonTextDefault: queryButtonText(localeDefaults) ||
+ viewDef.defaults.buttonText ||
+ queryButtonText(BASE_OPTION_DEFAULTS) ||
+ viewDef.type, // fall back to given view name
+ };
+ }
+ // hack to get memoization working
+ var durationInputMap = {};
+ function createDurationCached(durationInput) {
+ var json = JSON.stringify(durationInput);
+ var res = durationInputMap[json];
+ if (res === undefined) {
+ res = createDuration(durationInput);
+ durationInputMap[json] = res;
+ }
+ return res;
+ }
+
+ var DateProfileGenerator = /** @class */ (function () {
+ function DateProfileGenerator(props) {
+ this.props = props;
+ this.nowDate = getNow(props.nowInput, props.dateEnv);
+ this.initHiddenDays();
+ }
+ /* Date Range Computation
+ ------------------------------------------------------------------------------------------------------------------*/
+ // Builds a structure with info about what the dates/ranges will be for the "prev" view.
+ DateProfileGenerator.prototype.buildPrev = function (currentDateProfile, currentDate, forceToValid) {
+ var dateEnv = this.props.dateEnv;
+ var prevDate = dateEnv.subtract(dateEnv.startOf(currentDate, currentDateProfile.currentRangeUnit), // important for start-of-month
+ currentDateProfile.dateIncrement);
+ return this.build(prevDate, -1, forceToValid);
+ };
+ // Builds a structure with info about what the dates/ranges will be for the "next" view.
+ DateProfileGenerator.prototype.buildNext = function (currentDateProfile, currentDate, forceToValid) {
+ var dateEnv = this.props.dateEnv;
+ var nextDate = dateEnv.add(dateEnv.startOf(currentDate, currentDateProfile.currentRangeUnit), // important for start-of-month
+ currentDateProfile.dateIncrement);
+ return this.build(nextDate, 1, forceToValid);
+ };
+ // Builds a structure holding dates/ranges for rendering around the given date.
+ // Optional direction param indicates whether the date is being incremented/decremented
+ // from its previous value. decremented = -1, incremented = 1 (default).
+ DateProfileGenerator.prototype.build = function (currentDate, direction, forceToValid) {
+ if (forceToValid === void 0) { forceToValid = true; }
+ var props = this.props;
+ var validRange;
+ var currentInfo;
+ var isRangeAllDay;
+ var renderRange;
+ var activeRange;
+ var isValid;
+ validRange = this.buildValidRange();
+ validRange = this.trimHiddenDays(validRange);
+ if (forceToValid) {
+ currentDate = constrainMarkerToRange(currentDate, validRange);
+ }
+ currentInfo = this.buildCurrentRangeInfo(currentDate, direction);
+ isRangeAllDay = /^(year|month|week|day)$/.test(currentInfo.unit);
+ renderRange = this.buildRenderRange(this.trimHiddenDays(currentInfo.range), currentInfo.unit, isRangeAllDay);
+ renderRange = this.trimHiddenDays(renderRange);
+ activeRange = renderRange;
+ if (!props.showNonCurrentDates) {
+ activeRange = intersectRanges(activeRange, currentInfo.range);
+ }
+ activeRange = this.adjustActiveRange(activeRange);
+ activeRange = intersectRanges(activeRange, validRange); // might return null
+ // it's invalid if the originally requested date is not contained,
+ // or if the range is completely outside of the valid range.
+ isValid = rangesIntersect(currentInfo.range, validRange);
+ return {
+ // constraint for where prev/next operations can go and where events can be dragged/resized to.
+ // an object with optional start and end properties.
+ validRange: validRange,
+ // range the view is formally responsible for.
+ // for example, a month view might have 1st-31st, excluding padded dates
+ currentRange: currentInfo.range,
+ // name of largest unit being displayed, like "month" or "week"
+ currentRangeUnit: currentInfo.unit,
+ isRangeAllDay: isRangeAllDay,
+ // dates that display events and accept drag-n-drop
+ // will be `null` if no dates accept events
+ activeRange: activeRange,
+ // date range with a rendered skeleton
+ // includes not-active days that need some sort of DOM
+ renderRange: renderRange,
+ // Duration object that denotes the first visible time of any given day
+ slotMinTime: props.slotMinTime,
+ // Duration object that denotes the exclusive visible end time of any given day
+ slotMaxTime: props.slotMaxTime,
+ isValid: isValid,
+ // how far the current date will move for a prev/next operation
+ dateIncrement: this.buildDateIncrement(currentInfo.duration),
+ // pass a fallback (might be null) ^
+ };
+ };
+ // Builds an object with optional start/end properties.
+ // Indicates the minimum/maximum dates to display.
+ // not responsible for trimming hidden days.
+ DateProfileGenerator.prototype.buildValidRange = function () {
+ var input = this.props.validRangeInput;
+ var simpleInput = typeof input === 'function'
+ ? input.call(this.props.calendarApi, this.nowDate)
+ : input;
+ return this.refineRange(simpleInput) ||
+ { start: null, end: null }; // completely open-ended
+ };
+ // Builds a structure with info about the "current" range, the range that is
+ // highlighted as being the current month for example.
+ // See build() for a description of `direction`.
+ // Guaranteed to have `range` and `unit` properties. `duration` is optional.
+ DateProfileGenerator.prototype.buildCurrentRangeInfo = function (date, direction) {
+ var props = this.props;
+ var duration = null;
+ var unit = null;
+ var range = null;
+ var dayCount;
+ if (props.duration) {
+ duration = props.duration;
+ unit = props.durationUnit;
+ range = this.buildRangeFromDuration(date, direction, duration, unit);
+ }
+ else if ((dayCount = this.props.dayCount)) {
+ unit = 'day';
+ range = this.buildRangeFromDayCount(date, direction, dayCount);
+ }
+ else if ((range = this.buildCustomVisibleRange(date))) {
+ unit = props.dateEnv.greatestWholeUnit(range.start, range.end).unit;
+ }
+ else {
+ duration = this.getFallbackDuration();
+ unit = greatestDurationDenominator(duration).unit;
+ range = this.buildRangeFromDuration(date, direction, duration, unit);
+ }
+ return { duration: duration, unit: unit, range: range };
+ };
+ DateProfileGenerator.prototype.getFallbackDuration = function () {
+ return createDuration({ day: 1 });
+ };
+ // Returns a new activeRange to have time values (un-ambiguate)
+ // slotMinTime or slotMaxTime causes the range to expand.
+ DateProfileGenerator.prototype.adjustActiveRange = function (range) {
+ var _a = this.props, dateEnv = _a.dateEnv, usesMinMaxTime = _a.usesMinMaxTime, slotMinTime = _a.slotMinTime, slotMaxTime = _a.slotMaxTime;
+ var start = range.start, end = range.end;
+ if (usesMinMaxTime) {
+ // expand active range if slotMinTime is negative (why not when positive?)
+ if (asRoughDays(slotMinTime) < 0) {
+ start = startOfDay(start); // necessary?
+ start = dateEnv.add(start, slotMinTime);
+ }
+ // expand active range if slotMaxTime is beyond one day (why not when negative?)
+ if (asRoughDays(slotMaxTime) > 1) {
+ end = startOfDay(end); // necessary?
+ end = addDays(end, -1);
+ end = dateEnv.add(end, slotMaxTime);
+ }
+ }
+ return { start: start, end: end };
+ };
+ // Builds the "current" range when it is specified as an explicit duration.
+ // `unit` is the already-computed greatestDurationDenominator unit of duration.
+ DateProfileGenerator.prototype.buildRangeFromDuration = function (date, direction, duration, unit) {
+ var _a = this.props, dateEnv = _a.dateEnv, dateAlignment = _a.dateAlignment;
+ var start;
+ var end;
+ var res;
+ // compute what the alignment should be
+ if (!dateAlignment) {
+ var dateIncrement = this.props.dateIncrement;
+ if (dateIncrement) {
+ // use the smaller of the two units
+ if (asRoughMs(dateIncrement) < asRoughMs(duration)) {
+ dateAlignment = greatestDurationDenominator(dateIncrement).unit;
+ }
+ else {
+ dateAlignment = unit;
+ }
+ }
+ else {
+ dateAlignment = unit;
+ }
+ }
+ // if the view displays a single day or smaller
+ if (asRoughDays(duration) <= 1) {
+ if (this.isHiddenDay(start)) {
+ start = this.skipHiddenDays(start, direction);
+ start = startOfDay(start);
+ }
+ }
+ function computeRes() {
+ start = dateEnv.startOf(date, dateAlignment);
+ end = dateEnv.add(start, duration);
+ res = { start: start, end: end };
+ }
+ computeRes();
+ // if range is completely enveloped by hidden days, go past the hidden days
+ if (!this.trimHiddenDays(res)) {
+ date = this.skipHiddenDays(date, direction);
+ computeRes();
+ }
+ return res;
+ };
+ // Builds the "current" range when a dayCount is specified.
+ DateProfileGenerator.prototype.buildRangeFromDayCount = function (date, direction, dayCount) {
+ var _a = this.props, dateEnv = _a.dateEnv, dateAlignment = _a.dateAlignment;
+ var runningCount = 0;
+ var start = date;
+ var end;
+ if (dateAlignment) {
+ start = dateEnv.startOf(start, dateAlignment);
+ }
+ start = startOfDay(start);
+ start = this.skipHiddenDays(start, direction);
+ end = start;
+ do {
+ end = addDays(end, 1);
+ if (!this.isHiddenDay(end)) {
+ runningCount += 1;
+ }
+ } while (runningCount < dayCount);
+ return { start: start, end: end };
+ };
+ // Builds a normalized range object for the "visible" range,
+ // which is a way to define the currentRange and activeRange at the same time.
+ DateProfileGenerator.prototype.buildCustomVisibleRange = function (date) {
+ var props = this.props;
+ var input = props.visibleRangeInput;
+ var simpleInput = typeof input === 'function'
+ ? input.call(props.calendarApi, props.dateEnv.toDate(date))
+ : input;
+ var range = this.refineRange(simpleInput);
+ if (range && (range.start == null || range.end == null)) {
+ return null;
+ }
+ return range;
+ };
+ // Computes the range that will represent the element/cells for *rendering*,
+ // but which may have voided days/times.
+ // not responsible for trimming hidden days.
+ DateProfileGenerator.prototype.buildRenderRange = function (currentRange, currentRangeUnit, isRangeAllDay) {
+ return currentRange;
+ };
+ // Compute the duration value that should be added/substracted to the current date
+ // when a prev/next operation happens.
+ DateProfileGenerator.prototype.buildDateIncrement = function (fallback) {
+ var dateIncrement = this.props.dateIncrement;
+ var customAlignment;
+ if (dateIncrement) {
+ return dateIncrement;
+ }
+ if ((customAlignment = this.props.dateAlignment)) {
+ return createDuration(1, customAlignment);
+ }
+ if (fallback) {
+ return fallback;
+ }
+ return createDuration({ days: 1 });
+ };
+ DateProfileGenerator.prototype.refineRange = function (rangeInput) {
+ if (rangeInput) {
+ var range = parseRange(rangeInput, this.props.dateEnv);
+ if (range) {
+ range = computeVisibleDayRange(range);
+ }
+ return range;
+ }
+ return null;
+ };
+ /* Hidden Days
+ ------------------------------------------------------------------------------------------------------------------*/
+ // Initializes internal variables related to calculating hidden days-of-week
+ DateProfileGenerator.prototype.initHiddenDays = function () {
+ var hiddenDays = this.props.hiddenDays || []; // array of day-of-week indices that are hidden
+ var isHiddenDayHash = []; // is the day-of-week hidden? (hash with day-of-week-index -> bool)
+ var dayCnt = 0;
+ var i;
+ if (this.props.weekends === false) {
+ hiddenDays.push(0, 6); // 0=sunday, 6=saturday
+ }
+ for (i = 0; i < 7; i += 1) {
+ if (!(isHiddenDayHash[i] = hiddenDays.indexOf(i) !== -1)) {
+ dayCnt += 1;
+ }
+ }
+ if (!dayCnt) {
+ throw new Error('invalid hiddenDays'); // all days were hidden? bad.
+ }
+ this.isHiddenDayHash = isHiddenDayHash;
+ };
+ // Remove days from the beginning and end of the range that are computed as hidden.
+ // If the whole range is trimmed off, returns null
+ DateProfileGenerator.prototype.trimHiddenDays = function (range) {
+ var start = range.start, end = range.end;
+ if (start) {
+ start = this.skipHiddenDays(start);
+ }
+ if (end) {
+ end = this.skipHiddenDays(end, -1, true);
+ }
+ if (start == null || end == null || start < end) {
+ return { start: start, end: end };
+ }
+ return null;
+ };
+ // Is the current day hidden?
+ // `day` is a day-of-week index (0-6), or a Date (used for UTC)
+ DateProfileGenerator.prototype.isHiddenDay = function (day) {
+ if (day instanceof Date) {
+ day = day.getUTCDay();
+ }
+ return this.isHiddenDayHash[day];
+ };
+ // Incrementing the current day until it is no longer a hidden day, returning a copy.
+ // DOES NOT CONSIDER validRange!
+ // If the initial value of `date` is not a hidden day, don't do anything.
+ // Pass `isExclusive` as `true` if you are dealing with an end date.
+ // `inc` defaults to `1` (increment one day forward each time)
+ DateProfileGenerator.prototype.skipHiddenDays = function (date, inc, isExclusive) {
+ if (inc === void 0) { inc = 1; }
+ if (isExclusive === void 0) { isExclusive = false; }
+ while (this.isHiddenDayHash[(date.getUTCDay() + (isExclusive ? inc : 0) + 7) % 7]) {
+ date = addDays(date, inc);
+ }
+ return date;
+ };
+ return DateProfileGenerator;
+ }());
+
+ function reduceViewType(viewType, action) {
+ switch (action.type) {
+ case 'CHANGE_VIEW_TYPE':
+ viewType = action.viewType;
+ }
+ return viewType;
+ }
+
+ function reduceDynamicOptionOverrides(dynamicOptionOverrides, action) {
+ var _a;
+ switch (action.type) {
+ case 'SET_OPTION':
+ return __assign(__assign({}, dynamicOptionOverrides), (_a = {}, _a[action.optionName] = action.rawOptionValue, _a));
+ default:
+ return dynamicOptionOverrides;
+ }
+ }
+
+ function reduceDateProfile(currentDateProfile, action, currentDate, dateProfileGenerator) {
+ var dp;
+ switch (action.type) {
+ case 'CHANGE_VIEW_TYPE':
+ return dateProfileGenerator.build(action.dateMarker || currentDate);
+ case 'CHANGE_DATE':
+ return dateProfileGenerator.build(action.dateMarker);
+ case 'PREV':
+ dp = dateProfileGenerator.buildPrev(currentDateProfile, currentDate);
+ if (dp.isValid) {
+ return dp;
+ }
+ break;
+ case 'NEXT':
+ dp = dateProfileGenerator.buildNext(currentDateProfile, currentDate);
+ if (dp.isValid) {
+ return dp;
+ }
+ break;
+ }
+ return currentDateProfile;
+ }
+
+ function initEventSources(calendarOptions, dateProfile, context) {
+ var activeRange = dateProfile ? dateProfile.activeRange : null;
+ return addSources({}, parseInitialSources(calendarOptions, context), activeRange, context);
+ }
+ function reduceEventSources(eventSources, action, dateProfile, context) {
+ var activeRange = dateProfile ? dateProfile.activeRange : null; // need this check?
+ switch (action.type) {
+ case 'ADD_EVENT_SOURCES': // already parsed
+ return addSources(eventSources, action.sources, activeRange, context);
+ case 'REMOVE_EVENT_SOURCE':
+ return removeSource(eventSources, action.sourceId);
+ case 'PREV': // TODO: how do we track all actions that affect dateProfile :(
+ case 'NEXT':
+ case 'CHANGE_DATE':
+ case 'CHANGE_VIEW_TYPE':
+ if (dateProfile) {
+ return fetchDirtySources(eventSources, activeRange, context);
+ }
+ return eventSources;
+ case 'FETCH_EVENT_SOURCES':
+ return fetchSourcesByIds(eventSources, action.sourceIds ? // why no type?
+ arrayToHash(action.sourceIds) :
+ excludeStaticSources(eventSources, context), activeRange, action.isRefetch || false, context);
+ case 'RECEIVE_EVENTS':
+ case 'RECEIVE_EVENT_ERROR':
+ return receiveResponse$1(eventSources, action.sourceId, action.fetchId, action.fetchRange);
+ case 'REMOVE_ALL_EVENT_SOURCES':
+ return {};
+ default:
+ return eventSources;
+ }
+ }
+ function reduceEventSourcesNewTimeZone(eventSources, dateProfile, context) {
+ var activeRange = dateProfile ? dateProfile.activeRange : null; // need this check?
+ return fetchSourcesByIds(eventSources, excludeStaticSources(eventSources, context), activeRange, true, context);
+ }
+ function computeEventSourcesLoading(eventSources) {
+ for (var sourceId in eventSources) {
+ if (eventSources[sourceId].isFetching) {
+ return true;
+ }
+ }
+ return false;
+ }
+ function addSources(eventSourceHash, sources, fetchRange, context) {
+ var hash = {};
+ for (var _i = 0, sources_1 = sources; _i < sources_1.length; _i++) {
+ var source = sources_1[_i];
+ hash[source.sourceId] = source;
+ }
+ if (fetchRange) {
+ hash = fetchDirtySources(hash, fetchRange, context);
+ }
+ return __assign(__assign({}, eventSourceHash), hash);
+ }
+ function removeSource(eventSourceHash, sourceId) {
+ return filterHash(eventSourceHash, function (eventSource) { return eventSource.sourceId !== sourceId; });
+ }
+ function fetchDirtySources(sourceHash, fetchRange, context) {
+ return fetchSourcesByIds(sourceHash, filterHash(sourceHash, function (eventSource) { return isSourceDirty(eventSource, fetchRange, context); }), fetchRange, false, context);
+ }
+ function isSourceDirty(eventSource, fetchRange, context) {
+ if (!doesSourceNeedRange(eventSource, context)) {
+ return !eventSource.latestFetchId;
+ }
+ return !context.options.lazyFetching ||
+ !eventSource.fetchRange ||
+ eventSource.isFetching || // always cancel outdated in-progress fetches
+ fetchRange.start < eventSource.fetchRange.start ||
+ fetchRange.end > eventSource.fetchRange.end;
+ }
+ function fetchSourcesByIds(prevSources, sourceIdHash, fetchRange, isRefetch, context) {
+ var nextSources = {};
+ for (var sourceId in prevSources) {
+ var source = prevSources[sourceId];
+ if (sourceIdHash[sourceId]) {
+ nextSources[sourceId] = fetchSource$1(source, fetchRange, isRefetch, context);
+ }
+ else {
+ nextSources[sourceId] = source;
+ }
+ }
+ return nextSources;
+ }
+ function fetchSource$1(eventSource, fetchRange, isRefetch, context) {
+ var options = context.options, calendarApi = context.calendarApi;
+ var sourceDef = context.pluginHooks.eventSourceDefs[eventSource.sourceDefId];
+ var fetchId = guid();
+ sourceDef.fetch({
+ eventSource: eventSource,
+ range: fetchRange,
+ isRefetch: isRefetch,
+ context: context,
+ }, function (res) {
+ var rawEvents = res.rawEvents;
+ if (options.eventSourceSuccess) {
+ rawEvents = options.eventSourceSuccess.call(calendarApi, rawEvents, res.xhr) || rawEvents;
+ }
+ if (eventSource.success) {
+ rawEvents = eventSource.success.call(calendarApi, rawEvents, res.xhr) || rawEvents;
+ }
+ context.dispatch({
+ type: 'RECEIVE_EVENTS',
+ sourceId: eventSource.sourceId,
+ fetchId: fetchId,
+ fetchRange: fetchRange,
+ rawEvents: rawEvents,
+ });
+ }, function (error) {
+ console.warn(error.message, error);
+ if (options.eventSourceFailure) {
+ options.eventSourceFailure.call(calendarApi, error);
+ }
+ if (eventSource.failure) {
+ eventSource.failure(error);
+ }
+ context.dispatch({
+ type: 'RECEIVE_EVENT_ERROR',
+ sourceId: eventSource.sourceId,
+ fetchId: fetchId,
+ fetchRange: fetchRange,
+ error: error,
+ });
+ });
+ return __assign(__assign({}, eventSource), { isFetching: true, latestFetchId: fetchId });
+ }
+ function receiveResponse$1(sourceHash, sourceId, fetchId, fetchRange) {
+ var _a;
+ var eventSource = sourceHash[sourceId];
+ if (eventSource && // not already removed
+ fetchId === eventSource.latestFetchId) {
+ return __assign(__assign({}, sourceHash), (_a = {}, _a[sourceId] = __assign(__assign({}, eventSource), { isFetching: false, fetchRange: fetchRange }), _a));
+ }
+ return sourceHash;
+ }
+ function excludeStaticSources(eventSources, context) {
+ return filterHash(eventSources, function (eventSource) { return doesSourceNeedRange(eventSource, context); });
+ }
+ function parseInitialSources(rawOptions, context) {
+ var refiners = buildEventSourceRefiners(context);
+ var rawSources = [].concat(rawOptions.eventSources || []);
+ var sources = []; // parsed
+ if (rawOptions.initialEvents) {
+ rawSources.unshift(rawOptions.initialEvents);
+ }
+ if (rawOptions.events) {
+ rawSources.unshift(rawOptions.events);
+ }
+ for (var _i = 0, rawSources_1 = rawSources; _i < rawSources_1.length; _i++) {
+ var rawSource = rawSources_1[_i];
+ var source = parseEventSource(rawSource, context, refiners);
+ if (source) {
+ sources.push(source);
+ }
+ }
+ return sources;
+ }
+ function doesSourceNeedRange(eventSource, context) {
+ var defs = context.pluginHooks.eventSourceDefs;
+ return !defs[eventSource.sourceDefId].ignoreRange;
+ }
+
+ function reduceEventStore(eventStore, action, eventSources, dateProfile, context) {
+ switch (action.type) {
+ case 'RECEIVE_EVENTS': // raw
+ return receiveRawEvents(eventStore, eventSources[action.sourceId], action.fetchId, action.fetchRange, action.rawEvents, context);
+ case 'ADD_EVENTS': // already parsed, but not expanded
+ return addEvent(eventStore, action.eventStore, // new ones
+ dateProfile ? dateProfile.activeRange : null, context);
+ case 'RESET_EVENTS':
+ return action.eventStore;
+ case 'MERGE_EVENTS': // already parsed and expanded
+ return mergeEventStores(eventStore, action.eventStore);
+ case 'PREV': // TODO: how do we track all actions that affect dateProfile :(
+ case 'NEXT':
+ case 'CHANGE_DATE':
+ case 'CHANGE_VIEW_TYPE':
+ if (dateProfile) {
+ return expandRecurring(eventStore, dateProfile.activeRange, context);
+ }
+ return eventStore;
+ case 'REMOVE_EVENTS':
+ return excludeSubEventStore(eventStore, action.eventStore);
+ case 'REMOVE_EVENT_SOURCE':
+ return excludeEventsBySourceId(eventStore, action.sourceId);
+ case 'REMOVE_ALL_EVENT_SOURCES':
+ return filterEventStoreDefs(eventStore, function (eventDef) { return (!eventDef.sourceId // only keep events with no source id
+ ); });
+ case 'REMOVE_ALL_EVENTS':
+ return createEmptyEventStore();
+ default:
+ return eventStore;
+ }
+ }
+ function receiveRawEvents(eventStore, eventSource, fetchId, fetchRange, rawEvents, context) {
+ if (eventSource && // not already removed
+ fetchId === eventSource.latestFetchId // TODO: wish this logic was always in event-sources
+ ) {
+ var subset = parseEvents(transformRawEvents(rawEvents, eventSource, context), eventSource, context);
+ if (fetchRange) {
+ subset = expandRecurring(subset, fetchRange, context);
+ }
+ return mergeEventStores(excludeEventsBySourceId(eventStore, eventSource.sourceId), subset);
+ }
+ return eventStore;
+ }
+ function transformRawEvents(rawEvents, eventSource, context) {
+ var calEachTransform = context.options.eventDataTransform;
+ var sourceEachTransform = eventSource ? eventSource.eventDataTransform : null;
+ if (sourceEachTransform) {
+ rawEvents = transformEachRawEvent(rawEvents, sourceEachTransform);
+ }
+ if (calEachTransform) {
+ rawEvents = transformEachRawEvent(rawEvents, calEachTransform);
+ }
+ return rawEvents;
+ }
+ function transformEachRawEvent(rawEvents, func) {
+ var refinedEvents;
+ if (!func) {
+ refinedEvents = rawEvents;
+ }
+ else {
+ refinedEvents = [];
+ for (var _i = 0, rawEvents_1 = rawEvents; _i < rawEvents_1.length; _i++) {
+ var rawEvent = rawEvents_1[_i];
+ var refinedEvent = func(rawEvent);
+ if (refinedEvent) {
+ refinedEvents.push(refinedEvent);
+ }
+ else if (refinedEvent == null) {
+ refinedEvents.push(rawEvent);
+ } // if a different falsy value, do nothing
+ }
+ }
+ return refinedEvents;
+ }
+ function addEvent(eventStore, subset, expandRange, context) {
+ if (expandRange) {
+ subset = expandRecurring(subset, expandRange, context);
+ }
+ return mergeEventStores(eventStore, subset);
+ }
+ function rezoneEventStoreDates(eventStore, oldDateEnv, newDateEnv) {
+ var defs = eventStore.defs;
+ var instances = mapHash(eventStore.instances, function (instance) {
+ var def = defs[instance.defId];
+ if (def.allDay || def.recurringDef) {
+ return instance; // isn't dependent on timezone
+ }
+ return __assign(__assign({}, instance), { range: {
+ start: newDateEnv.createMarker(oldDateEnv.toDate(instance.range.start, instance.forcedStartTzo)),
+ end: newDateEnv.createMarker(oldDateEnv.toDate(instance.range.end, instance.forcedEndTzo)),
+ }, forcedStartTzo: newDateEnv.canComputeOffset ? null : instance.forcedStartTzo, forcedEndTzo: newDateEnv.canComputeOffset ? null : instance.forcedEndTzo });
+ });
+ return { defs: defs, instances: instances };
+ }
+ function excludeEventsBySourceId(eventStore, sourceId) {
+ return filterEventStoreDefs(eventStore, function (eventDef) { return eventDef.sourceId !== sourceId; });
+ }
+ // QUESTION: why not just return instances? do a general object-property-exclusion util
+ function excludeInstances(eventStore, removals) {
+ return {
+ defs: eventStore.defs,
+ instances: filterHash(eventStore.instances, function (instance) { return !removals[instance.instanceId]; }),
+ };
+ }
+
+ function reduceDateSelection(currentSelection, action) {
+ switch (action.type) {
+ case 'UNSELECT_DATES':
+ return null;
+ case 'SELECT_DATES':
+ return action.selection;
+ default:
+ return currentSelection;
+ }
+ }
+
+ function reduceSelectedEvent(currentInstanceId, action) {
+ switch (action.type) {
+ case 'UNSELECT_EVENT':
+ return '';
+ case 'SELECT_EVENT':
+ return action.eventInstanceId;
+ default:
+ return currentInstanceId;
+ }
+ }
+
+ function reduceEventDrag(currentDrag, action) {
+ var newDrag;
+ switch (action.type) {
+ case 'UNSET_EVENT_DRAG':
+ return null;
+ case 'SET_EVENT_DRAG':
+ newDrag = action.state;
+ return {
+ affectedEvents: newDrag.affectedEvents,
+ mutatedEvents: newDrag.mutatedEvents,
+ isEvent: newDrag.isEvent,
+ };
+ default:
+ return currentDrag;
+ }
+ }
+
+ function reduceEventResize(currentResize, action) {
+ var newResize;
+ switch (action.type) {
+ case 'UNSET_EVENT_RESIZE':
+ return null;
+ case 'SET_EVENT_RESIZE':
+ newResize = action.state;
+ return {
+ affectedEvents: newResize.affectedEvents,
+ mutatedEvents: newResize.mutatedEvents,
+ isEvent: newResize.isEvent,
+ };
+ default:
+ return currentResize;
+ }
+ }
+
+ function parseToolbars(calendarOptions, calendarOptionOverrides, theme, viewSpecs, calendarApi) {
+ var viewsWithButtons = [];
+ var headerToolbar = calendarOptions.headerToolbar ? parseToolbar(calendarOptions.headerToolbar, calendarOptions, calendarOptionOverrides, theme, viewSpecs, calendarApi, viewsWithButtons) : null;
+ var footerToolbar = calendarOptions.footerToolbar ? parseToolbar(calendarOptions.footerToolbar, calendarOptions, calendarOptionOverrides, theme, viewSpecs, calendarApi, viewsWithButtons) : null;
+ return { headerToolbar: headerToolbar, footerToolbar: footerToolbar, viewsWithButtons: viewsWithButtons };
+ }
+ function parseToolbar(sectionStrHash, calendarOptions, calendarOptionOverrides, theme, viewSpecs, calendarApi, viewsWithButtons) {
+ return mapHash(sectionStrHash, function (sectionStr) { return parseSection(sectionStr, calendarOptions, calendarOptionOverrides, theme, viewSpecs, calendarApi, viewsWithButtons); });
+ }
+ /*
+ BAD: querying icons and text here. should be done at render time
+ */
+ function parseSection(sectionStr, calendarOptions, calendarOptionOverrides, theme, viewSpecs, calendarApi, viewsWithButtons) {
+ var isRtl = calendarOptions.direction === 'rtl';
+ var calendarCustomButtons = calendarOptions.customButtons || {};
+ var calendarButtonTextOverrides = calendarOptionOverrides.buttonText || {};
+ var calendarButtonText = calendarOptions.buttonText || {};
+ var sectionSubstrs = sectionStr ? sectionStr.split(' ') : [];
+ return sectionSubstrs.map(function (buttonGroupStr) { return (buttonGroupStr.split(',').map(function (buttonName) {
+ if (buttonName === 'title') {
+ return { buttonName: buttonName };
+ }
+ var customButtonProps;
+ var viewSpec;
+ var buttonClick;
+ var buttonIcon; // only one of these will be set
+ var buttonText; // "
+ if ((customButtonProps = calendarCustomButtons[buttonName])) {
+ buttonClick = function (ev) {
+ if (customButtonProps.click) {
+ customButtonProps.click.call(ev.target, ev, ev.target); // TODO: use Calendar this context?
+ }
+ };
+ (buttonIcon = theme.getCustomButtonIconClass(customButtonProps)) ||
+ (buttonIcon = theme.getIconClass(buttonName, isRtl)) ||
+ (buttonText = customButtonProps.text);
+ }
+ else if ((viewSpec = viewSpecs[buttonName])) {
+ viewsWithButtons.push(buttonName);
+ buttonClick = function () {
+ calendarApi.changeView(buttonName);
+ };
+ (buttonText = viewSpec.buttonTextOverride) ||
+ (buttonIcon = theme.getIconClass(buttonName, isRtl)) ||
+ (buttonText = viewSpec.buttonTextDefault);
+ }
+ else if (calendarApi[buttonName]) { // a calendarApi method
+ buttonClick = function () {
+ calendarApi[buttonName]();
+ };
+ (buttonText = calendarButtonTextOverrides[buttonName]) ||
+ (buttonIcon = theme.getIconClass(buttonName, isRtl)) ||
+ (buttonText = calendarButtonText[buttonName]);
+ // ^ everything else is considered default
+ }
+ return { buttonName: buttonName, buttonClick: buttonClick, buttonIcon: buttonIcon, buttonText: buttonText };
+ })); });
+ }
+
+ var eventSourceDef$3 = {
+ ignoreRange: true,
+ parseMeta: function (refined) {
+ if (Array.isArray(refined.events)) {
+ return refined.events;
+ }
+ return null;
+ },
+ fetch: function (arg, success) {
+ success({
+ rawEvents: arg.eventSource.meta,
+ });
+ },
+ };
+ var arrayEventSourcePlugin = createPlugin({
+ eventSourceDefs: [eventSourceDef$3],
+ });
+
+ var eventSourceDef$2 = {
+ parseMeta: function (refined) {
+ if (typeof refined.events === 'function') {
+ return refined.events;
+ }
+ return null;
+ },
+ fetch: function (arg, success, failure) {
+ var dateEnv = arg.context.dateEnv;
+ var func = arg.eventSource.meta;
+ unpromisify(func.bind(null, buildRangeApiWithTimeZone(arg.range, dateEnv)), function (rawEvents) {
+ success({ rawEvents: rawEvents }); // needs an object response
+ }, failure);
+ },
+ };
+ var funcEventSourcePlugin = createPlugin({
+ eventSourceDefs: [eventSourceDef$2],
+ });
+
+ function requestJson(method, url, params, successCallback, failureCallback) {
+ method = method.toUpperCase();
+ var body = null;
+ if (method === 'GET') {
+ url = injectQueryStringParams(url, params);
+ }
+ else {
+ body = encodeParams(params);
+ }
+ var xhr = new XMLHttpRequest();
+ xhr.open(method, url, true);
+ if (method !== 'GET') {
+ xhr.setRequestHeader('Content-Type', 'application/x-www-form-urlencoded');
+ }
+ xhr.onload = function () {
+ if (xhr.status >= 200 && xhr.status < 400) {
+ var parsed = false;
+ var res = void 0;
+ try {
+ res = JSON.parse(xhr.responseText);
+ parsed = true;
+ }
+ catch (err) {
+ // will handle parsed=false
+ }
+ if (parsed) {
+ successCallback(res, xhr);
+ }
+ else {
+ failureCallback('Failure parsing JSON', xhr);
+ }
+ }
+ else {
+ failureCallback('Request failed', xhr);
+ }
+ };
+ xhr.onerror = function () {
+ failureCallback('Request failed', xhr);
+ };
+ xhr.send(body);
+ }
+ function injectQueryStringParams(url, params) {
+ return url +
+ (url.indexOf('?') === -1 ? '?' : '&') +
+ encodeParams(params);
+ }
+ function encodeParams(params) {
+ var parts = [];
+ for (var key in params) {
+ parts.push(encodeURIComponent(key) + "=" + encodeURIComponent(params[key]));
+ }
+ return parts.join('&');
+ }
+
+ var JSON_FEED_EVENT_SOURCE_REFINERS = {
+ method: String,
+ extraParams: identity,
+ startParam: String,
+ endParam: String,
+ timeZoneParam: String,
+ };
+
+ var eventSourceDef$1 = {
+ parseMeta: function (refined) {
+ if (refined.url && (refined.format === 'json' || !refined.format)) {
+ return {
+ url: refined.url,
+ format: 'json',
+ method: (refined.method || 'GET').toUpperCase(),
+ extraParams: refined.extraParams,
+ startParam: refined.startParam,
+ endParam: refined.endParam,
+ timeZoneParam: refined.timeZoneParam,
+ };
+ }
+ return null;
+ },
+ fetch: function (arg, success, failure) {
+ var meta = arg.eventSource.meta;
+ var requestParams = buildRequestParams$2(meta, arg.range, arg.context);
+ requestJson(meta.method, meta.url, requestParams, function (rawEvents, xhr) {
+ success({ rawEvents: rawEvents, xhr: xhr });
+ }, function (errorMessage, xhr) {
+ failure({ message: errorMessage, xhr: xhr });
+ });
+ },
+ };
+ var jsonFeedEventSourcePlugin = createPlugin({
+ eventSourceRefiners: JSON_FEED_EVENT_SOURCE_REFINERS,
+ eventSourceDefs: [eventSourceDef$1],
+ });
+ function buildRequestParams$2(meta, range, context) {
+ var dateEnv = context.dateEnv, options = context.options;
+ var startParam;
+ var endParam;
+ var timeZoneParam;
+ var customRequestParams;
+ var params = {};
+ startParam = meta.startParam;
+ if (startParam == null) {
+ startParam = options.startParam;
+ }
+ endParam = meta.endParam;
+ if (endParam == null) {
+ endParam = options.endParam;
+ }
+ timeZoneParam = meta.timeZoneParam;
+ if (timeZoneParam == null) {
+ timeZoneParam = options.timeZoneParam;
+ }
+ // retrieve any outbound GET/POST data from the options
+ if (typeof meta.extraParams === 'function') {
+ // supplied as a function that returns a key/value object
+ customRequestParams = meta.extraParams();
+ }
+ else {
+ // probably supplied as a straight key/value object
+ customRequestParams = meta.extraParams || {};
+ }
+ __assign(params, customRequestParams);
+ params[startParam] = dateEnv.formatIso(range.start);
+ params[endParam] = dateEnv.formatIso(range.end);
+ if (dateEnv.timeZone !== 'local') {
+ params[timeZoneParam] = dateEnv.timeZone;
+ }
+ return params;
+ }
+
+ var SIMPLE_RECURRING_REFINERS = {
+ daysOfWeek: identity,
+ startTime: createDuration,
+ endTime: createDuration,
+ duration: createDuration,
+ startRecur: identity,
+ endRecur: identity,
+ };
+
+ var recurring = {
+ parse: function (refined, dateEnv) {
+ if (refined.daysOfWeek || refined.startTime || refined.endTime || refined.startRecur || refined.endRecur) {
+ var recurringData = {
+ daysOfWeek: refined.daysOfWeek || null,
+ startTime: refined.startTime || null,
+ endTime: refined.endTime || null,
+ startRecur: refined.startRecur ? dateEnv.createMarker(refined.startRecur) : null,
+ endRecur: refined.endRecur ? dateEnv.createMarker(refined.endRecur) : null,
+ };
+ var duration = void 0;
+ if (refined.duration) {
+ duration = refined.duration;
+ }
+ if (!duration && refined.startTime && refined.endTime) {
+ duration = subtractDurations(refined.endTime, refined.startTime);
+ }
+ return {
+ allDayGuess: Boolean(!refined.startTime && !refined.endTime),
+ duration: duration,
+ typeData: recurringData, // doesn't need endTime anymore but oh well
+ };
+ }
+ return null;
+ },
+ expand: function (typeData, framingRange, dateEnv) {
+ var clippedFramingRange = intersectRanges(framingRange, { start: typeData.startRecur, end: typeData.endRecur });
+ if (clippedFramingRange) {
+ return expandRanges(typeData.daysOfWeek, typeData.startTime, clippedFramingRange, dateEnv);
+ }
+ return [];
+ },
+ };
+ var simpleRecurringEventsPlugin = createPlugin({
+ recurringTypes: [recurring],
+ eventRefiners: SIMPLE_RECURRING_REFINERS,
+ });
+ function expandRanges(daysOfWeek, startTime, framingRange, dateEnv) {
+ var dowHash = daysOfWeek ? arrayToHash(daysOfWeek) : null;
+ var dayMarker = startOfDay(framingRange.start);
+ var endMarker = framingRange.end;
+ var instanceStarts = [];
+ while (dayMarker < endMarker) {
+ var instanceStart
+ // if everyday, or this particular day-of-week
+ = void 0;
+ // if everyday, or this particular day-of-week
+ if (!dowHash || dowHash[dayMarker.getUTCDay()]) {
+ if (startTime) {
+ instanceStart = dateEnv.add(dayMarker, startTime);
+ }
+ else {
+ instanceStart = dayMarker;
+ }
+ instanceStarts.push(instanceStart);
+ }
+ dayMarker = addDays(dayMarker, 1);
+ }
+ return instanceStarts;
+ }
+
+ var changeHandlerPlugin = createPlugin({
+ optionChangeHandlers: {
+ events: function (events, context) {
+ handleEventSources([events], context);
+ },
+ eventSources: handleEventSources,
+ },
+ });
+ /*
+ BUG: if `event` was supplied, all previously-given `eventSources` will be wiped out
+ */
+ function handleEventSources(inputs, context) {
+ var unfoundSources = hashValuesToArray(context.getCurrentData().eventSources);
+ var newInputs = [];
+ for (var _i = 0, inputs_1 = inputs; _i < inputs_1.length; _i++) {
+ var input = inputs_1[_i];
+ var inputFound = false;
+ for (var i = 0; i < unfoundSources.length; i += 1) {
+ if (unfoundSources[i]._raw === input) {
+ unfoundSources.splice(i, 1); // delete
+ inputFound = true;
+ break;
+ }
+ }
+ if (!inputFound) {
+ newInputs.push(input);
+ }
+ }
+ for (var _a = 0, unfoundSources_1 = unfoundSources; _a < unfoundSources_1.length; _a++) {
+ var unfoundSource = unfoundSources_1[_a];
+ context.dispatch({
+ type: 'REMOVE_EVENT_SOURCE',
+ sourceId: unfoundSource.sourceId,
+ });
+ }
+ for (var _b = 0, newInputs_1 = newInputs; _b < newInputs_1.length; _b++) {
+ var newInput = newInputs_1[_b];
+ context.calendarApi.addEventSource(newInput);
+ }
+ }
+
+ function handleDateProfile(dateProfile, context) {
+ context.emitter.trigger('datesSet', __assign(__assign({}, buildRangeApiWithTimeZone(dateProfile.activeRange, context.dateEnv)), { view: context.viewApi }));
+ }
+
+ function handleEventStore(eventStore, context) {
+ var emitter = context.emitter;
+ if (emitter.hasHandlers('eventsSet')) {
+ emitter.trigger('eventsSet', buildEventApis(eventStore, context));
+ }
+ }
+
+ /*
+ this array is exposed on the root namespace so that UMD plugins can add to it.
+ see the rollup-bundles script.
+ */
+ var globalPlugins = [
+ arrayEventSourcePlugin,
+ funcEventSourcePlugin,
+ jsonFeedEventSourcePlugin,
+ simpleRecurringEventsPlugin,
+ changeHandlerPlugin,
+ createPlugin({
+ isLoadingFuncs: [
+ function (state) { return computeEventSourcesLoading(state.eventSources); },
+ ],
+ contentTypeHandlers: {
+ html: function () { return ({ render: injectHtml }); },
+ domNodes: function () { return ({ render: injectDomNodes }); },
+ },
+ propSetHandlers: {
+ dateProfile: handleDateProfile,
+ eventStore: handleEventStore,
+ },
+ }),
+ ];
+ function injectHtml(el, html) {
+ el.innerHTML = html;
+ }
+ function injectDomNodes(el, domNodes) {
+ var oldNodes = Array.prototype.slice.call(el.childNodes); // TODO: use array util
+ var newNodes = Array.prototype.slice.call(domNodes); // TODO: use array util
+ if (!isArraysEqual(oldNodes, newNodes)) {
+ for (var _i = 0, newNodes_1 = newNodes; _i < newNodes_1.length; _i++) {
+ var newNode = newNodes_1[_i];
+ el.appendChild(newNode);
+ }
+ oldNodes.forEach(removeElement);
+ }
+ }
+
+ var DelayedRunner = /** @class */ (function () {
+ function DelayedRunner(drainedOption) {
+ this.drainedOption = drainedOption;
+ this.isRunning = false;
+ this.isDirty = false;
+ this.pauseDepths = {};
+ this.timeoutId = 0;
+ }
+ DelayedRunner.prototype.request = function (delay) {
+ this.isDirty = true;
+ if (!this.isPaused()) {
+ this.clearTimeout();
+ if (delay == null) {
+ this.tryDrain();
+ }
+ else {
+ this.timeoutId = setTimeout(// NOT OPTIMAL! TODO: look at debounce
+ this.tryDrain.bind(this), delay);
+ }
+ }
+ };
+ DelayedRunner.prototype.pause = function (scope) {
+ if (scope === void 0) { scope = ''; }
+ var pauseDepths = this.pauseDepths;
+ pauseDepths[scope] = (pauseDepths[scope] || 0) + 1;
+ this.clearTimeout();
+ };
+ DelayedRunner.prototype.resume = function (scope, force) {
+ if (scope === void 0) { scope = ''; }
+ var pauseDepths = this.pauseDepths;
+ if (scope in pauseDepths) {
+ if (force) {
+ delete pauseDepths[scope];
+ }
+ else {
+ pauseDepths[scope] -= 1;
+ var depth = pauseDepths[scope];
+ if (depth <= 0) {
+ delete pauseDepths[scope];
+ }
+ }
+ this.tryDrain();
+ }
+ };
+ DelayedRunner.prototype.isPaused = function () {
+ return Object.keys(this.pauseDepths).length;
+ };
+ DelayedRunner.prototype.tryDrain = function () {
+ if (!this.isRunning && !this.isPaused()) {
+ this.isRunning = true;
+ while (this.isDirty) {
+ this.isDirty = false;
+ this.drained(); // might set isDirty to true again
+ }
+ this.isRunning = false;
+ }
+ };
+ DelayedRunner.prototype.clear = function () {
+ this.clearTimeout();
+ this.isDirty = false;
+ this.pauseDepths = {};
+ };
+ DelayedRunner.prototype.clearTimeout = function () {
+ if (this.timeoutId) {
+ clearTimeout(this.timeoutId);
+ this.timeoutId = 0;
+ }
+ };
+ DelayedRunner.prototype.drained = function () {
+ if (this.drainedOption) {
+ this.drainedOption();
+ }
+ };
+ return DelayedRunner;
+ }());
+
+ var TaskRunner = /** @class */ (function () {
+ function TaskRunner(runTaskOption, drainedOption) {
+ this.runTaskOption = runTaskOption;
+ this.drainedOption = drainedOption;
+ this.queue = [];
+ this.delayedRunner = new DelayedRunner(this.drain.bind(this));
+ }
+ TaskRunner.prototype.request = function (task, delay) {
+ this.queue.push(task);
+ this.delayedRunner.request(delay);
+ };
+ TaskRunner.prototype.pause = function (scope) {
+ this.delayedRunner.pause(scope);
+ };
+ TaskRunner.prototype.resume = function (scope, force) {
+ this.delayedRunner.resume(scope, force);
+ };
+ TaskRunner.prototype.drain = function () {
+ var queue = this.queue;
+ while (queue.length) {
+ var completedTasks = [];
+ var task = void 0;
+ while ((task = queue.shift())) {
+ this.runTask(task);
+ completedTasks.push(task);
+ }
+ this.drained(completedTasks);
+ } // keep going, in case new tasks were added in the drained handler
+ };
+ TaskRunner.prototype.runTask = function (task) {
+ if (this.runTaskOption) {
+ this.runTaskOption(task);
+ }
+ };
+ TaskRunner.prototype.drained = function (completedTasks) {
+ if (this.drainedOption) {
+ this.drainedOption(completedTasks);
+ }
+ };
+ return TaskRunner;
+ }());
+
+ // Computes what the title at the top of the calendarApi should be for this view
+ function buildTitle(dateProfile, viewOptions, dateEnv) {
+ var range;
+ // for views that span a large unit of time, show the proper interval, ignoring stray days before and after
+ if (/^(year|month)$/.test(dateProfile.currentRangeUnit)) {
+ range = dateProfile.currentRange;
+ }
+ else { // for day units or smaller, use the actual day range
+ range = dateProfile.activeRange;
+ }
+ return dateEnv.formatRange(range.start, range.end, createFormatter(viewOptions.titleFormat || buildTitleFormat(dateProfile)), {
+ isEndExclusive: dateProfile.isRangeAllDay,
+ defaultSeparator: viewOptions.titleRangeSeparator,
+ });
+ }
+ // Generates the format string that should be used to generate the title for the current date range.
+ // Attempts to compute the most appropriate format if not explicitly specified with `titleFormat`.
+ function buildTitleFormat(dateProfile) {
+ var currentRangeUnit = dateProfile.currentRangeUnit;
+ if (currentRangeUnit === 'year') {
+ return { year: 'numeric' };
+ }
+ if (currentRangeUnit === 'month') {
+ return { year: 'numeric', month: 'long' }; // like "September 2014"
+ }
+ var days = diffWholeDays(dateProfile.currentRange.start, dateProfile.currentRange.end);
+ if (days !== null && days > 1) {
+ // multi-day range. shorter, like "Sep 9 - 10 2014"
+ return { year: 'numeric', month: 'short', day: 'numeric' };
+ }
+ // one day. longer, like "September 9 2014"
+ return { year: 'numeric', month: 'long', day: 'numeric' };
+ }
+
+ // in future refactor, do the redux-style function(state=initial) for initial-state
+ // also, whatever is happening in constructor, have it happen in action queue too
+ var CalendarDataManager = /** @class */ (function () {
+ function CalendarDataManager(props) {
+ var _this = this;
+ this.computeOptionsData = memoize(this._computeOptionsData);
+ this.computeCurrentViewData = memoize(this._computeCurrentViewData);
+ this.organizeRawLocales = memoize(organizeRawLocales);
+ this.buildLocale = memoize(buildLocale);
+ this.buildPluginHooks = buildBuildPluginHooks();
+ this.buildDateEnv = memoize(buildDateEnv);
+ this.buildTheme = memoize(buildTheme);
+ this.parseToolbars = memoize(parseToolbars);
+ this.buildViewSpecs = memoize(buildViewSpecs);
+ this.buildDateProfileGenerator = memoizeObjArg(buildDateProfileGenerator);
+ this.buildViewApi = memoize(buildViewApi);
+ this.buildViewUiProps = memoizeObjArg(buildViewUiProps);
+ this.buildEventUiBySource = memoize(buildEventUiBySource, isPropsEqual);
+ this.buildEventUiBases = memoize(buildEventUiBases);
+ this.parseContextBusinessHours = memoizeObjArg(parseContextBusinessHours);
+ this.buildTitle = memoize(buildTitle);
+ this.emitter = new Emitter();
+ this.actionRunner = new TaskRunner(this._handleAction.bind(this), this.updateData.bind(this));
+ this.currentCalendarOptionsInput = {};
+ this.currentCalendarOptionsRefined = {};
+ this.currentViewOptionsInput = {};
+ this.currentViewOptionsRefined = {};
+ this.currentCalendarOptionsRefiners = {};
+ this.getCurrentData = function () { return _this.data; };
+ this.dispatch = function (action) {
+ _this.actionRunner.request(action); // protects against recursive calls to _handleAction
+ };
+ this.props = props;
+ this.actionRunner.pause();
+ var dynamicOptionOverrides = {};
+ var optionsData = this.computeOptionsData(props.optionOverrides, dynamicOptionOverrides, props.calendarApi);
+ var currentViewType = optionsData.calendarOptions.initialView || optionsData.pluginHooks.initialView;
+ var currentViewData = this.computeCurrentViewData(currentViewType, optionsData, props.optionOverrides, dynamicOptionOverrides);
+ // wire things up
+ // TODO: not DRY
+ props.calendarApi.currentDataManager = this;
+ this.emitter.setThisContext(props.calendarApi);
+ this.emitter.setOptions(currentViewData.options);
+ var currentDate = getInitialDate(optionsData.calendarOptions, optionsData.dateEnv);
+ var dateProfile = currentViewData.dateProfileGenerator.build(currentDate);
+ if (!rangeContainsMarker(dateProfile.activeRange, currentDate)) {
+ currentDate = dateProfile.currentRange.start;
+ }
+ var calendarContext = {
+ dateEnv: optionsData.dateEnv,
+ options: optionsData.calendarOptions,
+ pluginHooks: optionsData.pluginHooks,
+ calendarApi: props.calendarApi,
+ dispatch: this.dispatch,
+ emitter: this.emitter,
+ getCurrentData: this.getCurrentData,
+ };
+ // needs to be after setThisContext
+ for (var _i = 0, _a = optionsData.pluginHooks.contextInit; _i < _a.length; _i++) {
+ var callback = _a[_i];
+ callback(calendarContext);
+ }
+ // NOT DRY
+ var eventSources = initEventSources(optionsData.calendarOptions, dateProfile, calendarContext);
+ var initialState = {
+ dynamicOptionOverrides: dynamicOptionOverrides,
+ currentViewType: currentViewType,
+ currentDate: currentDate,
+ dateProfile: dateProfile,
+ businessHours: this.parseContextBusinessHours(calendarContext),
+ eventSources: eventSources,
+ eventUiBases: {},
+ eventStore: createEmptyEventStore(),
+ renderableEventStore: createEmptyEventStore(),
+ dateSelection: null,
+ eventSelection: '',
+ eventDrag: null,
+ eventResize: null,
+ selectionConfig: this.buildViewUiProps(calendarContext).selectionConfig,
+ };
+ var contextAndState = __assign(__assign({}, calendarContext), initialState);
+ for (var _b = 0, _c = optionsData.pluginHooks.reducers; _b < _c.length; _b++) {
+ var reducer = _c[_b];
+ __assign(initialState, reducer(null, null, contextAndState));
+ }
+ if (computeIsLoading(initialState, calendarContext)) {
+ this.emitter.trigger('loading', true); // NOT DRY
+ }
+ this.state = initialState;
+ this.updateData();
+ this.actionRunner.resume();
+ }
+ CalendarDataManager.prototype.resetOptions = function (optionOverrides, append) {
+ var props = this.props;
+ props.optionOverrides = append
+ ? __assign(__assign({}, props.optionOverrides), optionOverrides) : optionOverrides;
+ this.actionRunner.request({
+ type: 'NOTHING',
+ });
+ };
+ CalendarDataManager.prototype._handleAction = function (action) {
+ var _a = this, props = _a.props, state = _a.state, emitter = _a.emitter;
+ var dynamicOptionOverrides = reduceDynamicOptionOverrides(state.dynamicOptionOverrides, action);
+ var optionsData = this.computeOptionsData(props.optionOverrides, dynamicOptionOverrides, props.calendarApi);
+ var currentViewType = reduceViewType(state.currentViewType, action);
+ var currentViewData = this.computeCurrentViewData(currentViewType, optionsData, props.optionOverrides, dynamicOptionOverrides);
+ // wire things up
+ // TODO: not DRY
+ props.calendarApi.currentDataManager = this;
+ emitter.setThisContext(props.calendarApi);
+ emitter.setOptions(currentViewData.options);
+ var calendarContext = {
+ dateEnv: optionsData.dateEnv,
+ options: optionsData.calendarOptions,
+ pluginHooks: optionsData.pluginHooks,
+ calendarApi: props.calendarApi,
+ dispatch: this.dispatch,
+ emitter: emitter,
+ getCurrentData: this.getCurrentData,
+ };
+ var currentDate = state.currentDate, dateProfile = state.dateProfile;
+ if (this.data && this.data.dateProfileGenerator !== currentViewData.dateProfileGenerator) { // hack
+ dateProfile = currentViewData.dateProfileGenerator.build(currentDate);
+ }
+ currentDate = reduceCurrentDate(currentDate, action);
+ dateProfile = reduceDateProfile(dateProfile, action, currentDate, currentViewData.dateProfileGenerator);
+ if (action.type === 'PREV' || // TODO: move this logic into DateProfileGenerator
+ action.type === 'NEXT' || // "
+ !rangeContainsMarker(dateProfile.currentRange, currentDate)) {
+ currentDate = dateProfile.currentRange.start;
+ }
+ var eventSources = reduceEventSources(state.eventSources, action, dateProfile, calendarContext);
+ var eventStore = reduceEventStore(state.eventStore, action, eventSources, dateProfile, calendarContext);
+ var isEventsLoading = computeEventSourcesLoading(eventSources); // BAD. also called in this func in computeIsLoading
+ var renderableEventStore = (isEventsLoading && !currentViewData.options.progressiveEventRendering) ?
+ (state.renderableEventStore || eventStore) : // try from previous state
+ eventStore;
+ var _b = this.buildViewUiProps(calendarContext), eventUiSingleBase = _b.eventUiSingleBase, selectionConfig = _b.selectionConfig; // will memoize obj
+ var eventUiBySource = this.buildEventUiBySource(eventSources);
+ var eventUiBases = this.buildEventUiBases(renderableEventStore.defs, eventUiSingleBase, eventUiBySource);
+ var newState = {
+ dynamicOptionOverrides: dynamicOptionOverrides,
+ currentViewType: currentViewType,
+ currentDate: currentDate,
+ dateProfile: dateProfile,
+ eventSources: eventSources,
+ eventStore: eventStore,
+ renderableEventStore: renderableEventStore,
+ selectionConfig: selectionConfig,
+ eventUiBases: eventUiBases,
+ businessHours: this.parseContextBusinessHours(calendarContext),
+ dateSelection: reduceDateSelection(state.dateSelection, action),
+ eventSelection: reduceSelectedEvent(state.eventSelection, action),
+ eventDrag: reduceEventDrag(state.eventDrag, action),
+ eventResize: reduceEventResize(state.eventResize, action),
+ };
+ var contextAndState = __assign(__assign({}, calendarContext), newState);
+ for (var _i = 0, _c = optionsData.pluginHooks.reducers; _i < _c.length; _i++) {
+ var reducer = _c[_i];
+ __assign(newState, reducer(state, action, contextAndState)); // give the OLD state, for old value
+ }
+ var wasLoading = computeIsLoading(state, calendarContext);
+ var isLoading = computeIsLoading(newState, calendarContext);
+ // TODO: use propSetHandlers in plugin system
+ if (!wasLoading && isLoading) {
+ emitter.trigger('loading', true);
+ }
+ else if (wasLoading && !isLoading) {
+ emitter.trigger('loading', false);
+ }
+ this.state = newState;
+ if (props.onAction) {
+ props.onAction(action);
+ }
+ };
+ CalendarDataManager.prototype.updateData = function () {
+ var _a = this, props = _a.props, state = _a.state;
+ var oldData = this.data;
+ var optionsData = this.computeOptionsData(props.optionOverrides, state.dynamicOptionOverrides, props.calendarApi);
+ var currentViewData = this.computeCurrentViewData(state.currentViewType, optionsData, props.optionOverrides, state.dynamicOptionOverrides);
+ var data = this.data = __assign(__assign(__assign({ viewTitle: this.buildTitle(state.dateProfile, currentViewData.options, optionsData.dateEnv), calendarApi: props.calendarApi, dispatch: this.dispatch, emitter: this.emitter, getCurrentData: this.getCurrentData }, optionsData), currentViewData), state);
+ var changeHandlers = optionsData.pluginHooks.optionChangeHandlers;
+ var oldCalendarOptions = oldData && oldData.calendarOptions;
+ var newCalendarOptions = optionsData.calendarOptions;
+ if (oldCalendarOptions && oldCalendarOptions !== newCalendarOptions) {
+ if (oldCalendarOptions.timeZone !== newCalendarOptions.timeZone) {
+ // hack
+ state.eventSources = data.eventSources = reduceEventSourcesNewTimeZone(data.eventSources, state.dateProfile, data);
+ state.eventStore = data.eventStore = rezoneEventStoreDates(data.eventStore, oldData.dateEnv, data.dateEnv);
+ }
+ for (var optionName in changeHandlers) {
+ if (oldCalendarOptions[optionName] !== newCalendarOptions[optionName]) {
+ changeHandlers[optionName](newCalendarOptions[optionName], data);
+ }
+ }
+ }
+ if (props.onData) {
+ props.onData(data);
+ }
+ };
+ CalendarDataManager.prototype._computeOptionsData = function (optionOverrides, dynamicOptionOverrides, calendarApi) {
+ // TODO: blacklist options that are handled by optionChangeHandlers
+ var _a = this.processRawCalendarOptions(optionOverrides, dynamicOptionOverrides), refinedOptions = _a.refinedOptions, pluginHooks = _a.pluginHooks, localeDefaults = _a.localeDefaults, availableLocaleData = _a.availableLocaleData, extra = _a.extra;
+ warnUnknownOptions(extra);
+ var dateEnv = this.buildDateEnv(refinedOptions.timeZone, refinedOptions.locale, refinedOptions.weekNumberCalculation, refinedOptions.firstDay, refinedOptions.weekText, pluginHooks, availableLocaleData, refinedOptions.defaultRangeSeparator);
+ var viewSpecs = this.buildViewSpecs(pluginHooks.views, optionOverrides, dynamicOptionOverrides, localeDefaults);
+ var theme = this.buildTheme(refinedOptions, pluginHooks);
+ var toolbarConfig = this.parseToolbars(refinedOptions, optionOverrides, theme, viewSpecs, calendarApi);
+ return {
+ calendarOptions: refinedOptions,
+ pluginHooks: pluginHooks,
+ dateEnv: dateEnv,
+ viewSpecs: viewSpecs,
+ theme: theme,
+ toolbarConfig: toolbarConfig,
+ localeDefaults: localeDefaults,
+ availableRawLocales: availableLocaleData.map,
+ };
+ };
+ // always called from behind a memoizer
+ CalendarDataManager.prototype.processRawCalendarOptions = function (optionOverrides, dynamicOptionOverrides) {
+ var _a = mergeRawOptions([
+ BASE_OPTION_DEFAULTS,
+ optionOverrides,
+ dynamicOptionOverrides,
+ ]), locales = _a.locales, locale = _a.locale;
+ var availableLocaleData = this.organizeRawLocales(locales);
+ var availableRawLocales = availableLocaleData.map;
+ var localeDefaults = this.buildLocale(locale || availableLocaleData.defaultCode, availableRawLocales).options;
+ var pluginHooks = this.buildPluginHooks(optionOverrides.plugins || [], globalPlugins);
+ var refiners = this.currentCalendarOptionsRefiners = __assign(__assign(__assign(__assign(__assign({}, BASE_OPTION_REFINERS), CALENDAR_LISTENER_REFINERS), CALENDAR_OPTION_REFINERS), pluginHooks.listenerRefiners), pluginHooks.optionRefiners);
+ var extra = {};
+ var raw = mergeRawOptions([
+ BASE_OPTION_DEFAULTS,
+ localeDefaults,
+ optionOverrides,
+ dynamicOptionOverrides,
+ ]);
+ var refined = {};
+ var currentRaw = this.currentCalendarOptionsInput;
+ var currentRefined = this.currentCalendarOptionsRefined;
+ var anyChanges = false;
+ for (var optionName in raw) {
+ if (optionName !== 'plugins') { // because plugins is special-cased
+ if (raw[optionName] === currentRaw[optionName] ||
+ (COMPLEX_OPTION_COMPARATORS[optionName] &&
+ (optionName in currentRaw) &&
+ COMPLEX_OPTION_COMPARATORS[optionName](currentRaw[optionName], raw[optionName]))) {
+ refined[optionName] = currentRefined[optionName];
+ }
+ else if (refiners[optionName]) {
+ refined[optionName] = refiners[optionName](raw[optionName]);
+ anyChanges = true;
+ }
+ else {
+ extra[optionName] = currentRaw[optionName];
+ }
+ }
+ }
+ if (anyChanges) {
+ this.currentCalendarOptionsInput = raw;
+ this.currentCalendarOptionsRefined = refined;
+ }
+ return {
+ rawOptions: this.currentCalendarOptionsInput,
+ refinedOptions: this.currentCalendarOptionsRefined,
+ pluginHooks: pluginHooks,
+ availableLocaleData: availableLocaleData,
+ localeDefaults: localeDefaults,
+ extra: extra,
+ };
+ };
+ CalendarDataManager.prototype._computeCurrentViewData = function (viewType, optionsData, optionOverrides, dynamicOptionOverrides) {
+ var viewSpec = optionsData.viewSpecs[viewType];
+ if (!viewSpec) {
+ throw new Error("viewType \"" + viewType + "\" is not available. Please make sure you've loaded all neccessary plugins");
+ }
+ var _a = this.processRawViewOptions(viewSpec, optionsData.pluginHooks, optionsData.localeDefaults, optionOverrides, dynamicOptionOverrides), refinedOptions = _a.refinedOptions, extra = _a.extra;
+ warnUnknownOptions(extra);
+ var dateProfileGenerator = this.buildDateProfileGenerator({
+ dateProfileGeneratorClass: viewSpec.optionDefaults.dateProfileGeneratorClass,
+ duration: viewSpec.duration,
+ durationUnit: viewSpec.durationUnit,
+ usesMinMaxTime: viewSpec.optionDefaults.usesMinMaxTime,
+ dateEnv: optionsData.dateEnv,
+ calendarApi: this.props.calendarApi,
+ slotMinTime: refinedOptions.slotMinTime,
+ slotMaxTime: refinedOptions.slotMaxTime,
+ showNonCurrentDates: refinedOptions.showNonCurrentDates,
+ dayCount: refinedOptions.dayCount,
+ dateAlignment: refinedOptions.dateAlignment,
+ dateIncrement: refinedOptions.dateIncrement,
+ hiddenDays: refinedOptions.hiddenDays,
+ weekends: refinedOptions.weekends,
+ nowInput: refinedOptions.now,
+ validRangeInput: refinedOptions.validRange,
+ visibleRangeInput: refinedOptions.visibleRange,
+ monthMode: refinedOptions.monthMode,
+ fixedWeekCount: refinedOptions.fixedWeekCount,
+ });
+ var viewApi = this.buildViewApi(viewType, this.getCurrentData, optionsData.dateEnv);
+ return { viewSpec: viewSpec, options: refinedOptions, dateProfileGenerator: dateProfileGenerator, viewApi: viewApi };
+ };
+ CalendarDataManager.prototype.processRawViewOptions = function (viewSpec, pluginHooks, localeDefaults, optionOverrides, dynamicOptionOverrides) {
+ var raw = mergeRawOptions([
+ BASE_OPTION_DEFAULTS,
+ viewSpec.optionDefaults,
+ localeDefaults,
+ optionOverrides,
+ viewSpec.optionOverrides,
+ dynamicOptionOverrides,
+ ]);
+ var refiners = __assign(__assign(__assign(__assign(__assign(__assign({}, BASE_OPTION_REFINERS), CALENDAR_LISTENER_REFINERS), CALENDAR_OPTION_REFINERS), VIEW_OPTION_REFINERS), pluginHooks.listenerRefiners), pluginHooks.optionRefiners);
+ var refined = {};
+ var currentRaw = this.currentViewOptionsInput;
+ var currentRefined = this.currentViewOptionsRefined;
+ var anyChanges = false;
+ var extra = {};
+ for (var optionName in raw) {
+ if (raw[optionName] === currentRaw[optionName]) {
+ refined[optionName] = currentRefined[optionName];
+ }
+ else {
+ if (raw[optionName] === this.currentCalendarOptionsInput[optionName]) {
+ if (optionName in this.currentCalendarOptionsRefined) { // might be an "extra" prop
+ refined[optionName] = this.currentCalendarOptionsRefined[optionName];
+ }
+ }
+ else if (refiners[optionName]) {
+ refined[optionName] = refiners[optionName](raw[optionName]);
+ }
+ else {
+ extra[optionName] = raw[optionName];
+ }
+ anyChanges = true;
+ }
+ }
+ if (anyChanges) {
+ this.currentViewOptionsInput = raw;
+ this.currentViewOptionsRefined = refined;
+ }
+ return {
+ rawOptions: this.currentViewOptionsInput,
+ refinedOptions: this.currentViewOptionsRefined,
+ extra: extra,
+ };
+ };
+ return CalendarDataManager;
+ }());
+ function buildDateEnv(timeZone, explicitLocale, weekNumberCalculation, firstDay, weekText, pluginHooks, availableLocaleData, defaultSeparator) {
+ var locale = buildLocale(explicitLocale || availableLocaleData.defaultCode, availableLocaleData.map);
+ return new DateEnv({
+ calendarSystem: 'gregory',
+ timeZone: timeZone,
+ namedTimeZoneImpl: pluginHooks.namedTimeZonedImpl,
+ locale: locale,
+ weekNumberCalculation: weekNumberCalculation,
+ firstDay: firstDay,
+ weekText: weekText,
+ cmdFormatter: pluginHooks.cmdFormatter,
+ defaultSeparator: defaultSeparator,
+ });
+ }
+ function buildTheme(options, pluginHooks) {
+ var ThemeClass = pluginHooks.themeClasses[options.themeSystem] || StandardTheme;
+ return new ThemeClass(options);
+ }
+ function buildDateProfileGenerator(props) {
+ var DateProfileGeneratorClass = props.dateProfileGeneratorClass || DateProfileGenerator;
+ return new DateProfileGeneratorClass(props);
+ }
+ function buildViewApi(type, getCurrentData, dateEnv) {
+ return new ViewApi(type, getCurrentData, dateEnv);
+ }
+ function buildEventUiBySource(eventSources) {
+ return mapHash(eventSources, function (eventSource) { return eventSource.ui; });
+ }
+ function buildEventUiBases(eventDefs, eventUiSingleBase, eventUiBySource) {
+ var eventUiBases = { '': eventUiSingleBase };
+ for (var defId in eventDefs) {
+ var def = eventDefs[defId];
+ if (def.sourceId && eventUiBySource[def.sourceId]) {
+ eventUiBases[defId] = eventUiBySource[def.sourceId];
+ }
+ }
+ return eventUiBases;
+ }
+ function buildViewUiProps(calendarContext) {
+ var options = calendarContext.options;
+ return {
+ eventUiSingleBase: createEventUi({
+ display: options.eventDisplay,
+ editable: options.editable,
+ startEditable: options.eventStartEditable,
+ durationEditable: options.eventDurationEditable,
+ constraint: options.eventConstraint,
+ overlap: typeof options.eventOverlap === 'boolean' ? options.eventOverlap : undefined,
+ allow: options.eventAllow,
+ backgroundColor: options.eventBackgroundColor,
+ borderColor: options.eventBorderColor,
+ textColor: options.eventTextColor,
+ color: options.eventColor,
+ // classNames: options.eventClassNames // render hook will handle this
+ }, calendarContext),
+ selectionConfig: createEventUi({
+ constraint: options.selectConstraint,
+ overlap: typeof options.selectOverlap === 'boolean' ? options.selectOverlap : undefined,
+ allow: options.selectAllow,
+ }, calendarContext),
+ };
+ }
+ function computeIsLoading(state, context) {
+ for (var _i = 0, _a = context.pluginHooks.isLoadingFuncs; _i < _a.length; _i++) {
+ var isLoadingFunc = _a[_i];
+ if (isLoadingFunc(state)) {
+ return true;
+ }
+ }
+ return false;
+ }
+ function parseContextBusinessHours(calendarContext) {
+ return parseBusinessHours(calendarContext.options.businessHours, calendarContext);
+ }
+ function warnUnknownOptions(options, viewName) {
+ for (var optionName in options) {
+ console.warn("Unknown option '" + optionName + "'" +
+ (viewName ? " for view '" + viewName + "'" : ''));
+ }
+ }
+
+ // TODO: move this to react plugin?
+ var CalendarDataProvider = /** @class */ (function (_super) {
+ __extends(CalendarDataProvider, _super);
+ function CalendarDataProvider(props) {
+ var _this = _super.call(this, props) || this;
+ _this.handleData = function (data) {
+ if (!_this.dataManager) { // still within initial run, before assignment in constructor
+ // eslint-disable-next-line react/no-direct-mutation-state
+ _this.state = data; // can't use setState yet
+ }
+ else {
+ _this.setState(data);
+ }
+ };
+ _this.dataManager = new CalendarDataManager({
+ optionOverrides: props.optionOverrides,
+ calendarApi: props.calendarApi,
+ onData: _this.handleData,
+ });
+ return _this;
+ }
+ CalendarDataProvider.prototype.render = function () {
+ return this.props.children(this.state);
+ };
+ CalendarDataProvider.prototype.componentDidUpdate = function (prevProps) {
+ var newOptionOverrides = this.props.optionOverrides;
+ if (newOptionOverrides !== prevProps.optionOverrides) { // prevent recursive handleData
+ this.dataManager.resetOptions(newOptionOverrides);
+ }
+ };
+ return CalendarDataProvider;
+ }(Component));
+
+ // HELPERS
+ /*
+ if nextDayThreshold is specified, slicing is done in an all-day fashion.
+ you can get nextDayThreshold from context.nextDayThreshold
+ */
+ function sliceEvents(props, allDay) {
+ return sliceEventStore(props.eventStore, props.eventUiBases, props.dateProfile.activeRange, allDay ? props.nextDayThreshold : null).fg;
+ }
+
+ var NamedTimeZoneImpl = /** @class */ (function () {
+ function NamedTimeZoneImpl(timeZoneName) {
+ this.timeZoneName = timeZoneName;
+ }
+ return NamedTimeZoneImpl;
+ }());
+
+ var SegHierarchy = /** @class */ (function () {
+ function SegHierarchy() {
+ // settings
+ this.strictOrder = false;
+ this.allowReslicing = false;
+ this.maxCoord = -1; // -1 means no max
+ this.maxStackCnt = -1; // -1 means no max
+ this.levelCoords = []; // ordered
+ this.entriesByLevel = []; // parallel with levelCoords
+ this.stackCnts = {}; // TODO: use better technique!?
+ }
+ SegHierarchy.prototype.addSegs = function (inputs) {
+ var hiddenEntries = [];
+ for (var _i = 0, inputs_1 = inputs; _i < inputs_1.length; _i++) {
+ var input = inputs_1[_i];
+ this.insertEntry(input, hiddenEntries);
+ }
+ return hiddenEntries;
+ };
+ SegHierarchy.prototype.insertEntry = function (entry, hiddenEntries) {
+ var insertion = this.findInsertion(entry);
+ if (this.isInsertionValid(insertion, entry)) {
+ this.insertEntryAt(entry, insertion);
+ return 1;
+ }
+ return this.handleInvalidInsertion(insertion, entry, hiddenEntries);
+ };
+ SegHierarchy.prototype.isInsertionValid = function (insertion, entry) {
+ return (this.maxCoord === -1 || insertion.levelCoord + entry.thickness <= this.maxCoord) &&
+ (this.maxStackCnt === -1 || insertion.stackCnt < this.maxStackCnt);
+ };
+ // returns number of new entries inserted
+ SegHierarchy.prototype.handleInvalidInsertion = function (insertion, entry, hiddenEntries) {
+ if (this.allowReslicing && insertion.touchingEntry) {
+ return this.splitEntry(entry, insertion.touchingEntry, hiddenEntries);
+ }
+ hiddenEntries.push(entry);
+ return 0;
+ };
+ SegHierarchy.prototype.splitEntry = function (entry, barrier, hiddenEntries) {
+ var partCnt = 0;
+ var splitHiddenEntries = [];
+ var entrySpan = entry.span;
+ var barrierSpan = barrier.span;
+ if (entrySpan.start < barrierSpan.start) {
+ partCnt += this.insertEntry({
+ index: entry.index,
+ thickness: entry.thickness,
+ span: { start: entrySpan.start, end: barrierSpan.start },
+ }, splitHiddenEntries);
+ }
+ if (entrySpan.end > barrierSpan.end) {
+ partCnt += this.insertEntry({
+ index: entry.index,
+ thickness: entry.thickness,
+ span: { start: barrierSpan.end, end: entrySpan.end },
+ }, splitHiddenEntries);
+ }
+ if (partCnt) {
+ hiddenEntries.push.apply(hiddenEntries, __spreadArray([{
+ index: entry.index,
+ thickness: entry.thickness,
+ span: intersectSpans(barrierSpan, entrySpan), // guaranteed to intersect
+ }], splitHiddenEntries));
+ return partCnt;
+ }
+ hiddenEntries.push(entry);
+ return 0;
+ };
+ SegHierarchy.prototype.insertEntryAt = function (entry, insertion) {
+ var _a = this, entriesByLevel = _a.entriesByLevel, levelCoords = _a.levelCoords;
+ var destLevel = insertion.level;
+ if (destLevel >= levelCoords.length || // level doesn't exist yet
+ levelCoords[destLevel] > insertion.levelCoord // destLevel needs to be pushed forward to make way
+ ) {
+ // create a new level
+ insertAt(levelCoords, destLevel, insertion.levelCoord);
+ insertAt(entriesByLevel, destLevel, [entry]);
+ }
+ else {
+ // insert into existing level
+ insertAt(entriesByLevel[destLevel], insertion.lateralEnd, entry);
+ }
+ this.stackCnts[buildEntryKey(entry)] = insertion.stackCnt;
+ };
+ SegHierarchy.prototype.findInsertion = function (newEntry) {
+ var _a = this, levelCoords = _a.levelCoords, entriesByLevel = _a.entriesByLevel, stackCnts = _a.stackCnts, strictOrder = _a.strictOrder;
+ var levelCnt = levelCoords.length;
+ var resLevelCoord = 0;
+ var resLevel = 0;
+ var lateralStart = 0;
+ var lateralEnd = 0;
+ var touchingLevel = -1;
+ var touchingEntry = null; // last touch entry
+ for (var level = 0; level < levelCnt; level += 1) {
+ var levelCoord = levelCoords[level];
+ // if the current level is past the placed entry, we have found a good empty space and can stop.
+ // if strictOrder, keep finding more lateral intersections.
+ if (!strictOrder && levelCoord >= resLevelCoord + newEntry.thickness) {
+ break;
+ }
+ var entries = entriesByLevel[level];
+ var entry = void 0;
+ var searchRes = binarySearch(entries, newEntry.span.start, getEntrySpanEnd);
+ lateralStart = searchRes[0] + searchRes[1]; // if exact match (which doesn't collide), go to next one
+ lateralEnd = lateralStart; // also functions as a moving index
+ while ( // loop through entries that horizontally intersect
+ (entry = entries[lateralEnd]) && // but not past the whole entry list
+ entry.span.start < newEntry.span.end // and not entirely past newEntry
+ ) {
+ if (strictOrder || // strict-mode doesn't care about vert intersection. record touch and keep pushing down
+ ( // vertically intersects?
+ resLevelCoord < levelCoord + entry.thickness &&
+ resLevelCoord + newEntry.thickness > levelCoord)) {
+ // push down the potential destination
+ resLevelCoord = levelCoord + entry.thickness; // move to bottom of colliding entry
+ touchingLevel = level;
+ touchingEntry = entry;
+ }
+ lateralEnd += 1;
+ }
+ // regardless of whether there were collisions in the current level,
+ // keep updating the final-destination level until it goes past the final-destination coord.
+ if (levelCoord < resLevelCoord) {
+ resLevel = level + 1;
+ }
+ }
+ return {
+ level: resLevel,
+ levelCoord: resLevelCoord,
+ lateralStart: lateralStart,
+ lateralEnd: lateralEnd,
+ touchingLevel: touchingLevel,
+ touchingEntry: touchingEntry,
+ stackCnt: touchingEntry ? stackCnts[buildEntryKey(touchingEntry)] + 1 : 0,
+ };
+ };
+ // sorted by levelCoord (lowest to highest)
+ SegHierarchy.prototype.toRects = function () {
+ var _a = this, entriesByLevel = _a.entriesByLevel, levelCoords = _a.levelCoords;
+ var levelCnt = entriesByLevel.length;
+ var rects = [];
+ for (var level = 0; level < levelCnt; level += 1) {
+ var entries = entriesByLevel[level];
+ var levelCoord = levelCoords[level];
+ for (var _i = 0, entries_1 = entries; _i < entries_1.length; _i++) {
+ var entry = entries_1[_i];
+ rects.push(__assign(__assign({}, entry), { levelCoord: levelCoord }));
+ }
+ }
+ return rects;
+ };
+ return SegHierarchy;
+ }());
+ function getEntrySpanEnd(entry) {
+ return entry.span.end;
+ }
+ function buildEntryKey(entry) {
+ return entry.index + ':' + entry.span.start;
+ }
+ // returns groups with entries sorted by input order
+ function groupIntersectingEntries(entries) {
+ var merges = [];
+ for (var _i = 0, entries_2 = entries; _i < entries_2.length; _i++) {
+ var entry = entries_2[_i];
+ var filteredMerges = [];
+ var hungryMerge = {
+ span: entry.span,
+ entries: [entry],
+ };
+ for (var _a = 0, merges_1 = merges; _a < merges_1.length; _a++) {
+ var merge = merges_1[_a];
+ if (intersectSpans(merge.span, hungryMerge.span)) {
+ hungryMerge = {
+ entries: merge.entries.concat(hungryMerge.entries),
+ span: joinSpans(merge.span, hungryMerge.span),
+ };
+ }
+ else {
+ filteredMerges.push(merge);
+ }
+ }
+ filteredMerges.push(hungryMerge);
+ merges = filteredMerges;
+ }
+ return merges;
+ }
+ function joinSpans(span0, span1) {
+ return {
+ start: Math.min(span0.start, span1.start),
+ end: Math.max(span0.end, span1.end),
+ };
+ }
+ function intersectSpans(span0, span1) {
+ var start = Math.max(span0.start, span1.start);
+ var end = Math.min(span0.end, span1.end);
+ if (start < end) {
+ return { start: start, end: end };
+ }
+ return null;
+ }
+ // general util
+ // ---------------------------------------------------------------------------------------------------------------------
+ function insertAt(arr, index, item) {
+ arr.splice(index, 0, item);
+ }
+ function binarySearch(a, searchVal, getItemVal) {
+ var startIndex = 0;
+ var endIndex = a.length; // exclusive
+ if (!endIndex || searchVal < getItemVal(a[startIndex])) { // no items OR before first item
+ return [0, 0];
+ }
+ if (searchVal > getItemVal(a[endIndex - 1])) { // after last item
+ return [endIndex, 0];
+ }
+ while (startIndex < endIndex) {
+ var middleIndex = Math.floor(startIndex + (endIndex - startIndex) / 2);
+ var middleVal = getItemVal(a[middleIndex]);
+ if (searchVal < middleVal) {
+ endIndex = middleIndex;
+ }
+ else if (searchVal > middleVal) {
+ startIndex = middleIndex + 1;
+ }
+ else { // equal!
+ return [middleIndex, 1];
+ }
+ }
+ return [startIndex, 0];
+ }
+
+ var Interaction = /** @class */ (function () {
+ function Interaction(settings) {
+ this.component = settings.component;
+ this.isHitComboAllowed = settings.isHitComboAllowed || null;
+ }
+ Interaction.prototype.destroy = function () {
+ };
+ return Interaction;
+ }());
+ function parseInteractionSettings(component, input) {
+ return {
+ component: component,
+ el: input.el,
+ useEventCenter: input.useEventCenter != null ? input.useEventCenter : true,
+ isHitComboAllowed: input.isHitComboAllowed || null,
+ };
+ }
+ function interactionSettingsToStore(settings) {
+ var _a;
+ return _a = {},
+ _a[settings.component.uid] = settings,
+ _a;
+ }
+ // global state
+ var interactionSettingsStore = {};
+
+ /*
+ An abstraction for a dragging interaction originating on an event.
+ Does higher-level things than PointerDragger, such as possibly:
+ - a "mirror" that moves with the pointer
+ - a minimum number of pixels or other criteria for a true drag to begin
+
+ subclasses must emit:
+ - pointerdown
+ - dragstart
+ - dragmove
+ - pointerup
+ - dragend
+ */
+ var ElementDragging = /** @class */ (function () {
+ function ElementDragging(el, selector) {
+ this.emitter = new Emitter();
+ }
+ ElementDragging.prototype.destroy = function () {
+ };
+ ElementDragging.prototype.setMirrorIsVisible = function (bool) {
+ // optional if subclass doesn't want to support a mirror
+ };
+ ElementDragging.prototype.setMirrorNeedsRevert = function (bool) {
+ // optional if subclass doesn't want to support a mirror
+ };
+ ElementDragging.prototype.setAutoScrollEnabled = function (bool) {
+ // optional
+ };
+ return ElementDragging;
+ }());
+
+ // TODO: get rid of this in favor of options system,
+ // tho it's really easy to access this globally rather than pass thru options.
+ var config = {};
+
+ /*
+ Information about what will happen when an external element is dragged-and-dropped
+ onto a calendar. Contains information for creating an event.
+ */
+ var DRAG_META_REFINERS = {
+ startTime: createDuration,
+ duration: createDuration,
+ create: Boolean,
+ sourceId: String,
+ };
+ function parseDragMeta(raw) {
+ var _a = refineProps(raw, DRAG_META_REFINERS), refined = _a.refined, extra = _a.extra;
+ return {
+ startTime: refined.startTime || null,
+ duration: refined.duration || null,
+ create: refined.create != null ? refined.create : true,
+ sourceId: refined.sourceId,
+ leftoverProps: extra,
+ };
+ }
+
+ var ToolbarSection = /** @class */ (function (_super) {
+ __extends(ToolbarSection, _super);
+ function ToolbarSection() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ ToolbarSection.prototype.render = function () {
+ var _this = this;
+ var children = this.props.widgetGroups.map(function (widgetGroup) { return _this.renderWidgetGroup(widgetGroup); });
+ return createElement.apply(void 0, __spreadArray(['div', { className: 'fc-toolbar-chunk' }], children));
+ };
+ ToolbarSection.prototype.renderWidgetGroup = function (widgetGroup) {
+ var props = this.props;
+ var theme = this.context.theme;
+ var children = [];
+ var isOnlyButtons = true;
+ for (var _i = 0, widgetGroup_1 = widgetGroup; _i < widgetGroup_1.length; _i++) {
+ var widget = widgetGroup_1[_i];
+ var buttonName = widget.buttonName, buttonClick = widget.buttonClick, buttonText = widget.buttonText, buttonIcon = widget.buttonIcon;
+ if (buttonName === 'title') {
+ isOnlyButtons = false;
+ children.push(createElement("h2", { className: "fc-toolbar-title" }, props.title));
+ }
+ else {
+ var ariaAttrs = buttonIcon ? { 'aria-label': buttonName } : {};
+ var buttonClasses = ["fc-" + buttonName + "-button", theme.getClass('button')];
+ if (buttonName === props.activeButton) {
+ buttonClasses.push(theme.getClass('buttonActive'));
+ }
+ var isDisabled = (!props.isTodayEnabled && buttonName === 'today') ||
+ (!props.isPrevEnabled && buttonName === 'prev') ||
+ (!props.isNextEnabled && buttonName === 'next');
+ children.push(createElement("button", __assign({ disabled: isDisabled, className: buttonClasses.join(' '), onClick: buttonClick, type: "button" }, ariaAttrs), buttonText || (buttonIcon ? createElement("span", { className: buttonIcon }) : '')));
+ }
+ }
+ if (children.length > 1) {
+ var groupClassName = (isOnlyButtons && theme.getClass('buttonGroup')) || '';
+ return createElement.apply(void 0, __spreadArray(['div', { className: groupClassName }], children));
+ }
+ return children[0];
+ };
+ return ToolbarSection;
+ }(BaseComponent));
+
+ var Toolbar = /** @class */ (function (_super) {
+ __extends(Toolbar, _super);
+ function Toolbar() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ Toolbar.prototype.render = function () {
+ var _a = this.props, model = _a.model, extraClassName = _a.extraClassName;
+ var forceLtr = false;
+ var startContent;
+ var endContent;
+ var centerContent = model.center;
+ if (model.left) {
+ forceLtr = true;
+ startContent = model.left;
+ }
+ else {
+ startContent = model.start;
+ }
+ if (model.right) {
+ forceLtr = true;
+ endContent = model.right;
+ }
+ else {
+ endContent = model.end;
+ }
+ var classNames = [
+ extraClassName || '',
+ 'fc-toolbar',
+ forceLtr ? 'fc-toolbar-ltr' : '',
+ ];
+ return (createElement("div", { className: classNames.join(' ') },
+ this.renderSection('start', startContent || []),
+ this.renderSection('center', centerContent || []),
+ this.renderSection('end', endContent || [])));
+ };
+ Toolbar.prototype.renderSection = function (key, widgetGroups) {
+ var props = this.props;
+ return (createElement(ToolbarSection, { key: key, widgetGroups: widgetGroups, title: props.title, activeButton: props.activeButton, isTodayEnabled: props.isTodayEnabled, isPrevEnabled: props.isPrevEnabled, isNextEnabled: props.isNextEnabled }));
+ };
+ return Toolbar;
+ }(BaseComponent));
+
+ // TODO: do function component?
+ var ViewContainer = /** @class */ (function (_super) {
+ __extends(ViewContainer, _super);
+ function ViewContainer() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.state = {
+ availableWidth: null,
+ };
+ _this.handleEl = function (el) {
+ _this.el = el;
+ setRef(_this.props.elRef, el);
+ _this.updateAvailableWidth();
+ };
+ _this.handleResize = function () {
+ _this.updateAvailableWidth();
+ };
+ return _this;
+ }
+ ViewContainer.prototype.render = function () {
+ var _a = this, props = _a.props, state = _a.state;
+ var aspectRatio = props.aspectRatio;
+ var classNames = [
+ 'fc-view-harness',
+ (aspectRatio || props.liquid || props.height)
+ ? 'fc-view-harness-active' // harness controls the height
+ : 'fc-view-harness-passive', // let the view do the height
+ ];
+ var height = '';
+ var paddingBottom = '';
+ if (aspectRatio) {
+ if (state.availableWidth !== null) {
+ height = state.availableWidth / aspectRatio;
+ }
+ else {
+ // while waiting to know availableWidth, we can't set height to *zero*
+ // because will cause lots of unnecessary scrollbars within scrollgrid.
+ // BETTER: don't start rendering ANYTHING yet until we know container width
+ // NOTE: why not always use paddingBottom? Causes height oscillation (issue 5606)
+ paddingBottom = (1 / aspectRatio) * 100 + "%";
+ }
+ }
+ else {
+ height = props.height || '';
+ }
+ return (createElement("div", { ref: this.handleEl, onClick: props.onClick, className: classNames.join(' '), style: { height: height, paddingBottom: paddingBottom } }, props.children));
+ };
+ ViewContainer.prototype.componentDidMount = function () {
+ this.context.addResizeHandler(this.handleResize);
+ };
+ ViewContainer.prototype.componentWillUnmount = function () {
+ this.context.removeResizeHandler(this.handleResize);
+ };
+ ViewContainer.prototype.updateAvailableWidth = function () {
+ if (this.el && // needed. but why?
+ this.props.aspectRatio // aspectRatio is the only height setting that needs availableWidth
+ ) {
+ this.setState({ availableWidth: this.el.offsetWidth });
+ }
+ };
+ return ViewContainer;
+ }(BaseComponent));
+
+ /*
+ Detects when the user clicks on an event within a DateComponent
+ */
+ var EventClicking = /** @class */ (function (_super) {
+ __extends(EventClicking, _super);
+ function EventClicking(settings) {
+ var _this = _super.call(this, settings) || this;
+ _this.handleSegClick = function (ev, segEl) {
+ var component = _this.component;
+ var context = component.context;
+ var seg = getElSeg(segEl);
+ if (seg && // might be the surrounding the more link
+ component.isValidSegDownEl(ev.target)) {
+ // our way to simulate a link click for elements that can't be
tags
+ // grab before trigger fired in case trigger trashes DOM thru rerendering
+ var hasUrlContainer = elementClosest(ev.target, '.fc-event-forced-url');
+ var url = hasUrlContainer ? hasUrlContainer.querySelector('a[href]').href : '';
+ context.emitter.trigger('eventClick', {
+ el: segEl,
+ event: new EventApi(component.context, seg.eventRange.def, seg.eventRange.instance),
+ jsEvent: ev,
+ view: context.viewApi,
+ });
+ if (url && !ev.defaultPrevented) {
+ window.location.href = url;
+ }
+ }
+ };
+ _this.destroy = listenBySelector(settings.el, 'click', '.fc-event', // on both fg and bg events
+ _this.handleSegClick);
+ return _this;
+ }
+ return EventClicking;
+ }(Interaction));
+
+ /*
+ Triggers events and adds/removes core classNames when the user's pointer
+ enters/leaves event-elements of a component.
+ */
+ var EventHovering = /** @class */ (function (_super) {
+ __extends(EventHovering, _super);
+ function EventHovering(settings) {
+ var _this = _super.call(this, settings) || this;
+ // for simulating an eventMouseLeave when the event el is destroyed while mouse is over it
+ _this.handleEventElRemove = function (el) {
+ if (el === _this.currentSegEl) {
+ _this.handleSegLeave(null, _this.currentSegEl);
+ }
+ };
+ _this.handleSegEnter = function (ev, segEl) {
+ if (getElSeg(segEl)) { // TODO: better way to make sure not hovering over more+ link or its wrapper
+ _this.currentSegEl = segEl;
+ _this.triggerEvent('eventMouseEnter', ev, segEl);
+ }
+ };
+ _this.handleSegLeave = function (ev, segEl) {
+ if (_this.currentSegEl) {
+ _this.currentSegEl = null;
+ _this.triggerEvent('eventMouseLeave', ev, segEl);
+ }
+ };
+ _this.removeHoverListeners = listenToHoverBySelector(settings.el, '.fc-event', // on both fg and bg events
+ _this.handleSegEnter, _this.handleSegLeave);
+ return _this;
+ }
+ EventHovering.prototype.destroy = function () {
+ this.removeHoverListeners();
+ };
+ EventHovering.prototype.triggerEvent = function (publicEvName, ev, segEl) {
+ var component = this.component;
+ var context = component.context;
+ var seg = getElSeg(segEl);
+ if (!ev || component.isValidSegDownEl(ev.target)) {
+ context.emitter.trigger(publicEvName, {
+ el: segEl,
+ event: new EventApi(context, seg.eventRange.def, seg.eventRange.instance),
+ jsEvent: ev,
+ view: context.viewApi,
+ });
+ }
+ };
+ return EventHovering;
+ }(Interaction));
+
+ var CalendarContent = /** @class */ (function (_super) {
+ __extends(CalendarContent, _super);
+ function CalendarContent() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.buildViewContext = memoize(buildViewContext);
+ _this.buildViewPropTransformers = memoize(buildViewPropTransformers);
+ _this.buildToolbarProps = memoize(buildToolbarProps);
+ _this.handleNavLinkClick = buildDelegationHandler('a[data-navlink]', _this._handleNavLinkClick.bind(_this));
+ _this.headerRef = createRef();
+ _this.footerRef = createRef();
+ _this.interactionsStore = {};
+ // Component Registration
+ // -----------------------------------------------------------------------------------------------------------------
+ _this.registerInteractiveComponent = function (component, settingsInput) {
+ var settings = parseInteractionSettings(component, settingsInput);
+ var DEFAULT_INTERACTIONS = [
+ EventClicking,
+ EventHovering,
+ ];
+ var interactionClasses = DEFAULT_INTERACTIONS.concat(_this.props.pluginHooks.componentInteractions);
+ var interactions = interactionClasses.map(function (TheInteractionClass) { return new TheInteractionClass(settings); });
+ _this.interactionsStore[component.uid] = interactions;
+ interactionSettingsStore[component.uid] = settings;
+ };
+ _this.unregisterInteractiveComponent = function (component) {
+ for (var _i = 0, _a = _this.interactionsStore[component.uid]; _i < _a.length; _i++) {
+ var listener = _a[_i];
+ listener.destroy();
+ }
+ delete _this.interactionsStore[component.uid];
+ delete interactionSettingsStore[component.uid];
+ };
+ // Resizing
+ // -----------------------------------------------------------------------------------------------------------------
+ _this.resizeRunner = new DelayedRunner(function () {
+ _this.props.emitter.trigger('_resize', true); // should window resizes be considered "forced" ?
+ _this.props.emitter.trigger('windowResize', { view: _this.props.viewApi });
+ });
+ _this.handleWindowResize = function (ev) {
+ var options = _this.props.options;
+ if (options.handleWindowResize &&
+ ev.target === window // avoid jqui events
+ ) {
+ _this.resizeRunner.request(options.windowResizeDelay);
+ }
+ };
+ return _this;
+ }
+ /*
+ renders INSIDE of an outer div
+ */
+ CalendarContent.prototype.render = function () {
+ var props = this.props;
+ var toolbarConfig = props.toolbarConfig, options = props.options;
+ var toolbarProps = this.buildToolbarProps(props.viewSpec, props.dateProfile, props.dateProfileGenerator, props.currentDate, getNow(props.options.now, props.dateEnv), // TODO: use NowTimer????
+ props.viewTitle);
+ var viewVGrow = false;
+ var viewHeight = '';
+ var viewAspectRatio;
+ if (props.isHeightAuto || props.forPrint) {
+ viewHeight = '';
+ }
+ else if (options.height != null) {
+ viewVGrow = true;
+ }
+ else if (options.contentHeight != null) {
+ viewHeight = options.contentHeight;
+ }
+ else {
+ viewAspectRatio = Math.max(options.aspectRatio, 0.5); // prevent from getting too tall
+ }
+ var viewContext = this.buildViewContext(props.viewSpec, props.viewApi, props.options, props.dateProfileGenerator, props.dateEnv, props.theme, props.pluginHooks, props.dispatch, props.getCurrentData, props.emitter, props.calendarApi, this.registerInteractiveComponent, this.unregisterInteractiveComponent);
+ return (createElement(ViewContextType.Provider, { value: viewContext },
+ toolbarConfig.headerToolbar && (createElement(Toolbar, __assign({ ref: this.headerRef, extraClassName: "fc-header-toolbar", model: toolbarConfig.headerToolbar }, toolbarProps))),
+ createElement(ViewContainer, { liquid: viewVGrow, height: viewHeight, aspectRatio: viewAspectRatio, onClick: this.handleNavLinkClick },
+ this.renderView(props),
+ this.buildAppendContent()),
+ toolbarConfig.footerToolbar && (createElement(Toolbar, __assign({ ref: this.footerRef, extraClassName: "fc-footer-toolbar", model: toolbarConfig.footerToolbar }, toolbarProps)))));
+ };
+ CalendarContent.prototype.componentDidMount = function () {
+ var props = this.props;
+ this.calendarInteractions = props.pluginHooks.calendarInteractions
+ .map(function (CalendarInteractionClass) { return new CalendarInteractionClass(props); });
+ window.addEventListener('resize', this.handleWindowResize);
+ var propSetHandlers = props.pluginHooks.propSetHandlers;
+ for (var propName in propSetHandlers) {
+ propSetHandlers[propName](props[propName], props);
+ }
+ };
+ CalendarContent.prototype.componentDidUpdate = function (prevProps) {
+ var props = this.props;
+ var propSetHandlers = props.pluginHooks.propSetHandlers;
+ for (var propName in propSetHandlers) {
+ if (props[propName] !== prevProps[propName]) {
+ propSetHandlers[propName](props[propName], props);
+ }
+ }
+ };
+ CalendarContent.prototype.componentWillUnmount = function () {
+ window.removeEventListener('resize', this.handleWindowResize);
+ this.resizeRunner.clear();
+ for (var _i = 0, _a = this.calendarInteractions; _i < _a.length; _i++) {
+ var interaction = _a[_i];
+ interaction.destroy();
+ }
+ this.props.emitter.trigger('_unmount');
+ };
+ CalendarContent.prototype._handleNavLinkClick = function (ev, anchorEl) {
+ var _a = this.props, dateEnv = _a.dateEnv, options = _a.options, calendarApi = _a.calendarApi;
+ var navLinkOptions = anchorEl.getAttribute('data-navlink');
+ navLinkOptions = navLinkOptions ? JSON.parse(navLinkOptions) : {};
+ var dateMarker = dateEnv.createMarker(navLinkOptions.date);
+ var viewType = navLinkOptions.type;
+ var customAction = viewType === 'day' ? options.navLinkDayClick :
+ viewType === 'week' ? options.navLinkWeekClick : null;
+ if (typeof customAction === 'function') {
+ customAction.call(calendarApi, dateEnv.toDate(dateMarker), ev);
+ }
+ else {
+ if (typeof customAction === 'string') {
+ viewType = customAction;
+ }
+ calendarApi.zoomTo(dateMarker, viewType);
+ }
+ };
+ CalendarContent.prototype.buildAppendContent = function () {
+ var props = this.props;
+ var children = props.pluginHooks.viewContainerAppends.map(function (buildAppendContent) { return buildAppendContent(props); });
+ return createElement.apply(void 0, __spreadArray([Fragment, {}], children));
+ };
+ CalendarContent.prototype.renderView = function (props) {
+ var pluginHooks = props.pluginHooks;
+ var viewSpec = props.viewSpec;
+ var viewProps = {
+ dateProfile: props.dateProfile,
+ businessHours: props.businessHours,
+ eventStore: props.renderableEventStore,
+ eventUiBases: props.eventUiBases,
+ dateSelection: props.dateSelection,
+ eventSelection: props.eventSelection,
+ eventDrag: props.eventDrag,
+ eventResize: props.eventResize,
+ isHeightAuto: props.isHeightAuto,
+ forPrint: props.forPrint,
+ };
+ var transformers = this.buildViewPropTransformers(pluginHooks.viewPropsTransformers);
+ for (var _i = 0, transformers_1 = transformers; _i < transformers_1.length; _i++) {
+ var transformer = transformers_1[_i];
+ __assign(viewProps, transformer.transform(viewProps, props));
+ }
+ var ViewComponent = viewSpec.component;
+ return (createElement(ViewComponent, __assign({}, viewProps)));
+ };
+ return CalendarContent;
+ }(PureComponent));
+ function buildToolbarProps(viewSpec, dateProfile, dateProfileGenerator, currentDate, now, title) {
+ // don't force any date-profiles to valid date profiles (the `false`) so that we can tell if it's invalid
+ var todayInfo = dateProfileGenerator.build(now, undefined, false); // TODO: need `undefined` or else INFINITE LOOP for some reason
+ var prevInfo = dateProfileGenerator.buildPrev(dateProfile, currentDate, false);
+ var nextInfo = dateProfileGenerator.buildNext(dateProfile, currentDate, false);
+ return {
+ title: title,
+ activeButton: viewSpec.type,
+ isTodayEnabled: todayInfo.isValid && !rangeContainsMarker(dateProfile.currentRange, now),
+ isPrevEnabled: prevInfo.isValid,
+ isNextEnabled: nextInfo.isValid,
+ };
+ }
+ // Plugin
+ // -----------------------------------------------------------------------------------------------------------------
+ function buildViewPropTransformers(theClasses) {
+ return theClasses.map(function (TheClass) { return new TheClass(); });
+ }
+
+ var CalendarRoot = /** @class */ (function (_super) {
+ __extends(CalendarRoot, _super);
+ function CalendarRoot() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.state = {
+ forPrint: false,
+ };
+ _this.handleBeforePrint = function () {
+ _this.setState({ forPrint: true });
+ };
+ _this.handleAfterPrint = function () {
+ _this.setState({ forPrint: false });
+ };
+ return _this;
+ }
+ CalendarRoot.prototype.render = function () {
+ var props = this.props;
+ var options = props.options;
+ var forPrint = this.state.forPrint;
+ var isHeightAuto = forPrint || options.height === 'auto' || options.contentHeight === 'auto';
+ var height = (!isHeightAuto && options.height != null) ? options.height : '';
+ var classNames = [
+ 'fc',
+ forPrint ? 'fc-media-print' : 'fc-media-screen',
+ "fc-direction-" + options.direction,
+ props.theme.getClass('root'),
+ ];
+ if (!getCanVGrowWithinCell()) {
+ classNames.push('fc-liquid-hack');
+ }
+ return props.children(classNames, height, isHeightAuto, forPrint);
+ };
+ CalendarRoot.prototype.componentDidMount = function () {
+ var emitter = this.props.emitter;
+ emitter.on('_beforeprint', this.handleBeforePrint);
+ emitter.on('_afterprint', this.handleAfterPrint);
+ };
+ CalendarRoot.prototype.componentWillUnmount = function () {
+ var emitter = this.props.emitter;
+ emitter.off('_beforeprint', this.handleBeforePrint);
+ emitter.off('_afterprint', this.handleAfterPrint);
+ };
+ return CalendarRoot;
+ }(BaseComponent));
+
+ // Computes a default column header formatting string if `colFormat` is not explicitly defined
+ function computeFallbackHeaderFormat(datesRepDistinctDays, dayCnt) {
+ // if more than one week row, or if there are a lot of columns with not much space,
+ // put just the day numbers will be in each cell
+ if (!datesRepDistinctDays || dayCnt > 10) {
+ return createFormatter({ weekday: 'short' }); // "Sat"
+ }
+ if (dayCnt > 1) {
+ return createFormatter({ weekday: 'short', month: 'numeric', day: 'numeric', omitCommas: true }); // "Sat 11/12"
+ }
+ return createFormatter({ weekday: 'long' }); // "Saturday"
+ }
+
+ var CLASS_NAME = 'fc-col-header-cell'; // do the cushion too? no
+ function renderInner$1(hookProps) {
+ return hookProps.text;
+ }
+
+ var TableDateCell = /** @class */ (function (_super) {
+ __extends(TableDateCell, _super);
+ function TableDateCell() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ TableDateCell.prototype.render = function () {
+ var _a = this.context, dateEnv = _a.dateEnv, options = _a.options, theme = _a.theme, viewApi = _a.viewApi;
+ var props = this.props;
+ var date = props.date, dateProfile = props.dateProfile;
+ var dayMeta = getDateMeta(date, props.todayRange, null, dateProfile);
+ var classNames = [CLASS_NAME].concat(getDayClassNames(dayMeta, theme));
+ var text = dateEnv.format(date, props.dayHeaderFormat);
+ // if colCnt is 1, we are already in a day-view and don't need a navlink
+ var navLinkAttrs = (options.navLinks && !dayMeta.isDisabled && props.colCnt > 1)
+ ? { 'data-navlink': buildNavLinkData(date), tabIndex: 0 }
+ : {};
+ var hookProps = __assign(__assign(__assign({ date: dateEnv.toDate(date), view: viewApi }, props.extraHookProps), { text: text }), dayMeta);
+ return (createElement(RenderHook, { hookProps: hookProps, classNames: options.dayHeaderClassNames, content: options.dayHeaderContent, defaultContent: renderInner$1, didMount: options.dayHeaderDidMount, willUnmount: options.dayHeaderWillUnmount }, function (rootElRef, customClassNames, innerElRef, innerContent) { return (createElement("th", __assign({ ref: rootElRef, className: classNames.concat(customClassNames).join(' '), "data-date": !dayMeta.isDisabled ? formatDayString(date) : undefined, colSpan: props.colSpan }, props.extraDataAttrs),
+ createElement("div", { className: "fc-scrollgrid-sync-inner" }, !dayMeta.isDisabled && (createElement("a", __assign({ ref: innerElRef, className: [
+ 'fc-col-header-cell-cushion',
+ props.isSticky ? 'fc-sticky' : '',
+ ].join(' ') }, navLinkAttrs), innerContent))))); }));
+ };
+ return TableDateCell;
+ }(BaseComponent));
+
+ var TableDowCell = /** @class */ (function (_super) {
+ __extends(TableDowCell, _super);
+ function TableDowCell() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ TableDowCell.prototype.render = function () {
+ var props = this.props;
+ var _a = this.context, dateEnv = _a.dateEnv, theme = _a.theme, viewApi = _a.viewApi, options = _a.options;
+ var date = addDays(new Date(259200000), props.dow); // start with Sun, 04 Jan 1970 00:00:00 GMT
+ var dateMeta = {
+ dow: props.dow,
+ isDisabled: false,
+ isFuture: false,
+ isPast: false,
+ isToday: false,
+ isOther: false,
+ };
+ var classNames = [CLASS_NAME].concat(getDayClassNames(dateMeta, theme), props.extraClassNames || []);
+ var text = dateEnv.format(date, props.dayHeaderFormat);
+ var hookProps = __assign(__assign(__assign(__assign({ // TODO: make this public?
+ date: date }, dateMeta), { view: viewApi }), props.extraHookProps), { text: text });
+ return (createElement(RenderHook, { hookProps: hookProps, classNames: options.dayHeaderClassNames, content: options.dayHeaderContent, defaultContent: renderInner$1, didMount: options.dayHeaderDidMount, willUnmount: options.dayHeaderWillUnmount }, function (rootElRef, customClassNames, innerElRef, innerContent) { return (createElement("th", __assign({ ref: rootElRef, className: classNames.concat(customClassNames).join(' '), colSpan: props.colSpan }, props.extraDataAttrs),
+ createElement("div", { className: "fc-scrollgrid-sync-inner" },
+ createElement("a", { className: [
+ 'fc-col-header-cell-cushion',
+ props.isSticky ? 'fc-sticky' : '',
+ ].join(' '), ref: innerElRef }, innerContent)))); }));
+ };
+ return TableDowCell;
+ }(BaseComponent));
+
+ var NowTimer = /** @class */ (function (_super) {
+ __extends(NowTimer, _super);
+ function NowTimer(props, context) {
+ var _this = _super.call(this, props, context) || this;
+ _this.initialNowDate = getNow(context.options.now, context.dateEnv);
+ _this.initialNowQueriedMs = new Date().valueOf();
+ _this.state = _this.computeTiming().currentState;
+ return _this;
+ }
+ NowTimer.prototype.render = function () {
+ var _a = this, props = _a.props, state = _a.state;
+ return props.children(state.nowDate, state.todayRange);
+ };
+ NowTimer.prototype.componentDidMount = function () {
+ this.setTimeout();
+ };
+ NowTimer.prototype.componentDidUpdate = function (prevProps) {
+ if (prevProps.unit !== this.props.unit) {
+ this.clearTimeout();
+ this.setTimeout();
+ }
+ };
+ NowTimer.prototype.componentWillUnmount = function () {
+ this.clearTimeout();
+ };
+ NowTimer.prototype.computeTiming = function () {
+ var _a = this, props = _a.props, context = _a.context;
+ var unroundedNow = addMs(this.initialNowDate, new Date().valueOf() - this.initialNowQueriedMs);
+ var currentUnitStart = context.dateEnv.startOf(unroundedNow, props.unit);
+ var nextUnitStart = context.dateEnv.add(currentUnitStart, createDuration(1, props.unit));
+ var waitMs = nextUnitStart.valueOf() - unroundedNow.valueOf();
+ // there is a max setTimeout ms value (https://stackoverflow.com/a/3468650/96342)
+ // ensure no longer than a day
+ waitMs = Math.min(1000 * 60 * 60 * 24, waitMs);
+ return {
+ currentState: { nowDate: currentUnitStart, todayRange: buildDayRange(currentUnitStart) },
+ nextState: { nowDate: nextUnitStart, todayRange: buildDayRange(nextUnitStart) },
+ waitMs: waitMs,
+ };
+ };
+ NowTimer.prototype.setTimeout = function () {
+ var _this = this;
+ var _a = this.computeTiming(), nextState = _a.nextState, waitMs = _a.waitMs;
+ this.timeoutId = setTimeout(function () {
+ _this.setState(nextState, function () {
+ _this.setTimeout();
+ });
+ }, waitMs);
+ };
+ NowTimer.prototype.clearTimeout = function () {
+ if (this.timeoutId) {
+ clearTimeout(this.timeoutId);
+ }
+ };
+ NowTimer.contextType = ViewContextType;
+ return NowTimer;
+ }(Component));
+ function buildDayRange(date) {
+ var start = startOfDay(date);
+ var end = addDays(start, 1);
+ return { start: start, end: end };
+ }
+
+ var DayHeader = /** @class */ (function (_super) {
+ __extends(DayHeader, _super);
+ function DayHeader() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.createDayHeaderFormatter = memoize(createDayHeaderFormatter);
+ return _this;
+ }
+ DayHeader.prototype.render = function () {
+ var context = this.context;
+ var _a = this.props, dates = _a.dates, dateProfile = _a.dateProfile, datesRepDistinctDays = _a.datesRepDistinctDays, renderIntro = _a.renderIntro;
+ var dayHeaderFormat = this.createDayHeaderFormatter(context.options.dayHeaderFormat, datesRepDistinctDays, dates.length);
+ return (createElement(NowTimer, { unit: "day" }, function (nowDate, todayRange) { return (createElement("tr", null,
+ renderIntro && renderIntro('day'),
+ dates.map(function (date) { return (datesRepDistinctDays ? (createElement(TableDateCell, { key: date.toISOString(), date: date, dateProfile: dateProfile, todayRange: todayRange, colCnt: dates.length, dayHeaderFormat: dayHeaderFormat })) : (createElement(TableDowCell, { key: date.getUTCDay(), dow: date.getUTCDay(), dayHeaderFormat: dayHeaderFormat }))); }))); }));
+ };
+ return DayHeader;
+ }(BaseComponent));
+ function createDayHeaderFormatter(explicitFormat, datesRepDistinctDays, dateCnt) {
+ return explicitFormat || computeFallbackHeaderFormat(datesRepDistinctDays, dateCnt);
+ }
+
+ var DaySeriesModel = /** @class */ (function () {
+ function DaySeriesModel(range, dateProfileGenerator) {
+ var date = range.start;
+ var end = range.end;
+ var indices = [];
+ var dates = [];
+ var dayIndex = -1;
+ while (date < end) { // loop each day from start to end
+ if (dateProfileGenerator.isHiddenDay(date)) {
+ indices.push(dayIndex + 0.5); // mark that it's between indices
+ }
+ else {
+ dayIndex += 1;
+ indices.push(dayIndex);
+ dates.push(date);
+ }
+ date = addDays(date, 1);
+ }
+ this.dates = dates;
+ this.indices = indices;
+ this.cnt = dates.length;
+ }
+ DaySeriesModel.prototype.sliceRange = function (range) {
+ var firstIndex = this.getDateDayIndex(range.start); // inclusive first index
+ var lastIndex = this.getDateDayIndex(addDays(range.end, -1)); // inclusive last index
+ var clippedFirstIndex = Math.max(0, firstIndex);
+ var clippedLastIndex = Math.min(this.cnt - 1, lastIndex);
+ // deal with in-between indices
+ clippedFirstIndex = Math.ceil(clippedFirstIndex); // in-between starts round to next cell
+ clippedLastIndex = Math.floor(clippedLastIndex); // in-between ends round to prev cell
+ if (clippedFirstIndex <= clippedLastIndex) {
+ return {
+ firstIndex: clippedFirstIndex,
+ lastIndex: clippedLastIndex,
+ isStart: firstIndex === clippedFirstIndex,
+ isEnd: lastIndex === clippedLastIndex,
+ };
+ }
+ return null;
+ };
+ // Given a date, returns its chronolocial cell-index from the first cell of the grid.
+ // If the date lies between cells (because of hiddenDays), returns a floating-point value between offsets.
+ // If before the first offset, returns a negative number.
+ // If after the last offset, returns an offset past the last cell offset.
+ // Only works for *start* dates of cells. Will not work for exclusive end dates for cells.
+ DaySeriesModel.prototype.getDateDayIndex = function (date) {
+ var indices = this.indices;
+ var dayOffset = Math.floor(diffDays(this.dates[0], date));
+ if (dayOffset < 0) {
+ return indices[0] - 1;
+ }
+ if (dayOffset >= indices.length) {
+ return indices[indices.length - 1] + 1;
+ }
+ return indices[dayOffset];
+ };
+ return DaySeriesModel;
+ }());
+
+ var DayTableModel = /** @class */ (function () {
+ function DayTableModel(daySeries, breakOnWeeks) {
+ var dates = daySeries.dates;
+ var daysPerRow;
+ var firstDay;
+ var rowCnt;
+ if (breakOnWeeks) {
+ // count columns until the day-of-week repeats
+ firstDay = dates[0].getUTCDay();
+ for (daysPerRow = 1; daysPerRow < dates.length; daysPerRow += 1) {
+ if (dates[daysPerRow].getUTCDay() === firstDay) {
+ break;
+ }
+ }
+ rowCnt = Math.ceil(dates.length / daysPerRow);
+ }
+ else {
+ rowCnt = 1;
+ daysPerRow = dates.length;
+ }
+ this.rowCnt = rowCnt;
+ this.colCnt = daysPerRow;
+ this.daySeries = daySeries;
+ this.cells = this.buildCells();
+ this.headerDates = this.buildHeaderDates();
+ }
+ DayTableModel.prototype.buildCells = function () {
+ var rows = [];
+ for (var row = 0; row < this.rowCnt; row += 1) {
+ var cells = [];
+ for (var col = 0; col < this.colCnt; col += 1) {
+ cells.push(this.buildCell(row, col));
+ }
+ rows.push(cells);
+ }
+ return rows;
+ };
+ DayTableModel.prototype.buildCell = function (row, col) {
+ var date = this.daySeries.dates[row * this.colCnt + col];
+ return {
+ key: date.toISOString(),
+ date: date,
+ };
+ };
+ DayTableModel.prototype.buildHeaderDates = function () {
+ var dates = [];
+ for (var col = 0; col < this.colCnt; col += 1) {
+ dates.push(this.cells[0][col].date);
+ }
+ return dates;
+ };
+ DayTableModel.prototype.sliceRange = function (range) {
+ var colCnt = this.colCnt;
+ var seriesSeg = this.daySeries.sliceRange(range);
+ var segs = [];
+ if (seriesSeg) {
+ var firstIndex = seriesSeg.firstIndex, lastIndex = seriesSeg.lastIndex;
+ var index = firstIndex;
+ while (index <= lastIndex) {
+ var row = Math.floor(index / colCnt);
+ var nextIndex = Math.min((row + 1) * colCnt, lastIndex + 1);
+ segs.push({
+ row: row,
+ firstCol: index % colCnt,
+ lastCol: (nextIndex - 1) % colCnt,
+ isStart: seriesSeg.isStart && index === firstIndex,
+ isEnd: seriesSeg.isEnd && (nextIndex - 1) === lastIndex,
+ });
+ index = nextIndex;
+ }
+ }
+ return segs;
+ };
+ return DayTableModel;
+ }());
+
+ var Slicer = /** @class */ (function () {
+ function Slicer() {
+ this.sliceBusinessHours = memoize(this._sliceBusinessHours);
+ this.sliceDateSelection = memoize(this._sliceDateSpan);
+ this.sliceEventStore = memoize(this._sliceEventStore);
+ this.sliceEventDrag = memoize(this._sliceInteraction);
+ this.sliceEventResize = memoize(this._sliceInteraction);
+ this.forceDayIfListItem = false; // hack
+ }
+ Slicer.prototype.sliceProps = function (props, dateProfile, nextDayThreshold, context) {
+ var extraArgs = [];
+ for (var _i = 4; _i < arguments.length; _i++) {
+ extraArgs[_i - 4] = arguments[_i];
+ }
+ var eventUiBases = props.eventUiBases;
+ var eventSegs = this.sliceEventStore.apply(this, __spreadArray([props.eventStore, eventUiBases, dateProfile, nextDayThreshold], extraArgs));
+ return {
+ dateSelectionSegs: this.sliceDateSelection.apply(this, __spreadArray([props.dateSelection, eventUiBases, context], extraArgs)),
+ businessHourSegs: this.sliceBusinessHours.apply(this, __spreadArray([props.businessHours, dateProfile, nextDayThreshold, context], extraArgs)),
+ fgEventSegs: eventSegs.fg,
+ bgEventSegs: eventSegs.bg,
+ eventDrag: this.sliceEventDrag.apply(this, __spreadArray([props.eventDrag, eventUiBases, dateProfile, nextDayThreshold], extraArgs)),
+ eventResize: this.sliceEventResize.apply(this, __spreadArray([props.eventResize, eventUiBases, dateProfile, nextDayThreshold], extraArgs)),
+ eventSelection: props.eventSelection,
+ }; // TODO: give interactionSegs?
+ };
+ Slicer.prototype.sliceNowDate = function (// does not memoize
+ date, context) {
+ var extraArgs = [];
+ for (var _i = 2; _i < arguments.length; _i++) {
+ extraArgs[_i - 2] = arguments[_i];
+ }
+ return this._sliceDateSpan.apply(this, __spreadArray([{ range: { start: date, end: addMs(date, 1) }, allDay: false },
+ {},
+ context], extraArgs));
+ };
+ Slicer.prototype._sliceBusinessHours = function (businessHours, dateProfile, nextDayThreshold, context) {
+ var extraArgs = [];
+ for (var _i = 4; _i < arguments.length; _i++) {
+ extraArgs[_i - 4] = arguments[_i];
+ }
+ if (!businessHours) {
+ return [];
+ }
+ return this._sliceEventStore.apply(this, __spreadArray([expandRecurring(businessHours, computeActiveRange(dateProfile, Boolean(nextDayThreshold)), context),
+ {},
+ dateProfile,
+ nextDayThreshold], extraArgs)).bg;
+ };
+ Slicer.prototype._sliceEventStore = function (eventStore, eventUiBases, dateProfile, nextDayThreshold) {
+ var extraArgs = [];
+ for (var _i = 4; _i < arguments.length; _i++) {
+ extraArgs[_i - 4] = arguments[_i];
+ }
+ if (eventStore) {
+ var rangeRes = sliceEventStore(eventStore, eventUiBases, computeActiveRange(dateProfile, Boolean(nextDayThreshold)), nextDayThreshold);
+ return {
+ bg: this.sliceEventRanges(rangeRes.bg, extraArgs),
+ fg: this.sliceEventRanges(rangeRes.fg, extraArgs),
+ };
+ }
+ return { bg: [], fg: [] };
+ };
+ Slicer.prototype._sliceInteraction = function (interaction, eventUiBases, dateProfile, nextDayThreshold) {
+ var extraArgs = [];
+ for (var _i = 4; _i < arguments.length; _i++) {
+ extraArgs[_i - 4] = arguments[_i];
+ }
+ if (!interaction) {
+ return null;
+ }
+ var rangeRes = sliceEventStore(interaction.mutatedEvents, eventUiBases, computeActiveRange(dateProfile, Boolean(nextDayThreshold)), nextDayThreshold);
+ return {
+ segs: this.sliceEventRanges(rangeRes.fg, extraArgs),
+ affectedInstances: interaction.affectedEvents.instances,
+ isEvent: interaction.isEvent,
+ };
+ };
+ Slicer.prototype._sliceDateSpan = function (dateSpan, eventUiBases, context) {
+ var extraArgs = [];
+ for (var _i = 3; _i < arguments.length; _i++) {
+ extraArgs[_i - 3] = arguments[_i];
+ }
+ if (!dateSpan) {
+ return [];
+ }
+ var eventRange = fabricateEventRange(dateSpan, eventUiBases, context);
+ var segs = this.sliceRange.apply(this, __spreadArray([dateSpan.range], extraArgs));
+ for (var _a = 0, segs_1 = segs; _a < segs_1.length; _a++) {
+ var seg = segs_1[_a];
+ seg.eventRange = eventRange;
+ }
+ return segs;
+ };
+ /*
+ "complete" seg means it has component and eventRange
+ */
+ Slicer.prototype.sliceEventRanges = function (eventRanges, extraArgs) {
+ var segs = [];
+ for (var _i = 0, eventRanges_1 = eventRanges; _i < eventRanges_1.length; _i++) {
+ var eventRange = eventRanges_1[_i];
+ segs.push.apply(segs, this.sliceEventRange(eventRange, extraArgs));
+ }
+ return segs;
+ };
+ /*
+ "complete" seg means it has component and eventRange
+ */
+ Slicer.prototype.sliceEventRange = function (eventRange, extraArgs) {
+ var dateRange = eventRange.range;
+ // hack to make multi-day events that are being force-displayed as list-items to take up only one day
+ if (this.forceDayIfListItem && eventRange.ui.display === 'list-item') {
+ dateRange = {
+ start: dateRange.start,
+ end: addDays(dateRange.start, 1),
+ };
+ }
+ var segs = this.sliceRange.apply(this, __spreadArray([dateRange], extraArgs));
+ for (var _i = 0, segs_2 = segs; _i < segs_2.length; _i++) {
+ var seg = segs_2[_i];
+ seg.eventRange = eventRange;
+ seg.isStart = eventRange.isStart && seg.isStart;
+ seg.isEnd = eventRange.isEnd && seg.isEnd;
+ }
+ return segs;
+ };
+ return Slicer;
+ }());
+ /*
+ for incorporating slotMinTime/slotMaxTime if appropriate
+ TODO: should be part of DateProfile!
+ TimelineDateProfile already does this btw
+ */
+ function computeActiveRange(dateProfile, isComponentAllDay) {
+ var range = dateProfile.activeRange;
+ if (isComponentAllDay) {
+ return range;
+ }
+ return {
+ start: addMs(range.start, dateProfile.slotMinTime.milliseconds),
+ end: addMs(range.end, dateProfile.slotMaxTime.milliseconds - 864e5), // 864e5 = ms in a day
+ };
+ }
+
+ // high-level segmenting-aware tester functions
+ // ------------------------------------------------------------------------------------------------------------------------
+ function isInteractionValid(interaction, dateProfile, context) {
+ var instances = interaction.mutatedEvents.instances;
+ for (var instanceId in instances) {
+ if (!rangeContainsRange(dateProfile.validRange, instances[instanceId].range)) {
+ return false;
+ }
+ }
+ return isNewPropsValid({ eventDrag: interaction }, context); // HACK: the eventDrag props is used for ALL interactions
+ }
+ function isDateSelectionValid(dateSelection, dateProfile, context) {
+ if (!rangeContainsRange(dateProfile.validRange, dateSelection.range)) {
+ return false;
+ }
+ return isNewPropsValid({ dateSelection: dateSelection }, context);
+ }
+ function isNewPropsValid(newProps, context) {
+ var calendarState = context.getCurrentData();
+ var props = __assign({ businessHours: calendarState.businessHours, dateSelection: '', eventStore: calendarState.eventStore, eventUiBases: calendarState.eventUiBases, eventSelection: '', eventDrag: null, eventResize: null }, newProps);
+ return (context.pluginHooks.isPropsValid || isPropsValid)(props, context);
+ }
+ function isPropsValid(state, context, dateSpanMeta, filterConfig) {
+ if (dateSpanMeta === void 0) { dateSpanMeta = {}; }
+ if (state.eventDrag && !isInteractionPropsValid(state, context, dateSpanMeta, filterConfig)) {
+ return false;
+ }
+ if (state.dateSelection && !isDateSelectionPropsValid(state, context, dateSpanMeta, filterConfig)) {
+ return false;
+ }
+ return true;
+ }
+ // Moving Event Validation
+ // ------------------------------------------------------------------------------------------------------------------------
+ function isInteractionPropsValid(state, context, dateSpanMeta, filterConfig) {
+ var currentState = context.getCurrentData();
+ var interaction = state.eventDrag; // HACK: the eventDrag props is used for ALL interactions
+ var subjectEventStore = interaction.mutatedEvents;
+ var subjectDefs = subjectEventStore.defs;
+ var subjectInstances = subjectEventStore.instances;
+ var subjectConfigs = compileEventUis(subjectDefs, interaction.isEvent ?
+ state.eventUiBases :
+ { '': currentState.selectionConfig });
+ if (filterConfig) {
+ subjectConfigs = mapHash(subjectConfigs, filterConfig);
+ }
+ // exclude the subject events. TODO: exclude defs too?
+ var otherEventStore = excludeInstances(state.eventStore, interaction.affectedEvents.instances);
+ var otherDefs = otherEventStore.defs;
+ var otherInstances = otherEventStore.instances;
+ var otherConfigs = compileEventUis(otherDefs, state.eventUiBases);
+ for (var subjectInstanceId in subjectInstances) {
+ var subjectInstance = subjectInstances[subjectInstanceId];
+ var subjectRange = subjectInstance.range;
+ var subjectConfig = subjectConfigs[subjectInstance.defId];
+ var subjectDef = subjectDefs[subjectInstance.defId];
+ // constraint
+ if (!allConstraintsPass(subjectConfig.constraints, subjectRange, otherEventStore, state.businessHours, context)) {
+ return false;
+ }
+ // overlap
+ var eventOverlap = context.options.eventOverlap;
+ var eventOverlapFunc = typeof eventOverlap === 'function' ? eventOverlap : null;
+ for (var otherInstanceId in otherInstances) {
+ var otherInstance = otherInstances[otherInstanceId];
+ // intersect! evaluate
+ if (rangesIntersect(subjectRange, otherInstance.range)) {
+ var otherOverlap = otherConfigs[otherInstance.defId].overlap;
+ // consider the other event's overlap. only do this if the subject event is a "real" event
+ if (otherOverlap === false && interaction.isEvent) {
+ return false;
+ }
+ if (subjectConfig.overlap === false) {
+ return false;
+ }
+ if (eventOverlapFunc && !eventOverlapFunc(new EventApi(context, otherDefs[otherInstance.defId], otherInstance), // still event
+ new EventApi(context, subjectDef, subjectInstance))) {
+ return false;
+ }
+ }
+ }
+ // allow (a function)
+ var calendarEventStore = currentState.eventStore; // need global-to-calendar, not local to component (splittable)state
+ for (var _i = 0, _a = subjectConfig.allows; _i < _a.length; _i++) {
+ var subjectAllow = _a[_i];
+ var subjectDateSpan = __assign(__assign({}, dateSpanMeta), { range: subjectInstance.range, allDay: subjectDef.allDay });
+ var origDef = calendarEventStore.defs[subjectDef.defId];
+ var origInstance = calendarEventStore.instances[subjectInstanceId];
+ var eventApi = void 0;
+ if (origDef) { // was previously in the calendar
+ eventApi = new EventApi(context, origDef, origInstance);
+ }
+ else { // was an external event
+ eventApi = new EventApi(context, subjectDef); // no instance, because had no dates
+ }
+ if (!subjectAllow(buildDateSpanApiWithContext(subjectDateSpan, context), eventApi)) {
+ return false;
+ }
+ }
+ }
+ return true;
+ }
+ // Date Selection Validation
+ // ------------------------------------------------------------------------------------------------------------------------
+ function isDateSelectionPropsValid(state, context, dateSpanMeta, filterConfig) {
+ var relevantEventStore = state.eventStore;
+ var relevantDefs = relevantEventStore.defs;
+ var relevantInstances = relevantEventStore.instances;
+ var selection = state.dateSelection;
+ var selectionRange = selection.range;
+ var selectionConfig = context.getCurrentData().selectionConfig;
+ if (filterConfig) {
+ selectionConfig = filterConfig(selectionConfig);
+ }
+ // constraint
+ if (!allConstraintsPass(selectionConfig.constraints, selectionRange, relevantEventStore, state.businessHours, context)) {
+ return false;
+ }
+ // overlap
+ var selectOverlap = context.options.selectOverlap;
+ var selectOverlapFunc = typeof selectOverlap === 'function' ? selectOverlap : null;
+ for (var relevantInstanceId in relevantInstances) {
+ var relevantInstance = relevantInstances[relevantInstanceId];
+ // intersect! evaluate
+ if (rangesIntersect(selectionRange, relevantInstance.range)) {
+ if (selectionConfig.overlap === false) {
+ return false;
+ }
+ if (selectOverlapFunc && !selectOverlapFunc(new EventApi(context, relevantDefs[relevantInstance.defId], relevantInstance), null)) {
+ return false;
+ }
+ }
+ }
+ // allow (a function)
+ for (var _i = 0, _a = selectionConfig.allows; _i < _a.length; _i++) {
+ var selectionAllow = _a[_i];
+ var fullDateSpan = __assign(__assign({}, dateSpanMeta), selection);
+ if (!selectionAllow(buildDateSpanApiWithContext(fullDateSpan, context), null)) {
+ return false;
+ }
+ }
+ return true;
+ }
+ // Constraint Utils
+ // ------------------------------------------------------------------------------------------------------------------------
+ function allConstraintsPass(constraints, subjectRange, otherEventStore, businessHoursUnexpanded, context) {
+ for (var _i = 0, constraints_1 = constraints; _i < constraints_1.length; _i++) {
+ var constraint = constraints_1[_i];
+ if (!anyRangesContainRange(constraintToRanges(constraint, subjectRange, otherEventStore, businessHoursUnexpanded, context), subjectRange)) {
+ return false;
+ }
+ }
+ return true;
+ }
+ function constraintToRanges(constraint, subjectRange, // for expanding a recurring constraint, or expanding business hours
+ otherEventStore, // for if constraint is an even group ID
+ businessHoursUnexpanded, // for if constraint is 'businessHours'
+ context) {
+ if (constraint === 'businessHours') {
+ return eventStoreToRanges(expandRecurring(businessHoursUnexpanded, subjectRange, context));
+ }
+ if (typeof constraint === 'string') { // an group ID
+ return eventStoreToRanges(filterEventStoreDefs(otherEventStore, function (eventDef) { return eventDef.groupId === constraint; }));
+ }
+ if (typeof constraint === 'object' && constraint) { // non-null object
+ return eventStoreToRanges(expandRecurring(constraint, subjectRange, context));
+ }
+ return []; // if it's false
+ }
+ // TODO: move to event-store file?
+ function eventStoreToRanges(eventStore) {
+ var instances = eventStore.instances;
+ var ranges = [];
+ for (var instanceId in instances) {
+ ranges.push(instances[instanceId].range);
+ }
+ return ranges;
+ }
+ // TODO: move to geom file?
+ function anyRangesContainRange(outerRanges, innerRange) {
+ for (var _i = 0, outerRanges_1 = outerRanges; _i < outerRanges_1.length; _i++) {
+ var outerRange = outerRanges_1[_i];
+ if (rangeContainsRange(outerRange, innerRange)) {
+ return true;
+ }
+ }
+ return false;
+ }
+
+ var VISIBLE_HIDDEN_RE = /^(visible|hidden)$/;
+ var Scroller = /** @class */ (function (_super) {
+ __extends(Scroller, _super);
+ function Scroller() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.handleEl = function (el) {
+ _this.el = el;
+ setRef(_this.props.elRef, el);
+ };
+ return _this;
+ }
+ Scroller.prototype.render = function () {
+ var props = this.props;
+ var liquid = props.liquid, liquidIsAbsolute = props.liquidIsAbsolute;
+ var isAbsolute = liquid && liquidIsAbsolute;
+ var className = ['fc-scroller'];
+ if (liquid) {
+ if (liquidIsAbsolute) {
+ className.push('fc-scroller-liquid-absolute');
+ }
+ else {
+ className.push('fc-scroller-liquid');
+ }
+ }
+ return (createElement("div", { ref: this.handleEl, className: className.join(' '), style: {
+ overflowX: props.overflowX,
+ overflowY: props.overflowY,
+ left: (isAbsolute && -(props.overcomeLeft || 0)) || '',
+ right: (isAbsolute && -(props.overcomeRight || 0)) || '',
+ bottom: (isAbsolute && -(props.overcomeBottom || 0)) || '',
+ marginLeft: (!isAbsolute && -(props.overcomeLeft || 0)) || '',
+ marginRight: (!isAbsolute && -(props.overcomeRight || 0)) || '',
+ marginBottom: (!isAbsolute && -(props.overcomeBottom || 0)) || '',
+ maxHeight: props.maxHeight || '',
+ } }, props.children));
+ };
+ Scroller.prototype.needsXScrolling = function () {
+ if (VISIBLE_HIDDEN_RE.test(this.props.overflowX)) {
+ return false;
+ }
+ // testing scrollWidth>clientWidth is unreliable cross-browser when pixel heights aren't integers.
+ // much more reliable to see if children are taller than the scroller, even tho doesn't account for
+ // inner-child margins and absolute positioning
+ var el = this.el;
+ var realClientWidth = this.el.getBoundingClientRect().width - this.getYScrollbarWidth();
+ var children = el.children;
+ for (var i = 0; i < children.length; i += 1) {
+ var childEl = children[i];
+ if (childEl.getBoundingClientRect().width > realClientWidth) {
+ return true;
+ }
+ }
+ return false;
+ };
+ Scroller.prototype.needsYScrolling = function () {
+ if (VISIBLE_HIDDEN_RE.test(this.props.overflowY)) {
+ return false;
+ }
+ // testing scrollHeight>clientHeight is unreliable cross-browser when pixel heights aren't integers.
+ // much more reliable to see if children are taller than the scroller, even tho doesn't account for
+ // inner-child margins and absolute positioning
+ var el = this.el;
+ var realClientHeight = this.el.getBoundingClientRect().height - this.getXScrollbarWidth();
+ var children = el.children;
+ for (var i = 0; i < children.length; i += 1) {
+ var childEl = children[i];
+ if (childEl.getBoundingClientRect().height > realClientHeight) {
+ return true;
+ }
+ }
+ return false;
+ };
+ Scroller.prototype.getXScrollbarWidth = function () {
+ if (VISIBLE_HIDDEN_RE.test(this.props.overflowX)) {
+ return 0;
+ }
+ return this.el.offsetHeight - this.el.clientHeight; // only works because we guarantee no borders. TODO: add to CSS with important?
+ };
+ Scroller.prototype.getYScrollbarWidth = function () {
+ if (VISIBLE_HIDDEN_RE.test(this.props.overflowY)) {
+ return 0;
+ }
+ return this.el.offsetWidth - this.el.clientWidth; // only works because we guarantee no borders. TODO: add to CSS with important?
+ };
+ return Scroller;
+ }(BaseComponent));
+
+ /*
+ TODO: somehow infer OtherArgs from masterCallback?
+ TODO: infer RefType from masterCallback if provided
+ */
+ var RefMap = /** @class */ (function () {
+ function RefMap(masterCallback) {
+ var _this = this;
+ this.masterCallback = masterCallback;
+ this.currentMap = {};
+ this.depths = {};
+ this.callbackMap = {};
+ this.handleValue = function (val, key) {
+ var _a = _this, depths = _a.depths, currentMap = _a.currentMap;
+ var removed = false;
+ var added = false;
+ if (val !== null) {
+ // for bug... ACTUALLY: can probably do away with this now that callers don't share numeric indices anymore
+ removed = (key in currentMap);
+ currentMap[key] = val;
+ depths[key] = (depths[key] || 0) + 1;
+ added = true;
+ }
+ else {
+ depths[key] -= 1;
+ if (!depths[key]) {
+ delete currentMap[key];
+ delete _this.callbackMap[key];
+ removed = true;
+ }
+ }
+ if (_this.masterCallback) {
+ if (removed) {
+ _this.masterCallback(null, String(key));
+ }
+ if (added) {
+ _this.masterCallback(val, String(key));
+ }
+ }
+ };
+ }
+ RefMap.prototype.createRef = function (key) {
+ var _this = this;
+ var refCallback = this.callbackMap[key];
+ if (!refCallback) {
+ refCallback = this.callbackMap[key] = function (val) {
+ _this.handleValue(val, String(key));
+ };
+ }
+ return refCallback;
+ };
+ // TODO: check callers that don't care about order. should use getAll instead
+ // NOTE: this method has become less valuable now that we are encouraged to map order by some other index
+ // TODO: provide ONE array-export function, buildArray, which fails on non-numeric indexes. caller can manipulate and "collect"
+ RefMap.prototype.collect = function (startIndex, endIndex, step) {
+ return collectFromHash(this.currentMap, startIndex, endIndex, step);
+ };
+ RefMap.prototype.getAll = function () {
+ return hashValuesToArray(this.currentMap);
+ };
+ return RefMap;
+ }());
+
+ function computeShrinkWidth(chunkEls) {
+ var shrinkCells = findElements(chunkEls, '.fc-scrollgrid-shrink');
+ var largestWidth = 0;
+ for (var _i = 0, shrinkCells_1 = shrinkCells; _i < shrinkCells_1.length; _i++) {
+ var shrinkCell = shrinkCells_1[_i];
+ largestWidth = Math.max(largestWidth, computeSmallestCellWidth(shrinkCell));
+ }
+ return Math.ceil(largestWidth); // elements work best with integers. round up to ensure contents fits
+ }
+ function getSectionHasLiquidHeight(props, sectionConfig) {
+ return props.liquid && sectionConfig.liquid; // does the section do liquid-height? (need to have whole scrollgrid liquid-height as well)
+ }
+ function getAllowYScrolling(props, sectionConfig) {
+ return sectionConfig.maxHeight != null || // if its possible for the height to max out, we might need scrollbars
+ getSectionHasLiquidHeight(props, sectionConfig); // if the section is liquid height, it might condense enough to require scrollbars
+ }
+ // TODO: ONLY use `arg`. force out internal function to use same API
+ function renderChunkContent(sectionConfig, chunkConfig, arg) {
+ var expandRows = arg.expandRows;
+ var content = typeof chunkConfig.content === 'function' ?
+ chunkConfig.content(arg) :
+ createElement('table', {
+ className: [
+ chunkConfig.tableClassName,
+ sectionConfig.syncRowHeights ? 'fc-scrollgrid-sync-table' : '',
+ ].join(' '),
+ style: {
+ minWidth: arg.tableMinWidth,
+ width: arg.clientWidth,
+ height: expandRows ? arg.clientHeight : '', // css `height` on a serves as a min-height
+ },
+ }, arg.tableColGroupNode, createElement('tbody', {}, typeof chunkConfig.rowContent === 'function' ? chunkConfig.rowContent(arg) : chunkConfig.rowContent));
+ return content;
+ }
+ function isColPropsEqual(cols0, cols1) {
+ return isArraysEqual(cols0, cols1, isPropsEqual);
+ }
+ function renderMicroColGroup(cols, shrinkWidth) {
+ var colNodes = [];
+ /*
+ for ColProps with spans, it would have been great to make a single / elements with colspans.
+ SOLUTION: making individual
+ _this.frameElRefs = new RefMap(); // the fc-daygrid-day-frame
+ _this.fgElRefs = new RefMap(); // the fc-daygrid-day-events
+ _this.segHarnessRefs = new RefMap(); // indexed by "instanceId:firstCol"
+ _this.rootElRef = createRef();
+ _this.state = {
+ framePositions: null,
+ maxContentHeight: null,
+ eventInstanceHeights: {},
+ };
+ return _this;
+ }
+ TableRow.prototype.render = function () {
+ var _this = this;
+ var _a = this, props = _a.props, state = _a.state, context = _a.context;
+ var options = context.options;
+ var colCnt = props.cells.length;
+ var businessHoursByCol = splitSegsByFirstCol(props.businessHourSegs, colCnt);
+ var bgEventSegsByCol = splitSegsByFirstCol(props.bgEventSegs, colCnt);
+ var highlightSegsByCol = splitSegsByFirstCol(this.getHighlightSegs(), colCnt);
+ var mirrorSegsByCol = splitSegsByFirstCol(this.getMirrorSegs(), colCnt);
+ var _b = computeFgSegPlacement(sortEventSegs(props.fgEventSegs, options.eventOrder), props.dayMaxEvents, props.dayMaxEventRows, options.eventOrderStrict, state.eventInstanceHeights, state.maxContentHeight, props.cells), singleColPlacements = _b.singleColPlacements, multiColPlacements = _b.multiColPlacements, moreCnts = _b.moreCnts, moreMarginTops = _b.moreMarginTops;
+ var isForcedInvisible = // TODO: messy way to compute this
+ (props.eventDrag && props.eventDrag.affectedInstances) ||
+ (props.eventResize && props.eventResize.affectedInstances) ||
+ {};
+ return (createElement("tr", { ref: this.rootElRef },
+ props.renderIntro && props.renderIntro(),
+ props.cells.map(function (cell, col) {
+ var normalFgNodes = _this.renderFgSegs(col, props.forPrint ? singleColPlacements[col] : multiColPlacements[col], props.todayRange, isForcedInvisible);
+ var mirrorFgNodes = _this.renderFgSegs(col, buildMirrorPlacements$1(mirrorSegsByCol[col], multiColPlacements), props.todayRange, {}, Boolean(props.eventDrag), Boolean(props.eventResize), false);
+ return (createElement(TableCell, { key: cell.key, elRef: _this.cellElRefs.createRef(cell.key), innerElRef: _this.frameElRefs.createRef(cell.key) /* FF problem, but okay to use for left/right. TODO: rename prop */, dateProfile: props.dateProfile, date: cell.date, showDayNumber: props.showDayNumbers, showWeekNumber: props.showWeekNumbers && col === 0, forceDayTop: props.showWeekNumbers /* even displaying weeknum for row, not necessarily day */, todayRange: props.todayRange, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, extraHookProps: cell.extraHookProps, extraDataAttrs: cell.extraDataAttrs, extraClassNames: cell.extraClassNames, extraDateSpan: cell.extraDateSpan, moreCnt: moreCnts[col], moreMarginTop: moreMarginTops[col], singlePlacements: singleColPlacements[col], fgContentElRef: _this.fgElRefs.createRef(cell.key), fgContent: ( // Fragment scopes the keys
+ createElement(Fragment, null,
+ createElement(Fragment, null, normalFgNodes),
+ createElement(Fragment, null, mirrorFgNodes))), bgContent: ( // Fragment scopes the keys
+ createElement(Fragment, null,
+ _this.renderFillSegs(highlightSegsByCol[col], 'highlight'),
+ _this.renderFillSegs(businessHoursByCol[col], 'non-business'),
+ _this.renderFillSegs(bgEventSegsByCol[col], 'bg-event'))) }));
+ })));
+ };
+ TableRow.prototype.componentDidMount = function () {
+ this.updateSizing(true);
+ };
+ TableRow.prototype.componentDidUpdate = function (prevProps, prevState) {
+ var currentProps = this.props;
+ this.updateSizing(!isPropsEqual(prevProps, currentProps));
+ };
+ TableRow.prototype.getHighlightSegs = function () {
+ var props = this.props;
+ if (props.eventDrag && props.eventDrag.segs.length) { // messy check
+ return props.eventDrag.segs;
+ }
+ if (props.eventResize && props.eventResize.segs.length) { // messy check
+ return props.eventResize.segs;
+ }
+ return props.dateSelectionSegs;
+ };
+ TableRow.prototype.getMirrorSegs = function () {
+ var props = this.props;
+ if (props.eventResize && props.eventResize.segs.length) { // messy check
+ return props.eventResize.segs;
+ }
+ return [];
+ };
+ TableRow.prototype.renderFgSegs = function (col, segPlacements, todayRange, isForcedInvisible, isDragging, isResizing, isDateSelecting) {
+ var context = this.context;
+ var eventSelection = this.props.eventSelection;
+ var framePositions = this.state.framePositions;
+ var defaultDisplayEventEnd = this.props.cells.length === 1; // colCnt === 1
+ var isMirror = isDragging || isResizing || isDateSelecting;
+ var nodes = [];
+ if (framePositions) {
+ for (var _i = 0, segPlacements_1 = segPlacements; _i < segPlacements_1.length; _i++) {
+ var placement = segPlacements_1[_i];
+ var seg = placement.seg;
+ var instanceId = seg.eventRange.instance.instanceId;
+ var key = instanceId + ':' + col;
+ var isVisible = placement.isVisible && !isForcedInvisible[instanceId];
+ var isAbsolute = placement.isAbsolute;
+ var left = '';
+ var right = '';
+ if (isAbsolute) {
+ if (context.isRtl) {
+ right = 0;
+ left = framePositions.lefts[seg.lastCol] - framePositions.lefts[seg.firstCol];
+ }
+ else {
+ left = 0;
+ right = framePositions.rights[seg.firstCol] - framePositions.rights[seg.lastCol];
+ }
+ }
+ /*
+ known bug: events that are force to be list-item but span multiple days still take up space in later columns
+ todo: in print view, for multi-day events, don't display title within non-start/end segs
+ */
+ nodes.push(createElement("div", { className: 'fc-daygrid-event-harness' + (isAbsolute ? ' fc-daygrid-event-harness-abs' : ''), key: key, ref: isMirror ? null : this.segHarnessRefs.createRef(key), style: {
+ visibility: isVisible ? '' : 'hidden',
+ marginTop: isAbsolute ? '' : placement.marginTop,
+ top: isAbsolute ? placement.absoluteTop : '',
+ left: left,
+ right: right,
+ } }, hasListItemDisplay(seg) ? (createElement(TableListItemEvent, __assign({ seg: seg, isDragging: isDragging, isSelected: instanceId === eventSelection, defaultDisplayEventEnd: defaultDisplayEventEnd }, getSegMeta(seg, todayRange)))) : (createElement(TableBlockEvent, __assign({ seg: seg, isDragging: isDragging, isResizing: isResizing, isDateSelecting: isDateSelecting, isSelected: instanceId === eventSelection, defaultDisplayEventEnd: defaultDisplayEventEnd }, getSegMeta(seg, todayRange))))));
+ }
+ }
+ return nodes;
+ };
+ TableRow.prototype.renderFillSegs = function (segs, fillType) {
+ var isRtl = this.context.isRtl;
+ var todayRange = this.props.todayRange;
+ var framePositions = this.state.framePositions;
+ var nodes = [];
+ if (framePositions) {
+ for (var _i = 0, segs_1 = segs; _i < segs_1.length; _i++) {
+ var seg = segs_1[_i];
+ var leftRightCss = isRtl ? {
+ right: 0,
+ left: framePositions.lefts[seg.lastCol] - framePositions.lefts[seg.firstCol],
+ } : {
+ left: 0,
+ right: framePositions.rights[seg.firstCol] - framePositions.rights[seg.lastCol],
+ };
+ nodes.push(createElement("div", { key: buildEventRangeKey(seg.eventRange), className: "fc-daygrid-bg-harness", style: leftRightCss }, fillType === 'bg-event' ?
+ createElement(BgEvent, __assign({ seg: seg }, getSegMeta(seg, todayRange))) :
+ renderFill(fillType)));
+ }
+ }
+ return createElement.apply(void 0, __spreadArray([Fragment, {}], nodes));
+ };
+ TableRow.prototype.updateSizing = function (isExternalSizingChange) {
+ var _a = this, props = _a.props, frameElRefs = _a.frameElRefs;
+ if (!props.forPrint &&
+ props.clientWidth !== null // positioning ready?
+ ) {
+ if (isExternalSizingChange) {
+ var frameEls = props.cells.map(function (cell) { return frameElRefs.currentMap[cell.key]; });
+ if (frameEls.length) {
+ var originEl = this.rootElRef.current;
+ this.setState({
+ framePositions: new PositionCache(originEl, frameEls, true, // isHorizontal
+ false),
+ });
+ }
+ }
+ var limitByContentHeight = props.dayMaxEvents === true || props.dayMaxEventRows === true;
+ this.setState({
+ eventInstanceHeights: this.queryEventInstanceHeights(),
+ maxContentHeight: limitByContentHeight ? this.computeMaxContentHeight() : null,
+ });
+ }
+ };
+ TableRow.prototype.queryEventInstanceHeights = function () {
+ var segElMap = this.segHarnessRefs.currentMap;
+ var eventInstanceHeights = {};
+ // get the max height amongst instance segs
+ for (var key in segElMap) {
+ var height = Math.round(segElMap[key].getBoundingClientRect().height);
+ var instanceId = key.split(':')[0]; // deconstruct how renderFgSegs makes the key
+ eventInstanceHeights[instanceId] = Math.max(eventInstanceHeights[instanceId] || 0, height);
+ }
+ return eventInstanceHeights;
+ };
+ TableRow.prototype.computeMaxContentHeight = function () {
+ var firstKey = this.props.cells[0].key;
+ var cellEl = this.cellElRefs.currentMap[firstKey];
+ var fcContainerEl = this.fgElRefs.currentMap[firstKey];
+ return cellEl.getBoundingClientRect().bottom - fcContainerEl.getBoundingClientRect().top;
+ };
+ TableRow.prototype.getCellEls = function () {
+ var elMap = this.cellElRefs.currentMap;
+ return this.props.cells.map(function (cell) { return elMap[cell.key]; });
+ };
+ return TableRow;
+ }(DateComponent));
+ TableRow.addStateEquality({
+ eventInstanceHeights: isPropsEqual,
+ });
+ function buildMirrorPlacements$1(mirrorSegs, colPlacements) {
+ if (!mirrorSegs.length) {
+ return [];
+ }
+ var topsByInstanceId = buildAbsoluteTopHash$1(colPlacements); // TODO: cache this at first render?
+ return mirrorSegs.map(function (seg) { return ({
+ seg: seg,
+ isVisible: true,
+ isAbsolute: true,
+ absoluteTop: topsByInstanceId[seg.eventRange.instance.instanceId],
+ marginTop: 0,
+ }); });
+ }
+ function buildAbsoluteTopHash$1(colPlacements) {
+ var topsByInstanceId = {};
+ for (var _i = 0, colPlacements_1 = colPlacements; _i < colPlacements_1.length; _i++) {
+ var placements = colPlacements_1[_i];
+ for (var _a = 0, placements_1 = placements; _a < placements_1.length; _a++) {
+ var placement = placements_1[_a];
+ topsByInstanceId[placement.seg.eventRange.instance.instanceId] = placement.absoluteTop;
+ }
+ }
+ return colPlacements;
+ }
+
+ var Table = /** @class */ (function (_super) {
+ __extends(Table, _super);
+ function Table() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.splitBusinessHourSegs = memoize(splitSegsByRow);
+ _this.splitBgEventSegs = memoize(splitSegsByRow);
+ _this.splitFgEventSegs = memoize(splitSegsByRow);
+ _this.splitDateSelectionSegs = memoize(splitSegsByRow);
+ _this.splitEventDrag = memoize(splitInteractionByRow);
+ _this.splitEventResize = memoize(splitInteractionByRow);
+ _this.rowRefs = new RefMap();
+ _this.handleRootEl = function (rootEl) {
+ _this.rootEl = rootEl;
+ if (rootEl) {
+ _this.context.registerInteractiveComponent(_this, {
+ el: rootEl,
+ isHitComboAllowed: _this.props.isHitComboAllowed,
+ });
+ }
+ else {
+ _this.context.unregisterInteractiveComponent(_this);
+ }
+ };
+ return _this;
+ }
+ Table.prototype.render = function () {
+ var _this = this;
+ var props = this.props;
+ var dateProfile = props.dateProfile, dayMaxEventRows = props.dayMaxEventRows, dayMaxEvents = props.dayMaxEvents, expandRows = props.expandRows;
+ var rowCnt = props.cells.length;
+ var businessHourSegsByRow = this.splitBusinessHourSegs(props.businessHourSegs, rowCnt);
+ var bgEventSegsByRow = this.splitBgEventSegs(props.bgEventSegs, rowCnt);
+ var fgEventSegsByRow = this.splitFgEventSegs(props.fgEventSegs, rowCnt);
+ var dateSelectionSegsByRow = this.splitDateSelectionSegs(props.dateSelectionSegs, rowCnt);
+ var eventDragByRow = this.splitEventDrag(props.eventDrag, rowCnt);
+ var eventResizeByRow = this.splitEventResize(props.eventResize, rowCnt);
+ var limitViaBalanced = dayMaxEvents === true || dayMaxEventRows === true;
+ // if rows can't expand to fill fixed height, can't do balanced-height event limit
+ // TODO: best place to normalize these options?
+ if (limitViaBalanced && !expandRows) {
+ limitViaBalanced = false;
+ dayMaxEventRows = null;
+ dayMaxEvents = null;
+ }
+ var classNames = [
+ 'fc-daygrid-body',
+ limitViaBalanced ? 'fc-daygrid-body-balanced' : 'fc-daygrid-body-unbalanced',
+ expandRows ? '' : 'fc-daygrid-body-natural', // will height of one row depend on the others?
+ ];
+ return (createElement("div", { className: classNames.join(' '), ref: this.handleRootEl, style: {
+ // these props are important to give this wrapper correct dimensions for interactions
+ // TODO: if we set it here, can we avoid giving to inner tables?
+ width: props.clientWidth,
+ minWidth: props.tableMinWidth,
+ } },
+ createElement(NowTimer, { unit: "day" }, function (nowDate, todayRange) { return (createElement(Fragment, null,
+ createElement("table", { className: "fc-scrollgrid-sync-table", style: {
+ width: props.clientWidth,
+ minWidth: props.tableMinWidth,
+ height: expandRows ? props.clientHeight : '',
+ } },
+ props.colGroupNode,
+ createElement("tbody", null, props.cells.map(function (cells, row) { return (createElement(TableRow, { ref: _this.rowRefs.createRef(row), key: cells.length
+ ? cells[0].date.toISOString() /* best? or put key on cell? or use diff formatter? */
+ : row // in case there are no cells (like when resource view is loading)
+ , showDayNumbers: rowCnt > 1, showWeekNumbers: props.showWeekNumbers, todayRange: todayRange, dateProfile: dateProfile, cells: cells, renderIntro: props.renderRowIntro, businessHourSegs: businessHourSegsByRow[row], eventSelection: props.eventSelection, bgEventSegs: bgEventSegsByRow[row].filter(isSegAllDay) /* hack */, fgEventSegs: fgEventSegsByRow[row], dateSelectionSegs: dateSelectionSegsByRow[row], eventDrag: eventDragByRow[row], eventResize: eventResizeByRow[row], dayMaxEvents: dayMaxEvents, dayMaxEventRows: dayMaxEventRows, clientWidth: props.clientWidth, clientHeight: props.clientHeight, forPrint: props.forPrint })); }))))); })));
+ };
+ // Hit System
+ // ----------------------------------------------------------------------------------------------------
+ Table.prototype.prepareHits = function () {
+ this.rowPositions = new PositionCache(this.rootEl, this.rowRefs.collect().map(function (rowObj) { return rowObj.getCellEls()[0]; }), // first cell el in each row. TODO: not optimal
+ false, true);
+ this.colPositions = new PositionCache(this.rootEl, this.rowRefs.currentMap[0].getCellEls(), // cell els in first row
+ true, // horizontal
+ false);
+ };
+ Table.prototype.queryHit = function (positionLeft, positionTop) {
+ var _a = this, colPositions = _a.colPositions, rowPositions = _a.rowPositions;
+ var col = colPositions.leftToIndex(positionLeft);
+ var row = rowPositions.topToIndex(positionTop);
+ if (row != null && col != null) {
+ var cell = this.props.cells[row][col];
+ return {
+ dateProfile: this.props.dateProfile,
+ dateSpan: __assign({ range: this.getCellRange(row, col), allDay: true }, cell.extraDateSpan),
+ dayEl: this.getCellEl(row, col),
+ rect: {
+ left: colPositions.lefts[col],
+ right: colPositions.rights[col],
+ top: rowPositions.tops[row],
+ bottom: rowPositions.bottoms[row],
+ },
+ layer: 0,
+ };
+ }
+ return null;
+ };
+ Table.prototype.getCellEl = function (row, col) {
+ return this.rowRefs.currentMap[row].getCellEls()[col]; // TODO: not optimal
+ };
+ Table.prototype.getCellRange = function (row, col) {
+ var start = this.props.cells[row][col].date;
+ var end = addDays(start, 1);
+ return { start: start, end: end };
+ };
+ return Table;
+ }(DateComponent));
+ function isSegAllDay(seg) {
+ return seg.eventRange.def.allDay;
+ }
+
+ var DayTableSlicer = /** @class */ (function (_super) {
+ __extends(DayTableSlicer, _super);
+ function DayTableSlicer() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.forceDayIfListItem = true;
+ return _this;
+ }
+ DayTableSlicer.prototype.sliceRange = function (dateRange, dayTableModel) {
+ return dayTableModel.sliceRange(dateRange);
+ };
+ return DayTableSlicer;
+ }(Slicer));
+
+ var DayTable = /** @class */ (function (_super) {
+ __extends(DayTable, _super);
+ function DayTable() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.slicer = new DayTableSlicer();
+ _this.tableRef = createRef();
+ return _this;
+ }
+ DayTable.prototype.render = function () {
+ var _a = this, props = _a.props, context = _a.context;
+ return (createElement(Table, __assign({ ref: this.tableRef }, this.slicer.sliceProps(props, props.dateProfile, props.nextDayThreshold, context, props.dayTableModel), { dateProfile: props.dateProfile, cells: props.dayTableModel.cells, colGroupNode: props.colGroupNode, tableMinWidth: props.tableMinWidth, renderRowIntro: props.renderRowIntro, dayMaxEvents: props.dayMaxEvents, dayMaxEventRows: props.dayMaxEventRows, showWeekNumbers: props.showWeekNumbers, expandRows: props.expandRows, headerAlignElRef: props.headerAlignElRef, clientWidth: props.clientWidth, clientHeight: props.clientHeight, forPrint: props.forPrint })));
+ };
+ return DayTable;
+ }(DateComponent));
+
+ var DayTableView = /** @class */ (function (_super) {
+ __extends(DayTableView, _super);
+ function DayTableView() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.buildDayTableModel = memoize(buildDayTableModel);
+ _this.headerRef = createRef();
+ _this.tableRef = createRef();
+ return _this;
+ }
+ DayTableView.prototype.render = function () {
+ var _this = this;
+ var _a = this.context, options = _a.options, dateProfileGenerator = _a.dateProfileGenerator;
+ var props = this.props;
+ var dayTableModel = this.buildDayTableModel(props.dateProfile, dateProfileGenerator);
+ var headerContent = options.dayHeaders && (createElement(DayHeader, { ref: this.headerRef, dateProfile: props.dateProfile, dates: dayTableModel.headerDates, datesRepDistinctDays: dayTableModel.rowCnt === 1 }));
+ var bodyContent = function (contentArg) { return (createElement(DayTable, { ref: _this.tableRef, dateProfile: props.dateProfile, dayTableModel: dayTableModel, businessHours: props.businessHours, dateSelection: props.dateSelection, eventStore: props.eventStore, eventUiBases: props.eventUiBases, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, nextDayThreshold: options.nextDayThreshold, colGroupNode: contentArg.tableColGroupNode, tableMinWidth: contentArg.tableMinWidth, dayMaxEvents: options.dayMaxEvents, dayMaxEventRows: options.dayMaxEventRows, showWeekNumbers: options.weekNumbers, expandRows: !props.isHeightAuto, headerAlignElRef: _this.headerElRef, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, forPrint: props.forPrint })); };
+ return options.dayMinWidth
+ ? this.renderHScrollLayout(headerContent, bodyContent, dayTableModel.colCnt, options.dayMinWidth)
+ : this.renderSimpleLayout(headerContent, bodyContent);
+ };
+ return DayTableView;
+ }(TableView));
+ function buildDayTableModel(dateProfile, dateProfileGenerator) {
+ var daySeries = new DaySeriesModel(dateProfile.renderRange, dateProfileGenerator);
+ return new DayTableModel(daySeries, /year|month|week/.test(dateProfile.currentRangeUnit));
+ }
+
+ var TableDateProfileGenerator = /** @class */ (function (_super) {
+ __extends(TableDateProfileGenerator, _super);
+ function TableDateProfileGenerator() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ // Computes the date range that will be rendered.
+ TableDateProfileGenerator.prototype.buildRenderRange = function (currentRange, currentRangeUnit, isRangeAllDay) {
+ var dateEnv = this.props.dateEnv;
+ var renderRange = _super.prototype.buildRenderRange.call(this, currentRange, currentRangeUnit, isRangeAllDay);
+ var start = renderRange.start;
+ var end = renderRange.end;
+ var endOfWeek;
+ // year and month views should be aligned with weeks. this is already done for week
+ if (/^(year|month)$/.test(currentRangeUnit)) {
+ start = dateEnv.startOfWeek(start);
+ // make end-of-week if not already
+ endOfWeek = dateEnv.startOfWeek(end);
+ if (endOfWeek.valueOf() !== end.valueOf()) {
+ end = addWeeks(endOfWeek, 1);
+ }
+ }
+ // ensure 6 weeks
+ if (this.props.monthMode &&
+ this.props.fixedWeekCount) {
+ var rowCnt = Math.ceil(// could be partial weeks due to hiddenDays
+ diffWeeks(start, end));
+ end = addWeeks(end, 6 - rowCnt);
+ }
+ return { start: start, end: end };
+ };
+ return TableDateProfileGenerator;
+ }(DateProfileGenerator));
+
+ var dayGridPlugin = createPlugin({
+ initialView: 'dayGridMonth',
+ views: {
+ dayGrid: {
+ component: DayTableView,
+ dateProfileGeneratorClass: TableDateProfileGenerator,
+ },
+ dayGridDay: {
+ type: 'dayGrid',
+ duration: { days: 1 },
+ },
+ dayGridWeek: {
+ type: 'dayGrid',
+ duration: { weeks: 1 },
+ },
+ dayGridMonth: {
+ type: 'dayGrid',
+ duration: { months: 1 },
+ monthMode: true,
+ fixedWeekCount: true,
+ },
+ },
+ });
+
+ var AllDaySplitter = /** @class */ (function (_super) {
+ __extends(AllDaySplitter, _super);
+ function AllDaySplitter() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ AllDaySplitter.prototype.getKeyInfo = function () {
+ return {
+ allDay: {},
+ timed: {},
+ };
+ };
+ AllDaySplitter.prototype.getKeysForDateSpan = function (dateSpan) {
+ if (dateSpan.allDay) {
+ return ['allDay'];
+ }
+ return ['timed'];
+ };
+ AllDaySplitter.prototype.getKeysForEventDef = function (eventDef) {
+ if (!eventDef.allDay) {
+ return ['timed'];
+ }
+ if (hasBgRendering(eventDef)) {
+ return ['timed', 'allDay'];
+ }
+ return ['allDay'];
+ };
+ return AllDaySplitter;
+ }(Splitter));
+
+ var DEFAULT_SLAT_LABEL_FORMAT = createFormatter({
+ hour: 'numeric',
+ minute: '2-digit',
+ omitZeroMinute: true,
+ meridiem: 'short',
+ });
+ function TimeColsAxisCell(props) {
+ var classNames = [
+ 'fc-timegrid-slot',
+ 'fc-timegrid-slot-label',
+ props.isLabeled ? 'fc-scrollgrid-shrink' : 'fc-timegrid-slot-minor',
+ ];
+ return (createElement(ViewContextType.Consumer, null, function (context) {
+ if (!props.isLabeled) {
+ return (createElement("td", { className: classNames.join(' '), "data-time": props.isoTimeStr }));
+ }
+ var dateEnv = context.dateEnv, options = context.options, viewApi = context.viewApi;
+ var labelFormat = // TODO: fully pre-parse
+ options.slotLabelFormat == null ? DEFAULT_SLAT_LABEL_FORMAT :
+ Array.isArray(options.slotLabelFormat) ? createFormatter(options.slotLabelFormat[0]) :
+ createFormatter(options.slotLabelFormat);
+ var hookProps = {
+ level: 0,
+ time: props.time,
+ date: dateEnv.toDate(props.date),
+ view: viewApi,
+ text: dateEnv.format(props.date, labelFormat),
+ };
+ return (createElement(RenderHook, { hookProps: hookProps, classNames: options.slotLabelClassNames, content: options.slotLabelContent, defaultContent: renderInnerContent$3, didMount: options.slotLabelDidMount, willUnmount: options.slotLabelWillUnmount }, function (rootElRef, customClassNames, innerElRef, innerContent) { return (createElement("td", { ref: rootElRef, className: classNames.concat(customClassNames).join(' '), "data-time": props.isoTimeStr },
+ createElement("div", { className: "fc-timegrid-slot-label-frame fc-scrollgrid-shrink-frame" },
+ createElement("div", { className: "fc-timegrid-slot-label-cushion fc-scrollgrid-shrink-cushion", ref: innerElRef }, innerContent)))); }));
+ }));
+ }
+ function renderInnerContent$3(props) {
+ return props.text;
+ }
+
+ var TimeBodyAxis = /** @class */ (function (_super) {
+ __extends(TimeBodyAxis, _super);
+ function TimeBodyAxis() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ TimeBodyAxis.prototype.render = function () {
+ return this.props.slatMetas.map(function (slatMeta) { return (createElement("tr", { key: slatMeta.key },
+ createElement(TimeColsAxisCell, __assign({}, slatMeta)))); });
+ };
+ return TimeBodyAxis;
+ }(BaseComponent));
+
+ var DEFAULT_WEEK_NUM_FORMAT = createFormatter({ week: 'short' });
+ var AUTO_ALL_DAY_MAX_EVENT_ROWS = 5;
+ var TimeColsView = /** @class */ (function (_super) {
+ __extends(TimeColsView, _super);
+ function TimeColsView() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.allDaySplitter = new AllDaySplitter(); // for use by subclasses
+ _this.headerElRef = createRef();
+ _this.rootElRef = createRef();
+ _this.scrollerElRef = createRef();
+ _this.state = {
+ slatCoords: null,
+ };
+ _this.handleScrollTopRequest = function (scrollTop) {
+ var scrollerEl = _this.scrollerElRef.current;
+ if (scrollerEl) { // TODO: not sure how this could ever be null. weirdness with the reducer
+ scrollerEl.scrollTop = scrollTop;
+ }
+ };
+ /* Header Render Methods
+ ------------------------------------------------------------------------------------------------------------------*/
+ _this.renderHeadAxis = function (rowKey, frameHeight) {
+ if (frameHeight === void 0) { frameHeight = ''; }
+ var options = _this.context.options;
+ var dateProfile = _this.props.dateProfile;
+ var range = dateProfile.renderRange;
+ var dayCnt = diffDays(range.start, range.end);
+ var navLinkAttrs = (options.navLinks && dayCnt === 1) // only do in day views (to avoid doing in week views that dont need it)
+ ? { 'data-navlink': buildNavLinkData(range.start, 'week'), tabIndex: 0 }
+ : {};
+ if (options.weekNumbers && rowKey === 'day') {
+ return (createElement(WeekNumberRoot, { date: range.start, defaultFormat: DEFAULT_WEEK_NUM_FORMAT }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("th", { ref: rootElRef, className: [
+ 'fc-timegrid-axis',
+ 'fc-scrollgrid-shrink',
+ ].concat(classNames).join(' ') },
+ createElement("div", { className: "fc-timegrid-axis-frame fc-scrollgrid-shrink-frame fc-timegrid-axis-frame-liquid", style: { height: frameHeight } },
+ createElement("a", __assign({ ref: innerElRef, className: "fc-timegrid-axis-cushion fc-scrollgrid-shrink-cushion fc-scrollgrid-sync-inner" }, navLinkAttrs), innerContent)))); }));
+ }
+ return (createElement("th", { className: "fc-timegrid-axis" },
+ createElement("div", { className: "fc-timegrid-axis-frame", style: { height: frameHeight } })));
+ };
+ /* Table Component Render Methods
+ ------------------------------------------------------------------------------------------------------------------*/
+ // only a one-way height sync. we don't send the axis inner-content height to the DayGrid,
+ // but DayGrid still needs to have classNames on inner elements in order to measure.
+ _this.renderTableRowAxis = function (rowHeight) {
+ var _a = _this.context, options = _a.options, viewApi = _a.viewApi;
+ var hookProps = {
+ text: options.allDayText,
+ view: viewApi,
+ };
+ return (
+ // TODO: make reusable hook. used in list view too
+ createElement(RenderHook, { hookProps: hookProps, classNames: options.allDayClassNames, content: options.allDayContent, defaultContent: renderAllDayInner$1, didMount: options.allDayDidMount, willUnmount: options.allDayWillUnmount }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("td", { ref: rootElRef, className: [
+ 'fc-timegrid-axis',
+ 'fc-scrollgrid-shrink',
+ ].concat(classNames).join(' ') },
+ createElement("div", { className: 'fc-timegrid-axis-frame fc-scrollgrid-shrink-frame' + (rowHeight == null ? ' fc-timegrid-axis-frame-liquid' : ''), style: { height: rowHeight } },
+ createElement("span", { className: "fc-timegrid-axis-cushion fc-scrollgrid-shrink-cushion fc-scrollgrid-sync-inner", ref: innerElRef }, innerContent)))); }));
+ };
+ _this.handleSlatCoords = function (slatCoords) {
+ _this.setState({ slatCoords: slatCoords });
+ };
+ return _this;
+ }
+ // rendering
+ // ----------------------------------------------------------------------------------------------------
+ TimeColsView.prototype.renderSimpleLayout = function (headerRowContent, allDayContent, timeContent) {
+ var _a = this, context = _a.context, props = _a.props;
+ var sections = [];
+ var stickyHeaderDates = getStickyHeaderDates(context.options);
+ if (headerRowContent) {
+ sections.push({
+ type: 'header',
+ key: 'header',
+ isSticky: stickyHeaderDates,
+ chunk: {
+ elRef: this.headerElRef,
+ tableClassName: 'fc-col-header',
+ rowContent: headerRowContent,
+ },
+ });
+ }
+ if (allDayContent) {
+ sections.push({
+ type: 'body',
+ key: 'all-day',
+ chunk: { content: allDayContent },
+ });
+ sections.push({
+ type: 'body',
+ key: 'all-day-divider',
+ outerContent: ( // TODO: rename to cellContent so don't need to define ?
+ createElement("tr", { className: "fc-scrollgrid-section" },
+ createElement("td", { className: 'fc-timegrid-divider ' + context.theme.getClass('tableCellShaded') }))),
+ });
+ }
+ sections.push({
+ type: 'body',
+ key: 'body',
+ liquid: true,
+ expandRows: Boolean(context.options.expandRows),
+ chunk: {
+ scrollerElRef: this.scrollerElRef,
+ content: timeContent,
+ },
+ });
+ return (createElement(ViewRoot, { viewSpec: context.viewSpec, elRef: this.rootElRef }, function (rootElRef, classNames) { return (createElement("div", { className: ['fc-timegrid'].concat(classNames).join(' '), ref: rootElRef },
+ createElement(SimpleScrollGrid, { liquid: !props.isHeightAuto && !props.forPrint, collapsibleWidth: props.forPrint, cols: [{ width: 'shrink' }], sections: sections }))); }));
+ };
+ TimeColsView.prototype.renderHScrollLayout = function (headerRowContent, allDayContent, timeContent, colCnt, dayMinWidth, slatMetas, slatCoords) {
+ var _this = this;
+ var ScrollGrid = this.context.pluginHooks.scrollGridImpl;
+ if (!ScrollGrid) {
+ throw new Error('No ScrollGrid implementation');
+ }
+ var _a = this, context = _a.context, props = _a.props;
+ var stickyHeaderDates = !props.forPrint && getStickyHeaderDates(context.options);
+ var stickyFooterScrollbar = !props.forPrint && getStickyFooterScrollbar(context.options);
+ var sections = [];
+ if (headerRowContent) {
+ sections.push({
+ type: 'header',
+ key: 'header',
+ isSticky: stickyHeaderDates,
+ syncRowHeights: true,
+ chunks: [
+ {
+ key: 'axis',
+ rowContent: function (arg) { return (createElement("tr", null, _this.renderHeadAxis('day', arg.rowSyncHeights[0]))); },
+ },
+ {
+ key: 'cols',
+ elRef: this.headerElRef,
+ tableClassName: 'fc-col-header',
+ rowContent: headerRowContent,
+ },
+ ],
+ });
+ }
+ if (allDayContent) {
+ sections.push({
+ type: 'body',
+ key: 'all-day',
+ syncRowHeights: true,
+ chunks: [
+ {
+ key: 'axis',
+ rowContent: function (contentArg) { return (createElement("tr", null, _this.renderTableRowAxis(contentArg.rowSyncHeights[0]))); },
+ },
+ {
+ key: 'cols',
+ content: allDayContent,
+ },
+ ],
+ });
+ sections.push({
+ key: 'all-day-divider',
+ type: 'body',
+ outerContent: ( // TODO: rename to cellContent so don't need to define ?
+ createElement("tr", { className: "fc-scrollgrid-section" },
+ createElement("td", { colSpan: 2, className: 'fc-timegrid-divider ' + context.theme.getClass('tableCellShaded') }))),
+ });
+ }
+ var isNowIndicator = context.options.nowIndicator;
+ sections.push({
+ type: 'body',
+ key: 'body',
+ liquid: true,
+ expandRows: Boolean(context.options.expandRows),
+ chunks: [
+ {
+ key: 'axis',
+ content: function (arg) { return (
+ // TODO: make this now-indicator arrow more DRY with TimeColsContent
+ createElement("div", { className: "fc-timegrid-axis-chunk" },
+ createElement("table", { style: { height: arg.expandRows ? arg.clientHeight : '' } },
+ arg.tableColGroupNode,
+ createElement("tbody", null,
+ createElement(TimeBodyAxis, { slatMetas: slatMetas }))),
+ createElement("div", { className: "fc-timegrid-now-indicator-container" },
+ createElement(NowTimer, { unit: isNowIndicator ? 'minute' : 'day' /* hacky */ }, function (nowDate) {
+ var nowIndicatorTop = isNowIndicator &&
+ slatCoords &&
+ slatCoords.safeComputeTop(nowDate); // might return void
+ if (typeof nowIndicatorTop === 'number') {
+ return (createElement(NowIndicatorRoot, { isAxis: true, date: nowDate }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("div", { ref: rootElRef, className: ['fc-timegrid-now-indicator-arrow'].concat(classNames).join(' '), style: { top: nowIndicatorTop } }, innerContent)); }));
+ }
+ return null;
+ })))); },
+ },
+ {
+ key: 'cols',
+ scrollerElRef: this.scrollerElRef,
+ content: timeContent,
+ },
+ ],
+ });
+ if (stickyFooterScrollbar) {
+ sections.push({
+ key: 'footer',
+ type: 'footer',
+ isSticky: true,
+ chunks: [
+ {
+ key: 'axis',
+ content: renderScrollShim,
+ },
+ {
+ key: 'cols',
+ content: renderScrollShim,
+ },
+ ],
+ });
+ }
+ return (createElement(ViewRoot, { viewSpec: context.viewSpec, elRef: this.rootElRef }, function (rootElRef, classNames) { return (createElement("div", { className: ['fc-timegrid'].concat(classNames).join(' '), ref: rootElRef },
+ createElement(ScrollGrid, { liquid: !props.isHeightAuto && !props.forPrint, collapsibleWidth: false, colGroups: [
+ { width: 'shrink', cols: [{ width: 'shrink' }] },
+ { cols: [{ span: colCnt, minWidth: dayMinWidth }] },
+ ], sections: sections }))); }));
+ };
+ /* Dimensions
+ ------------------------------------------------------------------------------------------------------------------*/
+ TimeColsView.prototype.getAllDayMaxEventProps = function () {
+ var _a = this.context.options, dayMaxEvents = _a.dayMaxEvents, dayMaxEventRows = _a.dayMaxEventRows;
+ if (dayMaxEvents === true || dayMaxEventRows === true) { // is auto?
+ dayMaxEvents = undefined;
+ dayMaxEventRows = AUTO_ALL_DAY_MAX_EVENT_ROWS; // make sure "auto" goes to a real number
+ }
+ return { dayMaxEvents: dayMaxEvents, dayMaxEventRows: dayMaxEventRows };
+ };
+ return TimeColsView;
+ }(DateComponent));
+ function renderAllDayInner$1(hookProps) {
+ return hookProps.text;
+ }
+
+ var TimeColsSlatsCoords = /** @class */ (function () {
+ function TimeColsSlatsCoords(positions, dateProfile, slotDuration) {
+ this.positions = positions;
+ this.dateProfile = dateProfile;
+ this.slotDuration = slotDuration;
+ }
+ TimeColsSlatsCoords.prototype.safeComputeTop = function (date) {
+ var dateProfile = this.dateProfile;
+ if (rangeContainsMarker(dateProfile.currentRange, date)) {
+ var startOfDayDate = startOfDay(date);
+ var timeMs = date.valueOf() - startOfDayDate.valueOf();
+ if (timeMs >= asRoughMs(dateProfile.slotMinTime) &&
+ timeMs < asRoughMs(dateProfile.slotMaxTime)) {
+ return this.computeTimeTop(createDuration(timeMs));
+ }
+ }
+ return null;
+ };
+ // Computes the top coordinate, relative to the bounds of the grid, of the given date.
+ // A `startOfDayDate` must be given for avoiding ambiguity over how to treat midnight.
+ TimeColsSlatsCoords.prototype.computeDateTop = function (when, startOfDayDate) {
+ if (!startOfDayDate) {
+ startOfDayDate = startOfDay(when);
+ }
+ return this.computeTimeTop(createDuration(when.valueOf() - startOfDayDate.valueOf()));
+ };
+ // Computes the top coordinate, relative to the bounds of the grid, of the given time (a Duration).
+ // This is a makeshify way to compute the time-top. Assumes all slatMetas dates are uniform.
+ // Eventually allow computation with arbirary slat dates.
+ TimeColsSlatsCoords.prototype.computeTimeTop = function (duration) {
+ var _a = this, positions = _a.positions, dateProfile = _a.dateProfile;
+ var len = positions.els.length;
+ // floating-point value of # of slots covered
+ var slatCoverage = (duration.milliseconds - asRoughMs(dateProfile.slotMinTime)) / asRoughMs(this.slotDuration);
+ var slatIndex;
+ var slatRemainder;
+ // compute a floating-point number for how many slats should be progressed through.
+ // from 0 to number of slats (inclusive)
+ // constrained because slotMinTime/slotMaxTime might be customized.
+ slatCoverage = Math.max(0, slatCoverage);
+ slatCoverage = Math.min(len, slatCoverage);
+ // an integer index of the furthest whole slat
+ // from 0 to number slats (*exclusive*, so len-1)
+ slatIndex = Math.floor(slatCoverage);
+ slatIndex = Math.min(slatIndex, len - 1);
+ // how much further through the slatIndex slat (from 0.0-1.0) must be covered in addition.
+ // could be 1.0 if slatCoverage is covering *all* the slots
+ slatRemainder = slatCoverage - slatIndex;
+ return positions.tops[slatIndex] +
+ positions.getHeight(slatIndex) * slatRemainder;
+ };
+ return TimeColsSlatsCoords;
+ }());
+
+ var TimeColsSlatsBody = /** @class */ (function (_super) {
+ __extends(TimeColsSlatsBody, _super);
+ function TimeColsSlatsBody() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ TimeColsSlatsBody.prototype.render = function () {
+ var _a = this, props = _a.props, context = _a.context;
+ var options = context.options;
+ var slatElRefs = props.slatElRefs;
+ return (createElement("tbody", null, props.slatMetas.map(function (slatMeta, i) {
+ var hookProps = {
+ time: slatMeta.time,
+ date: context.dateEnv.toDate(slatMeta.date),
+ view: context.viewApi,
+ };
+ var classNames = [
+ 'fc-timegrid-slot',
+ 'fc-timegrid-slot-lane',
+ slatMeta.isLabeled ? '' : 'fc-timegrid-slot-minor',
+ ];
+ return (createElement("tr", { key: slatMeta.key, ref: slatElRefs.createRef(slatMeta.key) },
+ props.axis && (createElement(TimeColsAxisCell, __assign({}, slatMeta))),
+ createElement(RenderHook, { hookProps: hookProps, classNames: options.slotLaneClassNames, content: options.slotLaneContent, didMount: options.slotLaneDidMount, willUnmount: options.slotLaneWillUnmount }, function (rootElRef, customClassNames, innerElRef, innerContent) { return (createElement("td", { ref: rootElRef, className: classNames.concat(customClassNames).join(' '), "data-time": slatMeta.isoTimeStr }, innerContent)); })));
+ })));
+ };
+ return TimeColsSlatsBody;
+ }(BaseComponent));
+
+ /*
+ for the horizontal "slats" that run width-wise. Has a time axis on a side. Depends on RTL.
+ */
+ var TimeColsSlats = /** @class */ (function (_super) {
+ __extends(TimeColsSlats, _super);
+ function TimeColsSlats() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.rootElRef = createRef();
+ _this.slatElRefs = new RefMap();
+ return _this;
+ }
+ TimeColsSlats.prototype.render = function () {
+ var _a = this, props = _a.props, context = _a.context;
+ return (createElement("div", { className: "fc-timegrid-slots", ref: this.rootElRef },
+ createElement("table", { className: context.theme.getClass('table'), style: {
+ minWidth: props.tableMinWidth,
+ width: props.clientWidth,
+ height: props.minHeight,
+ } },
+ props.tableColGroupNode /* relies on there only being a single subcomponent
+ NOTE: doesn't support collapsibleWidth (which is sortof a hack anyway)
+ */
+ var ScrollGrid = /** @class */ (function (_super) {
+ __extends(ScrollGrid, _super);
+ function ScrollGrid() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.compileColGroupStats = memoizeArraylike(compileColGroupStat, isColGroupStatsEqual);
+ _this.renderMicroColGroups = memoizeArraylike(renderMicroColGroup); // yucky to memoize VNodes, but much more efficient for consumers
+ _this.clippedScrollerRefs = new RefMap();
+ // doesn't hold non-scrolling els used just for padding
+ _this.scrollerElRefs = new RefMap(_this._handleScrollerEl.bind(_this));
+ _this.chunkElRefs = new RefMap(_this._handleChunkEl.bind(_this));
+ _this.getStickyScrolling = memoizeArraylike(initStickyScrolling, null, destroyStickyScrolling);
+ _this.getScrollSyncersBySection = memoizeHashlike(initScrollSyncer.bind(_this, true), null, destroyScrollSyncer);
+ _this.getScrollSyncersByColumn = memoizeHashlike(initScrollSyncer.bind(_this, false), null, destroyScrollSyncer);
+ _this.stickyScrollings = [];
+ _this.scrollSyncersBySection = {};
+ _this.scrollSyncersByColumn = {};
+ // for row-height-syncing
+ _this.rowUnstableMap = new Map(); // no need to groom. always self-cancels
+ _this.rowInnerMaxHeightMap = new Map();
+ _this.anyRowHeightsChanged = false;
+ _this.recentSizingCnt = 0;
+ _this.state = {
+ shrinkWidths: [],
+ forceYScrollbars: false,
+ forceXScrollbars: false,
+ scrollerClientWidths: {},
+ scrollerClientHeights: {},
+ sectionRowMaxHeights: [],
+ };
+ _this.handleSizing = function (isForcedResize, sectionRowMaxHeightsChanged) {
+ if (!_this.allowSizing()) {
+ return;
+ }
+ if (!sectionRowMaxHeightsChanged) { // something else changed, probably external
+ _this.anyRowHeightsChanged = true;
+ }
+ var otherState = {};
+ // if reacting to self-change of sectionRowMaxHeightsChanged, or not stable, don't do anything
+ if (isForcedResize || (!sectionRowMaxHeightsChanged && !_this.rowUnstableMap.size)) {
+ otherState.sectionRowMaxHeights = _this.computeSectionRowMaxHeights();
+ }
+ _this.setState(__assign(__assign({ shrinkWidths: _this.computeShrinkWidths() }, _this.computeScrollerDims()), otherState), function () {
+ if (!_this.rowUnstableMap.size) {
+ _this.updateStickyScrolling(); // needs to happen AFTER final positioning committed to DOM
+ }
+ });
+ };
+ _this.handleRowHeightChange = function (rowEl, isStable) {
+ var _a = _this, rowUnstableMap = _a.rowUnstableMap, rowInnerMaxHeightMap = _a.rowInnerMaxHeightMap;
+ if (!isStable) {
+ rowUnstableMap.set(rowEl, true);
+ }
+ else {
+ rowUnstableMap.delete(rowEl);
+ var innerMaxHeight = getRowInnerMaxHeight(rowEl);
+ if (!rowInnerMaxHeightMap.has(rowEl) || rowInnerMaxHeightMap.get(rowEl) !== innerMaxHeight) {
+ rowInnerMaxHeightMap.set(rowEl, innerMaxHeight);
+ _this.anyRowHeightsChanged = true;
+ }
+ if (!rowUnstableMap.size && _this.anyRowHeightsChanged) {
+ _this.anyRowHeightsChanged = false;
+ _this.setState({
+ sectionRowMaxHeights: _this.computeSectionRowMaxHeights(),
+ });
+ }
+ }
+ };
+ return _this;
+ }
+ ScrollGrid.prototype.render = function () {
+ var _a = this, props = _a.props, state = _a.state, context = _a.context;
+ var shrinkWidths = state.shrinkWidths;
+ var colGroupStats = this.compileColGroupStats(props.colGroups.map(function (colGroup) { return [colGroup]; }));
+ var microColGroupNodes = this.renderMicroColGroups(colGroupStats.map(function (stat, i) { return [stat.cols, shrinkWidths[i]]; }));
+ var classNames = getScrollGridClassNames(props.liquid, context);
+ var _b = this.getDims(); _b[0]; _b[1];
+ // TODO: make DRY
+ var sectionConfigs = props.sections;
+ var configCnt = sectionConfigs.length;
+ var configI = 0;
+ var currentConfig;
+ var headSectionNodes = [];
+ var bodySectionNodes = [];
+ var footSectionNodes = [];
+ while (configI < configCnt && (currentConfig = sectionConfigs[configI]).type === 'header') {
+ headSectionNodes.push(this.renderSection(currentConfig, configI, colGroupStats, microColGroupNodes, state.sectionRowMaxHeights));
+ configI += 1;
+ }
+ while (configI < configCnt && (currentConfig = sectionConfigs[configI]).type === 'body') {
+ bodySectionNodes.push(this.renderSection(currentConfig, configI, colGroupStats, microColGroupNodes, state.sectionRowMaxHeights));
+ configI += 1;
+ }
+ while (configI < configCnt && (currentConfig = sectionConfigs[configI]).type === 'footer') {
+ footSectionNodes.push(this.renderSection(currentConfig, configI, colGroupStats, microColGroupNodes, state.sectionRowMaxHeights));
+ configI += 1;
+ }
+ var isBuggy = !getCanVGrowWithinCell(); // see NOTE in SimpleScrollGrid
+ return createElement('table', {
+ ref: props.elRef,
+ className: classNames.join(' '),
+ }, renderMacroColGroup(colGroupStats, shrinkWidths), Boolean(!isBuggy && headSectionNodes.length) && createElement.apply(void 0, __spreadArray(['thead', {}], headSectionNodes)), Boolean(!isBuggy && bodySectionNodes.length) && createElement.apply(void 0, __spreadArray(['tbody', {}], bodySectionNodes)), Boolean(!isBuggy && footSectionNodes.length) && createElement.apply(void 0, __spreadArray(['tfoot', {}], footSectionNodes)), isBuggy && createElement.apply(void 0, __spreadArray(__spreadArray(__spreadArray(['tbody', {}], headSectionNodes), bodySectionNodes), footSectionNodes)));
+ };
+ ScrollGrid.prototype.renderSection = function (sectionConfig, sectionIndex, colGroupStats, microColGroupNodes, sectionRowMaxHeights) {
+ var _this = this;
+ if ('outerContent' in sectionConfig) {
+ return (createElement(Fragment, { key: sectionConfig.key }, sectionConfig.outerContent));
+ }
+ return (createElement("tr", { key: sectionConfig.key, className: getSectionClassNames(sectionConfig, this.props.liquid).join(' ') }, sectionConfig.chunks.map(function (chunkConfig, i) { return _this.renderChunk(sectionConfig, sectionIndex, colGroupStats[i], microColGroupNodes[i], chunkConfig, i, (sectionRowMaxHeights[sectionIndex] || [])[i] || []); })));
+ };
+ ScrollGrid.prototype.renderChunk = function (sectionConfig, sectionIndex, colGroupStat, microColGroupNode, chunkConfig, chunkIndex, rowHeights) {
+ if ('outerContent' in chunkConfig) {
+ return (createElement(Fragment, { key: chunkConfig.key }, chunkConfig.outerContent));
+ }
+ var state = this.state;
+ var scrollerClientWidths = state.scrollerClientWidths, scrollerClientHeights = state.scrollerClientHeights;
+ var _a = this.getDims(), sectionCnt = _a[0], chunksPerSection = _a[1];
+ var index = sectionIndex * chunksPerSection + chunkIndex;
+ var sideScrollIndex = (!this.context.isRtl || getIsRtlScrollbarOnLeft()) ? chunksPerSection - 1 : 0;
+ var isVScrollSide = chunkIndex === sideScrollIndex;
+ var isLastSection = sectionIndex === sectionCnt - 1;
+ var forceXScrollbars = isLastSection && state.forceXScrollbars; // NOOOO can result in `null`
+ var forceYScrollbars = isVScrollSide && state.forceYScrollbars; // NOOOO can result in `null`
+ var allowXScrolling = colGroupStat && colGroupStat.allowXScrolling; // rename?
+ var allowYScrolling = getAllowYScrolling(this.props, sectionConfig); // rename? do in section func?
+ var chunkVGrow = getSectionHasLiquidHeight(this.props, sectionConfig); // do in section func?
+ var expandRows = sectionConfig.expandRows && chunkVGrow;
+ var tableMinWidth = (colGroupStat && colGroupStat.totalColMinWidth) || '';
+ var content = renderChunkContent(sectionConfig, chunkConfig, {
+ tableColGroupNode: microColGroupNode,
+ tableMinWidth: tableMinWidth,
+ clientWidth: scrollerClientWidths[index] !== undefined ? scrollerClientWidths[index] : null,
+ clientHeight: scrollerClientHeights[index] !== undefined ? scrollerClientHeights[index] : null,
+ expandRows: expandRows,
+ syncRowHeights: Boolean(sectionConfig.syncRowHeights),
+ rowSyncHeights: rowHeights,
+ reportRowHeightChange: this.handleRowHeightChange,
+ });
+ var overflowX = forceXScrollbars ? (isLastSection ? 'auto' : 'scroll-hidden') :
+ !allowXScrolling ? 'hidden' :
+ (isLastSection ? 'auto' : 'scroll-hidden');
+ var overflowY = forceYScrollbars ? (isVScrollSide ? 'auto' : 'scroll-hidden') :
+ !allowYScrolling ? 'hidden' :
+ (isVScrollSide ? 'auto' : 'scroll-hidden');
+ // it *could* be possible to reduce DOM wrappers by only doing a ClippedScroller when allowXScrolling or allowYScrolling,
+ // but if these values were to change, the inner components would be unmounted/remounted because of the parent change.
+ content = (createElement(ClippedScroller, { ref: this.clippedScrollerRefs.createRef(index), scrollerElRef: this.scrollerElRefs.createRef(index), overflowX: overflowX, overflowY: overflowY, liquid: chunkVGrow, maxHeight: sectionConfig.maxHeight }, content));
+ return (createElement("td", { key: chunkConfig.key, ref: this.chunkElRefs.createRef(index) }, content));
+ };
+ ScrollGrid.prototype.componentDidMount = function () {
+ this.updateScrollSyncers();
+ this.handleSizing(false);
+ this.context.addResizeHandler(this.handleSizing);
+ };
+ ScrollGrid.prototype.componentDidUpdate = function (prevProps, prevState) {
+ this.updateScrollSyncers();
+ // TODO: need better solution when state contains non-sizing things
+ this.handleSizing(false, prevState.sectionRowMaxHeights !== this.state.sectionRowMaxHeights);
+ };
+ ScrollGrid.prototype.componentWillUnmount = function () {
+ this.context.removeResizeHandler(this.handleSizing);
+ this.destroyStickyScrolling();
+ this.destroyScrollSyncers();
+ };
+ ScrollGrid.prototype.allowSizing = function () {
+ var now = new Date();
+ if (!this.lastSizingDate ||
+ now.valueOf() > this.lastSizingDate.valueOf() + config.SCROLLGRID_RESIZE_INTERVAL) {
+ this.lastSizingDate = now;
+ this.recentSizingCnt = 0;
+ return true;
+ }
+ return (this.recentSizingCnt += 1) <= 10;
+ };
+ ScrollGrid.prototype.computeShrinkWidths = function () {
+ var _this = this;
+ var colGroupStats = this.compileColGroupStats(this.props.colGroups.map(function (colGroup) { return [colGroup]; }));
+ var _a = this.getDims(), sectionCnt = _a[0], chunksPerSection = _a[1];
+ var cnt = sectionCnt * chunksPerSection;
+ var shrinkWidths = [];
+ colGroupStats.forEach(function (colGroupStat, i) {
+ if (colGroupStat.hasShrinkCol) {
+ var chunkEls = _this.chunkElRefs.collect(i, cnt, chunksPerSection); // in one col
+ shrinkWidths[i] = computeShrinkWidth(chunkEls);
+ }
+ });
+ return shrinkWidths;
+ };
+ // has the side effect of grooming rowInnerMaxHeightMap
+ // TODO: somehow short-circuit if there are no new height changes
+ ScrollGrid.prototype.computeSectionRowMaxHeights = function () {
+ var newHeightMap = new Map();
+ var _a = this.getDims(), sectionCnt = _a[0], chunksPerSection = _a[1];
+ var sectionRowMaxHeights = [];
+ for (var sectionI = 0; sectionI < sectionCnt; sectionI += 1) {
+ var sectionConfig = this.props.sections[sectionI];
+ var assignableHeights = []; // chunk, row
+ if (sectionConfig && sectionConfig.syncRowHeights) {
+ var rowHeightsByChunk = [];
+ for (var chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
+ var index = sectionI * chunksPerSection + chunkI;
+ var rowHeights = [];
+ var chunkEl = this.chunkElRefs.currentMap[index];
+ if (chunkEl) {
+ rowHeights = findElements(chunkEl, '.fc-scrollgrid-sync-table tr').map(function (rowEl) {
+ var max = getRowInnerMaxHeight(rowEl);
+ newHeightMap.set(rowEl, max);
+ return max;
+ });
+ }
+ else {
+ rowHeights = [];
+ }
+ rowHeightsByChunk.push(rowHeights);
+ }
+ var rowCnt = rowHeightsByChunk[0].length;
+ var isEqualRowCnt = true;
+ for (var chunkI = 1; chunkI < chunksPerSection; chunkI += 1) {
+ var isOuterContent = sectionConfig.chunks[chunkI] && sectionConfig.chunks[chunkI].outerContent !== undefined; // can be null
+ if (!isOuterContent && rowHeightsByChunk[chunkI].length !== rowCnt) { // skip outer content
+ isEqualRowCnt = false;
+ break;
+ }
+ }
+ if (!isEqualRowCnt) {
+ var chunkHeightSums = [];
+ for (var chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
+ chunkHeightSums.push(sumNumbers(rowHeightsByChunk[chunkI]) + rowHeightsByChunk[chunkI].length);
+ }
+ var maxTotalSum = Math.max.apply(Math, chunkHeightSums);
+ for (var chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
+ var rowInChunkCnt = rowHeightsByChunk[chunkI].length;
+ var rowInChunkTotalHeight = maxTotalSum - rowInChunkCnt; // subtract border
+ // height of non-first row. we do this to avoid rounding, because it's unreliable within a table
+ var rowInChunkHeightOthers = Math.floor(rowInChunkTotalHeight / rowInChunkCnt);
+ // whatever is leftover goes to the first row
+ var rowInChunkHeightFirst = rowInChunkTotalHeight - rowInChunkHeightOthers * (rowInChunkCnt - 1);
+ var rowInChunkHeights = [];
+ var row = 0;
+ if (row < rowInChunkCnt) {
+ rowInChunkHeights.push(rowInChunkHeightFirst);
+ row += 1;
+ }
+ while (row < rowInChunkCnt) {
+ rowInChunkHeights.push(rowInChunkHeightOthers);
+ row += 1;
+ }
+ assignableHeights.push(rowInChunkHeights);
+ }
+ }
+ else {
+ for (var chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
+ assignableHeights.push([]);
+ }
+ for (var row = 0; row < rowCnt; row += 1) {
+ var rowHeightsAcrossChunks = [];
+ for (var chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
+ var h = rowHeightsByChunk[chunkI][row];
+ if (h != null) { // protect against outerContent
+ rowHeightsAcrossChunks.push(h);
+ }
+ }
+ var maxHeight = Math.max.apply(Math, rowHeightsAcrossChunks);
+ for (var chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
+ assignableHeights[chunkI].push(maxHeight);
+ }
+ }
+ }
+ }
+ sectionRowMaxHeights.push(assignableHeights);
+ }
+ this.rowInnerMaxHeightMap = newHeightMap;
+ return sectionRowMaxHeights;
+ };
+ ScrollGrid.prototype.computeScrollerDims = function () {
+ var scrollbarWidth = getScrollbarWidths();
+ var _a = this.getDims(), sectionCnt = _a[0], chunksPerSection = _a[1];
+ var sideScrollI = (!this.context.isRtl || getIsRtlScrollbarOnLeft()) ? chunksPerSection - 1 : 0;
+ var lastSectionI = sectionCnt - 1;
+ var currentScrollers = this.clippedScrollerRefs.currentMap;
+ var scrollerEls = this.scrollerElRefs.currentMap;
+ var forceYScrollbars = false;
+ var forceXScrollbars = false;
+ var scrollerClientWidths = {};
+ var scrollerClientHeights = {};
+ for (var sectionI = 0; sectionI < sectionCnt; sectionI += 1) { // along edge
+ var index = sectionI * chunksPerSection + sideScrollI;
+ var scroller = currentScrollers[index];
+ if (scroller && scroller.needsYScrolling()) {
+ forceYScrollbars = true;
+ break;
+ }
+ }
+ for (var chunkI = 0; chunkI < chunksPerSection; chunkI += 1) { // along last row
+ var index = lastSectionI * chunksPerSection + chunkI;
+ var scroller = currentScrollers[index];
+ if (scroller && scroller.needsXScrolling()) {
+ forceXScrollbars = true;
+ break;
+ }
+ }
+ for (var sectionI = 0; sectionI < sectionCnt; sectionI += 1) {
+ for (var chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
+ var index = sectionI * chunksPerSection + chunkI;
+ var scrollerEl = scrollerEls[index];
+ if (scrollerEl) {
+ // TODO: weird way to get this. need harness b/c doesn't include table borders
+ var harnessEl = scrollerEl.parentNode;
+ scrollerClientWidths[index] = Math.floor(harnessEl.getBoundingClientRect().width - ((chunkI === sideScrollI && forceYScrollbars)
+ ? scrollbarWidth.y // use global because scroller might not have scrollbars yet but will need them in future
+ : 0));
+ scrollerClientHeights[index] = Math.floor(harnessEl.getBoundingClientRect().height - ((sectionI === lastSectionI && forceXScrollbars)
+ ? scrollbarWidth.x // use global because scroller might not have scrollbars yet but will need them in future
+ : 0));
+ }
+ }
+ }
+ return { forceYScrollbars: forceYScrollbars, forceXScrollbars: forceXScrollbars, scrollerClientWidths: scrollerClientWidths, scrollerClientHeights: scrollerClientHeights };
+ };
+ ScrollGrid.prototype.updateStickyScrolling = function () {
+ var isRtl = this.context.isRtl;
+ var argsByKey = this.scrollerElRefs.getAll().map(function (scrollEl) { return [scrollEl, isRtl]; });
+ var stickyScrollings = this.getStickyScrolling(argsByKey);
+ stickyScrollings.forEach(function (stickyScrolling) { return stickyScrolling.updateSize(); });
+ this.stickyScrollings = stickyScrollings;
+ };
+ ScrollGrid.prototype.destroyStickyScrolling = function () {
+ this.stickyScrollings.forEach(destroyStickyScrolling);
+ };
+ ScrollGrid.prototype.updateScrollSyncers = function () {
+ var _a = this.getDims(), sectionCnt = _a[0], chunksPerSection = _a[1];
+ var cnt = sectionCnt * chunksPerSection;
+ var scrollElsBySection = {};
+ var scrollElsByColumn = {};
+ var scrollElMap = this.scrollerElRefs.currentMap;
+ for (var sectionI = 0; sectionI < sectionCnt; sectionI += 1) {
+ var startIndex = sectionI * chunksPerSection;
+ var endIndex = startIndex + chunksPerSection;
+ scrollElsBySection[sectionI] = collectFromHash(scrollElMap, startIndex, endIndex, 1); // use the filtered
+ }
+ for (var col = 0; col < chunksPerSection; col += 1) {
+ scrollElsByColumn[col] = this.scrollerElRefs.collect(col, cnt, chunksPerSection); // DON'T use the filtered
+ }
+ this.scrollSyncersBySection = this.getScrollSyncersBySection(scrollElsBySection);
+ this.scrollSyncersByColumn = this.getScrollSyncersByColumn(scrollElsByColumn);
+ };
+ ScrollGrid.prototype.destroyScrollSyncers = function () {
+ mapHash(this.scrollSyncersBySection, destroyScrollSyncer);
+ mapHash(this.scrollSyncersByColumn, destroyScrollSyncer);
+ };
+ ScrollGrid.prototype.getChunkConfigByIndex = function (index) {
+ var chunksPerSection = this.getDims()[1];
+ var sectionI = Math.floor(index / chunksPerSection);
+ var chunkI = index % chunksPerSection;
+ var sectionConfig = this.props.sections[sectionI];
+ return sectionConfig && sectionConfig.chunks[chunkI];
+ };
+ ScrollGrid.prototype.forceScrollLeft = function (col, scrollLeft) {
+ var scrollSyncer = this.scrollSyncersByColumn[col];
+ if (scrollSyncer) {
+ scrollSyncer.forceScrollLeft(scrollLeft);
+ }
+ };
+ ScrollGrid.prototype.forceScrollTop = function (sectionI, scrollTop) {
+ var scrollSyncer = this.scrollSyncersBySection[sectionI];
+ if (scrollSyncer) {
+ scrollSyncer.forceScrollTop(scrollTop);
+ }
+ };
+ ScrollGrid.prototype._handleChunkEl = function (chunkEl, key) {
+ var chunkConfig = this.getChunkConfigByIndex(parseInt(key, 10));
+ if (chunkConfig) { // null if section disappeared. bad, b/c won't null-set the elRef
+ setRef(chunkConfig.elRef, chunkEl);
+ }
+ };
+ ScrollGrid.prototype._handleScrollerEl = function (scrollerEl, key) {
+ var chunkConfig = this.getChunkConfigByIndex(parseInt(key, 10));
+ if (chunkConfig) { // null if section disappeared. bad, b/c won't null-set the elRef
+ setRef(chunkConfig.scrollerElRef, scrollerEl);
+ }
+ };
+ ScrollGrid.prototype.getDims = function () {
+ var sectionCnt = this.props.sections.length;
+ var chunksPerSection = sectionCnt ? this.props.sections[0].chunks.length : 0;
+ return [sectionCnt, chunksPerSection];
+ };
+ return ScrollGrid;
+ }(BaseComponent));
+ ScrollGrid.addStateEquality({
+ shrinkWidths: isArraysEqual,
+ scrollerClientWidths: isPropsEqual,
+ scrollerClientHeights: isPropsEqual,
+ });
+ function sumNumbers(numbers) {
+ var sum = 0;
+ for (var _i = 0, numbers_1 = numbers; _i < numbers_1.length; _i++) {
+ var n = numbers_1[_i];
+ sum += n;
+ }
+ return sum;
+ }
+ function getRowInnerMaxHeight(rowEl) {
+ var innerHeights = findElements(rowEl, '.fc-scrollgrid-sync-inner').map(getElHeight);
+ if (innerHeights.length) {
+ return Math.max.apply(Math, innerHeights);
+ }
+ return 0;
+ }
+ function getElHeight(el) {
+ return el.offsetHeight; // better to deal with integers, for rounding, for PureComponent
+ }
+ function renderMacroColGroup(colGroupStats, shrinkWidths) {
+ var children = colGroupStats.map(function (colGroupStat, i) {
+ var width = colGroupStat.width;
+ if (width === 'shrink') {
+ width = colGroupStat.totalColWidth + sanitizeShrinkWidth(shrinkWidths[i]) + 1; // +1 for border :(
+ }
+ return ( // eslint-disable-next-line react/jsx-key
+ createElement("col", { style: { width: width } }));
+ });
+ return createElement.apply(void 0, __spreadArray(['colgroup', {}], children));
+ }
+ function compileColGroupStat(colGroupConfig) {
+ var totalColWidth = sumColProp(colGroupConfig.cols, 'width'); // excludes "shrink"
+ var totalColMinWidth = sumColProp(colGroupConfig.cols, 'minWidth');
+ var hasShrinkCol = hasShrinkWidth(colGroupConfig.cols);
+ var allowXScrolling = colGroupConfig.width !== 'shrink' && Boolean(totalColWidth || totalColMinWidth || hasShrinkCol);
+ return {
+ hasShrinkCol: hasShrinkCol,
+ totalColWidth: totalColWidth,
+ totalColMinWidth: totalColMinWidth,
+ allowXScrolling: allowXScrolling,
+ cols: colGroupConfig.cols,
+ width: colGroupConfig.width,
+ };
+ }
+ function sumColProp(cols, propName) {
+ var total = 0;
+ for (var _i = 0, cols_1 = cols; _i < cols_1.length; _i++) {
+ var col = cols_1[_i];
+ var val = col[propName];
+ if (typeof val === 'number') {
+ total += val * (col.span || 1);
+ }
+ }
+ return total;
+ }
+ var COL_GROUP_STAT_EQUALITY = {
+ cols: isColPropsEqual,
+ };
+ function isColGroupStatsEqual(stat0, stat1) {
+ return compareObjs(stat0, stat1, COL_GROUP_STAT_EQUALITY);
+ }
+ // for memoizers...
+ function initScrollSyncer(isVertical) {
+ var scrollEls = [];
+ for (var _i = 1; _i < arguments.length; _i++) {
+ scrollEls[_i - 1] = arguments[_i];
+ }
+ return new ScrollSyncer(isVertical, scrollEls);
+ }
+ function destroyScrollSyncer(scrollSyncer) {
+ scrollSyncer.destroy();
+ }
+ function initStickyScrolling(scrollEl, isRtl) {
+ return new StickyScrolling(scrollEl, isRtl);
+ }
+ function destroyStickyScrolling(stickyScrolling) {
+ stickyScrolling.destroy();
+ }
+
+ var scrollGridPlugin = createPlugin({
+ deps: [
+ premiumCommonPlugin,
+ ],
+ scrollGridImpl: ScrollGrid,
+ });
+ config.SCROLLGRID_RESIZE_INTERVAL = 500;
+
+ config.COLLAPSIBLE_WIDTH_THRESHOLD = 1200;
+ var contexts = [];
+ var undoFuncs = [];
+ var adaptivePlugin = createPlugin({
+ deps: [
+ premiumCommonPlugin,
+ ],
+ contextInit: function (context) {
+ if (!contexts.length) {
+ attachGlobalHandlers();
+ }
+ contexts.push(context);
+ context.calendarApi.on('_unmount', function () {
+ removeExact(contexts, context);
+ if (!contexts.length) {
+ removeGlobalHandlers();
+ }
+ });
+ },
+ });
+ function attachGlobalHandlers() {
+ window.addEventListener('beforeprint', handleBeforePrint);
+ window.addEventListener('afterprint', handleAfterPrint);
+ // // for testing
+ // let forPrint = false
+ // document.addEventListener('keypress', (ev) => {
+ // if (ev.key === 'p') {
+ // forPrint = !forPrint
+ // if (forPrint) {
+ // handleBeforePrint()
+ // } else {
+ // handleAfterPrint()
+ // }
+ // }
+ // })
+ }
+ function removeGlobalHandlers() {
+ window.removeEventListener('beforeprint', handleBeforePrint);
+ window.removeEventListener('afterprint', handleAfterPrint);
+ }
+ function handleBeforePrint() {
+ var scrollEls = queryScrollerEls();
+ var scrollCoords = queryScrollerCoords(scrollEls);
+ for (var _i = 0, contexts_1 = contexts; _i < contexts_1.length; _i++) {
+ var context = contexts_1[_i];
+ context.emitter.trigger('_beforeprint');
+ }
+ flushToDom(); // because printing grabs DOM immediately after
+ killHorizontalScrolling(scrollEls, scrollCoords);
+ undoFuncs.push(function () { return restoreScrollerCoords(scrollEls, scrollCoords); });
+ undoFuncs.push(freezeScrollgridWidths());
+ }
+ function handleAfterPrint() {
+ for (var _i = 0, contexts_2 = contexts; _i < contexts_2.length; _i++) {
+ var context = contexts_2[_i];
+ context.emitter.trigger('_afterprint');
+ }
+ flushToDom(); // guarantee that there are real scrollers
+ while (undoFuncs.length) {
+ undoFuncs.shift()();
+ }
+ }
+ // scrollgrid widths
+ function freezeScrollgridWidths() {
+ var els = findElements(document.body, '.fc-scrollgrid');
+ els.forEach(freezeScrollGridWidth);
+ return function () { return els.forEach(unfreezeScrollGridWidth); };
+ }
+ function freezeScrollGridWidth(el) {
+ var elWidth = el.getBoundingClientRect().width;
+ // along with collapsibleWidth, this is a hack for #5707
+ if (!el.classList.contains('fc-scrollgrid-collapsible') || elWidth < config.COLLAPSIBLE_WIDTH_THRESHOLD) {
+ el.style.width = elWidth + 'px';
+ }
+ }
+ function unfreezeScrollGridWidth(el) {
+ el.style.width = '';
+ }
+ // scrollers
+ // TODO: use scroll normalization!? yes
+ function queryScrollerEls() {
+ return findElements(document.body, '.fc-scroller-harness > .fc-scroller');
+ }
+ function queryScrollerCoords(els) {
+ return els.map(function (el) {
+ var computedStyle = window.getComputedStyle(el);
+ return {
+ scrollLeft: el.scrollLeft,
+ scrollTop: el.scrollTop,
+ overflowX: computedStyle.overflowX,
+ overflowY: computedStyle.overflowY,
+ marginBottom: computedStyle.marginBottom,
+ };
+ });
+ }
+ function killHorizontalScrolling(els, coords) {
+ els.forEach(function (el, i) {
+ el.style.overflowX = 'visible'; // need to clear X/Y to get true overflow
+ el.style.overflowY = 'visible'; // "
+ el.style.marginBottom = ''; // for clipping away scrollbar. disable
+ el.style.left = -coords[i].scrollLeft + 'px'; // simulate scrollLeft! will be position:relative
+ });
+ }
+ function restoreScrollerCoords(els, coords) {
+ els.forEach(function (el, i) {
+ var c = coords[i];
+ el.style.overflowX = c.overflowX;
+ el.style.overflowY = c.overflowY;
+ el.style.marginBottom = c.marginBottom;
+ el.style.left = '';
+ el.scrollLeft = c.scrollLeft;
+ el.scrollTop = c.scrollTop;
+ });
+ }
+
+ var MIN_AUTO_LABELS = 18; // more than `12` months but less that `24` hours
+ var MAX_AUTO_SLOTS_PER_LABEL = 6; // allows 6 10-min slots in an hour
+ var MAX_AUTO_CELLS = 200; // allows 4-days to have a :30 slot duration
+ config.MAX_TIMELINE_SLOTS = 1000;
+ // potential nice values for slot-duration and interval-duration
+ var STOCK_SUB_DURATIONS = [
+ { years: 1 },
+ { months: 1 },
+ { days: 1 },
+ { hours: 1 },
+ { minutes: 30 },
+ { minutes: 15 },
+ { minutes: 10 },
+ { minutes: 5 },
+ { minutes: 1 },
+ { seconds: 30 },
+ { seconds: 15 },
+ { seconds: 10 },
+ { seconds: 5 },
+ { seconds: 1 },
+ { milliseconds: 500 },
+ { milliseconds: 100 },
+ { milliseconds: 10 },
+ { milliseconds: 1 },
+ ];
+ function buildTimelineDateProfile(dateProfile, dateEnv, allOptions, dateProfileGenerator) {
+ var tDateProfile = {
+ labelInterval: allOptions.slotLabelInterval,
+ slotDuration: allOptions.slotDuration,
+ };
+ validateLabelAndSlot(tDateProfile, dateProfile, dateEnv); // validate after computed grid duration
+ ensureLabelInterval(tDateProfile, dateProfile, dateEnv);
+ ensureSlotDuration(tDateProfile, dateProfile, dateEnv);
+ var input = allOptions.slotLabelFormat;
+ var rawFormats = Array.isArray(input) ? input :
+ (input != null) ? [input] :
+ computeHeaderFormats(tDateProfile, dateProfile, dateEnv, allOptions);
+ tDateProfile.headerFormats = rawFormats.map(function (rawFormat) { return createFormatter(rawFormat); });
+ tDateProfile.isTimeScale = Boolean(tDateProfile.slotDuration.milliseconds);
+ var largeUnit = null;
+ if (!tDateProfile.isTimeScale) {
+ var slotUnit = greatestDurationDenominator(tDateProfile.slotDuration).unit;
+ if (/year|month|week/.test(slotUnit)) {
+ largeUnit = slotUnit;
+ }
+ }
+ tDateProfile.largeUnit = largeUnit;
+ tDateProfile.emphasizeWeeks =
+ asCleanDays(tDateProfile.slotDuration) === 1 &&
+ currentRangeAs('weeks', dateProfile, dateEnv) >= 2 &&
+ !allOptions.businessHours;
+ /*
+ console.log('label interval =', timelineView.labelInterval.humanize())
+ console.log('slot duration =', timelineView.slotDuration.humanize())
+ console.log('header formats =', timelineView.headerFormats)
+ console.log('isTimeScale', timelineView.isTimeScale)
+ console.log('largeUnit', timelineView.largeUnit)
+ */
+ var rawSnapDuration = allOptions.snapDuration;
+ var snapDuration;
+ var snapsPerSlot;
+ if (rawSnapDuration) {
+ snapDuration = createDuration(rawSnapDuration);
+ snapsPerSlot = wholeDivideDurations(tDateProfile.slotDuration, snapDuration);
+ // ^ TODO: warning if not whole?
+ }
+ if (snapsPerSlot == null) {
+ snapDuration = tDateProfile.slotDuration;
+ snapsPerSlot = 1;
+ }
+ tDateProfile.snapDuration = snapDuration;
+ tDateProfile.snapsPerSlot = snapsPerSlot;
+ // more...
+ var timeWindowMs = asRoughMs(dateProfile.slotMaxTime) - asRoughMs(dateProfile.slotMinTime);
+ // TODO: why not use normalizeRange!?
+ var normalizedStart = normalizeDate(dateProfile.renderRange.start, tDateProfile, dateEnv);
+ var normalizedEnd = normalizeDate(dateProfile.renderRange.end, tDateProfile, dateEnv);
+ // apply slotMinTime/slotMaxTime
+ // TODO: View should be responsible.
+ if (tDateProfile.isTimeScale) {
+ normalizedStart = dateEnv.add(normalizedStart, dateProfile.slotMinTime);
+ normalizedEnd = dateEnv.add(addDays(normalizedEnd, -1), dateProfile.slotMaxTime);
+ }
+ tDateProfile.timeWindowMs = timeWindowMs;
+ tDateProfile.normalizedRange = { start: normalizedStart, end: normalizedEnd };
+ var slotDates = [];
+ var date = normalizedStart;
+ while (date < normalizedEnd) {
+ if (isValidDate(date, tDateProfile, dateProfile, dateProfileGenerator)) {
+ slotDates.push(date);
+ }
+ date = dateEnv.add(date, tDateProfile.slotDuration);
+ }
+ tDateProfile.slotDates = slotDates;
+ // more...
+ var snapIndex = -1;
+ var snapDiff = 0; // index of the diff :(
+ var snapDiffToIndex = [];
+ var snapIndexToDiff = [];
+ date = normalizedStart;
+ while (date < normalizedEnd) {
+ if (isValidDate(date, tDateProfile, dateProfile, dateProfileGenerator)) {
+ snapIndex += 1;
+ snapDiffToIndex.push(snapIndex);
+ snapIndexToDiff.push(snapDiff);
+ }
+ else {
+ snapDiffToIndex.push(snapIndex + 0.5);
+ }
+ date = dateEnv.add(date, tDateProfile.snapDuration);
+ snapDiff += 1;
+ }
+ tDateProfile.snapDiffToIndex = snapDiffToIndex;
+ tDateProfile.snapIndexToDiff = snapIndexToDiff;
+ tDateProfile.snapCnt = snapIndex + 1; // is always one behind
+ tDateProfile.slotCnt = tDateProfile.snapCnt / tDateProfile.snapsPerSlot;
+ // more...
+ tDateProfile.isWeekStarts = buildIsWeekStarts(tDateProfile, dateEnv);
+ tDateProfile.cellRows = buildCellRows(tDateProfile, dateEnv);
+ tDateProfile.slotsPerLabel = wholeDivideDurations(tDateProfile.labelInterval, tDateProfile.slotDuration);
+ return tDateProfile;
+ }
+ /*
+ snaps to appropriate unit
+ */
+ function normalizeDate(date, tDateProfile, dateEnv) {
+ var normalDate = date;
+ if (!tDateProfile.isTimeScale) {
+ normalDate = startOfDay(normalDate);
+ if (tDateProfile.largeUnit) {
+ normalDate = dateEnv.startOf(normalDate, tDateProfile.largeUnit);
+ }
+ }
+ return normalDate;
+ }
+ /*
+ snaps to appropriate unit
+ */
+ function normalizeRange(range, tDateProfile, dateEnv) {
+ if (!tDateProfile.isTimeScale) {
+ range = computeVisibleDayRange(range);
+ if (tDateProfile.largeUnit) {
+ var dayRange = range; // preserve original result
+ range = {
+ start: dateEnv.startOf(range.start, tDateProfile.largeUnit),
+ end: dateEnv.startOf(range.end, tDateProfile.largeUnit),
+ };
+ // if date is partially through the interval, or is in the same interval as the start,
+ // make the exclusive end be the *next* interval
+ if (range.end.valueOf() !== dayRange.end.valueOf() || range.end <= range.start) {
+ range = {
+ start: range.start,
+ end: dateEnv.add(range.end, tDateProfile.slotDuration),
+ };
+ }
+ }
+ }
+ return range;
+ }
+ function isValidDate(date, tDateProfile, dateProfile, dateProfileGenerator) {
+ if (dateProfileGenerator.isHiddenDay(date)) {
+ return false;
+ }
+ if (tDateProfile.isTimeScale) {
+ // determine if the time is within slotMinTime/slotMaxTime, which may have wacky values
+ var day = startOfDay(date);
+ var timeMs = date.valueOf() - day.valueOf();
+ var ms = timeMs - asRoughMs(dateProfile.slotMinTime); // milliseconds since slotMinTime
+ ms = ((ms % 86400000) + 86400000) % 86400000; // make negative values wrap to 24hr clock
+ return ms < tDateProfile.timeWindowMs; // before the slotMaxTime?
+ }
+ return true;
+ }
+ function validateLabelAndSlot(tDateProfile, dateProfile, dateEnv) {
+ var currentRange = dateProfile.currentRange;
+ // make sure labelInterval doesn't exceed the max number of cells
+ if (tDateProfile.labelInterval) {
+ var labelCnt = dateEnv.countDurationsBetween(currentRange.start, currentRange.end, tDateProfile.labelInterval);
+ if (labelCnt > config.MAX_TIMELINE_SLOTS) {
+ console.warn('slotLabelInterval results in too many cells');
+ tDateProfile.labelInterval = null;
+ }
+ }
+ // make sure slotDuration doesn't exceed the maximum number of cells
+ if (tDateProfile.slotDuration) {
+ var slotCnt = dateEnv.countDurationsBetween(currentRange.start, currentRange.end, tDateProfile.slotDuration);
+ if (slotCnt > config.MAX_TIMELINE_SLOTS) {
+ console.warn('slotDuration results in too many cells');
+ tDateProfile.slotDuration = null;
+ }
+ }
+ // make sure labelInterval is a multiple of slotDuration
+ if (tDateProfile.labelInterval && tDateProfile.slotDuration) {
+ var slotsPerLabel = wholeDivideDurations(tDateProfile.labelInterval, tDateProfile.slotDuration);
+ if (slotsPerLabel === null || slotsPerLabel < 1) {
+ console.warn('slotLabelInterval must be a multiple of slotDuration');
+ tDateProfile.slotDuration = null;
+ }
+ }
+ }
+ function ensureLabelInterval(tDateProfile, dateProfile, dateEnv) {
+ var currentRange = dateProfile.currentRange;
+ var labelInterval = tDateProfile.labelInterval;
+ if (!labelInterval) {
+ // compute based off the slot duration
+ // find the largest label interval with an acceptable slots-per-label
+ var input = void 0;
+ if (tDateProfile.slotDuration) {
+ for (var _i = 0, STOCK_SUB_DURATIONS_1 = STOCK_SUB_DURATIONS; _i < STOCK_SUB_DURATIONS_1.length; _i++) {
+ input = STOCK_SUB_DURATIONS_1[_i];
+ var tryLabelInterval = createDuration(input);
+ var slotsPerLabel = wholeDivideDurations(tryLabelInterval, tDateProfile.slotDuration);
+ if (slotsPerLabel !== null && slotsPerLabel <= MAX_AUTO_SLOTS_PER_LABEL) {
+ labelInterval = tryLabelInterval;
+ break;
+ }
+ }
+ // use the slot duration as a last resort
+ if (!labelInterval) {
+ labelInterval = tDateProfile.slotDuration;
+ }
+ // compute based off the view's duration
+ // find the largest label interval that yields the minimum number of labels
+ }
+ else {
+ for (var _a = 0, STOCK_SUB_DURATIONS_2 = STOCK_SUB_DURATIONS; _a < STOCK_SUB_DURATIONS_2.length; _a++) {
+ input = STOCK_SUB_DURATIONS_2[_a];
+ labelInterval = createDuration(input);
+ var labelCnt = dateEnv.countDurationsBetween(currentRange.start, currentRange.end, labelInterval);
+ if (labelCnt >= MIN_AUTO_LABELS) {
+ break;
+ }
+ }
+ }
+ tDateProfile.labelInterval = labelInterval;
+ }
+ return labelInterval;
+ }
+ function ensureSlotDuration(tDateProfile, dateProfile, dateEnv) {
+ var currentRange = dateProfile.currentRange;
+ var slotDuration = tDateProfile.slotDuration;
+ if (!slotDuration) {
+ var labelInterval = ensureLabelInterval(tDateProfile, dateProfile, dateEnv); // will compute if necessary
+ // compute based off the label interval
+ // find the largest slot duration that is different from labelInterval, but still acceptable
+ for (var _i = 0, STOCK_SUB_DURATIONS_3 = STOCK_SUB_DURATIONS; _i < STOCK_SUB_DURATIONS_3.length; _i++) {
+ var input = STOCK_SUB_DURATIONS_3[_i];
+ var trySlotDuration = createDuration(input);
+ var slotsPerLabel = wholeDivideDurations(labelInterval, trySlotDuration);
+ if (slotsPerLabel !== null && slotsPerLabel > 1 && slotsPerLabel <= MAX_AUTO_SLOTS_PER_LABEL) {
+ slotDuration = trySlotDuration;
+ break;
+ }
+ }
+ // only allow the value if it won't exceed the view's # of slots limit
+ if (slotDuration) {
+ var slotCnt = dateEnv.countDurationsBetween(currentRange.start, currentRange.end, slotDuration);
+ if (slotCnt > MAX_AUTO_CELLS) {
+ slotDuration = null;
+ }
+ }
+ // use the label interval as a last resort
+ if (!slotDuration) {
+ slotDuration = labelInterval;
+ }
+ tDateProfile.slotDuration = slotDuration;
+ }
+ return slotDuration;
+ }
+ function computeHeaderFormats(tDateProfile, dateProfile, dateEnv, allOptions) {
+ var format1;
+ var format2;
+ var labelInterval = tDateProfile.labelInterval;
+ var unit = greatestDurationDenominator(labelInterval).unit;
+ var weekNumbersVisible = allOptions.weekNumbers;
+ var format0 = (format1 = (format2 = null));
+ // NOTE: weekNumber computation function wont work
+ if ((unit === 'week') && !weekNumbersVisible) {
+ unit = 'day';
+ }
+ switch (unit) {
+ case 'year':
+ format0 = { year: 'numeric' }; // '2015'
+ break;
+ case 'month':
+ if (currentRangeAs('years', dateProfile, dateEnv) > 1) {
+ format0 = { year: 'numeric' }; // '2015'
+ }
+ format1 = { month: 'short' }; // 'Jan'
+ break;
+ case 'week':
+ if (currentRangeAs('years', dateProfile, dateEnv) > 1) {
+ format0 = { year: 'numeric' }; // '2015'
+ }
+ format1 = { week: 'narrow' }; // 'Wk4'
+ break;
+ case 'day':
+ if (currentRangeAs('years', dateProfile, dateEnv) > 1) {
+ format0 = { year: 'numeric', month: 'long' }; // 'January 2014'
+ }
+ else if (currentRangeAs('months', dateProfile, dateEnv) > 1) {
+ format0 = { month: 'long' }; // 'January'
+ }
+ if (weekNumbersVisible) {
+ format1 = { week: 'short' }; // 'Wk 4'
+ }
+ format2 = { weekday: 'narrow', day: 'numeric' }; // 'Su 9'
+ break;
+ case 'hour':
+ if (weekNumbersVisible) {
+ format0 = { week: 'short' }; // 'Wk 4'
+ }
+ if (currentRangeAs('days', dateProfile, dateEnv) > 1) {
+ format1 = { weekday: 'short', day: 'numeric', month: 'numeric', omitCommas: true }; // Sat 4/7
+ }
+ format2 = {
+ hour: 'numeric',
+ minute: '2-digit',
+ omitZeroMinute: true,
+ meridiem: 'short',
+ };
+ break;
+ case 'minute':
+ // sufficiently large number of different minute cells?
+ if ((asRoughMinutes(labelInterval) / 60) >= MAX_AUTO_SLOTS_PER_LABEL) {
+ format0 = {
+ hour: 'numeric',
+ meridiem: 'short',
+ };
+ format1 = function (params) { return (':' + padStart(params.date.minute, 2) // ':30'
+ ); };
+ }
+ else {
+ format0 = {
+ hour: 'numeric',
+ minute: 'numeric',
+ meridiem: 'short',
+ };
+ }
+ break;
+ case 'second':
+ // sufficiently large number of different second cells?
+ if ((asRoughSeconds(labelInterval) / 60) >= MAX_AUTO_SLOTS_PER_LABEL) {
+ format0 = { hour: 'numeric', minute: '2-digit', meridiem: 'lowercase' }; // '8:30 PM'
+ format1 = function (params) { return (':' + padStart(params.date.second, 2) // ':30'
+ ); };
+ }
+ else {
+ format0 = { hour: 'numeric', minute: '2-digit', second: '2-digit', meridiem: 'lowercase' }; // '8:30:45 PM'
+ }
+ break;
+ case 'millisecond':
+ format0 = { hour: 'numeric', minute: '2-digit', second: '2-digit', meridiem: 'lowercase' }; // '8:30:45 PM'
+ format1 = function (params) { return ('.' + padStart(params.millisecond, 3)); };
+ break;
+ }
+ return [].concat(format0 || [], format1 || [], format2 || []);
+ }
+ // Compute the number of the give units in the "current" range.
+ // Won't go more precise than days.
+ // Will return `0` if there's not a clean whole interval.
+ function currentRangeAs(unit, dateProfile, dateEnv) {
+ var range = dateProfile.currentRange;
+ var res = null;
+ if (unit === 'years') {
+ res = dateEnv.diffWholeYears(range.start, range.end);
+ }
+ else if (unit === 'months') {
+ res = dateEnv.diffWholeMonths(range.start, range.end);
+ }
+ else if (unit === 'weeks') {
+ res = dateEnv.diffWholeMonths(range.start, range.end);
+ }
+ else if (unit === 'days') {
+ res = diffWholeDays(range.start, range.end);
+ }
+ return res || 0;
+ }
+ function buildIsWeekStarts(tDateProfile, dateEnv) {
+ var slotDates = tDateProfile.slotDates, emphasizeWeeks = tDateProfile.emphasizeWeeks;
+ var prevWeekNumber = null;
+ var isWeekStarts = [];
+ for (var _i = 0, slotDates_1 = slotDates; _i < slotDates_1.length; _i++) {
+ var slotDate = slotDates_1[_i];
+ var weekNumber = dateEnv.computeWeekNumber(slotDate);
+ var isWeekStart = emphasizeWeeks && (prevWeekNumber !== null) && (prevWeekNumber !== weekNumber);
+ prevWeekNumber = weekNumber;
+ isWeekStarts.push(isWeekStart);
+ }
+ return isWeekStarts;
+ }
+ function buildCellRows(tDateProfile, dateEnv) {
+ var slotDates = tDateProfile.slotDates;
+ var formats = tDateProfile.headerFormats;
+ var cellRows = formats.map(function () { return []; }); // indexed by row,col
+ var slotAsDays = asCleanDays(tDateProfile.slotDuration);
+ var guessedSlotUnit = slotAsDays === 7 ? 'week' :
+ slotAsDays === 1 ? 'day' :
+ null;
+ // specifically for navclicks
+ var rowUnitsFromFormats = formats.map(function (format) { return (format.getLargestUnit ? format.getLargestUnit() : null); });
+ // builds cellRows and slotCells
+ for (var i = 0; i < slotDates.length; i += 1) {
+ var date = slotDates[i];
+ var isWeekStart = tDateProfile.isWeekStarts[i];
+ for (var row = 0; row < formats.length; row += 1) {
+ var format = formats[row];
+ var rowCells = cellRows[row];
+ var leadingCell = rowCells[rowCells.length - 1];
+ var isLastRow = row === formats.length - 1;
+ var isSuperRow = formats.length > 1 && !isLastRow; // more than one row and not the last
+ var newCell = null;
+ var rowUnit = rowUnitsFromFormats[row] || (isLastRow ? guessedSlotUnit : null);
+ if (isSuperRow) {
+ var text = dateEnv.format(date, format);
+ if (!leadingCell || (leadingCell.text !== text)) {
+ newCell = buildCellObject(date, text, rowUnit);
+ }
+ else {
+ leadingCell.colspan += 1;
+ }
+ }
+ else if (!leadingCell ||
+ isInt(dateEnv.countDurationsBetween(tDateProfile.normalizedRange.start, date, tDateProfile.labelInterval))) {
+ var text = dateEnv.format(date, format);
+ newCell = buildCellObject(date, text, rowUnit);
+ }
+ else {
+ leadingCell.colspan += 1;
+ }
+ if (newCell) {
+ newCell.weekStart = isWeekStart;
+ rowCells.push(newCell);
+ }
+ }
+ }
+ return cellRows;
+ }
+ function buildCellObject(date, text, rowUnit) {
+ return { date: date, text: text, rowUnit: rowUnit, colspan: 1, isWeekStart: false };
+ }
+
+ var TimelineHeaderThInner = /** @class */ (function (_super) {
+ __extends(TimelineHeaderThInner, _super);
+ function TimelineHeaderThInner() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ TimelineHeaderThInner.prototype.render = function () {
+ var _a = this, props = _a.props, context = _a.context;
+ var navLinkAttrs = props.navLinkData
+ ? { 'data-navlink': props.navLinkData, tabIndex: 0 }
+ : {};
+ return (createElement(ContentHook, { hookProps: props.hookProps, content: context.options.slotLabelContent, defaultContent: renderInnerContent$1 }, function (innerElRef, innerContent) { return (createElement("a", __assign({ ref: innerElRef, className: 'fc-timeline-slot-cushion fc-scrollgrid-sync-inner' + (props.isSticky ? ' fc-sticky' : '') }, navLinkAttrs), innerContent)); }));
+ };
+ return TimelineHeaderThInner;
+ }(BaseComponent));
+ function renderInnerContent$1(props) {
+ return props.text;
+ }
+ function refineHookProps$2(input) {
+ return {
+ level: input.level,
+ date: input.dateEnv.toDate(input.dateMarker),
+ view: input.viewApi,
+ text: input.text,
+ };
+ }
+
+ var TimelineHeaderTh = /** @class */ (function (_super) {
+ __extends(TimelineHeaderTh, _super);
+ function TimelineHeaderTh() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.refineHookProps = memoizeObjArg(refineHookProps$2);
+ _this.normalizeClassNames = buildClassNameNormalizer();
+ return _this;
+ }
+ TimelineHeaderTh.prototype.render = function () {
+ var _a = this, props = _a.props, context = _a.context;
+ var dateEnv = context.dateEnv, options = context.options;
+ var cell = props.cell, dateProfile = props.dateProfile, tDateProfile = props.tDateProfile;
+ // the cell.rowUnit is f'd
+ // giving 'month' for a 3-day view
+ // workaround: to infer day, do NOT time
+ var dateMeta = getDateMeta(cell.date, props.todayRange, props.nowDate, dateProfile);
+ var classNames = ['fc-timeline-slot', 'fc-timeline-slot-label'].concat(cell.rowUnit === 'time' // TODO: so slot classnames for week/month/bigger. see note above about rowUnit
+ ? getSlotClassNames(dateMeta, context.theme)
+ : getDayClassNames(dateMeta, context.theme));
+ if (cell.isWeekStart) {
+ classNames.push('fc-timeline-slot-em');
+ }
+ var navLinkData = (options.navLinks && cell.rowUnit && cell.rowUnit !== 'time')
+ ? buildNavLinkData(cell.date, cell.rowUnit)
+ : null;
+ var hookProps = this.refineHookProps({
+ level: props.rowLevel,
+ dateMarker: cell.date,
+ text: cell.text,
+ dateEnv: context.dateEnv,
+ viewApi: context.viewApi,
+ });
+ var customClassNames = this.normalizeClassNames(options.slotLabelClassNames, hookProps);
+ return (createElement(MountHook, { hookProps: hookProps, didMount: options.slotLabelDidMount, willUnmount: options.slotLabelWillUnmount }, function (rootElRef) { return (createElement("th", { ref: rootElRef, className: classNames.concat(customClassNames).join(' '), "data-date": dateEnv.formatIso(cell.date, { omitTime: !tDateProfile.isTimeScale, omitTimeZoneOffset: true }), colSpan: cell.colspan },
+ createElement("div", { className: "fc-timeline-slot-frame", style: { height: props.rowInnerHeight } },
+ createElement(TimelineHeaderThInner, { hookProps: hookProps, isSticky: props.isSticky, navLinkData: navLinkData })))); }));
+ };
+ return TimelineHeaderTh;
+ }(BaseComponent));
+
+ var TimelineHeaderRows = /** @class */ (function (_super) {
+ __extends(TimelineHeaderRows, _super);
+ function TimelineHeaderRows() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ TimelineHeaderRows.prototype.render = function () {
+ var _a = this.props, dateProfile = _a.dateProfile, tDateProfile = _a.tDateProfile, rowInnerHeights = _a.rowInnerHeights, todayRange = _a.todayRange, nowDate = _a.nowDate;
+ var cellRows = tDateProfile.cellRows;
+ return (createElement(Fragment, null, cellRows.map(function (rowCells, rowLevel) {
+ var isLast = rowLevel === cellRows.length - 1;
+ var isChrono = tDateProfile.isTimeScale && isLast; // the final row, with times?
+ var classNames = [
+ 'fc-timeline-header-row',
+ isChrono ? 'fc-timeline-header-row-chrono' : '',
+ ];
+ return ( // eslint-disable-next-line react/no-array-index-key
+ createElement("tr", { key: rowLevel, className: classNames.join(' ') }, rowCells.map(function (cell) { return (createElement(TimelineHeaderTh, { key: cell.date.toISOString(), cell: cell, rowLevel: rowLevel, dateProfile: dateProfile, tDateProfile: tDateProfile, todayRange: todayRange, nowDate: nowDate, rowInnerHeight: rowInnerHeights && rowInnerHeights[rowLevel], isSticky: !isLast })); })));
+ })));
+ };
+ return TimelineHeaderRows;
+ }(BaseComponent));
+
+ var TimelineCoords = /** @class */ (function () {
+ function TimelineCoords(slatRootEl, // okay to expose?
+ slatEls, dateProfile, tDateProfile, dateEnv, isRtl) {
+ this.slatRootEl = slatRootEl;
+ this.dateProfile = dateProfile;
+ this.tDateProfile = tDateProfile;
+ this.dateEnv = dateEnv;
+ this.isRtl = isRtl;
+ this.outerCoordCache = new PositionCache(slatRootEl, slatEls, true, // isHorizontal
+ false);
+ // for the inner divs within the slats
+ // used for event rendering and scrollTime, to disregard slat border
+ this.innerCoordCache = new PositionCache(slatRootEl, findDirectChildren(slatEls, 'div'), true, // isHorizontal
+ false);
+ }
+ TimelineCoords.prototype.isDateInRange = function (date) {
+ return rangeContainsMarker(this.dateProfile.currentRange, date);
+ };
+ // results range from negative width of area to 0
+ TimelineCoords.prototype.dateToCoord = function (date) {
+ var tDateProfile = this.tDateProfile;
+ var snapCoverage = this.computeDateSnapCoverage(date);
+ var slotCoverage = snapCoverage / tDateProfile.snapsPerSlot;
+ var slotIndex = Math.floor(slotCoverage);
+ slotIndex = Math.min(slotIndex, tDateProfile.slotCnt - 1);
+ var partial = slotCoverage - slotIndex;
+ var _a = this, innerCoordCache = _a.innerCoordCache, outerCoordCache = _a.outerCoordCache;
+ if (this.isRtl) {
+ return outerCoordCache.originClientRect.width - (outerCoordCache.rights[slotIndex] -
+ (innerCoordCache.getWidth(slotIndex) * partial));
+ }
+ return (outerCoordCache.lefts[slotIndex] +
+ (innerCoordCache.getWidth(slotIndex) * partial));
+ };
+ TimelineCoords.prototype.rangeToCoords = function (range) {
+ return {
+ start: this.dateToCoord(range.start),
+ end: this.dateToCoord(range.end),
+ };
+ };
+ TimelineCoords.prototype.durationToCoord = function (duration) {
+ var _a = this, dateProfile = _a.dateProfile, tDateProfile = _a.tDateProfile, dateEnv = _a.dateEnv, isRtl = _a.isRtl;
+ var coord = 0;
+ if (dateProfile) {
+ var date = dateEnv.add(dateProfile.activeRange.start, duration);
+ if (!tDateProfile.isTimeScale) {
+ date = startOfDay(date);
+ }
+ coord = this.dateToCoord(date);
+ // hack to overcome the left borders of non-first slat
+ if (!isRtl && coord) {
+ coord += 1;
+ }
+ }
+ return coord;
+ };
+ TimelineCoords.prototype.coordFromLeft = function (coord) {
+ if (this.isRtl) {
+ return this.outerCoordCache.originClientRect.width - coord;
+ }
+ return coord;
+ };
+ // returned value is between 0 and the number of snaps
+ TimelineCoords.prototype.computeDateSnapCoverage = function (date) {
+ return computeDateSnapCoverage(date, this.tDateProfile, this.dateEnv);
+ };
+ return TimelineCoords;
+ }());
+ // returned value is between 0 and the number of snaps
+ function computeDateSnapCoverage(date, tDateProfile, dateEnv) {
+ var snapDiff = dateEnv.countDurationsBetween(tDateProfile.normalizedRange.start, date, tDateProfile.snapDuration);
+ if (snapDiff < 0) {
+ return 0;
+ }
+ if (snapDiff >= tDateProfile.snapDiffToIndex.length) {
+ return tDateProfile.snapCnt;
+ }
+ var snapDiffInt = Math.floor(snapDiff);
+ var snapCoverage = tDateProfile.snapDiffToIndex[snapDiffInt];
+ if (isInt(snapCoverage)) { // not an in-between value
+ snapCoverage += snapDiff - snapDiffInt; // add the remainder
+ }
+ else {
+ // a fractional value, meaning the date is not visible
+ // always round up in this case. works for start AND end dates in a range.
+ snapCoverage = Math.ceil(snapCoverage);
+ }
+ return snapCoverage;
+ }
+ function coordToCss(hcoord, isRtl) {
+ if (hcoord === null) {
+ return { left: '', right: '' };
+ }
+ if (isRtl) {
+ return { right: hcoord, left: '' };
+ }
+ return { left: hcoord, right: '' };
+ }
+ function coordsToCss(hcoords, isRtl) {
+ if (!hcoords) {
+ return { left: '', right: '' };
+ }
+ if (isRtl) {
+ return { right: hcoords.start, left: -hcoords.end };
+ }
+ return { left: hcoords.start, right: -hcoords.end };
+ }
+
+ var TimelineHeader = /** @class */ (function (_super) {
+ __extends(TimelineHeader, _super);
+ function TimelineHeader() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.rootElRef = createRef();
+ return _this;
+ }
+ TimelineHeader.prototype.render = function () {
+ var _this = this;
+ var _a = this, props = _a.props, context = _a.context;
+ // TODO: very repetitive
+ // TODO: make part of tDateProfile?
+ var timerUnit = greatestDurationDenominator(props.tDateProfile.slotDuration).unit;
+ // WORKAROUND: make ignore slatCoords when out of sync with dateProfile
+ var slatCoords = props.slatCoords && props.slatCoords.dateProfile === props.dateProfile ? props.slatCoords : null;
+ return (createElement(NowTimer, { unit: timerUnit }, function (nowDate, todayRange) { return (createElement("div", { className: "fc-timeline-header", ref: _this.rootElRef },
+ createElement("table", { className: "fc-scrollgrid-sync-table", style: { minWidth: props.tableMinWidth, width: props.clientWidth } },
+ props.tableColGroupNode,
+ createElement("tbody", null,
+ createElement(TimelineHeaderRows, { dateProfile: props.dateProfile, tDateProfile: props.tDateProfile, nowDate: nowDate, todayRange: todayRange, rowInnerHeights: props.rowInnerHeights }))),
+ context.options.nowIndicator && (
+ // need to have a container regardless of whether the current view has a visible now indicator
+ // because apparently removal of the element resets the scroll for some reasons (issue #5351).
+ // this issue doesn't happen for the timeline body however (
+ createElement("div", { className: "fc-timeline-now-indicator-container" }, (slatCoords && slatCoords.isDateInRange(nowDate)) && (createElement(NowIndicatorRoot, { isAxis: true, date: nowDate }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("div", { ref: rootElRef, className: ['fc-timeline-now-indicator-arrow'].concat(classNames).join(' '), style: coordToCss(slatCoords.dateToCoord(nowDate), context.isRtl) }, innerContent)); })))))); }));
+ };
+ TimelineHeader.prototype.componentDidMount = function () {
+ this.updateSize();
+ };
+ TimelineHeader.prototype.componentDidUpdate = function () {
+ this.updateSize();
+ };
+ TimelineHeader.prototype.updateSize = function () {
+ if (this.props.onMaxCushionWidth) {
+ this.props.onMaxCushionWidth(this.computeMaxCushionWidth());
+ }
+ };
+ TimelineHeader.prototype.computeMaxCushionWidth = function () {
+ return Math.max.apply(Math, findElements(this.rootElRef.current, '.fc-timeline-header-row:last-child .fc-timeline-slot-cushion').map(function (el) { return el.getBoundingClientRect().width; }));
+ };
+ return TimelineHeader;
+ }(BaseComponent));
+
+ var TimelineSlatCell = /** @class */ (function (_super) {
+ __extends(TimelineSlatCell, _super);
+ function TimelineSlatCell() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ TimelineSlatCell.prototype.render = function () {
+ var _a = this, props = _a.props, context = _a.context;
+ var dateEnv = context.dateEnv, options = context.options, theme = context.theme;
+ var date = props.date, tDateProfile = props.tDateProfile, isEm = props.isEm;
+ var dateMeta = getDateMeta(props.date, props.todayRange, props.nowDate, props.dateProfile);
+ var classNames = ['fc-timeline-slot', 'fc-timeline-slot-lane'];
+ var dataAttrs = { 'data-date': dateEnv.formatIso(date, { omitTimeZoneOffset: true, omitTime: !tDateProfile.isTimeScale }) };
+ var hookProps = __assign(__assign({ date: dateEnv.toDate(props.date) }, dateMeta), { view: context.viewApi });
+ if (isEm) {
+ classNames.push('fc-timeline-slot-em');
+ }
+ if (tDateProfile.isTimeScale) {
+ classNames.push(isInt(dateEnv.countDurationsBetween(tDateProfile.normalizedRange.start, props.date, tDateProfile.labelInterval)) ?
+ 'fc-timeline-slot-major' :
+ 'fc-timeline-slot-minor');
+ }
+ classNames.push.apply(classNames, (props.isDay
+ ? getDayClassNames(dateMeta, theme)
+ : getSlotClassNames(dateMeta, theme)));
+ return (createElement(RenderHook, { hookProps: hookProps, classNames: options.slotLaneClassNames, content: options.slotLaneContent, didMount: options.slotLaneDidMount, willUnmount: options.slotLaneWillUnmount, elRef: props.elRef }, function (rootElRef, customClassNames, innerElRef, innerContent) { return (createElement("td", __assign({ ref: rootElRef, className: classNames.concat(customClassNames).join(' ') }, dataAttrs),
+ createElement("div", { ref: innerElRef }, innerContent))); }));
+ };
+ return TimelineSlatCell;
+ }(BaseComponent));
+
+ var TimelineSlatsBody = /** @class */ (function (_super) {
+ __extends(TimelineSlatsBody, _super);
+ function TimelineSlatsBody() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ TimelineSlatsBody.prototype.render = function () {
+ var props = this.props;
+ var tDateProfile = props.tDateProfile, cellElRefs = props.cellElRefs;
+ var slotDates = tDateProfile.slotDates, isWeekStarts = tDateProfile.isWeekStarts;
+ var isDay = !tDateProfile.isTimeScale && !tDateProfile.largeUnit;
+ return (createElement("tbody", null,
+ createElement("tr", null, slotDates.map(function (slotDate, i) {
+ var key = slotDate.toISOString();
+ return (createElement(TimelineSlatCell, { key: key, elRef: cellElRefs.createRef(key), date: slotDate, dateProfile: props.dateProfile, tDateProfile: tDateProfile, nowDate: props.nowDate, todayRange: props.todayRange, isEm: isWeekStarts[i], isDay: isDay }));
+ }))));
+ };
+ return TimelineSlatsBody;
+ }(BaseComponent));
+
+ var TimelineSlats = /** @class */ (function (_super) {
+ __extends(TimelineSlats, _super);
+ function TimelineSlats() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.rootElRef = createRef();
+ _this.cellElRefs = new RefMap();
+ _this.handleScrollRequest = function (request) {
+ var onScrollLeftRequest = _this.props.onScrollLeftRequest;
+ var coords = _this.coords;
+ if (onScrollLeftRequest && coords) {
+ if (request.time) {
+ var scrollLeft = coords.coordFromLeft(coords.durationToCoord(request.time));
+ onScrollLeftRequest(scrollLeft);
+ }
+ return true;
+ }
+ return null; // best?
+ };
+ return _this;
+ }
+ TimelineSlats.prototype.render = function () {
+ var _a = this, props = _a.props, context = _a.context;
+ return (createElement("div", { className: "fc-timeline-slots", ref: this.rootElRef },
+ createElement("table", { className: context.theme.getClass('table'), style: {
+ minWidth: props.tableMinWidth,
+ width: props.clientWidth,
+ } },
+ props.tableColGroupNode,
+ createElement(TimelineSlatsBody, { cellElRefs: this.cellElRefs, dateProfile: props.dateProfile, tDateProfile: props.tDateProfile, nowDate: props.nowDate, todayRange: props.todayRange }))));
+ };
+ TimelineSlats.prototype.componentDidMount = function () {
+ this.updateSizing();
+ this.scrollResponder = this.context.createScrollResponder(this.handleScrollRequest);
+ };
+ TimelineSlats.prototype.componentDidUpdate = function (prevProps) {
+ this.updateSizing();
+ this.scrollResponder.update(prevProps.dateProfile !== this.props.dateProfile);
+ };
+ TimelineSlats.prototype.componentWillUnmount = function () {
+ this.scrollResponder.detach();
+ if (this.props.onCoords) {
+ this.props.onCoords(null);
+ }
+ };
+ TimelineSlats.prototype.updateSizing = function () {
+ var _a = this, props = _a.props, context = _a.context;
+ if (props.clientWidth !== null && // is sizing stable?
+ this.scrollResponder
+ // ^it's possible to have clientWidth immediately after mount (when returning from print view), but w/o scrollResponder
+ ) {
+ var rootEl = this.rootElRef.current;
+ if (rootEl.offsetWidth) { // not hidden by css
+ this.coords = new TimelineCoords(this.rootElRef.current, collectCellEls(this.cellElRefs.currentMap, props.tDateProfile.slotDates), props.dateProfile, props.tDateProfile, context.dateEnv, context.isRtl);
+ if (props.onCoords) {
+ props.onCoords(this.coords);
+ }
+ this.scrollResponder.update(false); // TODO: wouldn't have to do this if coords were in state
+ }
+ }
+ };
+ TimelineSlats.prototype.positionToHit = function (leftPosition) {
+ var outerCoordCache = this.coords.outerCoordCache;
+ var _a = this.context, dateEnv = _a.dateEnv, isRtl = _a.isRtl;
+ var tDateProfile = this.props.tDateProfile;
+ var slatIndex = outerCoordCache.leftToIndex(leftPosition);
+ if (slatIndex != null) {
+ // somewhat similar to what TimeGrid does. consolidate?
+ var slatWidth = outerCoordCache.getWidth(slatIndex);
+ var partial = isRtl ?
+ (outerCoordCache.rights[slatIndex] - leftPosition) / slatWidth :
+ (leftPosition - outerCoordCache.lefts[slatIndex]) / slatWidth;
+ var localSnapIndex = Math.floor(partial * tDateProfile.snapsPerSlot);
+ var start = dateEnv.add(tDateProfile.slotDates[slatIndex], multiplyDuration(tDateProfile.snapDuration, localSnapIndex));
+ var end = dateEnv.add(start, tDateProfile.snapDuration);
+ return {
+ dateSpan: {
+ range: { start: start, end: end },
+ allDay: !this.props.tDateProfile.isTimeScale,
+ },
+ dayEl: this.cellElRefs.currentMap[slatIndex],
+ left: outerCoordCache.lefts[slatIndex],
+ right: outerCoordCache.rights[slatIndex],
+ };
+ }
+ return null;
+ };
+ return TimelineSlats;
+ }(BaseComponent));
+ function collectCellEls(elMap, slotDates) {
+ return slotDates.map(function (slotDate) {
+ var key = slotDate.toISOString();
+ return elMap[key];
+ });
+ }
+
+ function computeSegHCoords(segs, minWidth, timelineCoords) {
+ var hcoords = [];
+ if (timelineCoords) {
+ for (var _i = 0, segs_1 = segs; _i < segs_1.length; _i++) {
+ var seg = segs_1[_i];
+ var res = timelineCoords.rangeToCoords(seg);
+ var start = Math.round(res.start); // for barely-overlapping collisions
+ var end = Math.round(res.end); //
+ if (end - start < minWidth) {
+ end = start + minWidth;
+ }
+ hcoords.push({ start: start, end: end });
+ }
+ }
+ return hcoords;
+ }
+ function computeFgSegPlacements(segs, segHCoords, // might not have for every seg
+ eventInstanceHeights, // might not have for every seg
+ moreLinkHeights, // might not have for every more-link
+ strictOrder, maxStackCnt) {
+ var segInputs = [];
+ var crudePlacements = []; // when we don't know dims
+ for (var i = 0; i < segs.length; i += 1) {
+ var seg = segs[i];
+ var instanceId = seg.eventRange.instance.instanceId;
+ var height = eventInstanceHeights[instanceId];
+ var hcoords = segHCoords[i];
+ if (height && hcoords) {
+ segInputs.push({
+ index: i,
+ span: hcoords,
+ thickness: height,
+ });
+ }
+ else {
+ crudePlacements.push({
+ seg: seg,
+ hcoords: hcoords,
+ top: null,
+ });
+ }
+ }
+ var hierarchy = new SegHierarchy();
+ if (strictOrder != null) {
+ hierarchy.strictOrder = strictOrder;
+ }
+ if (maxStackCnt != null) {
+ hierarchy.maxStackCnt = maxStackCnt;
+ }
+ var hiddenEntries = hierarchy.addSegs(segInputs);
+ var hiddenPlacements = hiddenEntries.map(function (entry) { return ({
+ seg: segs[entry.index],
+ hcoords: entry.span,
+ top: 0,
+ }); });
+ var hiddenGroups = groupIntersectingEntries(hiddenEntries);
+ var moreLinkInputs = [];
+ var moreLinkCrudePlacements = [];
+ var extractSeg = function (entry) { return segs[entry.index]; };
+ for (var i = 0; i < hiddenGroups.length; i += 1) {
+ var hiddenGroup = hiddenGroups[i];
+ var sortedSegs = hiddenGroup.entries.map(extractSeg);
+ var height = moreLinkHeights[buildIsoString(computeEarliestSegStart(sortedSegs))]; // not optimal :(
+ if (height != null) {
+ // NOTE: the hiddenGroup's spanStart/spanEnd are already computed by rangeToCoords. computed during input.
+ moreLinkInputs.push({
+ index: segs.length + i,
+ thickness: height,
+ span: hiddenGroup.span,
+ });
+ }
+ else {
+ moreLinkCrudePlacements.push({
+ seg: sortedSegs,
+ hcoords: hiddenGroup.span,
+ top: null,
+ });
+ }
+ }
+ // add more-links into the hierarchy, but don't limit
+ hierarchy.maxStackCnt = -1;
+ hierarchy.addSegs(moreLinkInputs);
+ var visibleRects = hierarchy.toRects();
+ var visiblePlacements = [];
+ var maxHeight = 0;
+ for (var _i = 0, visibleRects_1 = visibleRects; _i < visibleRects_1.length; _i++) {
+ var rect = visibleRects_1[_i];
+ var segIndex = rect.index;
+ visiblePlacements.push({
+ seg: segIndex < segs.length
+ ? segs[segIndex] // a real seg
+ : hiddenGroups[segIndex - segs.length].entries.map(extractSeg),
+ hcoords: rect.span,
+ top: rect.levelCoord,
+ });
+ maxHeight = Math.max(maxHeight, rect.levelCoord + rect.thickness);
+ }
+ return [
+ visiblePlacements.concat(crudePlacements, hiddenPlacements, moreLinkCrudePlacements),
+ maxHeight,
+ ];
+ }
+
+ var TimelineLaneBg = /** @class */ (function (_super) {
+ __extends(TimelineLaneBg, _super);
+ function TimelineLaneBg() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ TimelineLaneBg.prototype.render = function () {
+ var props = this.props;
+ var highlightSeg = [].concat(props.eventResizeSegs, props.dateSelectionSegs);
+ return props.timelineCoords && (createElement("div", { className: "fc-timeline-bg" },
+ this.renderSegs(props.businessHourSegs || [], props.timelineCoords, 'non-business'),
+ this.renderSegs(props.bgEventSegs || [], props.timelineCoords, 'bg-event'),
+ this.renderSegs(highlightSeg, props.timelineCoords, 'highlight')));
+ };
+ TimelineLaneBg.prototype.renderSegs = function (segs, timelineCoords, fillType) {
+ var _a = this.props, todayRange = _a.todayRange, nowDate = _a.nowDate;
+ var isRtl = this.context.isRtl;
+ var segHCoords = computeSegHCoords(segs, 0, timelineCoords);
+ var children = segs.map(function (seg, i) {
+ var hcoords = segHCoords[i];
+ var hStyle = coordsToCss(hcoords, isRtl);
+ return (createElement("div", { key: buildEventRangeKey(seg.eventRange), className: "fc-timeline-bg-harness", style: hStyle }, fillType === 'bg-event' ?
+ createElement(BgEvent, __assign({ seg: seg }, getSegMeta(seg, todayRange, nowDate))) :
+ renderFill(fillType)));
+ });
+ return createElement(Fragment, null, children);
+ };
+ return TimelineLaneBg;
+ }(BaseComponent));
+
+ var TimelineLaneSlicer = /** @class */ (function (_super) {
+ __extends(TimelineLaneSlicer, _super);
+ function TimelineLaneSlicer() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ TimelineLaneSlicer.prototype.sliceRange = function (origRange, dateProfile, dateProfileGenerator, tDateProfile, dateEnv) {
+ var normalRange = normalizeRange(origRange, tDateProfile, dateEnv);
+ var segs = [];
+ // protect against when the span is entirely in an invalid date region
+ if (computeDateSnapCoverage(normalRange.start, tDateProfile, dateEnv)
+ < computeDateSnapCoverage(normalRange.end, tDateProfile, dateEnv)) {
+ // intersect the footprint's range with the grid's range
+ var slicedRange = intersectRanges(normalRange, tDateProfile.normalizedRange);
+ if (slicedRange) {
+ segs.push({
+ start: slicedRange.start,
+ end: slicedRange.end,
+ isStart: slicedRange.start.valueOf() === normalRange.start.valueOf()
+ && isValidDate(slicedRange.start, tDateProfile, dateProfile, dateProfileGenerator),
+ isEnd: slicedRange.end.valueOf() === normalRange.end.valueOf()
+ && isValidDate(addMs(slicedRange.end, -1), tDateProfile, dateProfile, dateProfileGenerator),
+ });
+ }
+ }
+ return segs;
+ };
+ return TimelineLaneSlicer;
+ }(Slicer));
+
+ var DEFAULT_TIME_FORMAT = createFormatter({
+ hour: 'numeric',
+ minute: '2-digit',
+ omitZeroMinute: true,
+ meridiem: 'narrow',
+ });
+ var TimelineEvent = /** @class */ (function (_super) {
+ __extends(TimelineEvent, _super);
+ function TimelineEvent() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ TimelineEvent.prototype.render = function () {
+ var props = this.props;
+ return (createElement(StandardEvent, __assign({}, props, { extraClassNames: ['fc-timeline-event', 'fc-h-event'], defaultTimeFormat: DEFAULT_TIME_FORMAT, defaultDisplayEventTime: !props.isTimeScale })));
+ };
+ return TimelineEvent;
+ }(BaseComponent));
+
+ var TimelineLaneMoreLink = /** @class */ (function (_super) {
+ __extends(TimelineLaneMoreLink, _super);
+ function TimelineLaneMoreLink() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.rootElRef = createRef();
+ return _this;
+ }
+ TimelineLaneMoreLink.prototype.render = function () {
+ var _this = this;
+ var _a = this, props = _a.props, context = _a.context;
+ var hiddenSegs = props.hiddenSegs, elRef = props.elRef, placement = props.placement, resourceId = props.resourceId;
+ var top = placement.top, hcoords = placement.hcoords;
+ var isVisible = hcoords && top !== null;
+ var hStyle = coordsToCss(hcoords, context.isRtl);
+ var extraDateSpan = resourceId ? { resourceId: resourceId } : {};
+ return (createElement(MoreLinkRoot, { allDayDate: null, moreCnt: hiddenSegs.length, allSegs: hiddenSegs, hiddenSegs: hiddenSegs, alignmentElRef: this.rootElRef, dateProfile: props.dateProfile, todayRange: props.todayRange, extraDateSpan: extraDateSpan, popoverContent: function () { return (createElement(Fragment, null, hiddenSegs.map(function (seg) {
+ var instanceId = seg.eventRange.instance.instanceId;
+ return (createElement("div", { key: instanceId, style: { visibility: props.isForcedInvisible[instanceId] ? 'hidden' : '' } },
+ createElement(TimelineEvent, __assign({ isTimeScale: props.isTimeScale, seg: seg, isDragging: false, isResizing: false, isDateSelecting: false, isSelected: instanceId === props.eventSelection }, getSegMeta(seg, props.todayRange, props.nowDate)))));
+ }))); } }, function (rootElRef, classNames, innerElRef, innerContent, handleClick) { return (createElement("a", { ref: function (el) {
+ setRef(rootElRef, el); // for MoreLinkRoot
+ setRef(elRef, el); // for props props
+ setRef(_this.rootElRef, el); // for this component
+ }, className: ['fc-timeline-more-link'].concat(classNames).join(' '), style: __assign({ visibility: isVisible ? '' : 'hidden', top: top || 0 }, hStyle), onClick: handleClick },
+ createElement("div", { ref: innerElRef, className: "fc-timeline-more-link-inner fc-sticky" }, innerContent))); }));
+ };
+ return TimelineLaneMoreLink;
+ }(BaseComponent));
+
+ var TimelineLane = /** @class */ (function (_super) {
+ __extends(TimelineLane, _super);
+ function TimelineLane() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.slicer = new TimelineLaneSlicer();
+ _this.sortEventSegs = memoize(sortEventSegs);
+ _this.harnessElRefs = new RefMap();
+ _this.moreElRefs = new RefMap();
+ _this.innerElRef = createRef();
+ // TODO: memoize event positioning
+ _this.state = {
+ eventInstanceHeights: {},
+ moreLinkHeights: {},
+ };
+ return _this;
+ }
+ TimelineLane.prototype.render = function () {
+ var _a = this, props = _a.props, state = _a.state, context = _a.context;
+ var options = context.options;
+ var dateProfile = props.dateProfile, tDateProfile = props.tDateProfile;
+ var slicedProps = this.slicer.sliceProps(props, dateProfile, tDateProfile.isTimeScale ? null : props.nextDayThreshold, context, // wish we didn't have to pass in the rest of the args...
+ dateProfile, context.dateProfileGenerator, tDateProfile, context.dateEnv);
+ var mirrorSegs = (slicedProps.eventDrag ? slicedProps.eventDrag.segs : null) ||
+ (slicedProps.eventResize ? slicedProps.eventResize.segs : null) ||
+ [];
+ var fgSegs = this.sortEventSegs(slicedProps.fgEventSegs, options.eventOrder);
+ var fgSegHCoords = computeSegHCoords(fgSegs, options.eventMinWidth, props.timelineCoords);
+ var _b = computeFgSegPlacements(fgSegs, fgSegHCoords, state.eventInstanceHeights, state.moreLinkHeights, options.eventOrderStrict, options.eventMaxStack), fgPlacements = _b[0], fgHeight = _b[1];
+ var isForcedInvisible = // TODO: more convenient
+ (slicedProps.eventDrag ? slicedProps.eventDrag.affectedInstances : null) ||
+ (slicedProps.eventResize ? slicedProps.eventResize.affectedInstances : null) ||
+ {};
+ return (createElement(Fragment, null,
+ createElement(TimelineLaneBg, { businessHourSegs: slicedProps.businessHourSegs, bgEventSegs: slicedProps.bgEventSegs, timelineCoords: props.timelineCoords, eventResizeSegs: slicedProps.eventResize ? slicedProps.eventResize.segs : [] /* bad new empty array? */, dateSelectionSegs: slicedProps.dateSelectionSegs, nowDate: props.nowDate, todayRange: props.todayRange }),
+ createElement("div", { className: "fc-timeline-events fc-scrollgrid-sync-inner", ref: this.innerElRef, style: { height: fgHeight } },
+ this.renderFgSegs(fgPlacements, isForcedInvisible, false, false, false),
+ this.renderFgSegs(buildMirrorPlacements(mirrorSegs, props.timelineCoords, fgPlacements), {}, Boolean(slicedProps.eventDrag), Boolean(slicedProps.eventResize), false))));
+ };
+ TimelineLane.prototype.componentDidMount = function () {
+ this.updateSize();
+ };
+ TimelineLane.prototype.componentDidUpdate = function (prevProps, prevState) {
+ if (prevProps.eventStore !== this.props.eventStore || // external thing changed?
+ prevProps.timelineCoords !== this.props.timelineCoords || // external thing changed?
+ prevState.moreLinkHeights !== this.state.moreLinkHeights // HACK. see addStateEquality
+ ) {
+ this.updateSize();
+ }
+ };
+ TimelineLane.prototype.updateSize = function () {
+ var _this = this;
+ var props = this.props;
+ var timelineCoords = props.timelineCoords;
+ if (props.onHeightChange) {
+ props.onHeightChange(this.innerElRef.current, false);
+ }
+ if (timelineCoords) {
+ this.setState({
+ eventInstanceHeights: mapHash(this.harnessElRefs.currentMap, function (harnessEl) { return (Math.round(harnessEl.getBoundingClientRect().height)); }),
+ moreLinkHeights: mapHash(this.moreElRefs.currentMap, function (moreEl) { return (Math.round(moreEl.getBoundingClientRect().height)); }),
+ }, function () {
+ if (props.onHeightChange) {
+ props.onHeightChange(_this.innerElRef.current, true);
+ }
+ });
+ }
+ };
+ TimelineLane.prototype.renderFgSegs = function (segPlacements, isForcedInvisible, isDragging, isResizing, isDateSelecting) {
+ var _a = this, harnessElRefs = _a.harnessElRefs, moreElRefs = _a.moreElRefs, props = _a.props, context = _a.context;
+ var isMirror = isDragging || isResizing || isDateSelecting;
+ return (createElement(Fragment, null, segPlacements.map(function (segPlacement) {
+ var seg = segPlacement.seg, hcoords = segPlacement.hcoords, top = segPlacement.top;
+ if (Array.isArray(seg)) { // a more-link
+ var isoStr = buildIsoString(computeEarliestSegStart(seg));
+ return (createElement(TimelineLaneMoreLink, { key: 'm:' + isoStr /* "m" for "more" */, elRef: moreElRefs.createRef(isoStr), hiddenSegs: seg, placement: segPlacement, dateProfile: props.dateProfile, nowDate: props.nowDate, todayRange: props.todayRange, isTimeScale: props.tDateProfile.isTimeScale, eventSelection: props.eventSelection, resourceId: props.resourceId, isForcedInvisible: isForcedInvisible }));
+ }
+ var instanceId = seg.eventRange.instance.instanceId;
+ var isVisible = isMirror || Boolean(!isForcedInvisible[instanceId] && hcoords && top !== null);
+ var hStyle = coordsToCss(hcoords, context.isRtl);
+ return (createElement("div", { key: 'e:' + instanceId /* "e" for "event" */, ref: isMirror ? null : harnessElRefs.createRef(instanceId), className: "fc-timeline-event-harness", style: __assign({ visibility: isVisible ? '' : 'hidden', top: top || 0 }, hStyle) },
+ createElement(TimelineEvent, __assign({ isTimeScale: props.tDateProfile.isTimeScale, seg: seg, isDragging: isDragging, isResizing: isResizing, isDateSelecting: isDateSelecting, isSelected: instanceId === props.eventSelection /* TODO: bad for mirror? */ }, getSegMeta(seg, props.todayRange, props.nowDate)))));
+ })));
+ };
+ return TimelineLane;
+ }(BaseComponent));
+ TimelineLane.addStateEquality({
+ eventInstanceHeights: isPropsEqual,
+ moreLinkHeights: isPropsEqual,
+ });
+ function buildMirrorPlacements(mirrorSegs, timelineCoords, fgPlacements) {
+ if (!mirrorSegs.length || !timelineCoords) {
+ return [];
+ }
+ var topsByInstanceId = buildAbsoluteTopHash(fgPlacements); // TODO: cache this at first render?
+ return mirrorSegs.map(function (seg) { return ({
+ seg: seg,
+ hcoords: timelineCoords.rangeToCoords(seg),
+ top: topsByInstanceId[seg.eventRange.instance.instanceId],
+ }); });
+ }
+ function buildAbsoluteTopHash(placements) {
+ var topsByInstanceId = {};
+ for (var _i = 0, placements_1 = placements; _i < placements_1.length; _i++) {
+ var placement = placements_1[_i];
+ var seg = placement.seg;
+ if (!Array.isArray(seg)) { // doesn't represent a more-link
+ topsByInstanceId[seg.eventRange.instance.instanceId] = placement.top;
+ }
+ }
+ return topsByInstanceId;
+ }
+
+ var TimelineGrid = /** @class */ (function (_super) {
+ __extends(TimelineGrid, _super);
+ function TimelineGrid() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.slatsRef = createRef();
+ _this.state = {
+ coords: null,
+ };
+ _this.handeEl = function (el) {
+ if (el) {
+ _this.context.registerInteractiveComponent(_this, { el: el });
+ }
+ else {
+ _this.context.unregisterInteractiveComponent(_this);
+ }
+ };
+ _this.handleCoords = function (coords) {
+ _this.setState({ coords: coords });
+ if (_this.props.onSlatCoords) {
+ _this.props.onSlatCoords(coords);
+ }
+ };
+ return _this;
+ }
+ TimelineGrid.prototype.render = function () {
+ var _this = this;
+ var _a = this, props = _a.props, state = _a.state, context = _a.context;
+ var options = context.options;
+ var dateProfile = props.dateProfile, tDateProfile = props.tDateProfile;
+ var timerUnit = greatestDurationDenominator(tDateProfile.slotDuration).unit;
+ return (createElement("div", { className: "fc-timeline-body", ref: this.handeEl, style: {
+ minWidth: props.tableMinWidth,
+ height: props.clientHeight,
+ width: props.clientWidth,
+ } },
+ createElement(NowTimer, { unit: timerUnit }, function (nowDate, todayRange) { return (createElement(Fragment, null,
+ createElement(TimelineSlats, { ref: _this.slatsRef, dateProfile: dateProfile, tDateProfile: tDateProfile, nowDate: nowDate, todayRange: todayRange, clientWidth: props.clientWidth, tableColGroupNode: props.tableColGroupNode, tableMinWidth: props.tableMinWidth, onCoords: _this.handleCoords, onScrollLeftRequest: props.onScrollLeftRequest }),
+ createElement(TimelineLane, { dateProfile: dateProfile, tDateProfile: props.tDateProfile, nowDate: nowDate, todayRange: todayRange, nextDayThreshold: options.nextDayThreshold, businessHours: props.businessHours, eventStore: props.eventStore, eventUiBases: props.eventUiBases, dateSelection: props.dateSelection, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, timelineCoords: state.coords }),
+ (options.nowIndicator && state.coords && state.coords.isDateInRange(nowDate)) && (createElement("div", { className: "fc-timeline-now-indicator-container" },
+ createElement(NowIndicatorRoot, { isAxis: false, date: nowDate }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("div", { ref: rootElRef, className: ['fc-timeline-now-indicator-line'].concat(classNames).join(' '), style: coordToCss(state.coords.dateToCoord(nowDate), context.isRtl) }, innerContent)); }))))); })));
+ };
+ // Hit System
+ // ------------------------------------------------------------------------------------------
+ TimelineGrid.prototype.queryHit = function (positionLeft, positionTop, elWidth, elHeight) {
+ var slats = this.slatsRef.current;
+ var slatHit = slats.positionToHit(positionLeft);
+ if (slatHit) {
+ return {
+ dateProfile: this.props.dateProfile,
+ dateSpan: slatHit.dateSpan,
+ rect: {
+ left: slatHit.left,
+ right: slatHit.right,
+ top: 0,
+ bottom: elHeight,
+ },
+ dayEl: slatHit.dayEl,
+ layer: 0,
+ };
+ }
+ return null;
+ };
+ return TimelineGrid;
+ }(DateComponent));
+
+ var TimelineView = /** @class */ (function (_super) {
+ __extends(TimelineView, _super);
+ function TimelineView() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.buildTimelineDateProfile = memoize(buildTimelineDateProfile);
+ _this.scrollGridRef = createRef();
+ _this.state = {
+ slatCoords: null,
+ slotCushionMaxWidth: null,
+ };
+ _this.handleSlatCoords = function (slatCoords) {
+ _this.setState({ slatCoords: slatCoords });
+ };
+ _this.handleScrollLeftRequest = function (scrollLeft) {
+ var scrollGrid = _this.scrollGridRef.current;
+ scrollGrid.forceScrollLeft(0, scrollLeft);
+ };
+ _this.handleMaxCushionWidth = function (slotCushionMaxWidth) {
+ _this.setState({
+ slotCushionMaxWidth: Math.ceil(slotCushionMaxWidth), // for less rerendering TODO: DRY
+ });
+ };
+ return _this;
+ }
+ TimelineView.prototype.render = function () {
+ var _this = this;
+ var _a = this, props = _a.props, state = _a.state, context = _a.context;
+ var options = context.options;
+ var stickyHeaderDates = !props.forPrint && getStickyHeaderDates(options);
+ var stickyFooterScrollbar = !props.forPrint && getStickyFooterScrollbar(options);
+ var tDateProfile = this.buildTimelineDateProfile(props.dateProfile, context.dateEnv, options, context.dateProfileGenerator);
+ var extraClassNames = [
+ 'fc-timeline',
+ options.eventOverlap === false ? 'fc-timeline-overlap-disabled' : '',
+ ];
+ var slotMinWidth = options.slotMinWidth;
+ var slatCols = buildSlatCols(tDateProfile, slotMinWidth || this.computeFallbackSlotMinWidth(tDateProfile));
+ var sections = [
+ {
+ type: 'header',
+ key: 'header',
+ isSticky: stickyHeaderDates,
+ chunks: [{
+ key: 'timeline',
+ content: function (contentArg) { return (createElement(TimelineHeader, { dateProfile: props.dateProfile, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, tableMinWidth: contentArg.tableMinWidth, tableColGroupNode: contentArg.tableColGroupNode, tDateProfile: tDateProfile, slatCoords: state.slatCoords, onMaxCushionWidth: slotMinWidth ? null : _this.handleMaxCushionWidth })); },
+ }],
+ },
+ {
+ type: 'body',
+ key: 'body',
+ liquid: true,
+ chunks: [{
+ key: 'timeline',
+ content: function (contentArg) { return (createElement(TimelineGrid, __assign({}, props, { clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, tableMinWidth: contentArg.tableMinWidth, tableColGroupNode: contentArg.tableColGroupNode, tDateProfile: tDateProfile, onSlatCoords: _this.handleSlatCoords, onScrollLeftRequest: _this.handleScrollLeftRequest }))); },
+ }],
+ },
+ ];
+ if (stickyFooterScrollbar) {
+ sections.push({
+ type: 'footer',
+ key: 'footer',
+ isSticky: true,
+ chunks: [{
+ key: 'timeline',
+ content: renderScrollShim,
+ }],
+ });
+ }
+ return (createElement(ViewRoot, { viewSpec: context.viewSpec }, function (rootElRef, classNames) { return (createElement("div", { ref: rootElRef, className: extraClassNames.concat(classNames).join(' ') },
+ createElement(ScrollGrid, { ref: _this.scrollGridRef, liquid: !props.isHeightAuto && !props.forPrint, collapsibleWidth: false, colGroups: [
+ { cols: slatCols },
+ ], sections: sections }))); }));
+ };
+ TimelineView.prototype.computeFallbackSlotMinWidth = function (tDateProfile) {
+ return Math.max(30, ((this.state.slotCushionMaxWidth || 0) / tDateProfile.slotsPerLabel));
+ };
+ return TimelineView;
+ }(DateComponent));
+ function buildSlatCols(tDateProfile, slotMinWidth) {
+ return [{
+ span: tDateProfile.slotCnt,
+ minWidth: slotMinWidth || 1, // needs to be a non-zero number to trigger horizontal scrollbars!??????
+ }];
+ }
+
+ var timelinePlugin = createPlugin({
+ deps: [
+ premiumCommonPlugin,
+ ],
+ initialView: 'timelineDay',
+ views: {
+ timeline: {
+ component: TimelineView,
+ usesMinMaxTime: true,
+ eventResizableFromStart: true, // how is this consumed for TimelineView tho?
+ },
+ timelineDay: {
+ type: 'timeline',
+ duration: { days: 1 },
+ },
+ timelineWeek: {
+ type: 'timeline',
+ duration: { weeks: 1 },
+ },
+ timelineMonth: {
+ type: 'timeline',
+ duration: { months: 1 },
+ },
+ timelineYear: {
+ type: 'timeline',
+ duration: { years: 1 },
+ },
+ },
+ });
+
+ function massageEventDragMutation(eventMutation, hit0, hit1) {
+ var resource0 = hit0.dateSpan.resourceId;
+ var resource1 = hit1.dateSpan.resourceId;
+ if (resource0 && resource1 &&
+ resource0 !== resource1) {
+ eventMutation.resourceMutation = {
+ matchResourceId: resource0,
+ setResourceId: resource1,
+ };
+ }
+ }
+ /*
+ TODO: all this would be much easier if we were using a hash!
+ */
+ function applyEventDefMutation(eventDef, mutation, context) {
+ var resourceMutation = mutation.resourceMutation;
+ if (resourceMutation && computeResourceEditable(eventDef, context)) {
+ var index = eventDef.resourceIds.indexOf(resourceMutation.matchResourceId);
+ if (index !== -1) {
+ var resourceIds = eventDef.resourceIds.slice(); // copy
+ resourceIds.splice(index, 1); // remove
+ if (resourceIds.indexOf(resourceMutation.setResourceId) === -1) { // not already in there
+ resourceIds.push(resourceMutation.setResourceId); // add
+ }
+ eventDef.resourceIds = resourceIds;
+ }
+ }
+ }
+ /*
+ HACK
+ TODO: use EventUi system instead of this
+ */
+ function computeResourceEditable(eventDef, context) {
+ var resourceEditable = eventDef.resourceEditable;
+ if (resourceEditable == null) {
+ var source = eventDef.sourceId && context.getCurrentData().eventSources[eventDef.sourceId];
+ if (source) {
+ resourceEditable = source.extendedProps.resourceEditable; // used the Source::extendedProps hack
+ }
+ if (resourceEditable == null) {
+ resourceEditable = context.options.eventResourceEditable;
+ if (resourceEditable == null) {
+ resourceEditable = context.options.editable; // TODO: use defaults system instead
+ }
+ }
+ }
+ return resourceEditable;
+ }
+ function transformEventDrop(mutation, context) {
+ var resourceMutation = mutation.resourceMutation;
+ if (resourceMutation) {
+ var calendarApi = context.calendarApi;
+ return {
+ oldResource: calendarApi.getResourceById(resourceMutation.matchResourceId),
+ newResource: calendarApi.getResourceById(resourceMutation.setResourceId),
+ };
+ }
+ return {
+ oldResource: null,
+ newResource: null,
+ };
+ }
+
+ var ResourceDataAdder = /** @class */ (function () {
+ function ResourceDataAdder() {
+ this.filterResources = memoize(filterResources);
+ }
+ ResourceDataAdder.prototype.transform = function (viewProps, calendarProps) {
+ if (calendarProps.viewSpec.optionDefaults.needsResourceData) {
+ return {
+ resourceStore: this.filterResources(calendarProps.resourceStore, calendarProps.options.filterResourcesWithEvents, calendarProps.eventStore, calendarProps.dateProfile.activeRange),
+ resourceEntityExpansions: calendarProps.resourceEntityExpansions,
+ };
+ }
+ return null;
+ };
+ return ResourceDataAdder;
+ }());
+ function filterResources(resourceStore, doFilterResourcesWithEvents, eventStore, activeRange) {
+ if (doFilterResourcesWithEvents) {
+ var instancesInRange = filterEventInstancesInRange(eventStore.instances, activeRange);
+ var hasEvents_1 = computeHasEvents(instancesInRange, eventStore.defs);
+ __assign(hasEvents_1, computeAncestorHasEvents(hasEvents_1, resourceStore));
+ return filterHash(resourceStore, function (resource, resourceId) { return hasEvents_1[resourceId]; });
+ }
+ return resourceStore;
+ }
+ function filterEventInstancesInRange(eventInstances, activeRange) {
+ return filterHash(eventInstances, function (eventInstance) { return rangesIntersect(eventInstance.range, activeRange); });
+ }
+ function computeHasEvents(eventInstances, eventDefs) {
+ var hasEvents = {};
+ for (var instanceId in eventInstances) {
+ var instance = eventInstances[instanceId];
+ for (var _i = 0, _a = eventDefs[instance.defId].resourceIds; _i < _a.length; _i++) {
+ var resourceId = _a[_i];
+ hasEvents[resourceId] = true;
+ }
+ }
+ return hasEvents;
+ }
+ /*
+ mark resources as having events if any of their ancestors have them
+ NOTE: resourceStore might not have all the resources that hasEvents{} has keyed
+ */
+ function computeAncestorHasEvents(hasEvents, resourceStore) {
+ var res = {};
+ for (var resourceId in hasEvents) {
+ var resource = void 0;
+ while ((resource = resourceStore[resourceId])) {
+ resourceId = resource.parentId; // now functioning as the parentId
+ if (resourceId) {
+ res[resourceId] = true;
+ }
+ else {
+ break;
+ }
+ }
+ }
+ return res;
+ }
+ /*
+ for making sure events that have editable resources are always draggable in resource views
+ */
+ function transformIsDraggable(val, eventDef, eventUi, context) {
+ if (!val) {
+ var state = context.getCurrentData();
+ var viewSpec = state.viewSpecs[state.currentViewType];
+ if (viewSpec.optionDefaults.needsResourceData) {
+ if (computeResourceEditable(eventDef, context)) {
+ return true;
+ }
+ }
+ }
+ return val;
+ }
+
+ // for when non-resource view should be given EventUi info (for event coloring/constraints based off of resource data)
+ var ResourceEventConfigAdder = /** @class */ (function () {
+ function ResourceEventConfigAdder() {
+ this.buildResourceEventUis = memoize(buildResourceEventUis, isPropsEqual);
+ this.injectResourceEventUis = memoize(injectResourceEventUis);
+ }
+ ResourceEventConfigAdder.prototype.transform = function (viewProps, calendarProps) {
+ if (!calendarProps.viewSpec.optionDefaults.needsResourceData) {
+ return {
+ eventUiBases: this.injectResourceEventUis(viewProps.eventUiBases, viewProps.eventStore.defs, this.buildResourceEventUis(calendarProps.resourceStore)),
+ };
+ }
+ return null;
+ };
+ return ResourceEventConfigAdder;
+ }());
+ function buildResourceEventUis(resourceStore) {
+ return mapHash(resourceStore, function (resource) { return resource.ui; });
+ }
+ function injectResourceEventUis(eventUiBases, eventDefs, resourceEventUis) {
+ return mapHash(eventUiBases, function (eventUi, defId) {
+ if (defId) { // not the '' key
+ return injectResourceEventUi(eventUi, eventDefs[defId], resourceEventUis);
+ }
+ return eventUi;
+ });
+ }
+ function injectResourceEventUi(origEventUi, eventDef, resourceEventUis) {
+ var parts = [];
+ // first resource takes precedence, which fights with the ordering of combineEventUis, thus the unshifts
+ for (var _i = 0, _a = eventDef.resourceIds; _i < _a.length; _i++) {
+ var resourceId = _a[_i];
+ if (resourceEventUis[resourceId]) {
+ parts.unshift(resourceEventUis[resourceId]);
+ }
+ }
+ parts.unshift(origEventUi);
+ return combineEventUis(parts);
+ }
+
+ var defs = []; // TODO: use plugin system
+ function registerResourceSourceDef(def) {
+ defs.push(def);
+ }
+ function getResourceSourceDef(id) {
+ return defs[id];
+ }
+ function getResourceSourceDefs() {
+ return defs;
+ }
+
+ // TODO: make this a plugin-able parser
+ // TODO: success/failure
+ var RESOURCE_SOURCE_REFINERS = {
+ id: String,
+ // for array. TODO: move to resource-array
+ resources: identity,
+ // for json feed. TODO: move to resource-json-feed
+ url: String,
+ method: String,
+ startParam: String,
+ endParam: String,
+ timeZoneParam: String,
+ extraParams: identity,
+ };
+ function parseResourceSource(input) {
+ var inputObj;
+ if (typeof input === 'string') {
+ inputObj = { url: input };
+ }
+ else if (typeof input === 'function' || Array.isArray(input)) {
+ inputObj = { resources: input };
+ }
+ else if (typeof input === 'object' && input) { // non-null object
+ inputObj = input;
+ }
+ if (inputObj) {
+ var _a = refineProps(inputObj, RESOURCE_SOURCE_REFINERS), refined = _a.refined, extra = _a.extra;
+ warnUnknownProps(extra);
+ var metaRes = buildResourceSourceMeta(refined);
+ if (metaRes) {
+ return {
+ _raw: input,
+ sourceId: guid(),
+ sourceDefId: metaRes.sourceDefId,
+ meta: metaRes.meta,
+ publicId: refined.id || '',
+ isFetching: false,
+ latestFetchId: '',
+ fetchRange: null,
+ };
+ }
+ }
+ return null;
+ }
+ function buildResourceSourceMeta(refined) {
+ var defs = getResourceSourceDefs();
+ for (var i = defs.length - 1; i >= 0; i -= 1) { // later-added plugins take precedence
+ var def = defs[i];
+ var meta = def.parseMeta(refined);
+ if (meta) {
+ return { meta: meta, sourceDefId: i };
+ }
+ }
+ return null;
+ }
+ function warnUnknownProps(props) {
+ for (var propName in props) {
+ console.warn("Unknown resource prop '" + propName + "'");
+ }
+ }
+
+ function reduceResourceSource(source, action, context) {
+ var options = context.options, dateProfile = context.dateProfile;
+ if (!source || !action) {
+ return createSource(options.initialResources || options.resources, dateProfile.activeRange, options.refetchResourcesOnNavigate, context);
+ }
+ switch (action.type) {
+ case 'RESET_RESOURCE_SOURCE':
+ return createSource(action.resourceSourceInput, dateProfile.activeRange, options.refetchResourcesOnNavigate, context);
+ case 'PREV': // TODO: how do we track all actions that affect dateProfile :(
+ case 'NEXT':
+ case 'CHANGE_DATE':
+ case 'CHANGE_VIEW_TYPE':
+ return handleRangeChange(source, dateProfile.activeRange, options.refetchResourcesOnNavigate, context);
+ case 'RECEIVE_RESOURCES':
+ case 'RECEIVE_RESOURCE_ERROR':
+ return receiveResponse(source, action.fetchId, action.fetchRange);
+ case 'REFETCH_RESOURCES':
+ return fetchSource(source, dateProfile.activeRange, context);
+ default:
+ return source;
+ }
+ }
+ function createSource(input, activeRange, refetchResourcesOnNavigate, context) {
+ if (input) {
+ var source = parseResourceSource(input);
+ source = fetchSource(source, refetchResourcesOnNavigate ? activeRange : null, context);
+ return source;
+ }
+ return null;
+ }
+ function handleRangeChange(source, activeRange, refetchResourcesOnNavigate, context) {
+ if (refetchResourcesOnNavigate &&
+ !doesSourceIgnoreRange(source) &&
+ (!source.fetchRange || !rangesEqual(source.fetchRange, activeRange))) {
+ return fetchSource(source, activeRange, context);
+ }
+ return source;
+ }
+ function doesSourceIgnoreRange(source) {
+ return Boolean(getResourceSourceDef(source.sourceDefId).ignoreRange);
+ }
+ function fetchSource(source, fetchRange, context) {
+ var sourceDef = getResourceSourceDef(source.sourceDefId);
+ var fetchId = guid();
+ sourceDef.fetch({
+ resourceSource: source,
+ range: fetchRange,
+ context: context,
+ }, function (res) {
+ context.dispatch({
+ type: 'RECEIVE_RESOURCES',
+ fetchId: fetchId,
+ fetchRange: fetchRange,
+ rawResources: res.rawResources,
+ });
+ }, function (error) {
+ context.dispatch({
+ type: 'RECEIVE_RESOURCE_ERROR',
+ fetchId: fetchId,
+ fetchRange: fetchRange,
+ error: error,
+ });
+ });
+ return __assign(__assign({}, source), { isFetching: true, latestFetchId: fetchId });
+ }
+ function receiveResponse(source, fetchId, fetchRange) {
+ if (fetchId === source.latestFetchId) {
+ return __assign(__assign({}, source), { isFetching: false, fetchRange: fetchRange });
+ }
+ return source;
+ }
+
+ var PRIVATE_ID_PREFIX = '_fc:';
+ var RESOURCE_REFINERS = {
+ id: String,
+ parentId: String,
+ children: identity,
+ title: String,
+ businessHours: identity,
+ extendedProps: identity,
+ // event-ui
+ eventEditable: Boolean,
+ eventStartEditable: Boolean,
+ eventDurationEditable: Boolean,
+ eventConstraint: identity,
+ eventOverlap: Boolean,
+ eventAllow: identity,
+ eventClassNames: parseClassNames,
+ eventBackgroundColor: String,
+ eventBorderColor: String,
+ eventTextColor: String,
+ eventColor: String,
+ };
+ /*
+ needs a full store so that it can populate children too
+ */
+ function parseResource(raw, parentId, store, context) {
+ if (parentId === void 0) { parentId = ''; }
+ var _a = refineProps(raw, RESOURCE_REFINERS), refined = _a.refined, extra = _a.extra;
+ var resource = {
+ id: refined.id || (PRIVATE_ID_PREFIX + guid()),
+ parentId: refined.parentId || parentId,
+ title: refined.title || '',
+ businessHours: refined.businessHours ? parseBusinessHours(refined.businessHours, context) : null,
+ ui: createEventUi({
+ editable: refined.eventEditable,
+ startEditable: refined.eventStartEditable,
+ durationEditable: refined.eventDurationEditable,
+ constraint: refined.eventConstraint,
+ overlap: refined.eventOverlap,
+ allow: refined.eventAllow,
+ classNames: refined.eventClassNames,
+ backgroundColor: refined.eventBackgroundColor,
+ borderColor: refined.eventBorderColor,
+ textColor: refined.eventTextColor,
+ color: refined.eventColor,
+ }, context),
+ extendedProps: __assign(__assign({}, extra), refined.extendedProps),
+ };
+ // help out ResourceApi from having user modify props
+ Object.freeze(resource.ui.classNames);
+ Object.freeze(resource.extendedProps);
+ if (store[resource.id]) ;
+ else {
+ store[resource.id] = resource;
+ if (refined.children) {
+ for (var _i = 0, _b = refined.children; _i < _b.length; _i++) {
+ var childInput = _b[_i];
+ parseResource(childInput, resource.id, store, context);
+ }
+ }
+ }
+ return resource;
+ }
+ /*
+ TODO: use this in more places
+ */
+ function getPublicId(id) {
+ if (id.indexOf(PRIVATE_ID_PREFIX) === 0) {
+ return '';
+ }
+ return id;
+ }
+
+ function reduceResourceStore(store, action, source, context) {
+ if (!store || !action) {
+ return {};
+ }
+ switch (action.type) {
+ case 'RECEIVE_RESOURCES':
+ return receiveRawResources(store, action.rawResources, action.fetchId, source, context);
+ case 'ADD_RESOURCE':
+ return addResource(store, action.resourceHash);
+ case 'REMOVE_RESOURCE':
+ return removeResource(store, action.resourceId);
+ case 'SET_RESOURCE_PROP':
+ return setResourceProp(store, action.resourceId, action.propName, action.propValue);
+ case 'SET_RESOURCE_EXTENDED_PROP':
+ return setResourceExtendedProp(store, action.resourceId, action.propName, action.propValue);
+ default:
+ return store;
+ }
+ }
+ function receiveRawResources(existingStore, inputs, fetchId, source, context) {
+ if (source.latestFetchId === fetchId) {
+ var nextStore = {};
+ for (var _i = 0, inputs_1 = inputs; _i < inputs_1.length; _i++) {
+ var input = inputs_1[_i];
+ parseResource(input, '', nextStore, context);
+ }
+ return nextStore;
+ }
+ return existingStore;
+ }
+ function addResource(existingStore, additions) {
+ // TODO: warn about duplicate IDs
+ return __assign(__assign({}, existingStore), additions);
+ }
+ function removeResource(existingStore, resourceId) {
+ var newStore = __assign({}, existingStore);
+ delete newStore[resourceId];
+ // promote children
+ for (var childResourceId in newStore) { // a child, *maybe* but probably not
+ if (newStore[childResourceId].parentId === resourceId) {
+ newStore[childResourceId] = __assign(__assign({}, newStore[childResourceId]), { parentId: '' });
+ }
+ }
+ return newStore;
+ }
+ function setResourceProp(existingStore, resourceId, name, value) {
+ var _a, _b;
+ var existingResource = existingStore[resourceId];
+ // TODO: sanitization
+ if (existingResource) {
+ return __assign(__assign({}, existingStore), (_a = {}, _a[resourceId] = __assign(__assign({}, existingResource), (_b = {}, _b[name] = value, _b)), _a));
+ }
+ return existingStore;
+ }
+ function setResourceExtendedProp(existingStore, resourceId, name, value) {
+ var _a, _b;
+ var existingResource = existingStore[resourceId];
+ if (existingResource) {
+ return __assign(__assign({}, existingStore), (_a = {}, _a[resourceId] = __assign(__assign({}, existingResource), { extendedProps: __assign(__assign({}, existingResource.extendedProps), (_b = {}, _b[name] = value, _b)) }), _a));
+ }
+ return existingStore;
+ }
+
+ function reduceResourceEntityExpansions(expansions, action) {
+ var _a;
+ if (!expansions || !action) {
+ return {};
+ }
+ switch (action.type) {
+ case 'SET_RESOURCE_ENTITY_EXPANDED':
+ return __assign(__assign({}, expansions), (_a = {}, _a[action.id] = action.isExpanded, _a));
+ default:
+ return expansions;
+ }
+ }
+
+ function reduceResources(state, action, context) {
+ var resourceSource = reduceResourceSource(state && state.resourceSource, action, context);
+ var resourceStore = reduceResourceStore(state && state.resourceStore, action, resourceSource, context);
+ var resourceEntityExpansions = reduceResourceEntityExpansions(state && state.resourceEntityExpansions, action);
+ return {
+ resourceSource: resourceSource,
+ resourceStore: resourceStore,
+ resourceEntityExpansions: resourceEntityExpansions,
+ };
+ }
+
+ var EVENT_REFINERS = {
+ resourceId: String,
+ resourceIds: identity,
+ resourceEditable: Boolean,
+ };
+ function generateEventDefResourceMembers(refined) {
+ return {
+ resourceIds: ensureStringArray(refined.resourceIds)
+ .concat(refined.resourceId ? [refined.resourceId] : []),
+ resourceEditable: refined.resourceEditable,
+ };
+ }
+ function ensureStringArray(items) {
+ return (items || []).map(function (item) { return String(item); });
+ }
+
+ function transformDateSelectionJoin(hit0, hit1) {
+ var resourceId0 = hit0.dateSpan.resourceId;
+ var resourceId1 = hit1.dateSpan.resourceId;
+ if (resourceId0 && resourceId1) {
+ return { resourceId: resourceId0 };
+ }
+ return null;
+ }
+
+ var ResourceApi = /** @class */ (function () {
+ function ResourceApi(_context, _resource) {
+ this._context = _context;
+ this._resource = _resource;
+ }
+ ResourceApi.prototype.setProp = function (name, value) {
+ var oldResource = this._resource;
+ this._context.dispatch({
+ type: 'SET_RESOURCE_PROP',
+ resourceId: oldResource.id,
+ propName: name,
+ propValue: value,
+ });
+ this.sync(oldResource);
+ };
+ ResourceApi.prototype.setExtendedProp = function (name, value) {
+ var oldResource = this._resource;
+ this._context.dispatch({
+ type: 'SET_RESOURCE_EXTENDED_PROP',
+ resourceId: oldResource.id,
+ propName: name,
+ propValue: value,
+ });
+ this.sync(oldResource);
+ };
+ ResourceApi.prototype.sync = function (oldResource) {
+ var context = this._context;
+ var resourceId = oldResource.id;
+ // TODO: what if dispatch didn't complete synchronously?
+ this._resource = context.getCurrentData().resourceStore[resourceId];
+ context.emitter.trigger('resourceChange', {
+ oldResource: new ResourceApi(context, oldResource),
+ resource: this,
+ revert: function () {
+ var _a;
+ context.dispatch({
+ type: 'ADD_RESOURCE',
+ resourceHash: (_a = {},
+ _a[resourceId] = oldResource,
+ _a),
+ });
+ },
+ });
+ };
+ ResourceApi.prototype.remove = function () {
+ var context = this._context;
+ var internalResource = this._resource;
+ var resourceId = internalResource.id;
+ context.dispatch({
+ type: 'REMOVE_RESOURCE',
+ resourceId: resourceId,
+ });
+ context.emitter.trigger('resourceRemove', {
+ resource: this,
+ revert: function () {
+ var _a;
+ context.dispatch({
+ type: 'ADD_RESOURCE',
+ resourceHash: (_a = {},
+ _a[resourceId] = internalResource,
+ _a),
+ });
+ },
+ });
+ };
+ ResourceApi.prototype.getParent = function () {
+ var context = this._context;
+ var parentId = this._resource.parentId;
+ if (parentId) {
+ return new ResourceApi(context, context.getCurrentData().resourceSource[parentId]);
+ }
+ return null;
+ };
+ ResourceApi.prototype.getChildren = function () {
+ var thisResourceId = this._resource.id;
+ var context = this._context;
+ var resourceStore = context.getCurrentData().resourceStore;
+ var childApis = [];
+ for (var resourceId in resourceStore) {
+ if (resourceStore[resourceId].parentId === thisResourceId) {
+ childApis.push(new ResourceApi(context, resourceStore[resourceId]));
+ }
+ }
+ return childApis;
+ };
+ /*
+ this is really inefficient!
+ TODO: make EventApi::resourceIds a hash or keep an index in the Calendar's state
+ */
+ ResourceApi.prototype.getEvents = function () {
+ var thisResourceId = this._resource.id;
+ var context = this._context;
+ var _a = context.getCurrentData().eventStore, defs = _a.defs, instances = _a.instances;
+ var eventApis = [];
+ for (var instanceId in instances) {
+ var instance = instances[instanceId];
+ var def = defs[instance.defId];
+ if (def.resourceIds.indexOf(thisResourceId) !== -1) { // inefficient!!!
+ eventApis.push(new EventApi(context, def, instance));
+ }
+ }
+ return eventApis;
+ };
+ Object.defineProperty(ResourceApi.prototype, "id", {
+ get: function () { return getPublicId(this._resource.id); },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(ResourceApi.prototype, "title", {
+ get: function () { return this._resource.title; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(ResourceApi.prototype, "eventConstraint", {
+ get: function () { return this._resource.ui.constraints[0] || null; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(ResourceApi.prototype, "eventOverlap", {
+ get: function () { return this._resource.ui.overlap; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(ResourceApi.prototype, "eventAllow", {
+ get: function () { return this._resource.ui.allows[0] || null; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(ResourceApi.prototype, "eventBackgroundColor", {
+ get: function () { return this._resource.ui.backgroundColor; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(ResourceApi.prototype, "eventBorderColor", {
+ get: function () { return this._resource.ui.borderColor; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(ResourceApi.prototype, "eventTextColor", {
+ get: function () { return this._resource.ui.textColor; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(ResourceApi.prototype, "eventClassNames", {
+ // NOTE: user can't modify these because Object.freeze was called in event-def parsing
+ get: function () { return this._resource.ui.classNames; },
+ enumerable: false,
+ configurable: true
+ });
+ Object.defineProperty(ResourceApi.prototype, "extendedProps", {
+ get: function () { return this._resource.extendedProps; },
+ enumerable: false,
+ configurable: true
+ });
+ ResourceApi.prototype.toPlainObject = function (settings) {
+ if (settings === void 0) { settings = {}; }
+ var internal = this._resource;
+ var ui = internal.ui;
+ var publicId = this.id;
+ var res = {};
+ if (publicId) {
+ res.id = publicId;
+ }
+ if (internal.title) {
+ res.title = internal.title;
+ }
+ if (settings.collapseEventColor && ui.backgroundColor && ui.backgroundColor === ui.borderColor) {
+ res.eventColor = ui.backgroundColor;
+ }
+ else {
+ if (ui.backgroundColor) {
+ res.eventBackgroundColor = ui.backgroundColor;
+ }
+ if (ui.borderColor) {
+ res.eventBorderColor = ui.borderColor;
+ }
+ }
+ if (ui.textColor) {
+ res.eventTextColor = ui.textColor;
+ }
+ if (ui.classNames.length) {
+ res.eventClassNames = ui.classNames;
+ }
+ if (Object.keys(internal.extendedProps).length) {
+ if (settings.collapseExtendedProps) {
+ __assign(res, internal.extendedProps);
+ }
+ else {
+ res.extendedProps = internal.extendedProps;
+ }
+ }
+ return res;
+ };
+ ResourceApi.prototype.toJSON = function () {
+ return this.toPlainObject();
+ };
+ return ResourceApi;
+ }());
+ function buildResourceApis(resourceStore, context) {
+ var resourceApis = [];
+ for (var resourceId in resourceStore) {
+ resourceApis.push(new ResourceApi(context, resourceStore[resourceId]));
+ }
+ return resourceApis;
+ }
+
+ CalendarApi.prototype.addResource = function (input, scrollTo) {
+ var _a;
+ var _this = this;
+ if (scrollTo === void 0) { scrollTo = true; }
+ var currentState = this.getCurrentData();
+ var resourceHash;
+ var resource;
+ if (input instanceof ResourceApi) {
+ resource = input._resource;
+ resourceHash = (_a = {}, _a[resource.id] = resource, _a);
+ }
+ else {
+ resourceHash = {};
+ resource = parseResource(input, '', resourceHash, currentState);
+ }
+ this.dispatch({
+ type: 'ADD_RESOURCE',
+ resourceHash: resourceHash,
+ });
+ if (scrollTo) {
+ // TODO: wait til dispatch completes somehow
+ this.trigger('_scrollRequest', { resourceId: resource.id });
+ }
+ var resourceApi = new ResourceApi(currentState, resource);
+ currentState.emitter.trigger('resourceAdd', {
+ resource: resourceApi,
+ revert: function () {
+ _this.dispatch({
+ type: 'REMOVE_RESOURCE',
+ resourceId: resource.id,
+ });
+ },
+ });
+ return resourceApi;
+ };
+ CalendarApi.prototype.getResourceById = function (id) {
+ id = String(id);
+ var currentState = this.getCurrentData(); // eslint-disable-line react/no-this-in-sfc
+ if (currentState.resourceStore) { // guard against calendar with no resource functionality
+ var rawResource = currentState.resourceStore[id];
+ if (rawResource) {
+ return new ResourceApi(currentState, rawResource);
+ }
+ }
+ return null;
+ };
+ CalendarApi.prototype.getResources = function () {
+ var currentState = this.getCurrentData();
+ var resourceStore = currentState.resourceStore;
+ var resourceApis = [];
+ if (resourceStore) { // guard against calendar with no resource functionality
+ for (var resourceId in resourceStore) {
+ resourceApis.push(new ResourceApi(currentState, resourceStore[resourceId]));
+ }
+ }
+ return resourceApis;
+ };
+ CalendarApi.prototype.getTopLevelResources = function () {
+ var currentState = this.getCurrentData();
+ var resourceStore = currentState.resourceStore;
+ var resourceApis = [];
+ if (resourceStore) { // guard against calendar with no resource functionality
+ for (var resourceId in resourceStore) {
+ if (!resourceStore[resourceId].parentId) {
+ resourceApis.push(new ResourceApi(currentState, resourceStore[resourceId]));
+ }
+ }
+ }
+ return resourceApis;
+ };
+ CalendarApi.prototype.refetchResources = function () {
+ this.dispatch({
+ type: 'REFETCH_RESOURCES',
+ });
+ };
+ function transformDatePoint(dateSpan, context) {
+ return dateSpan.resourceId ?
+ { resource: context.calendarApi.getResourceById(dateSpan.resourceId) } :
+ {};
+ }
+ function transformDateSpan(dateSpan, context) {
+ return dateSpan.resourceId ?
+ { resource: context.calendarApi.getResourceById(dateSpan.resourceId) } :
+ {};
+ }
+
+ /*
+ splits things BASED OFF OF which resources they are associated with.
+ creates a '' entry which is when something has NO resource.
+ */
+ var ResourceSplitter = /** @class */ (function (_super) {
+ __extends(ResourceSplitter, _super);
+ function ResourceSplitter() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ ResourceSplitter.prototype.getKeyInfo = function (props) {
+ return __assign({ '': {} }, props.resourceStore);
+ };
+ ResourceSplitter.prototype.getKeysForDateSpan = function (dateSpan) {
+ return [dateSpan.resourceId || ''];
+ };
+ ResourceSplitter.prototype.getKeysForEventDef = function (eventDef) {
+ var resourceIds = eventDef.resourceIds;
+ if (!resourceIds.length) {
+ return [''];
+ }
+ return resourceIds;
+ };
+ return ResourceSplitter;
+ }(Splitter));
+
+ function isPropsValidWithResources(combinedProps, context) {
+ var splitter = new ResourceSplitter();
+ var sets = splitter.splitProps(__assign(__assign({}, combinedProps), { resourceStore: context.getCurrentData().resourceStore }));
+ for (var resourceId in sets) {
+ var props = sets[resourceId];
+ // merge in event data from the non-resource segment
+ if (resourceId && sets['']) { // current segment is not the non-resource one, and there IS a non-resource one
+ props = __assign(__assign({}, props), { eventStore: mergeEventStores(sets[''].eventStore, props.eventStore), eventUiBases: __assign(__assign({}, sets[''].eventUiBases), props.eventUiBases) });
+ }
+ if (!isPropsValid(props, context, { resourceId: resourceId }, filterConfig.bind(null, resourceId))) {
+ return false;
+ }
+ }
+ return true;
+ }
+ function filterConfig(resourceId, config) {
+ return __assign(__assign({}, config), { constraints: filterConstraints(resourceId, config.constraints) });
+ }
+ function filterConstraints(resourceId, constraints) {
+ return constraints.map(function (constraint) {
+ var defs = constraint.defs;
+ if (defs) { // we are dealing with an EventStore
+ // if any of the events define constraints to resources that are NOT this resource,
+ // then this resource is unconditionally prohibited, which is what a `false` value does.
+ for (var defId in defs) {
+ var resourceIds = defs[defId].resourceIds;
+ if (resourceIds.length && resourceIds.indexOf(resourceId) === -1) { // TODO: use a hash?!!! (for other reasons too)
+ return false;
+ }
+ }
+ }
+ return constraint;
+ });
+ }
+
+ function transformExternalDef(dateSpan) {
+ return dateSpan.resourceId ?
+ { resourceId: dateSpan.resourceId } :
+ {};
+ }
+
+ EventApi.prototype.getResources = function () {
+ var calendarApi = this._context.calendarApi;
+ return this._def.resourceIds.map(function (resourceId) { return calendarApi.getResourceById(resourceId); });
+ };
+ EventApi.prototype.setResources = function (resources) {
+ var resourceIds = [];
+ // massage resources -> resourceIds
+ for (var _i = 0, resources_1 = resources; _i < resources_1.length; _i++) {
+ var resource = resources_1[_i];
+ var resourceId = null;
+ if (typeof resource === 'string') {
+ resourceId = resource;
+ }
+ else if (typeof resource === 'number') {
+ resourceId = String(resource);
+ }
+ else if (resource instanceof ResourceApi) {
+ resourceId = resource.id; // guaranteed to always have an ID. hmmm
+ }
+ else {
+ console.warn('unknown resource type: ' + resource);
+ }
+ if (resourceId) {
+ resourceIds.push(resourceId);
+ }
+ }
+ this.mutate({
+ standardProps: {
+ resourceIds: resourceIds,
+ },
+ });
+ };
+
+ var optionChangeHandlers = {
+ resources: handleResources,
+ };
+ function handleResources(newSourceInput, context) {
+ var oldSourceInput = context.getCurrentData().resourceSource._raw;
+ if (oldSourceInput !== newSourceInput) {
+ context.dispatch({
+ type: 'RESET_RESOURCE_SOURCE',
+ resourceSourceInput: newSourceInput,
+ });
+ }
+ }
+
+ var DEFAULT_RESOURCE_ORDER = parseFieldSpecs('id,title');
+ function handleResourceStore(resourceStore, calendarData) {
+ var emitter = calendarData.emitter;
+ if (emitter.hasHandlers('resourcesSet')) {
+ emitter.trigger('resourcesSet', buildResourceApis(resourceStore, calendarData));
+ }
+ }
+
+ var OPTION_REFINERS = {
+ initialResources: identity,
+ resources: identity,
+ eventResourceEditable: Boolean,
+ refetchResourcesOnNavigate: Boolean,
+ resourceOrder: parseFieldSpecs,
+ filterResourcesWithEvents: Boolean,
+ resourceGroupField: String,
+ resourceAreaWidth: identity,
+ resourceAreaColumns: identity,
+ resourcesInitiallyExpanded: Boolean,
+ datesAboveResources: Boolean,
+ needsResourceData: Boolean,
+ resourceAreaHeaderClassNames: identity,
+ resourceAreaHeaderContent: identity,
+ resourceAreaHeaderDidMount: identity,
+ resourceAreaHeaderWillUnmount: identity,
+ resourceGroupLabelClassNames: identity,
+ resourceGroupLabelContent: identity,
+ resourceGroupLabelDidMount: identity,
+ resourceGroupLabelWillUnmount: identity,
+ resourceLabelClassNames: identity,
+ resourceLabelContent: identity,
+ resourceLabelDidMount: identity,
+ resourceLabelWillUnmount: identity,
+ resourceLaneClassNames: identity,
+ resourceLaneContent: identity,
+ resourceLaneDidMount: identity,
+ resourceLaneWillUnmount: identity,
+ resourceGroupLaneClassNames: identity,
+ resourceGroupLaneContent: identity,
+ resourceGroupLaneDidMount: identity,
+ resourceGroupLaneWillUnmount: identity,
+ };
+ var LISTENER_REFINERS = {
+ resourcesSet: identity,
+ resourceAdd: identity,
+ resourceChange: identity,
+ resourceRemove: identity,
+ };
+
+ registerResourceSourceDef({
+ ignoreRange: true,
+ parseMeta: function (refined) {
+ if (Array.isArray(refined.resources)) {
+ return refined.resources;
+ }
+ return null;
+ },
+ fetch: function (arg, successCallback) {
+ successCallback({
+ rawResources: arg.resourceSource.meta,
+ });
+ },
+ });
+
+ registerResourceSourceDef({
+ parseMeta: function (refined) {
+ if (typeof refined.resources === 'function') {
+ return refined.resources;
+ }
+ return null;
+ },
+ fetch: function (arg, success, failure) {
+ var dateEnv = arg.context.dateEnv;
+ var func = arg.resourceSource.meta;
+ var publicArg = arg.range ? {
+ start: dateEnv.toDate(arg.range.start),
+ end: dateEnv.toDate(arg.range.end),
+ startStr: dateEnv.formatIso(arg.range.start),
+ endStr: dateEnv.formatIso(arg.range.end),
+ timeZone: dateEnv.timeZone,
+ } : {};
+ // TODO: make more dry with EventSourceFunc
+ // TODO: accept a response?
+ unpromisify(func.bind(null, publicArg), function (rawResources) {
+ success({ rawResources: rawResources }); // needs an object response
+ }, failure);
+ },
+ });
+
+ registerResourceSourceDef({
+ parseMeta: function (refined) {
+ if (refined.url) {
+ return {
+ url: refined.url,
+ method: (refined.method || 'GET').toUpperCase(),
+ extraParams: refined.extraParams,
+ };
+ }
+ return null;
+ },
+ fetch: function (arg, successCallback, failureCallback) {
+ var meta = arg.resourceSource.meta;
+ var requestParams = buildRequestParams(meta, arg.range, arg.context);
+ requestJson(meta.method, meta.url, requestParams, function (rawResources, xhr) {
+ successCallback({ rawResources: rawResources, xhr: xhr });
+ }, function (message, xhr) {
+ failureCallback({ message: message, xhr: xhr });
+ });
+ },
+ });
+ // TODO: somehow consolidate with event json feed
+ function buildRequestParams(meta, range, context) {
+ var dateEnv = context.dateEnv, options = context.options;
+ var startParam;
+ var endParam;
+ var timeZoneParam;
+ var customRequestParams;
+ var params = {};
+ if (range) {
+ startParam = meta.startParam;
+ if (startParam == null) {
+ startParam = options.startParam;
+ }
+ endParam = meta.endParam;
+ if (endParam == null) {
+ endParam = options.endParam;
+ }
+ timeZoneParam = meta.timeZoneParam;
+ if (timeZoneParam == null) {
+ timeZoneParam = options.timeZoneParam;
+ }
+ params[startParam] = dateEnv.formatIso(range.start);
+ params[endParam] = dateEnv.formatIso(range.end);
+ if (dateEnv.timeZone !== 'local') {
+ params[timeZoneParam] = dateEnv.timeZone;
+ }
+ }
+ // retrieve any outbound GET/POST data from the options
+ if (typeof meta.extraParams === 'function') {
+ // supplied as a function that returns a key/value object
+ customRequestParams = meta.extraParams();
+ }
+ else {
+ // probably supplied as a straight key/value object
+ customRequestParams = meta.extraParams || {};
+ }
+ __assign(params, customRequestParams);
+ return params;
+ }
+
+ // TODO: not used for Spreadsheet. START USING. difficult because of col-specific rendering props
+ function ResourceLabelRoot(props) {
+ return (createElement(ViewContextType.Consumer, null, function (context) {
+ var options = context.options;
+ var hookProps = {
+ resource: new ResourceApi(context, props.resource),
+ date: props.date ? context.dateEnv.toDate(props.date) : null,
+ view: context.viewApi,
+ };
+ var dataAttrs = {
+ 'data-resource-id': props.resource.id,
+ 'data-date': props.date ? formatDayString(props.date) : undefined,
+ };
+ return (createElement(RenderHook, { hookProps: hookProps, classNames: options.resourceLabelClassNames, content: options.resourceLabelContent, defaultContent: renderInnerContent, didMount: options.resourceLabelDidMount, willUnmount: options.resourceLabelWillUnmount }, function (rootElRef, classNames, innerElRef, innerContent) { return props.children(rootElRef, classNames, // TODO: pass in 'fc-resource' ?
+ dataAttrs, innerElRef, innerContent); }));
+ }));
+ }
+ function renderInnerContent(props) {
+ return props.resource.title || props.resource.id;
+ }
+
+ var ResourceCell = /** @class */ (function (_super) {
+ __extends(ResourceCell, _super);
+ function ResourceCell() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ ResourceCell.prototype.render = function () {
+ var props = this.props;
+ return (createElement(ResourceLabelRoot, { resource: props.resource, date: props.date }, function (elRef, customClassNames, dataAttrs, innerElRef, innerContent) { return (createElement("th", __assign({ ref: elRef, className: ['fc-col-header-cell', 'fc-resource'].concat(customClassNames).join(' '), colSpan: props.colSpan }, dataAttrs),
+ createElement("div", { className: "fc-scrollgrid-sync-inner" },
+ createElement("span", { className: [
+ 'fc-col-header-cell-cushion',
+ props.isSticky ? 'fc-sticky' : '',
+ ].join(' '), ref: innerElRef }, innerContent)))); }));
+ };
+ return ResourceCell;
+ }(BaseComponent));
+
+ var ResourceDayHeader = /** @class */ (function (_super) {
+ __extends(ResourceDayHeader, _super);
+ function ResourceDayHeader() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.buildDateFormat = memoize(buildDateFormat);
+ return _this;
+ }
+ ResourceDayHeader.prototype.render = function () {
+ var _this = this;
+ var _a = this, props = _a.props, context = _a.context;
+ var dateFormat = this.buildDateFormat(context.options.dayHeaderFormat, props.datesRepDistinctDays, props.dates.length);
+ return (createElement(NowTimer, { unit: "day" }, function (nowDate, todayRange) {
+ if (props.dates.length === 1) {
+ return _this.renderResourceRow(props.resources, props.dates[0]);
+ }
+ if (context.options.datesAboveResources) {
+ return _this.renderDayAndResourceRows(props.dates, dateFormat, todayRange, props.resources);
+ }
+ return _this.renderResourceAndDayRows(props.resources, props.dates, dateFormat, todayRange);
+ }));
+ };
+ ResourceDayHeader.prototype.renderResourceRow = function (resources, date) {
+ var resourceCells = resources.map(function (resource) { return (createElement(ResourceCell, { key: resource.id, resource: resource, colSpan: 1, date: date })); });
+ return this.buildTr(resourceCells, 'resources');
+ };
+ ResourceDayHeader.prototype.renderDayAndResourceRows = function (dates, dateFormat, todayRange, resources) {
+ var dateCells = [];
+ var resourceCells = [];
+ for (var _i = 0, dates_1 = dates; _i < dates_1.length; _i++) {
+ var date = dates_1[_i];
+ dateCells.push(this.renderDateCell(date, dateFormat, todayRange, resources.length, null, true));
+ for (var _a = 0, resources_1 = resources; _a < resources_1.length; _a++) {
+ var resource = resources_1[_a];
+ resourceCells.push(createElement(ResourceCell, { key: resource.id + ':' + date.toISOString(), resource: resource, colSpan: 1, date: date }));
+ }
+ }
+ return (createElement(Fragment, null,
+ this.buildTr(dateCells, 'day'),
+ this.buildTr(resourceCells, 'resources')));
+ };
+ ResourceDayHeader.prototype.renderResourceAndDayRows = function (resources, dates, dateFormat, todayRange) {
+ var resourceCells = [];
+ var dateCells = [];
+ for (var _i = 0, resources_2 = resources; _i < resources_2.length; _i++) {
+ var resource = resources_2[_i];
+ resourceCells.push(createElement(ResourceCell, { key: resource.id, resource: resource, colSpan: dates.length, isSticky: true }));
+ for (var _a = 0, dates_2 = dates; _a < dates_2.length; _a++) {
+ var date = dates_2[_a];
+ dateCells.push(this.renderDateCell(date, dateFormat, todayRange, 1, resource));
+ }
+ }
+ return (createElement(Fragment, null,
+ this.buildTr(resourceCells, 'resources'),
+ this.buildTr(dateCells, 'day')));
+ };
+ // a cell with date text. might have a resource associated with it
+ ResourceDayHeader.prototype.renderDateCell = function (date, dateFormat, todayRange, colSpan, resource, isSticky) {
+ var props = this.props;
+ var keyPostfix = resource ? ":" + resource.id : '';
+ var extraHookProps = resource ? { resource: new ResourceApi(this.context, resource) } : {};
+ var extraDataAttrs = resource ? { 'data-resource-id': resource.id } : {};
+ return props.datesRepDistinctDays ? (createElement(TableDateCell, { key: date.toISOString() + keyPostfix, date: date, dateProfile: props.dateProfile, todayRange: todayRange, colCnt: props.dates.length * props.resources.length, dayHeaderFormat: dateFormat, colSpan: colSpan, isSticky: isSticky, extraHookProps: extraHookProps, extraDataAttrs: extraDataAttrs })) : (createElement(TableDowCell // we can't leverage the pure-componentness becausae the extra* props are new every time :(
+ , { key: date.getUTCDay() + keyPostfix, dow: date.getUTCDay(), dayHeaderFormat: dateFormat, colSpan: colSpan, isSticky: isSticky, extraHookProps: extraHookProps, extraDataAttrs: extraDataAttrs }));
+ };
+ ResourceDayHeader.prototype.buildTr = function (cells, key) {
+ var renderIntro = this.props.renderIntro;
+ if (!cells.length) {
+ cells = [createElement("td", { key: 0 }, "\u00A0")];
+ }
+ return (createElement("tr", { key: key },
+ renderIntro && renderIntro(key),
+ cells));
+ };
+ return ResourceDayHeader;
+ }(BaseComponent));
+ function buildDateFormat(dayHeaderFormat, datesRepDistinctDays, dayCnt) {
+ return dayHeaderFormat || computeFallbackHeaderFormat(datesRepDistinctDays, dayCnt);
+ }
+
+ var ResourceIndex = /** @class */ (function () {
+ function ResourceIndex(resources) {
+ var indicesById = {};
+ var ids = [];
+ for (var i = 0; i < resources.length; i += 1) {
+ var id = resources[i].id;
+ ids.push(id);
+ indicesById[id] = i;
+ }
+ this.ids = ids;
+ this.indicesById = indicesById;
+ this.length = resources.length;
+ }
+ return ResourceIndex;
+ }());
+
+ var AbstractResourceDayTableModel = /** @class */ (function () {
+ function AbstractResourceDayTableModel(dayTableModel, resources, context) {
+ this.dayTableModel = dayTableModel;
+ this.resources = resources;
+ this.context = context;
+ this.resourceIndex = new ResourceIndex(resources);
+ this.rowCnt = dayTableModel.rowCnt;
+ this.colCnt = dayTableModel.colCnt * resources.length;
+ this.cells = this.buildCells();
+ }
+ AbstractResourceDayTableModel.prototype.buildCells = function () {
+ var _a = this, rowCnt = _a.rowCnt, dayTableModel = _a.dayTableModel, resources = _a.resources;
+ var rows = [];
+ for (var row = 0; row < rowCnt; row += 1) {
+ var rowCells = [];
+ for (var dateCol = 0; dateCol < dayTableModel.colCnt; dateCol += 1) {
+ for (var resourceCol = 0; resourceCol < resources.length; resourceCol += 1) {
+ var resource = resources[resourceCol];
+ var extraHookProps = { resource: new ResourceApi(this.context, resource) };
+ var extraDataAttrs = { 'data-resource-id': resource.id };
+ var extraClassNames = ['fc-resource'];
+ var extraDateSpan = { resourceId: resource.id };
+ var date = dayTableModel.cells[row][dateCol].date;
+ rowCells[this.computeCol(dateCol, resourceCol)] = {
+ key: resource.id + ':' + date.toISOString(),
+ date: date,
+ extraHookProps: extraHookProps,
+ extraDataAttrs: extraDataAttrs,
+ extraClassNames: extraClassNames,
+ extraDateSpan: extraDateSpan,
+ };
+ }
+ }
+ rows.push(rowCells);
+ }
+ return rows;
+ };
+ return AbstractResourceDayTableModel;
+ }());
+
+ /*
+ resources over dates
+ */
+ var ResourceDayTableModel = /** @class */ (function (_super) {
+ __extends(ResourceDayTableModel, _super);
+ function ResourceDayTableModel() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ ResourceDayTableModel.prototype.computeCol = function (dateI, resourceI) {
+ return resourceI * this.dayTableModel.colCnt + dateI;
+ };
+ /*
+ all date ranges are intact
+ */
+ ResourceDayTableModel.prototype.computeColRanges = function (dateStartI, dateEndI, resourceI) {
+ return [
+ {
+ firstCol: this.computeCol(dateStartI, resourceI),
+ lastCol: this.computeCol(dateEndI, resourceI),
+ isStart: true,
+ isEnd: true,
+ },
+ ];
+ };
+ return ResourceDayTableModel;
+ }(AbstractResourceDayTableModel));
+
+ /*
+ dates over resources
+ */
+ var DayResourceTableModel = /** @class */ (function (_super) {
+ __extends(DayResourceTableModel, _super);
+ function DayResourceTableModel() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ DayResourceTableModel.prototype.computeCol = function (dateI, resourceI) {
+ return dateI * this.resources.length + resourceI;
+ };
+ /*
+ every single day is broken up
+ */
+ DayResourceTableModel.prototype.computeColRanges = function (dateStartI, dateEndI, resourceI) {
+ var segs = [];
+ for (var i = dateStartI; i <= dateEndI; i += 1) {
+ var col = this.computeCol(i, resourceI);
+ segs.push({
+ firstCol: col,
+ lastCol: col,
+ isStart: i === dateStartI,
+ isEnd: i === dateEndI,
+ });
+ }
+ return segs;
+ };
+ return DayResourceTableModel;
+ }(AbstractResourceDayTableModel));
+
+ var NO_SEGS = []; // for memoizing
+ var VResourceJoiner = /** @class */ (function () {
+ function VResourceJoiner() {
+ this.joinDateSelection = memoize(this.joinSegs);
+ this.joinBusinessHours = memoize(this.joinSegs);
+ this.joinFgEvents = memoize(this.joinSegs);
+ this.joinBgEvents = memoize(this.joinSegs);
+ this.joinEventDrags = memoize(this.joinInteractions);
+ this.joinEventResizes = memoize(this.joinInteractions);
+ }
+ /*
+ propSets also has a '' key for things with no resource
+ */
+ VResourceJoiner.prototype.joinProps = function (propSets, resourceDayTable) {
+ var dateSelectionSets = [];
+ var businessHoursSets = [];
+ var fgEventSets = [];
+ var bgEventSets = [];
+ var eventDrags = [];
+ var eventResizes = [];
+ var eventSelection = '';
+ var keys = resourceDayTable.resourceIndex.ids.concat(['']); // add in the all-resource key
+ for (var _i = 0, keys_1 = keys; _i < keys_1.length; _i++) {
+ var key = keys_1[_i];
+ var props = propSets[key];
+ dateSelectionSets.push(props.dateSelectionSegs);
+ businessHoursSets.push(key ? props.businessHourSegs : NO_SEGS); // don't include redundant all-resource businesshours
+ fgEventSets.push(key ? props.fgEventSegs : NO_SEGS); // don't include fg all-resource segs
+ bgEventSets.push(props.bgEventSegs);
+ eventDrags.push(props.eventDrag);
+ eventResizes.push(props.eventResize);
+ eventSelection = eventSelection || props.eventSelection;
+ }
+ return {
+ dateSelectionSegs: this.joinDateSelection.apply(this, __spreadArray([resourceDayTable], dateSelectionSets)),
+ businessHourSegs: this.joinBusinessHours.apply(this, __spreadArray([resourceDayTable], businessHoursSets)),
+ fgEventSegs: this.joinFgEvents.apply(this, __spreadArray([resourceDayTable], fgEventSets)),
+ bgEventSegs: this.joinBgEvents.apply(this, __spreadArray([resourceDayTable], bgEventSets)),
+ eventDrag: this.joinEventDrags.apply(this, __spreadArray([resourceDayTable], eventDrags)),
+ eventResize: this.joinEventResizes.apply(this, __spreadArray([resourceDayTable], eventResizes)),
+ eventSelection: eventSelection,
+ };
+ };
+ VResourceJoiner.prototype.joinSegs = function (resourceDayTable) {
+ var segGroups = [];
+ for (var _i = 1; _i < arguments.length; _i++) {
+ segGroups[_i - 1] = arguments[_i];
+ }
+ var resourceCnt = resourceDayTable.resources.length;
+ var transformedSegs = [];
+ for (var i = 0; i < resourceCnt; i += 1) {
+ for (var _a = 0, _b = segGroups[i]; _a < _b.length; _a++) {
+ var seg = _b[_a];
+ transformedSegs.push.apply(transformedSegs, this.transformSeg(seg, resourceDayTable, i));
+ }
+ for (var _c = 0, _d = segGroups[resourceCnt]; _c < _d.length; _c++) { // one beyond. the all-resource
+ var seg = _d[_c];
+ transformedSegs.push.apply(// one beyond. the all-resource
+ transformedSegs, this.transformSeg(seg, resourceDayTable, i));
+ }
+ }
+ return transformedSegs;
+ };
+ /*
+ for expanding non-resource segs to all resources.
+ only for public use.
+ no memoizing.
+ */
+ VResourceJoiner.prototype.expandSegs = function (resourceDayTable, segs) {
+ var resourceCnt = resourceDayTable.resources.length;
+ var transformedSegs = [];
+ for (var i = 0; i < resourceCnt; i += 1) {
+ for (var _i = 0, segs_1 = segs; _i < segs_1.length; _i++) {
+ var seg = segs_1[_i];
+ transformedSegs.push.apply(transformedSegs, this.transformSeg(seg, resourceDayTable, i));
+ }
+ }
+ return transformedSegs;
+ };
+ VResourceJoiner.prototype.joinInteractions = function (resourceDayTable) {
+ var interactions = [];
+ for (var _i = 1; _i < arguments.length; _i++) {
+ interactions[_i - 1] = arguments[_i];
+ }
+ var resourceCnt = resourceDayTable.resources.length;
+ var affectedInstances = {};
+ var transformedSegs = [];
+ var anyInteractions = false;
+ var isEvent = false;
+ for (var i = 0; i < resourceCnt; i += 1) {
+ var interaction = interactions[i];
+ if (interaction) {
+ anyInteractions = true;
+ for (var _a = 0, _b = interaction.segs; _a < _b.length; _a++) {
+ var seg = _b[_a];
+ transformedSegs.push.apply(transformedSegs, this.transformSeg(seg, resourceDayTable, i));
+ }
+ __assign(affectedInstances, interaction.affectedInstances);
+ isEvent = isEvent || interaction.isEvent;
+ }
+ if (interactions[resourceCnt]) { // one beyond. the all-resource
+ for (var _c = 0, _d = interactions[resourceCnt].segs; _c < _d.length; _c++) {
+ var seg = _d[_c];
+ transformedSegs.push.apply(transformedSegs, this.transformSeg(seg, resourceDayTable, i));
+ }
+ }
+ }
+ if (anyInteractions) {
+ return {
+ affectedInstances: affectedInstances,
+ segs: transformedSegs,
+ isEvent: isEvent,
+ };
+ }
+ return null;
+ };
+ return VResourceJoiner;
+ }());
+
+ /*
+ TODO: just use ResourceHash somehow? could then use the generic ResourceSplitter
+ */
+ var VResourceSplitter = /** @class */ (function (_super) {
+ __extends(VResourceSplitter, _super);
+ function VResourceSplitter() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ VResourceSplitter.prototype.getKeyInfo = function (props) {
+ var resourceDayTableModel = props.resourceDayTableModel;
+ var hash = mapHash(resourceDayTableModel.resourceIndex.indicesById, function (i) { return resourceDayTableModel.resources[i]; }); // :(
+ hash[''] = {};
+ return hash;
+ };
+ VResourceSplitter.prototype.getKeysForDateSpan = function (dateSpan) {
+ return [dateSpan.resourceId || ''];
+ };
+ VResourceSplitter.prototype.getKeysForEventDef = function (eventDef) {
+ var resourceIds = eventDef.resourceIds;
+ if (!resourceIds.length) {
+ return [''];
+ }
+ return resourceIds;
+ };
+ return VResourceSplitter;
+ }(Splitter));
+
+ /*
+ doesn't accept grouping
+ */
+ function flattenResources(resourceStore, orderSpecs) {
+ return buildRowNodes(resourceStore, [], orderSpecs, false, {}, true)
+ .map(function (node) { return node.resource; });
+ }
+ function buildRowNodes(resourceStore, groupSpecs, orderSpecs, isVGrouping, expansions, expansionDefault) {
+ var complexNodes = buildHierarchy(resourceStore, isVGrouping ? -1 : 1, groupSpecs, orderSpecs);
+ var flatNodes = [];
+ flattenNodes(complexNodes, flatNodes, isVGrouping, [], 0, expansions, expansionDefault);
+ return flatNodes;
+ }
+ function flattenNodes(complexNodes, res, isVGrouping, rowSpans, depth, expansions, expansionDefault) {
+ for (var i = 0; i < complexNodes.length; i += 1) {
+ var complexNode = complexNodes[i];
+ var group = complexNode.group;
+ if (group) {
+ if (isVGrouping) {
+ var firstRowIndex = res.length;
+ var rowSpanIndex = rowSpans.length;
+ flattenNodes(complexNode.children, res, isVGrouping, rowSpans.concat(0), depth, expansions, expansionDefault);
+ if (firstRowIndex < res.length) {
+ var firstRow = res[firstRowIndex];
+ var firstRowSpans = firstRow.rowSpans = firstRow.rowSpans.slice();
+ firstRowSpans[rowSpanIndex] = res.length - firstRowIndex;
+ }
+ }
+ else {
+ var id = group.spec.field + ':' + group.value;
+ var isExpanded = expansions[id] != null ? expansions[id] : expansionDefault;
+ res.push({ id: id, group: group, isExpanded: isExpanded });
+ if (isExpanded) {
+ flattenNodes(complexNode.children, res, isVGrouping, rowSpans, depth + 1, expansions, expansionDefault);
+ }
+ }
+ }
+ else if (complexNode.resource) {
+ var id = complexNode.resource.id;
+ var isExpanded = expansions[id] != null ? expansions[id] : expansionDefault;
+ res.push({
+ id: id,
+ rowSpans: rowSpans,
+ depth: depth,
+ isExpanded: isExpanded,
+ hasChildren: Boolean(complexNode.children.length),
+ resource: complexNode.resource,
+ resourceFields: complexNode.resourceFields,
+ });
+ if (isExpanded) {
+ flattenNodes(complexNode.children, res, isVGrouping, rowSpans, depth + 1, expansions, expansionDefault);
+ }
+ }
+ }
+ }
+ function buildHierarchy(resourceStore, maxDepth, groupSpecs, orderSpecs) {
+ var resourceNodes = buildResourceNodes(resourceStore, orderSpecs);
+ var builtNodes = [];
+ for (var resourceId in resourceNodes) {
+ var resourceNode = resourceNodes[resourceId];
+ if (!resourceNode.resource.parentId) {
+ insertResourceNode(resourceNode, builtNodes, groupSpecs, 0, maxDepth, orderSpecs);
+ }
+ }
+ return builtNodes;
+ }
+ function buildResourceNodes(resourceStore, orderSpecs) {
+ var nodeHash = {};
+ for (var resourceId in resourceStore) {
+ var resource = resourceStore[resourceId];
+ nodeHash[resourceId] = {
+ resource: resource,
+ resourceFields: buildResourceFields(resource),
+ children: [],
+ };
+ }
+ for (var resourceId in resourceStore) {
+ var resource = resourceStore[resourceId];
+ if (resource.parentId) {
+ var parentNode = nodeHash[resource.parentId];
+ if (parentNode) {
+ insertResourceNodeInSiblings(nodeHash[resourceId], parentNode.children, orderSpecs);
+ }
+ }
+ }
+ return nodeHash;
+ }
+ function insertResourceNode(resourceNode, nodes, groupSpecs, depth, maxDepth, orderSpecs) {
+ if (groupSpecs.length && (maxDepth === -1 || depth <= maxDepth)) {
+ var groupNode = ensureGroupNodes(resourceNode, nodes, groupSpecs[0]);
+ insertResourceNode(resourceNode, groupNode.children, groupSpecs.slice(1), depth + 1, maxDepth, orderSpecs);
+ }
+ else {
+ insertResourceNodeInSiblings(resourceNode, nodes, orderSpecs);
+ }
+ }
+ function ensureGroupNodes(resourceNode, nodes, groupSpec) {
+ var groupValue = resourceNode.resourceFields[groupSpec.field];
+ var groupNode;
+ var newGroupIndex;
+ // find an existing group that matches, or determine the position for a new group
+ if (groupSpec.order) {
+ for (newGroupIndex = 0; newGroupIndex < nodes.length; newGroupIndex += 1) {
+ var node = nodes[newGroupIndex];
+ if (node.group) {
+ var cmp = flexibleCompare(groupValue, node.group.value) * groupSpec.order;
+ if (cmp === 0) {
+ groupNode = node;
+ break;
+ }
+ else if (cmp < 0) {
+ break;
+ }
+ }
+ }
+ }
+ else { // the groups are unordered
+ for (newGroupIndex = 0; newGroupIndex < nodes.length; newGroupIndex += 1) {
+ var node = nodes[newGroupIndex];
+ if (node.group && groupValue === node.group.value) {
+ groupNode = node;
+ break;
+ }
+ }
+ }
+ if (!groupNode) {
+ groupNode = {
+ group: {
+ value: groupValue,
+ spec: groupSpec,
+ },
+ children: [],
+ };
+ nodes.splice(newGroupIndex, 0, groupNode);
+ }
+ return groupNode;
+ }
+ function insertResourceNodeInSiblings(resourceNode, siblings, orderSpecs) {
+ var i;
+ for (i = 0; i < siblings.length; i += 1) {
+ var cmp = compareByFieldSpecs(siblings[i].resourceFields, resourceNode.resourceFields, orderSpecs); // TODO: pass in ResourceApi?
+ if (cmp > 0) { // went 1 past. insert at i
+ break;
+ }
+ }
+ siblings.splice(i, 0, resourceNode);
+ }
+ function buildResourceFields(resource) {
+ var obj = __assign(__assign(__assign({}, resource.extendedProps), resource.ui), resource);
+ delete obj.ui;
+ delete obj.extendedProps;
+ return obj;
+ }
+ function isGroupsEqual(group0, group1) {
+ return group0.spec === group1.spec && group0.value === group1.value;
+ }
+
+ var resourceCommonPlugin = createPlugin({
+ deps: [
+ premiumCommonPlugin,
+ ],
+ reducers: [
+ reduceResources,
+ ],
+ isLoadingFuncs: [
+ function (state) { return state.resourceSource && state.resourceSource.isFetching; },
+ ],
+ eventRefiners: EVENT_REFINERS,
+ eventDefMemberAdders: [generateEventDefResourceMembers],
+ isDraggableTransformers: [transformIsDraggable],
+ eventDragMutationMassagers: [massageEventDragMutation],
+ eventDefMutationAppliers: [applyEventDefMutation],
+ dateSelectionTransformers: [transformDateSelectionJoin],
+ datePointTransforms: [transformDatePoint],
+ dateSpanTransforms: [transformDateSpan],
+ viewPropsTransformers: [ResourceDataAdder, ResourceEventConfigAdder],
+ isPropsValid: isPropsValidWithResources,
+ externalDefTransforms: [transformExternalDef],
+ eventDropTransformers: [transformEventDrop],
+ optionChangeHandlers: optionChangeHandlers,
+ optionRefiners: OPTION_REFINERS,
+ listenerRefiners: LISTENER_REFINERS,
+ propSetHandlers: { resourceStore: handleResourceStore },
+ });
+
+ var ResourceDayTableJoiner = /** @class */ (function (_super) {
+ __extends(ResourceDayTableJoiner, _super);
+ function ResourceDayTableJoiner() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ ResourceDayTableJoiner.prototype.transformSeg = function (seg, resourceDayTableModel, resourceI) {
+ var colRanges = resourceDayTableModel.computeColRanges(seg.firstCol, seg.lastCol, resourceI);
+ return colRanges.map(function (colRange) { return (__assign(__assign(__assign({}, seg), colRange), { isStart: seg.isStart && colRange.isStart, isEnd: seg.isEnd && colRange.isEnd })); });
+ };
+ return ResourceDayTableJoiner;
+ }(VResourceJoiner));
+
+ var ResourceDayTable = /** @class */ (function (_super) {
+ __extends(ResourceDayTable, _super);
+ function ResourceDayTable() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.splitter = new VResourceSplitter();
+ _this.slicers = {};
+ _this.joiner = new ResourceDayTableJoiner();
+ _this.tableRef = createRef();
+ _this.isHitComboAllowed = function (hit0, hit1) {
+ var allowAcrossResources = _this.props.resourceDayTableModel.dayTableModel.colCnt === 1;
+ return allowAcrossResources || hit0.dateSpan.resourceId === hit1.dateSpan.resourceId;
+ };
+ return _this;
+ }
+ ResourceDayTable.prototype.render = function () {
+ var _this = this;
+ var _a = this, props = _a.props, context = _a.context;
+ var resourceDayTableModel = props.resourceDayTableModel, nextDayThreshold = props.nextDayThreshold, dateProfile = props.dateProfile;
+ var splitProps = this.splitter.splitProps(props);
+ this.slicers = mapHash(splitProps, function (split, resourceId) { return _this.slicers[resourceId] || new DayTableSlicer(); });
+ var slicedProps = mapHash(this.slicers, function (slicer, resourceId) { return slicer.sliceProps(splitProps[resourceId], dateProfile, nextDayThreshold, context, resourceDayTableModel.dayTableModel); });
+ return (createElement(Table, __assign({ forPrint: props.forPrint, ref: this.tableRef }, this.joiner.joinProps(slicedProps, resourceDayTableModel), { cells: resourceDayTableModel.cells, dateProfile: dateProfile, colGroupNode: props.colGroupNode, tableMinWidth: props.tableMinWidth, renderRowIntro: props.renderRowIntro, dayMaxEvents: props.dayMaxEvents, dayMaxEventRows: props.dayMaxEventRows, showWeekNumbers: props.showWeekNumbers, expandRows: props.expandRows, headerAlignElRef: props.headerAlignElRef, clientWidth: props.clientWidth, clientHeight: props.clientHeight, isHitComboAllowed: this.isHitComboAllowed })));
+ };
+ return ResourceDayTable;
+ }(DateComponent));
+
+ var ResourceDayTableView = /** @class */ (function (_super) {
+ __extends(ResourceDayTableView, _super);
+ function ResourceDayTableView() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.flattenResources = memoize(flattenResources);
+ _this.buildResourceDayTableModel = memoize(buildResourceDayTableModel);
+ _this.headerRef = createRef();
+ _this.tableRef = createRef();
+ return _this;
+ }
+ ResourceDayTableView.prototype.render = function () {
+ var _this = this;
+ var _a = this, props = _a.props, context = _a.context;
+ var options = context.options;
+ var resourceOrderSpecs = options.resourceOrder || DEFAULT_RESOURCE_ORDER;
+ var resources = this.flattenResources(props.resourceStore, resourceOrderSpecs);
+ var resourceDayTableModel = this.buildResourceDayTableModel(props.dateProfile, context.dateProfileGenerator, resources, options.datesAboveResources, context);
+ var headerContent = options.dayHeaders && (createElement(ResourceDayHeader, { ref: this.headerRef, resources: resources, dateProfile: props.dateProfile, dates: resourceDayTableModel.dayTableModel.headerDates, datesRepDistinctDays: true }));
+ var bodyContent = function (contentArg) { return (createElement(ResourceDayTable, { ref: _this.tableRef, dateProfile: props.dateProfile, resourceDayTableModel: resourceDayTableModel, businessHours: props.businessHours, eventStore: props.eventStore, eventUiBases: props.eventUiBases, dateSelection: props.dateSelection, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, nextDayThreshold: options.nextDayThreshold, tableMinWidth: contentArg.tableMinWidth, colGroupNode: contentArg.tableColGroupNode, dayMaxEvents: options.dayMaxEvents, dayMaxEventRows: options.dayMaxEventRows, showWeekNumbers: options.weekNumbers, expandRows: !props.isHeightAuto, headerAlignElRef: _this.headerElRef, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, forPrint: props.forPrint })); };
+ return options.dayMinWidth
+ ? this.renderHScrollLayout(headerContent, bodyContent, resourceDayTableModel.colCnt, options.dayMinWidth)
+ : this.renderSimpleLayout(headerContent, bodyContent);
+ };
+ return ResourceDayTableView;
+ }(TableView));
+ function buildResourceDayTableModel(dateProfile, dateProfileGenerator, resources, datesAboveResources, context) {
+ var dayTable = buildDayTableModel(dateProfile, dateProfileGenerator);
+ return datesAboveResources ?
+ new DayResourceTableModel(dayTable, resources, context) :
+ new ResourceDayTableModel(dayTable, resources, context);
+ }
+
+ var resourceDayGridPlugin = createPlugin({
+ deps: [
+ premiumCommonPlugin,
+ resourceCommonPlugin,
+ dayGridPlugin,
+ ],
+ initialView: 'resourceDayGridDay',
+ views: {
+ resourceDayGrid: {
+ type: 'dayGrid',
+ component: ResourceDayTableView,
+ needsResourceData: true,
+ },
+ resourceDayGridDay: {
+ type: 'resourceDayGrid',
+ duration: { days: 1 },
+ },
+ resourceDayGridWeek: {
+ type: 'resourceDayGrid',
+ duration: { weeks: 1 },
+ },
+ resourceDayGridMonth: {
+ type: 'resourceDayGrid',
+ duration: { months: 1 },
+ // TODO: wish we didn't have to C&P from dayGrid's file
+ monthMode: true,
+ fixedWeekCount: true,
+ },
+ },
+ });
+
+ var ResourceDayTimeColsJoiner = /** @class */ (function (_super) {
+ __extends(ResourceDayTimeColsJoiner, _super);
+ function ResourceDayTimeColsJoiner() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ ResourceDayTimeColsJoiner.prototype.transformSeg = function (seg, resourceDayTable, resourceI) {
+ return [
+ __assign(__assign({}, seg), { col: resourceDayTable.computeCol(seg.col, resourceI) }),
+ ];
+ };
+ return ResourceDayTimeColsJoiner;
+ }(VResourceJoiner));
+
+ var ResourceDayTimeCols = /** @class */ (function (_super) {
+ __extends(ResourceDayTimeCols, _super);
+ function ResourceDayTimeCols() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.buildDayRanges = memoize(buildDayRanges);
+ _this.splitter = new VResourceSplitter();
+ _this.slicers = {};
+ _this.joiner = new ResourceDayTimeColsJoiner();
+ _this.timeColsRef = createRef();
+ _this.isHitComboAllowed = function (hit0, hit1) {
+ var allowAcrossResources = _this.dayRanges.length === 1;
+ return allowAcrossResources || hit0.dateSpan.resourceId === hit1.dateSpan.resourceId;
+ };
+ return _this;
+ }
+ ResourceDayTimeCols.prototype.render = function () {
+ var _this = this;
+ var _a = this, props = _a.props, context = _a.context;
+ var dateEnv = context.dateEnv, options = context.options;
+ var dateProfile = props.dateProfile, resourceDayTableModel = props.resourceDayTableModel;
+ var dayRanges = this.dayRanges = this.buildDayRanges(resourceDayTableModel.dayTableModel, dateProfile, dateEnv);
+ var splitProps = this.splitter.splitProps(props);
+ this.slicers = mapHash(splitProps, function (split, resourceId) { return _this.slicers[resourceId] || new DayTimeColsSlicer(); });
+ var slicedProps = mapHash(this.slicers, function (slicer, resourceId) { return slicer.sliceProps(splitProps[resourceId], dateProfile, null, context, dayRanges); });
+ return ( // TODO: would move this further down hierarchy, but sliceNowDate needs it
+ createElement(NowTimer, { unit: options.nowIndicator ? 'minute' : 'day' }, function (nowDate, todayRange) { return (createElement(TimeCols, __assign({ ref: _this.timeColsRef }, _this.joiner.joinProps(slicedProps, resourceDayTableModel), { dateProfile: dateProfile, axis: props.axis, slotDuration: props.slotDuration, slatMetas: props.slatMetas, cells: resourceDayTableModel.cells[0], tableColGroupNode: props.tableColGroupNode, tableMinWidth: props.tableMinWidth, clientWidth: props.clientWidth, clientHeight: props.clientHeight, expandRows: props.expandRows, nowDate: nowDate, nowIndicatorSegs: options.nowIndicator && _this.buildNowIndicatorSegs(nowDate), todayRange: todayRange, onScrollTopRequest: props.onScrollTopRequest, forPrint: props.forPrint, onSlatCoords: props.onSlatCoords, isHitComboAllowed: _this.isHitComboAllowed }))); }));
+ };
+ ResourceDayTimeCols.prototype.buildNowIndicatorSegs = function (date) {
+ var nonResourceSegs = this.slicers[''].sliceNowDate(date, this.context, this.dayRanges);
+ return this.joiner.expandSegs(this.props.resourceDayTableModel, nonResourceSegs);
+ };
+ return ResourceDayTimeCols;
+ }(DateComponent));
+
+ var ResourceDayTimeColsView = /** @class */ (function (_super) {
+ __extends(ResourceDayTimeColsView, _super);
+ function ResourceDayTimeColsView() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.flattenResources = memoize(flattenResources);
+ _this.buildResourceTimeColsModel = memoize(buildResourceTimeColsModel);
+ _this.buildSlatMetas = memoize(buildSlatMetas);
+ return _this;
+ }
+ ResourceDayTimeColsView.prototype.render = function () {
+ var _this = this;
+ var _a = this, props = _a.props, context = _a.context;
+ var options = context.options, dateEnv = context.dateEnv;
+ var dateProfile = props.dateProfile;
+ var splitProps = this.allDaySplitter.splitProps(props);
+ var resourceOrderSpecs = options.resourceOrder || DEFAULT_RESOURCE_ORDER;
+ var resources = this.flattenResources(props.resourceStore, resourceOrderSpecs);
+ var resourceDayTableModel = this.buildResourceTimeColsModel(dateProfile, context.dateProfileGenerator, resources, options.datesAboveResources, context);
+ var slatMetas = this.buildSlatMetas(dateProfile.slotMinTime, dateProfile.slotMaxTime, options.slotLabelInterval, options.slotDuration, dateEnv);
+ var dayMinWidth = options.dayMinWidth;
+ var hasAttachedAxis = !dayMinWidth;
+ var hasDetachedAxis = dayMinWidth;
+ var headerContent = options.dayHeaders && (createElement(ResourceDayHeader, { resources: resources, dates: resourceDayTableModel.dayTableModel.headerDates, dateProfile: dateProfile, datesRepDistinctDays: true, renderIntro: hasAttachedAxis ? this.renderHeadAxis : null }));
+ var allDayContent = (options.allDaySlot !== false) && (function (contentArg) { return (createElement(ResourceDayTable, __assign({}, splitProps.allDay, { dateProfile: dateProfile, resourceDayTableModel: resourceDayTableModel, nextDayThreshold: options.nextDayThreshold, tableMinWidth: contentArg.tableMinWidth, colGroupNode: contentArg.tableColGroupNode, renderRowIntro: hasAttachedAxis ? _this.renderTableRowAxis : null, showWeekNumbers: false, expandRows: false, headerAlignElRef: _this.headerElRef, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, forPrint: props.forPrint }, _this.getAllDayMaxEventProps()))); });
+ var timeGridContent = function (contentArg) { return (createElement(ResourceDayTimeCols, __assign({}, splitProps.timed, { dateProfile: dateProfile, axis: hasAttachedAxis, slotDuration: options.slotDuration, slatMetas: slatMetas, resourceDayTableModel: resourceDayTableModel, tableColGroupNode: contentArg.tableColGroupNode, tableMinWidth: contentArg.tableMinWidth, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, onSlatCoords: _this.handleSlatCoords, expandRows: contentArg.expandRows, forPrint: props.forPrint, onScrollTopRequest: _this.handleScrollTopRequest }))); };
+ return hasDetachedAxis
+ ? this.renderHScrollLayout(headerContent, allDayContent, timeGridContent, resourceDayTableModel.colCnt, dayMinWidth, slatMetas, this.state.slatCoords)
+ : this.renderSimpleLayout(headerContent, allDayContent, timeGridContent);
+ };
+ return ResourceDayTimeColsView;
+ }(TimeColsView));
+ function buildResourceTimeColsModel(dateProfile, dateProfileGenerator, resources, datesAboveResources, context) {
+ var dayTable = buildTimeColsModel(dateProfile, dateProfileGenerator);
+ return datesAboveResources ?
+ new DayResourceTableModel(dayTable, resources, context) :
+ new ResourceDayTableModel(dayTable, resources, context);
+ }
+
+ var resourceTimeGridPlugin = createPlugin({
+ deps: [
+ premiumCommonPlugin,
+ resourceCommonPlugin,
+ timeGridPlugin,
+ ],
+ initialView: 'resourceTimeGridDay',
+ views: {
+ resourceTimeGrid: {
+ type: 'timeGrid',
+ component: ResourceDayTimeColsView,
+ needsResourceData: true,
+ },
+ resourceTimeGridDay: {
+ type: 'resourceTimeGrid',
+ duration: { days: 1 },
+ },
+ resourceTimeGridWeek: {
+ type: 'resourceTimeGrid',
+ duration: { weeks: 1 },
+ },
+ },
+ });
+
+ /*
+ Renders the DOM responsible for the subrow expander area,
+ as well as the space before it (used to align expanders of similar depths)
+ */
+ function ExpanderIcon(_a) {
+ var depth = _a.depth, hasChildren = _a.hasChildren, isExpanded = _a.isExpanded, onExpanderClick = _a.onExpanderClick;
+ var nodes = [];
+ for (var i = 0; i < depth; i += 1) {
+ nodes.push(createElement("span", { className: "fc-icon" }));
+ }
+ var iconClassNames = ['fc-icon'];
+ if (hasChildren) {
+ if (isExpanded) {
+ iconClassNames.push('fc-icon-minus-square');
+ }
+ else {
+ iconClassNames.push('fc-icon-plus-square');
+ }
+ }
+ nodes.push(createElement("span", { className: 'fc-datagrid-expander' + (hasChildren ? '' : ' fc-datagrid-expander-placeholder'), onClick: onExpanderClick },
+ createElement("span", { className: iconClassNames.join(' ') })));
+ return createElement.apply(void 0, __spreadArray([Fragment, {}], nodes));
+ }
+
+ function refineHookProps$1(raw) {
+ return {
+ resource: new ResourceApi(raw.context, raw.resource),
+ fieldValue: raw.fieldValue,
+ view: raw.context.viewApi,
+ };
+ }
+
+ var SpreadsheetIndividualCellInner = /** @class */ (function (_super) {
+ __extends(SpreadsheetIndividualCellInner, _super);
+ function SpreadsheetIndividualCellInner() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ SpreadsheetIndividualCellInner.prototype.render = function () {
+ var props = this.props;
+ return (createElement(ContentHook, { hookProps: props.hookProps, content: props.colSpec.cellContent, defaultContent: renderResourceInner }, function (innerElRef, innerContent) { return (createElement("span", { className: "fc-datagrid-cell-main", ref: innerElRef }, innerContent)); }));
+ };
+ return SpreadsheetIndividualCellInner;
+ }(BaseComponent));
+ function renderResourceInner(hookProps) {
+ return hookProps.fieldValue || createElement(Fragment, null, "\u00A0");
+ }
+
+ // worth making a PureComponent? (because of innerHeight)
+ var SpreadsheetIndividualCell = /** @class */ (function (_super) {
+ __extends(SpreadsheetIndividualCell, _super);
+ function SpreadsheetIndividualCell() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.refineHookProps = memoizeObjArg(refineHookProps$1);
+ _this.normalizeClassNames = buildClassNameNormalizer();
+ _this.onExpanderClick = function (ev) {
+ var props = _this.props;
+ if (props.hasChildren) {
+ _this.context.dispatch({
+ type: 'SET_RESOURCE_ENTITY_EXPANDED',
+ id: props.resource.id,
+ isExpanded: !props.isExpanded,
+ });
+ }
+ };
+ return _this;
+ }
+ SpreadsheetIndividualCell.prototype.render = function () {
+ var _this = this;
+ var _a = this, props = _a.props, context = _a.context;
+ var colSpec = props.colSpec;
+ var hookProps = this.refineHookProps({
+ resource: props.resource,
+ fieldValue: props.fieldValue,
+ context: context,
+ });
+ var customClassNames = this.normalizeClassNames(colSpec.cellClassNames, hookProps);
+ return (createElement(MountHook, { hookProps: hookProps, didMount: colSpec.cellDidMount, willUnmount: colSpec.cellWillUnmount }, function (rootElRef) { return (createElement("td", { ref: rootElRef, "data-resource-id": props.resource.id, className: [
+ 'fc-datagrid-cell',
+ 'fc-resource',
+ ].concat(customClassNames).join(' ') },
+ createElement("div", { className: "fc-datagrid-cell-frame", style: { height: props.innerHeight } },
+ createElement("div", { className: "fc-datagrid-cell-cushion fc-scrollgrid-sync-inner" },
+ colSpec.isMain && (createElement(ExpanderIcon, { depth: props.depth, hasChildren: props.hasChildren, isExpanded: props.isExpanded, onExpanderClick: _this.onExpanderClick })),
+ createElement(SpreadsheetIndividualCellInner, { hookProps: hookProps, colSpec: colSpec }))))); }));
+ };
+ return SpreadsheetIndividualCell;
+ }(BaseComponent));
+
+ // for VERTICAL cell grouping, in spreadsheet area
+ var SpreadsheetGroupCell = /** @class */ (function (_super) {
+ __extends(SpreadsheetGroupCell, _super);
+ function SpreadsheetGroupCell() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ SpreadsheetGroupCell.prototype.render = function () {
+ var _a = this, props = _a.props, context = _a.context;
+ var colSpec = props.colSpec;
+ var hookProps = {
+ groupValue: props.fieldValue,
+ view: context.viewApi,
+ };
+ // a grouped cell. no data that is specific to this specific resource
+ // `colSpec` is for the group. a GroupSpec :(
+ return (createElement(RenderHook, { hookProps: hookProps, classNames: colSpec.cellClassNames, content: colSpec.cellContent, defaultContent: renderGroupInner, didMount: colSpec.cellDidMount, willUnmount: colSpec.cellWillUnmount }, function (rootElRef, classNames, innerElRef, innerContent) { return (
+ // TODO: make data-attr with group value?
+ createElement("td", { className: ['fc-datagrid-cell', 'fc-resource-group'].concat(classNames).join(' '), rowSpan: props.rowSpan, ref: rootElRef },
+ createElement("div", { className: "fc-datagrid-cell-frame fc-datagrid-cell-frame-liquid" },
+ createElement("div", { className: "fc-datagrid-cell-cushion fc-sticky", ref: innerElRef }, innerContent)))); }));
+ };
+ return SpreadsheetGroupCell;
+ }(BaseComponent));
+ function renderGroupInner(hookProps) {
+ return hookProps.groupValue || createElement(Fragment, null, "\u00A0");
+ }
+
+ var SpreadsheetRow = /** @class */ (function (_super) {
+ __extends(SpreadsheetRow, _super);
+ function SpreadsheetRow() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ SpreadsheetRow.prototype.render = function () {
+ var props = this.props;
+ var resource = props.resource, rowSpans = props.rowSpans, depth = props.depth;
+ var resourceFields = buildResourceFields(resource); // slightly inefficient. already done up the call stack
+ return (createElement("tr", null, props.colSpecs.map(function (colSpec, i) {
+ var rowSpan = rowSpans[i];
+ if (rowSpan === 0) { // not responsible for group-based rows. VRowGroup is
+ return null;
+ }
+ if (rowSpan == null) {
+ rowSpan = 1;
+ }
+ var fieldValue = colSpec.field ? resourceFields[colSpec.field] :
+ (resource.title || getPublicId(resource.id));
+ if (rowSpan > 1) {
+ return (createElement(SpreadsheetGroupCell, { key: i, colSpec: colSpec, fieldValue: fieldValue, rowSpan: rowSpan }));
+ }
+ return (createElement(SpreadsheetIndividualCell, { key: i, colSpec: colSpec, resource: resource, fieldValue: fieldValue, depth: depth, hasChildren: props.hasChildren, isExpanded: props.isExpanded, innerHeight: props.innerHeight }));
+ })));
+ };
+ return SpreadsheetRow;
+ }(BaseComponent));
+ SpreadsheetRow.addPropsEquality({
+ rowSpans: isArraysEqual,
+ });
+
+ // for HORIZONTAL cell grouping, in spreadsheet area
+ var SpreadsheetGroupRow = /** @class */ (function (_super) {
+ __extends(SpreadsheetGroupRow, _super);
+ function SpreadsheetGroupRow() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.innerInnerRef = createRef();
+ _this.onExpanderClick = function () {
+ var props = _this.props;
+ _this.context.dispatch({
+ type: 'SET_RESOURCE_ENTITY_EXPANDED',
+ id: props.id,
+ isExpanded: !props.isExpanded,
+ });
+ };
+ return _this;
+ }
+ SpreadsheetGroupRow.prototype.render = function () {
+ var _this = this;
+ var _a = this, props = _a.props, context = _a.context;
+ var hookProps = { groupValue: props.group.value, view: context.viewApi };
+ var spec = props.group.spec;
+ return (createElement("tr", null,
+ createElement(RenderHook, { hookProps: hookProps, classNames: spec.labelClassNames, content: spec.labelContent, defaultContent: renderCellInner, didMount: spec.labelDidMount, willUnmount: spec.labelWillUnmount }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("td", { ref: rootElRef, colSpan: props.spreadsheetColCnt, className: [
+ 'fc-datagrid-cell',
+ 'fc-resource-group',
+ context.theme.getClass('tableCellShaded'),
+ ].concat(classNames).join(' ') },
+ createElement("div", { className: "fc-datagrid-cell-frame", style: { height: props.innerHeight } },
+ createElement("div", { className: "fc-datagrid-cell-cushion fc-scrollgrid-sync-inner", ref: _this.innerInnerRef },
+ createElement(ExpanderIcon, { depth: 0, hasChildren: true, isExpanded: props.isExpanded, onExpanderClick: _this.onExpanderClick }),
+ createElement("span", { className: "fc-datagrid-cell-main", ref: innerElRef }, innerContent))))); })));
+ };
+ return SpreadsheetGroupRow;
+ }(BaseComponent));
+ SpreadsheetGroupRow.addPropsEquality({
+ group: isGroupsEqual,
+ });
+ function renderCellInner(hookProps) {
+ return hookProps.groupValue || createElement(Fragment, null, "\u00A0");
+ }
+
+ var SPREADSHEET_COL_MIN_WIDTH = 20;
+ var SpreadsheetHeader = /** @class */ (function (_super) {
+ __extends(SpreadsheetHeader, _super);
+ function SpreadsheetHeader() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.resizerElRefs = new RefMap(_this._handleColResizerEl.bind(_this));
+ _this.colDraggings = {};
+ return _this;
+ }
+ SpreadsheetHeader.prototype.render = function () {
+ var _this = this;
+ var _a = this.props, colSpecs = _a.colSpecs, superHeaderRendering = _a.superHeaderRendering, rowInnerHeights = _a.rowInnerHeights;
+ var hookProps = { view: this.context.viewApi };
+ var rowNodes = [];
+ rowInnerHeights = rowInnerHeights.slice(); // copy, because we're gonna pop
+ if (superHeaderRendering) {
+ var rowInnerHeight_1 = rowInnerHeights.shift();
+ rowNodes.push(createElement("tr", { key: "row-super" },
+ createElement(RenderHook, { hookProps: hookProps, classNames: superHeaderRendering.headerClassNames, content: superHeaderRendering.headerContent, didMount: superHeaderRendering.headerDidMount, willUnmount: superHeaderRendering.headerWillUnmount }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("th", { colSpan: colSpecs.length, ref: rootElRef, className: [
+ 'fc-datagrid-cell',
+ 'fc-datagrid-cell-super',
+ ].concat(classNames).join(' ') },
+ createElement("div", { className: "fc-datagrid-cell-frame", style: { height: rowInnerHeight_1 } },
+ createElement("div", { className: "fc-datagrid-cell-cushion fc-scrollgrid-sync-inner", ref: innerElRef }, innerContent)))); })));
+ }
+ var rowInnerHeight = rowInnerHeights.shift();
+ rowNodes.push(createElement("tr", { key: "row" }, colSpecs.map(function (colSpec, i) {
+ var isLastCol = i === (colSpecs.length - 1);
+ // need empty inner div for abs positioning for resizer
+ return (createElement(RenderHook, { key: i, hookProps: hookProps, classNames: colSpec.headerClassNames, content: colSpec.headerContent, didMount: colSpec.headerDidMount, willUnmount: colSpec.headerWillUnmount }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("th", { ref: rootElRef, className: ['fc-datagrid-cell'].concat(classNames).join(' ') },
+ createElement("div", { className: "fc-datagrid-cell-frame", style: { height: rowInnerHeight } },
+ createElement("div", { className: "fc-datagrid-cell-cushion fc-scrollgrid-sync-inner" },
+ colSpec.isMain && (createElement("span", { className: "fc-datagrid-expander fc-datagrid-expander-placeholder" },
+ createElement("span", { className: "fc-icon" }))),
+ createElement("span", { className: "fc-datagrid-cell-main", ref: innerElRef }, innerContent)),
+ !isLastCol &&
+ createElement("div", { className: "fc-datagrid-cell-resizer", ref: _this.resizerElRefs.createRef(i) })))); }));
+ })));
+ return (createElement(Fragment, null, rowNodes));
+ };
+ SpreadsheetHeader.prototype._handleColResizerEl = function (resizerEl, index) {
+ var colDraggings = this.colDraggings;
+ if (!resizerEl) {
+ var dragging = colDraggings[index];
+ if (dragging) {
+ dragging.destroy();
+ delete colDraggings[index];
+ }
+ }
+ else {
+ var dragging = this.initColResizing(resizerEl, parseInt(index, 10));
+ if (dragging) {
+ colDraggings[index] = dragging;
+ }
+ }
+ };
+ SpreadsheetHeader.prototype.initColResizing = function (resizerEl, index) {
+ var _a = this.context, pluginHooks = _a.pluginHooks, isRtl = _a.isRtl;
+ var onColWidthChange = this.props.onColWidthChange;
+ var ElementDraggingImpl = pluginHooks.elementDraggingImpl;
+ if (ElementDraggingImpl) {
+ var dragging = new ElementDraggingImpl(resizerEl);
+ var startWidth_1; // of just the single column
+ var currentWidths_1; // of all columns
+ dragging.emitter.on('dragstart', function () {
+ var allCells = findElements(elementClosest(resizerEl, 'tr'), 'th');
+ currentWidths_1 = allCells.map(function (cellEl) { return (cellEl.getBoundingClientRect().width); });
+ startWidth_1 = currentWidths_1[index];
+ });
+ dragging.emitter.on('dragmove', function (pev) {
+ currentWidths_1[index] = Math.max(startWidth_1 + pev.deltaX * (isRtl ? -1 : 1), SPREADSHEET_COL_MIN_WIDTH);
+ if (onColWidthChange) {
+ onColWidthChange(currentWidths_1.slice()); // send a copy since currentWidths continues to be mutated
+ }
+ });
+ dragging.setAutoScrollEnabled(false); // because gets weird with auto-scrolling time area
+ return dragging;
+ }
+ return null;
+ };
+ return SpreadsheetHeader;
+ }(BaseComponent));
+
+ var ResourceTimelineLaneMisc = /** @class */ (function (_super) {
+ __extends(ResourceTimelineLaneMisc, _super);
+ function ResourceTimelineLaneMisc() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ ResourceTimelineLaneMisc.prototype.render = function () {
+ var _a = this, props = _a.props, context = _a.context;
+ var hookProps = { resource: new ResourceApi(context, props.resource) }; // just easier to make directly
+ return (createElement(ContentHook, { hookProps: hookProps, content: context.options.resourceLaneContent }, function (innerElRef, innerContent) { return (innerContent && // TODO: test how this would interfere with height
+ createElement("div", { className: "fc-timeline-lane-misc", ref: innerElRef }, innerContent)); }));
+ };
+ return ResourceTimelineLaneMisc;
+ }(BaseComponent));
+
+ var ResourceTimelineLane = /** @class */ (function (_super) {
+ __extends(ResourceTimelineLane, _super);
+ function ResourceTimelineLane() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.refineHookProps = memoizeObjArg(refineHookProps);
+ _this.normalizeClassNames = buildClassNameNormalizer();
+ _this.handleHeightChange = function (innerEl, isStable) {
+ if (_this.props.onHeightChange) {
+ _this.props.onHeightChange(
+ // would want to use own ref, but not guaranteed to be ready when this fires
+ elementClosest(innerEl, 'tr'), isStable);
+ }
+ };
+ return _this;
+ }
+ ResourceTimelineLane.prototype.render = function () {
+ var _this = this;
+ var _a = this, props = _a.props, context = _a.context;
+ var options = context.options;
+ var hookProps = this.refineHookProps({ resource: props.resource, context: context });
+ var customClassNames = this.normalizeClassNames(options.resourceLaneClassNames, hookProps);
+ return (createElement("tr", { ref: props.elRef },
+ createElement(MountHook, { hookProps: hookProps, didMount: options.resourceLaneDidMount, willUnmount: options.resourceLaneWillUnmount }, function (rootElRef) { return (createElement("td", { ref: rootElRef, className: ['fc-timeline-lane', 'fc-resource'].concat(customClassNames).join(' '), "data-resource-id": props.resource.id },
+ createElement("div", { className: "fc-timeline-lane-frame", style: { height: props.innerHeight } },
+ createElement(ResourceTimelineLaneMisc, { resource: props.resource }),
+ createElement(TimelineLane, { dateProfile: props.dateProfile, tDateProfile: props.tDateProfile, nowDate: props.nowDate, todayRange: props.todayRange, nextDayThreshold: props.nextDayThreshold, businessHours: props.businessHours, eventStore: props.eventStore, eventUiBases: props.eventUiBases, dateSelection: props.dateSelection, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, timelineCoords: props.timelineCoords, onHeightChange: _this.handleHeightChange, resourceId: props.resource.id })))); }))); // important NOT to do liquid-height. dont want to shrink height smaller than content
+ };
+ return ResourceTimelineLane;
+ }(BaseComponent));
+ function refineHookProps(raw) {
+ return {
+ resource: new ResourceApi(raw.context, raw.resource),
+ };
+ }
+
+ /*
+ parallels the SpreadsheetGroupRow
+ */
+ var DividerRow = /** @class */ (function (_super) {
+ __extends(DividerRow, _super);
+ function DividerRow() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ DividerRow.prototype.render = function () {
+ var _this = this;
+ var props = this.props;
+ var renderingHooks = this.props.renderingHooks;
+ var hookProps = { groupValue: props.groupValue, view: this.context.viewApi };
+ return (createElement("tr", { ref: props.elRef },
+ createElement(RenderHook, { hookProps: hookProps, classNames: renderingHooks.laneClassNames, content: renderingHooks.laneContent, didMount: renderingHooks.laneDidMount, willUnmount: renderingHooks.laneWillUnmount }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("td", { ref: rootElRef, className: [
+ 'fc-timeline-lane',
+ 'fc-resource-group',
+ _this.context.theme.getClass('tableCellShaded'),
+ ].concat(classNames).join(' ') },
+ createElement("div", { style: { height: props.innerHeight }, ref: innerElRef }, innerContent))); })));
+ };
+ return DividerRow;
+ }(BaseComponent));
+
+ var ResourceTimelineLanesBody = /** @class */ (function (_super) {
+ __extends(ResourceTimelineLanesBody, _super);
+ function ResourceTimelineLanesBody() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ ResourceTimelineLanesBody.prototype.render = function () {
+ var _a = this, props = _a.props, context = _a.context;
+ var rowElRefs = props.rowElRefs, innerHeights = props.innerHeights;
+ return (createElement("tbody", null, props.rowNodes.map(function (node, index) {
+ if (node.group) {
+ return (createElement(DividerRow, { key: node.id, elRef: rowElRefs.createRef(node.id), groupValue: node.group.value, renderingHooks: node.group.spec, innerHeight: innerHeights[index] || '' }));
+ }
+ if (node.resource) {
+ var resource = node.resource;
+ return (createElement(ResourceTimelineLane, __assign({ key: node.id, elRef: rowElRefs.createRef(node.id) }, props.splitProps[resource.id], { resource: resource, dateProfile: props.dateProfile, tDateProfile: props.tDateProfile, nowDate: props.nowDate, todayRange: props.todayRange, nextDayThreshold: context.options.nextDayThreshold, businessHours: resource.businessHours || props.fallbackBusinessHours, innerHeight: innerHeights[index] || '', timelineCoords: props.slatCoords, onHeightChange: props.onRowHeightChange })));
+ }
+ return null;
+ })));
+ };
+ return ResourceTimelineLanesBody;
+ }(BaseComponent));
+
+ var ResourceTimelineLanes = /** @class */ (function (_super) {
+ __extends(ResourceTimelineLanes, _super);
+ function ResourceTimelineLanes() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.rootElRef = createRef();
+ _this.rowElRefs = new RefMap();
+ return _this;
+ }
+ ResourceTimelineLanes.prototype.render = function () {
+ var _a = this, props = _a.props, context = _a.context;
+ return (createElement("table", { ref: this.rootElRef, className: 'fc-scrollgrid-sync-table ' + context.theme.getClass('table'), style: {
+ minWidth: props.tableMinWidth,
+ width: props.clientWidth,
+ height: props.minHeight,
+ } },
+ createElement(ResourceTimelineLanesBody, { rowElRefs: this.rowElRefs, rowNodes: props.rowNodes, dateProfile: props.dateProfile, tDateProfile: props.tDateProfile, nowDate: props.nowDate, todayRange: props.todayRange, splitProps: props.splitProps, fallbackBusinessHours: props.fallbackBusinessHours, slatCoords: props.slatCoords, innerHeights: props.innerHeights, onRowHeightChange: props.onRowHeightChange })));
+ };
+ ResourceTimelineLanes.prototype.componentDidMount = function () {
+ this.updateCoords();
+ };
+ ResourceTimelineLanes.prototype.componentDidUpdate = function () {
+ this.updateCoords();
+ };
+ ResourceTimelineLanes.prototype.componentWillUnmount = function () {
+ if (this.props.onRowCoords) {
+ this.props.onRowCoords(null);
+ }
+ };
+ ResourceTimelineLanes.prototype.updateCoords = function () {
+ var props = this.props;
+ if (props.onRowCoords && props.clientWidth !== null) { // a populated clientWidth means sizing has stabilized
+ this.props.onRowCoords(new PositionCache(this.rootElRef.current, collectRowEls(this.rowElRefs.currentMap, props.rowNodes), false, true));
+ }
+ };
+ return ResourceTimelineLanes;
+ }(BaseComponent));
+ function collectRowEls(elMap, rowNodes) {
+ return rowNodes.map(function (rowNode) { return elMap[rowNode.id]; });
+ }
+
+ var ResourceTimelineGrid = /** @class */ (function (_super) {
+ __extends(ResourceTimelineGrid, _super);
+ function ResourceTimelineGrid() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.computeHasResourceBusinessHours = memoize(computeHasResourceBusinessHours);
+ _this.resourceSplitter = new ResourceSplitter(); // doesn't let it do businessHours tho
+ _this.bgSlicer = new TimelineLaneSlicer();
+ _this.slatsRef = createRef(); // needed for Hit creation :(
+ _this.state = {
+ slatCoords: null,
+ };
+ _this.handleEl = function (el) {
+ if (el) {
+ _this.context.registerInteractiveComponent(_this, { el: el });
+ }
+ else {
+ _this.context.unregisterInteractiveComponent(_this);
+ }
+ };
+ _this.handleSlatCoords = function (slatCoords) {
+ _this.setState({ slatCoords: slatCoords });
+ if (_this.props.onSlatCoords) {
+ _this.props.onSlatCoords(slatCoords);
+ }
+ };
+ _this.handleRowCoords = function (rowCoords) {
+ _this.rowCoords = rowCoords;
+ if (_this.props.onRowCoords) {
+ _this.props.onRowCoords(rowCoords);
+ }
+ };
+ return _this;
+ }
+ ResourceTimelineGrid.prototype.render = function () {
+ var _this = this;
+ var _a = this, props = _a.props, state = _a.state, context = _a.context;
+ var dateProfile = props.dateProfile, tDateProfile = props.tDateProfile;
+ var timerUnit = greatestDurationDenominator(tDateProfile.slotDuration).unit;
+ var hasResourceBusinessHours = this.computeHasResourceBusinessHours(props.rowNodes);
+ var splitProps = this.resourceSplitter.splitProps(props);
+ var bgLaneProps = splitProps[''];
+ var bgSlicedProps = this.bgSlicer.sliceProps(bgLaneProps, dateProfile, tDateProfile.isTimeScale ? null : props.nextDayThreshold, context, // wish we didn't need to pass in the rest of these args...
+ dateProfile, context.dateProfileGenerator, tDateProfile, context.dateEnv);
+ // WORKAROUND: make ignore slatCoords when out of sync with dateProfile
+ var slatCoords = state.slatCoords && state.slatCoords.dateProfile === props.dateProfile ? state.slatCoords : null;
+ return (createElement("div", { ref: this.handleEl, className: [
+ 'fc-timeline-body',
+ props.expandRows ? 'fc-timeline-body-expandrows' : '',
+ ].join(' '), style: { minWidth: props.tableMinWidth } },
+ createElement(NowTimer, { unit: timerUnit }, function (nowDate, todayRange) { return (createElement(Fragment, null,
+ createElement(TimelineSlats, { ref: _this.slatsRef, dateProfile: dateProfile, tDateProfile: tDateProfile, nowDate: nowDate, todayRange: todayRange, clientWidth: props.clientWidth, tableColGroupNode: props.tableColGroupNode, tableMinWidth: props.tableMinWidth, onCoords: _this.handleSlatCoords, onScrollLeftRequest: props.onScrollLeftRequest }),
+ createElement(TimelineLaneBg, { businessHourSegs: hasResourceBusinessHours ? null : bgSlicedProps.businessHourSegs, bgEventSegs: bgSlicedProps.bgEventSegs, timelineCoords: slatCoords,
+ // empty array will result in unnecessary rerenders?
+ eventResizeSegs: (bgSlicedProps.eventResize ? bgSlicedProps.eventResize.segs : []), dateSelectionSegs: bgSlicedProps.dateSelectionSegs, nowDate: nowDate, todayRange: todayRange }),
+ createElement(ResourceTimelineLanes, { rowNodes: props.rowNodes, dateProfile: dateProfile, tDateProfile: props.tDateProfile, nowDate: nowDate, todayRange: todayRange, splitProps: splitProps, fallbackBusinessHours: hasResourceBusinessHours ? props.businessHours : null, clientWidth: props.clientWidth, minHeight: props.expandRows ? props.clientHeight : '', tableMinWidth: props.tableMinWidth, innerHeights: props.rowInnerHeights, slatCoords: slatCoords, onRowCoords: _this.handleRowCoords, onRowHeightChange: props.onRowHeightChange }),
+ (context.options.nowIndicator && slatCoords && slatCoords.isDateInRange(nowDate)) && (createElement("div", { className: "fc-timeline-now-indicator-container" },
+ createElement(NowIndicatorRoot, { isAxis: false, date: nowDate }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("div", { ref: rootElRef, className: ['fc-timeline-now-indicator-line'].concat(classNames).join(' '), style: coordToCss(slatCoords.dateToCoord(nowDate), context.isRtl) }, innerContent)); }))))); })));
+ };
+ // Hit System
+ // ------------------------------------------------------------------------------------------
+ ResourceTimelineGrid.prototype.queryHit = function (positionLeft, positionTop) {
+ var rowCoords = this.rowCoords;
+ var rowIndex = rowCoords.topToIndex(positionTop);
+ if (rowIndex != null) {
+ var resource = this.props.rowNodes[rowIndex].resource;
+ if (resource) { // not a group
+ var slatHit = this.slatsRef.current.positionToHit(positionLeft);
+ if (slatHit) {
+ return {
+ dateProfile: this.props.dateProfile,
+ dateSpan: {
+ range: slatHit.dateSpan.range,
+ allDay: slatHit.dateSpan.allDay,
+ resourceId: resource.id,
+ },
+ rect: {
+ left: slatHit.left,
+ right: slatHit.right,
+ top: rowCoords.tops[rowIndex],
+ bottom: rowCoords.bottoms[rowIndex],
+ },
+ dayEl: slatHit.dayEl,
+ layer: 0,
+ };
+ }
+ }
+ }
+ return null;
+ };
+ return ResourceTimelineGrid;
+ }(DateComponent));
+ function computeHasResourceBusinessHours(rowNodes) {
+ for (var _i = 0, rowNodes_1 = rowNodes; _i < rowNodes_1.length; _i++) {
+ var node = rowNodes_1[_i];
+ var resource = node.resource;
+ if (resource && resource.businessHours) {
+ return true;
+ }
+ }
+ return false;
+ }
+
+ var MIN_RESOURCE_AREA_WIDTH = 30; // definitely bigger than scrollbars
+ // RENAME?
+ var ResourceTimelineViewLayout = /** @class */ (function (_super) {
+ __extends(ResourceTimelineViewLayout, _super);
+ function ResourceTimelineViewLayout() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this.scrollGridRef = createRef();
+ _this.timeBodyScrollerElRef = createRef();
+ _this.spreadsheetHeaderChunkElRef = createRef();
+ _this.rootElRef = createRef();
+ _this.ensureScrollGridResizeId = 0;
+ _this.state = {
+ resourceAreaWidthOverride: null,
+ };
+ /*
+ ghetto debounce. don't race with ScrollGrid's resizing delay. solves #6140
+ */
+ _this.ensureScrollGridResize = function () {
+ if (_this.ensureScrollGridResizeId) {
+ clearTimeout(_this.ensureScrollGridResizeId);
+ }
+ _this.ensureScrollGridResizeId = setTimeout(function () {
+ _this.scrollGridRef.current.handleSizing(false);
+ }, config.SCROLLGRID_RESIZE_INTERVAL + 1);
+ };
+ return _this;
+ }
+ ResourceTimelineViewLayout.prototype.render = function () {
+ var _a = this, props = _a.props, state = _a.state, context = _a.context;
+ var options = context.options;
+ var stickyHeaderDates = !props.forPrint && getStickyHeaderDates(options);
+ var stickyFooterScrollbar = !props.forPrint && getStickyFooterScrollbar(options);
+ var sections = [
+ {
+ type: 'header',
+ key: 'header',
+ syncRowHeights: true,
+ isSticky: stickyHeaderDates,
+ chunks: [
+ {
+ key: 'datagrid',
+ elRef: this.spreadsheetHeaderChunkElRef,
+ // TODO: allow the content to specify this. have general-purpose 'content' with obj with keys
+ tableClassName: 'fc-datagrid-header',
+ rowContent: props.spreadsheetHeaderRows,
+ },
+ {
+ key: 'divider',
+ outerContent: (createElement("td", { className: 'fc-resource-timeline-divider ' + context.theme.getClass('tableCellShaded') })),
+ },
+ {
+ key: 'timeline',
+ content: props.timeHeaderContent,
+ },
+ ],
+ },
+ {
+ type: 'body',
+ key: 'body',
+ syncRowHeights: true,
+ liquid: true,
+ expandRows: Boolean(options.expandRows),
+ chunks: [
+ {
+ key: 'datagrid',
+ tableClassName: 'fc-datagrid-body',
+ rowContent: props.spreadsheetBodyRows,
+ },
+ {
+ key: 'divider',
+ outerContent: (createElement("td", { className: 'fc-resource-timeline-divider ' + context.theme.getClass('tableCellShaded') })),
+ },
+ {
+ key: 'timeline',
+ scrollerElRef: this.timeBodyScrollerElRef,
+ content: props.timeBodyContent,
+ },
+ ],
+ },
+ ];
+ if (stickyFooterScrollbar) {
+ sections.push({
+ type: 'footer',
+ key: 'footer',
+ isSticky: true,
+ chunks: [
+ {
+ key: 'datagrid',
+ content: renderScrollShim,
+ },
+ {
+ key: 'divider',
+ outerContent: (createElement("td", { className: 'fc-resource-timeline-divider ' + context.theme.getClass('tableCellShaded') })),
+ },
+ {
+ key: 'timeline',
+ content: renderScrollShim,
+ },
+ ],
+ });
+ }
+ var resourceAreaWidth = state.resourceAreaWidthOverride != null
+ ? state.resourceAreaWidthOverride
+ : options.resourceAreaWidth;
+ return (createElement(ScrollGrid, { ref: this.scrollGridRef, elRef: this.rootElRef, liquid: !props.isHeightAuto && !props.forPrint, collapsibleWidth: false, colGroups: [
+ { cols: props.spreadsheetCols, width: resourceAreaWidth },
+ { cols: [] },
+ { cols: props.timeCols },
+ ], sections: sections }));
+ };
+ ResourceTimelineViewLayout.prototype.forceTimeScroll = function (left) {
+ var scrollGrid = this.scrollGridRef.current;
+ scrollGrid.forceScrollLeft(2, left); // 2 = the time area
+ };
+ ResourceTimelineViewLayout.prototype.forceResourceScroll = function (top) {
+ var scrollGrid = this.scrollGridRef.current;
+ scrollGrid.forceScrollTop(1, top); // 1 = the body
+ };
+ ResourceTimelineViewLayout.prototype.getResourceScroll = function () {
+ var timeBodyScrollerEl = this.timeBodyScrollerElRef.current;
+ return timeBodyScrollerEl.scrollTop;
+ };
+ // Resource Area Resizing
+ // ------------------------------------------------------------------------------------------
+ // NOTE: a callback Ref for the resizer was firing multiple times with same elements (Preact)
+ // that's why we use spreadsheetResizerElRef instead
+ ResourceTimelineViewLayout.prototype.componentDidMount = function () {
+ this.initSpreadsheetResizing();
+ };
+ ResourceTimelineViewLayout.prototype.componentWillUnmount = function () {
+ this.destroySpreadsheetResizing();
+ };
+ ResourceTimelineViewLayout.prototype.initSpreadsheetResizing = function () {
+ var _this = this;
+ var _a = this.context, isRtl = _a.isRtl, pluginHooks = _a.pluginHooks;
+ var ElementDraggingImpl = pluginHooks.elementDraggingImpl;
+ var spreadsheetHeadEl = this.spreadsheetHeaderChunkElRef.current;
+ if (ElementDraggingImpl) {
+ var rootEl_1 = this.rootElRef.current;
+ var dragging = this.spreadsheetResizerDragging = new ElementDraggingImpl(rootEl_1, '.fc-resource-timeline-divider');
+ var dragStartWidth_1;
+ var viewWidth_1;
+ dragging.emitter.on('dragstart', function () {
+ dragStartWidth_1 = spreadsheetHeadEl.getBoundingClientRect().width;
+ viewWidth_1 = rootEl_1.getBoundingClientRect().width;
+ });
+ dragging.emitter.on('dragmove', function (pev) {
+ var newWidth = dragStartWidth_1 + pev.deltaX * (isRtl ? -1 : 1);
+ newWidth = Math.max(newWidth, MIN_RESOURCE_AREA_WIDTH);
+ newWidth = Math.min(newWidth, viewWidth_1 - MIN_RESOURCE_AREA_WIDTH);
+ // scrollgrid will ignore resize requests if there are too many :|
+ _this.setState({
+ resourceAreaWidthOverride: newWidth,
+ }, _this.ensureScrollGridResize);
+ });
+ dragging.setAutoScrollEnabled(false); // because gets weird with auto-scrolling time area
+ }
+ };
+ ResourceTimelineViewLayout.prototype.destroySpreadsheetResizing = function () {
+ if (this.spreadsheetResizerDragging) {
+ this.spreadsheetResizerDragging.destroy();
+ }
+ };
+ return ResourceTimelineViewLayout;
+ }(BaseComponent));
+
+ var ResourceTimelineView = /** @class */ (function (_super) {
+ __extends(ResourceTimelineView, _super);
+ function ResourceTimelineView(props, context) {
+ var _this = _super.call(this, props, context) || this;
+ _this.processColOptions = memoize(processColOptions);
+ _this.buildTimelineDateProfile = memoize(buildTimelineDateProfile);
+ _this.hasNesting = memoize(hasNesting);
+ _this.buildRowNodes = memoize(buildRowNodes);
+ _this.layoutRef = createRef();
+ _this.rowNodes = [];
+ _this.renderedRowNodes = [];
+ _this.buildRowIndex = memoize(buildRowIndex);
+ _this.handleSlatCoords = function (slatCoords) {
+ _this.setState({ slatCoords: slatCoords });
+ };
+ _this.handleRowCoords = function (rowCoords) {
+ _this.rowCoords = rowCoords;
+ _this.scrollResponder.update(false); // TODO: could eliminate this if rowCoords lived in state
+ };
+ _this.handleMaxCushionWidth = function (slotCushionMaxWidth) {
+ _this.setState({
+ slotCushionMaxWidth: Math.ceil(slotCushionMaxWidth), // for less rerendering TODO: DRY
+ });
+ };
+ // Scrolling
+ // ------------------------------------------------------------------------------------------------------------------
+ // this is useful for scrolling prev/next dates while resource is scrolled down
+ _this.handleScrollLeftRequest = function (scrollLeft) {
+ var layout = _this.layoutRef.current;
+ layout.forceTimeScroll(scrollLeft);
+ };
+ _this.handleScrollRequest = function (request) {
+ var rowCoords = _this.rowCoords;
+ var layout = _this.layoutRef.current;
+ var rowId = request.rowId || request.resourceId;
+ if (rowCoords) {
+ if (rowId) {
+ var rowIdToIndex = _this.buildRowIndex(_this.renderedRowNodes);
+ var index = rowIdToIndex[rowId];
+ if (index != null) {
+ var scrollTop = (request.fromBottom != null ?
+ rowCoords.bottoms[index] - request.fromBottom : // pixels from bottom edge
+ rowCoords.tops[index] // just use top edge
+ );
+ layout.forceResourceScroll(scrollTop);
+ }
+ }
+ return true;
+ }
+ return null;
+ };
+ // Resource INDIVIDUAL-Column Area Resizing
+ // ------------------------------------------------------------------------------------------
+ _this.handleColWidthChange = function (colWidths) {
+ _this.setState({
+ spreadsheetColWidths: colWidths,
+ });
+ };
+ _this.state = {
+ resourceAreaWidth: context.options.resourceAreaWidth,
+ spreadsheetColWidths: [],
+ };
+ return _this;
+ }
+ ResourceTimelineView.prototype.render = function () {
+ var _this = this;
+ var _a = this, props = _a.props, state = _a.state, context = _a.context;
+ var options = context.options, viewSpec = context.viewSpec;
+ var _b = this.processColOptions(context.options), superHeaderRendering = _b.superHeaderRendering, groupSpecs = _b.groupSpecs, orderSpecs = _b.orderSpecs, isVGrouping = _b.isVGrouping, colSpecs = _b.colSpecs;
+ var tDateProfile = this.buildTimelineDateProfile(props.dateProfile, context.dateEnv, options, context.dateProfileGenerator);
+ var rowNodes = this.rowNodes = this.buildRowNodes(props.resourceStore, groupSpecs, orderSpecs, isVGrouping, props.resourceEntityExpansions, options.resourcesInitiallyExpanded);
+ var extraClassNames = [
+ 'fc-resource-timeline',
+ this.hasNesting(rowNodes) ? '' : 'fc-resource-timeline-flat',
+ 'fc-timeline',
+ options.eventOverlap === false ? 'fc-timeline-overlap-disabled' : 'fc-timeline-overlap-enabled',
+ ];
+ var slotMinWidth = options.slotMinWidth;
+ var slatCols = buildSlatCols(tDateProfile, slotMinWidth || this.computeFallbackSlotMinWidth(tDateProfile));
+ return (createElement(ViewRoot, { viewSpec: viewSpec }, function (rootElRef, classNames) { return (createElement("div", { ref: rootElRef, className: extraClassNames.concat(classNames).join(' ') },
+ createElement(ResourceTimelineViewLayout, { ref: _this.layoutRef, forPrint: props.forPrint, isHeightAuto: props.isHeightAuto, spreadsheetCols: buildSpreadsheetCols(colSpecs, state.spreadsheetColWidths, ''), spreadsheetHeaderRows: function (contentArg) { return (createElement(SpreadsheetHeader // TODO: rename to SpreadsheetHeaderRows
+ , { superHeaderRendering: superHeaderRendering, colSpecs: colSpecs, onColWidthChange: _this.handleColWidthChange, rowInnerHeights: contentArg.rowSyncHeights })); }, spreadsheetBodyRows: function (contentArg) { return (createElement(Fragment, null, _this.renderSpreadsheetRows(rowNodes, colSpecs, contentArg.rowSyncHeights))); }, timeCols: slatCols, timeHeaderContent: function (contentArg) { return (createElement(TimelineHeader, { clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, tableMinWidth: contentArg.tableMinWidth, tableColGroupNode: contentArg.tableColGroupNode, dateProfile: props.dateProfile, tDateProfile: tDateProfile, slatCoords: state.slatCoords, rowInnerHeights: contentArg.rowSyncHeights, onMaxCushionWidth: slotMinWidth ? null : _this.handleMaxCushionWidth })); }, timeBodyContent: function (contentArg) { return (createElement(ResourceTimelineGrid, { dateProfile: props.dateProfile, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, tableMinWidth: contentArg.tableMinWidth, tableColGroupNode: contentArg.tableColGroupNode, expandRows: contentArg.expandRows, tDateProfile: tDateProfile, rowNodes: rowNodes, businessHours: props.businessHours, dateSelection: props.dateSelection, eventStore: props.eventStore, eventUiBases: props.eventUiBases, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, resourceStore: props.resourceStore, nextDayThreshold: context.options.nextDayThreshold, rowInnerHeights: contentArg.rowSyncHeights, onSlatCoords: _this.handleSlatCoords, onRowCoords: _this.handleRowCoords, onScrollLeftRequest: _this.handleScrollLeftRequest, onRowHeightChange: contentArg.reportRowHeightChange })); } }))); }));
+ };
+ ResourceTimelineView.prototype.renderSpreadsheetRows = function (nodes, colSpecs, rowSyncHeights) {
+ return nodes.map(function (node, index) {
+ if (node.group) {
+ return (createElement(SpreadsheetGroupRow, { key: node.id, id: node.id, spreadsheetColCnt: colSpecs.length, isExpanded: node.isExpanded, group: node.group, innerHeight: rowSyncHeights[index] || '' }));
+ }
+ if (node.resource) {
+ return (createElement(SpreadsheetRow, { key: node.id, colSpecs: colSpecs, rowSpans: node.rowSpans, depth: node.depth, isExpanded: node.isExpanded, hasChildren: node.hasChildren, resource: node.resource, innerHeight: rowSyncHeights[index] || '' }));
+ }
+ return null;
+ });
+ };
+ ResourceTimelineView.prototype.componentDidMount = function () {
+ this.renderedRowNodes = this.rowNodes;
+ this.scrollResponder = this.context.createScrollResponder(this.handleScrollRequest);
+ };
+ ResourceTimelineView.prototype.getSnapshotBeforeUpdate = function () {
+ if (!this.props.forPrint) { // because print-view is always zero?
+ return { resourceScroll: this.queryResourceScroll() };
+ }
+ return {};
+ };
+ ResourceTimelineView.prototype.componentDidUpdate = function (prevProps, prevState, snapshot) {
+ this.renderedRowNodes = this.rowNodes;
+ this.scrollResponder.update(prevProps.dateProfile !== this.props.dateProfile);
+ if (snapshot.resourceScroll) {
+ this.handleScrollRequest(snapshot.resourceScroll); // TODO: this gets triggered too often
+ }
+ };
+ ResourceTimelineView.prototype.componentWillUnmount = function () {
+ this.scrollResponder.detach();
+ };
+ ResourceTimelineView.prototype.computeFallbackSlotMinWidth = function (tDateProfile) {
+ return Math.max(30, ((this.state.slotCushionMaxWidth || 0) / tDateProfile.slotsPerLabel));
+ };
+ ResourceTimelineView.prototype.queryResourceScroll = function () {
+ var _a = this, rowCoords = _a.rowCoords, renderedRowNodes = _a.renderedRowNodes;
+ if (rowCoords) {
+ var layout = this.layoutRef.current;
+ var trBottoms = rowCoords.bottoms;
+ var scrollTop = layout.getResourceScroll();
+ var scroll_1 = {};
+ for (var i = 0; i < trBottoms.length; i += 1) {
+ var rowNode = renderedRowNodes[i];
+ var elBottom = trBottoms[i] - scrollTop; // from the top of the scroller
+ if (elBottom > 0) {
+ scroll_1.rowId = rowNode.id;
+ scroll_1.fromBottom = elBottom;
+ break;
+ }
+ }
+ return scroll_1;
+ }
+ return null;
+ };
+ return ResourceTimelineView;
+ }(BaseComponent));
+ ResourceTimelineView.addStateEquality({
+ spreadsheetColWidths: isArraysEqual,
+ });
+ function buildRowIndex(rowNodes) {
+ var rowIdToIndex = {};
+ for (var i = 0; i < rowNodes.length; i += 1) {
+ rowIdToIndex[rowNodes[i].id] = i;
+ }
+ return rowIdToIndex;
+ }
+ function buildSpreadsheetCols(colSpecs, forcedWidths, fallbackWidth) {
+ if (fallbackWidth === void 0) { fallbackWidth = ''; }
+ return colSpecs.map(function (colSpec, i) { return ({
+ className: colSpec.isMain ? 'fc-main-col' : '',
+ width: forcedWidths[i] || colSpec.width || fallbackWidth,
+ }); });
+ }
+ function hasNesting(nodes) {
+ for (var _i = 0, nodes_1 = nodes; _i < nodes_1.length; _i++) {
+ var node = nodes_1[_i];
+ if (node.group) {
+ return true;
+ }
+ if (node.resource) {
+ if (node.hasChildren) {
+ return true;
+ }
+ }
+ }
+ return false;
+ }
+ function processColOptions(options) {
+ var allColSpecs = options.resourceAreaColumns || [];
+ var superHeaderRendering = null;
+ if (!allColSpecs.length) {
+ allColSpecs.push({
+ headerClassNames: options.resourceAreaHeaderClassNames,
+ headerContent: options.resourceAreaHeaderContent || 'Resources',
+ headerDidMount: options.resourceAreaHeaderDidMount,
+ headerWillUnmount: options.resourceAreaHeaderWillUnmount,
+ });
+ }
+ else if (options.resourceAreaHeaderContent) { // weird way to determine if content
+ superHeaderRendering = {
+ headerClassNames: options.resourceAreaHeaderClassNames,
+ headerContent: options.resourceAreaHeaderContent,
+ headerDidMount: options.resourceAreaHeaderDidMount,
+ headerWillUnmount: options.resourceAreaHeaderWillUnmount,
+ };
+ }
+ var plainColSpecs = [];
+ var groupColSpecs = []; // part of the colSpecs, but filtered out in order to put first
+ var groupSpecs = [];
+ var isVGrouping = false;
+ for (var _i = 0, allColSpecs_1 = allColSpecs; _i < allColSpecs_1.length; _i++) {
+ var colSpec = allColSpecs_1[_i];
+ if (colSpec.group) {
+ groupColSpecs.push(__assign(__assign({}, colSpec), { cellClassNames: colSpec.cellClassNames || options.resourceGroupLabelClassNames, cellContent: colSpec.cellContent || options.resourceGroupLabelContent, cellDidMount: colSpec.cellDidMount || options.resourceGroupLabelDidMount, cellWillUnmount: colSpec.cellWillUnmount || options.resourceGroupLaneWillUnmount }));
+ }
+ else {
+ plainColSpecs.push(colSpec);
+ }
+ }
+ // BAD: mutates a user-supplied option
+ var mainColSpec = plainColSpecs[0];
+ mainColSpec.isMain = true;
+ mainColSpec.cellClassNames = mainColSpec.cellClassNames || options.resourceLabelClassNames;
+ mainColSpec.cellContent = mainColSpec.cellContent || options.resourceLabelContent;
+ mainColSpec.cellDidMount = mainColSpec.cellDidMount || options.resourceLabelDidMount;
+ mainColSpec.cellWillUnmount = mainColSpec.cellWillUnmount || options.resourceLabelWillUnmount;
+ if (groupColSpecs.length) {
+ groupSpecs = groupColSpecs;
+ isVGrouping = true;
+ }
+ else {
+ var hGroupField = options.resourceGroupField;
+ if (hGroupField) {
+ groupSpecs.push({
+ field: hGroupField,
+ labelClassNames: options.resourceGroupLabelClassNames,
+ labelContent: options.resourceGroupLabelContent,
+ labelDidMount: options.resourceGroupLabelDidMount,
+ labelWillUnmount: options.resourceGroupLabelWillUnmount,
+ laneClassNames: options.resourceGroupLaneClassNames,
+ laneContent: options.resourceGroupLaneContent,
+ laneDidMount: options.resourceGroupLaneDidMount,
+ laneWillUnmount: options.resourceGroupLaneWillUnmount,
+ });
+ }
+ }
+ var allOrderSpecs = options.resourceOrder || DEFAULT_RESOURCE_ORDER;
+ var plainOrderSpecs = [];
+ for (var _a = 0, allOrderSpecs_1 = allOrderSpecs; _a < allOrderSpecs_1.length; _a++) {
+ var orderSpec = allOrderSpecs_1[_a];
+ var isGroup = false;
+ for (var _b = 0, groupSpecs_1 = groupSpecs; _b < groupSpecs_1.length; _b++) {
+ var groupSpec = groupSpecs_1[_b];
+ if (groupSpec.field === orderSpec.field) {
+ groupSpec.order = orderSpec.order; // -1, 0, 1
+ isGroup = true;
+ break;
+ }
+ }
+ if (!isGroup) {
+ plainOrderSpecs.push(orderSpec);
+ }
+ }
+ return {
+ superHeaderRendering: superHeaderRendering,
+ isVGrouping: isVGrouping,
+ groupSpecs: groupSpecs,
+ colSpecs: groupColSpecs.concat(plainColSpecs),
+ orderSpecs: plainOrderSpecs,
+ };
+ }
+
+ var resourceTimelinePlugin = createPlugin({
+ deps: [
+ premiumCommonPlugin,
+ resourceCommonPlugin,
+ timelinePlugin,
+ ],
+ initialView: 'resourceTimelineDay',
+ views: {
+ resourceTimeline: {
+ type: 'timeline',
+ component: ResourceTimelineView,
+ needsResourceData: true,
+ resourceAreaWidth: '30%',
+ resourcesInitiallyExpanded: true,
+ eventResizableFromStart: true, // TODO: not DRY with this same setting in the main timeline config
+ },
+ resourceTimelineDay: {
+ type: 'resourceTimeline',
+ duration: { days: 1 },
+ },
+ resourceTimelineWeek: {
+ type: 'resourceTimeline',
+ duration: { weeks: 1 },
+ },
+ resourceTimelineMonth: {
+ type: 'resourceTimeline',
+ duration: { months: 1 },
+ },
+ resourceTimelineYear: {
+ type: 'resourceTimeline',
+ duration: { years: 1 },
+ },
+ },
+ });
+
+ globalPlugins.push(interactionPlugin, dayGridPlugin, timeGridPlugin, listPlugin, plugin, googleCalendarPlugin, scrollGridPlugin, adaptivePlugin, timelinePlugin, resourceCommonPlugin, resourceDayGridPlugin, resourceTimeGridPlugin, resourceTimelinePlugin);
+
+ exports.AbstractResourceDayTableModel = AbstractResourceDayTableModel;
+ exports.BASE_OPTION_DEFAULTS = BASE_OPTION_DEFAULTS;
+ exports.BASE_OPTION_REFINERS = BASE_OPTION_REFINERS;
+ exports.BaseComponent = BaseComponent;
+ exports.BgEvent = BgEvent;
+ exports.BootstrapTheme = BootstrapTheme;
+ exports.Calendar = Calendar;
+ exports.CalendarApi = CalendarApi;
+ exports.CalendarContent = CalendarContent;
+ exports.CalendarDataManager = CalendarDataManager;
+ exports.CalendarDataProvider = CalendarDataProvider;
+ exports.CalendarRoot = CalendarRoot;
+ exports.Component = Component;
+ exports.ContentHook = ContentHook;
+ exports.CustomContentRenderContext = CustomContentRenderContext;
+ exports.DEFAULT_RESOURCE_ORDER = DEFAULT_RESOURCE_ORDER;
+ exports.DateComponent = DateComponent;
+ exports.DateEnv = DateEnv;
+ exports.DateProfileGenerator = DateProfileGenerator;
+ exports.DayCellContent = DayCellContent;
+ exports.DayCellRoot = DayCellRoot;
+ exports.DayGridView = DayTableView;
+ exports.DayHeader = DayHeader;
+ exports.DayResourceTableModel = DayResourceTableModel;
+ exports.DaySeriesModel = DaySeriesModel;
+ exports.DayTable = DayTable;
+ exports.DayTableModel = DayTableModel;
+ exports.DayTableSlicer = DayTableSlicer;
+ exports.DayTimeCols = DayTimeCols;
+ exports.DayTimeColsSlicer = DayTimeColsSlicer;
+ exports.DayTimeColsView = DayTimeColsView;
+ exports.DelayedRunner = DelayedRunner;
+ exports.Draggable = ExternalDraggable;
+ exports.ElementDragging = ElementDragging;
+ exports.ElementScrollController = ElementScrollController;
+ exports.Emitter = Emitter;
+ exports.EventApi = EventApi;
+ exports.EventRoot = EventRoot;
+ exports.EventSourceApi = EventSourceApi;
+ exports.FeaturefulElementDragging = FeaturefulElementDragging;
+ exports.Fragment = Fragment;
+ exports.Interaction = Interaction;
+ exports.ListView = ListView;
+ exports.MoreLinkRoot = MoreLinkRoot;
+ exports.MountHook = MountHook;
+ exports.NamedTimeZoneImpl = NamedTimeZoneImpl;
+ exports.NowIndicatorRoot = NowIndicatorRoot;
+ exports.NowTimer = NowTimer;
+ exports.PointerDragging = PointerDragging;
+ exports.PositionCache = PositionCache;
+ exports.RefMap = RefMap;
+ exports.RenderHook = RenderHook;
+ exports.ResourceApi = ResourceApi;
+ exports.ResourceDayHeader = ResourceDayHeader;
+ exports.ResourceDayTable = ResourceDayTable;
+ exports.ResourceDayTableModel = ResourceDayTableModel;
+ exports.ResourceDayTableView = ResourceDayTableView;
+ exports.ResourceDayTimeCols = ResourceDayTimeCols;
+ exports.ResourceDayTimeColsView = ResourceDayTimeColsView;
+ exports.ResourceLabelRoot = ResourceLabelRoot;
+ exports.ResourceSplitter = ResourceSplitter;
+ exports.ResourceTimelineLane = ResourceTimelineLane;
+ exports.ResourceTimelineView = ResourceTimelineView;
+ exports.ScrollController = ScrollController;
+ exports.ScrollGrid = ScrollGrid;
+ exports.ScrollResponder = ScrollResponder;
+ exports.Scroller = Scroller;
+ exports.SegHierarchy = SegHierarchy;
+ exports.SimpleScrollGrid = SimpleScrollGrid;
+ exports.Slicer = Slicer;
+ exports.Splitter = Splitter;
+ exports.SpreadsheetRow = SpreadsheetRow;
+ exports.StandardEvent = StandardEvent;
+ exports.Table = Table;
+ exports.TableDateCell = TableDateCell;
+ exports.TableDowCell = TableDowCell;
+ exports.TableView = TableView;
+ exports.Theme = Theme;
+ exports.ThirdPartyDraggable = ThirdPartyDraggable;
+ exports.TimeCols = TimeCols;
+ exports.TimeColsSlatsCoords = TimeColsSlatsCoords;
+ exports.TimeColsView = TimeColsView;
+ exports.TimelineCoords = TimelineCoords;
+ exports.TimelineHeader = TimelineHeader;
+ exports.TimelineHeaderRows = TimelineHeaderRows;
+ exports.TimelineLane = TimelineLane;
+ exports.TimelineLaneBg = TimelineLaneBg;
+ exports.TimelineLaneSlicer = TimelineLaneSlicer;
+ exports.TimelineSlats = TimelineSlats;
+ exports.TimelineView = TimelineView;
+ exports.VResourceJoiner = VResourceJoiner;
+ exports.VResourceSplitter = VResourceSplitter;
+ exports.ViewApi = ViewApi;
+ exports.ViewContextType = ViewContextType;
+ exports.ViewRoot = ViewRoot;
+ exports.WeekNumberRoot = WeekNumberRoot;
+ exports.WindowScrollController = WindowScrollController;
+ exports.addDays = addDays;
+ exports.addDurations = addDurations;
+ exports.addMs = addMs;
+ exports.addWeeks = addWeeks;
+ exports.allowContextMenu = allowContextMenu;
+ exports.allowSelection = allowSelection;
+ exports.applyMutationToEventStore = applyMutationToEventStore;
+ exports.applyStyle = applyStyle;
+ exports.applyStyleProp = applyStyleProp;
+ exports.asCleanDays = asCleanDays;
+ exports.asRoughMinutes = asRoughMinutes;
+ exports.asRoughMs = asRoughMs;
+ exports.asRoughSeconds = asRoughSeconds;
+ exports.binarySearch = binarySearch;
+ exports.buildClassNameNormalizer = buildClassNameNormalizer;
+ exports.buildDayRanges = buildDayRanges;
+ exports.buildDayTableModel = buildDayTableModel;
+ exports.buildEntryKey = buildEntryKey;
+ exports.buildEventApis = buildEventApis;
+ exports.buildEventRangeKey = buildEventRangeKey;
+ exports.buildHashFromArray = buildHashFromArray;
+ exports.buildIsoString = buildIsoString;
+ exports.buildNavLinkData = buildNavLinkData;
+ exports.buildResourceFields = buildResourceFields;
+ exports.buildRowNodes = buildRowNodes;
+ exports.buildSegCompareObj = buildSegCompareObj;
+ exports.buildSegTimeText = buildSegTimeText;
+ exports.buildSlatCols = buildSlatCols;
+ exports.buildSlatMetas = buildSlatMetas;
+ exports.buildTimeColsModel = buildTimeColsModel;
+ exports.buildTimelineDateProfile = buildTimelineDateProfile;
+ exports.collectFromHash = collectFromHash;
+ exports.combineEventUis = combineEventUis;
+ exports.compareByFieldSpec = compareByFieldSpec;
+ exports.compareByFieldSpecs = compareByFieldSpecs;
+ exports.compareNumbers = compareNumbers;
+ exports.compareObjs = compareObjs;
+ exports.computeEarliestSegStart = computeEarliestSegStart;
+ exports.computeEdges = computeEdges;
+ exports.computeFallbackHeaderFormat = computeFallbackHeaderFormat;
+ exports.computeHeightAndMargins = computeHeightAndMargins;
+ exports.computeInnerRect = computeInnerRect;
+ exports.computeRect = computeRect;
+ exports.computeSegDraggable = computeSegDraggable;
+ exports.computeSegEndResizable = computeSegEndResizable;
+ exports.computeSegStartResizable = computeSegStartResizable;
+ exports.computeShrinkWidth = computeShrinkWidth;
+ exports.computeSmallestCellWidth = computeSmallestCellWidth;
+ exports.computeVisibleDayRange = computeVisibleDayRange;
+ exports.config = config;
+ exports.constrainPoint = constrainPoint;
+ exports.coordToCss = coordToCss;
+ exports.coordsToCss = coordsToCss;
+ exports.createContext = createContext;
+ exports.createDuration = createDuration;
+ exports.createElement = createElement;
+ exports.createEmptyEventStore = createEmptyEventStore;
+ exports.createEventInstance = createEventInstance;
+ exports.createEventUi = createEventUi;
+ exports.createFormatter = createFormatter;
+ exports.createPlugin = createPlugin;
+ exports.createPortal = createPortal;
+ exports.createRef = createRef;
+ exports.diffDates = diffDates;
+ exports.diffDayAndTime = diffDayAndTime;
+ exports.diffDays = diffDays;
+ exports.diffPoints = diffPoints;
+ exports.diffWeeks = diffWeeks;
+ exports.diffWholeDays = diffWholeDays;
+ exports.diffWholeWeeks = diffWholeWeeks;
+ exports.disableCursor = disableCursor;
+ exports.elementClosest = elementClosest;
+ exports.elementMatches = elementMatches;
+ exports.enableCursor = enableCursor;
+ exports.eventTupleToStore = eventTupleToStore;
+ exports.filterEventStoreDefs = filterEventStoreDefs;
+ exports.filterHash = filterHash;
+ exports.findDirectChildren = findDirectChildren;
+ exports.findElements = findElements;
+ exports.flattenResources = flattenResources;
+ exports.flexibleCompare = flexibleCompare;
+ exports.flushToDom = flushToDom;
+ exports.formatDate = formatDate;
+ exports.formatDayString = formatDayString;
+ exports.formatIsoTimeString = formatIsoTimeString;
+ exports.formatRange = formatRange;
+ exports.getAllowYScrolling = getAllowYScrolling;
+ exports.getCanVGrowWithinCell = getCanVGrowWithinCell;
+ exports.getClippingParents = getClippingParents;
+ exports.getDateMeta = getDateMeta;
+ exports.getDayClassNames = getDayClassNames;
+ exports.getDefaultEventEnd = getDefaultEventEnd;
+ exports.getElSeg = getElSeg;
+ exports.getEntrySpanEnd = getEntrySpanEnd;
+ exports.getEventClassNames = getEventClassNames;
+ exports.getIsRtlScrollbarOnLeft = getIsRtlScrollbarOnLeft;
+ exports.getPublicId = getPublicId;
+ exports.getRectCenter = getRectCenter;
+ exports.getRelevantEvents = getRelevantEvents;
+ exports.getScrollGridClassNames = getScrollGridClassNames;
+ exports.getScrollbarWidths = getScrollbarWidths;
+ exports.getSectionClassNames = getSectionClassNames;
+ exports.getSectionHasLiquidHeight = getSectionHasLiquidHeight;
+ exports.getSegMeta = getSegMeta;
+ exports.getSlotClassNames = getSlotClassNames;
+ exports.getStickyFooterScrollbar = getStickyFooterScrollbar;
+ exports.getStickyHeaderDates = getStickyHeaderDates;
+ exports.getUnequalProps = getUnequalProps;
+ exports.globalLocales = globalLocales;
+ exports.globalPlugins = globalPlugins;
+ exports.greatestDurationDenominator = greatestDurationDenominator;
+ exports.groupIntersectingEntries = groupIntersectingEntries;
+ exports.guid = guid;
+ exports.hasBgRendering = hasBgRendering;
+ exports.hasShrinkWidth = hasShrinkWidth;
+ exports.identity = identity;
+ exports.interactionSettingsStore = interactionSettingsStore;
+ exports.interactionSettingsToStore = interactionSettingsToStore;
+ exports.intersectRanges = intersectRanges;
+ exports.intersectRects = intersectRects;
+ exports.intersectSpans = intersectSpans;
+ exports.isArraysEqual = isArraysEqual;
+ exports.isColPropsEqual = isColPropsEqual;
+ exports.isDateSelectionValid = isDateSelectionValid;
+ exports.isDateSpansEqual = isDateSpansEqual;
+ exports.isGroupsEqual = isGroupsEqual;
+ exports.isInt = isInt;
+ exports.isInteractionValid = isInteractionValid;
+ exports.isMultiDayRange = isMultiDayRange;
+ exports.isPropsEqual = isPropsEqual;
+ exports.isPropsValid = isPropsValid;
+ exports.isValidDate = isValidDate$1;
+ exports.joinSpans = joinSpans;
+ exports.listenBySelector = listenBySelector;
+ exports.mapHash = mapHash;
+ exports.memoize = memoize;
+ exports.memoizeArraylike = memoizeArraylike;
+ exports.memoizeHashlike = memoizeHashlike;
+ exports.memoizeObjArg = memoizeObjArg;
+ exports.mergeEventStores = mergeEventStores;
+ exports.multiplyDuration = multiplyDuration;
+ exports.padStart = padStart;
+ exports.parseBusinessHours = parseBusinessHours;
+ exports.parseClassNames = parseClassNames;
+ exports.parseDragMeta = parseDragMeta;
+ exports.parseEventDef = parseEventDef;
+ exports.parseFieldSpecs = parseFieldSpecs;
+ exports.parseMarker = parse;
+ exports.pointInsideRect = pointInsideRect;
+ exports.preventContextMenu = preventContextMenu;
+ exports.preventDefault = preventDefault;
+ exports.preventSelection = preventSelection;
+ exports.rangeContainsMarker = rangeContainsMarker;
+ exports.rangeContainsRange = rangeContainsRange;
+ exports.rangesEqual = rangesEqual;
+ exports.rangesIntersect = rangesIntersect;
+ exports.refineEventDef = refineEventDef;
+ exports.refineProps = refineProps;
+ exports.removeElement = removeElement;
+ exports.removeExact = removeExact;
+ exports.render = render;
+ exports.renderChunkContent = renderChunkContent;
+ exports.renderFill = renderFill;
+ exports.renderMicroColGroup = renderMicroColGroup;
+ exports.renderScrollShim = renderScrollShim;
+ exports.requestJson = requestJson;
+ exports.sanitizeShrinkWidth = sanitizeShrinkWidth;
+ exports.setElSeg = setElSeg;
+ exports.setRef = setRef;
+ exports.setScrollFromLeftEdge = setScrollFromLeftEdge;
+ exports.sliceEventStore = sliceEventStore;
+ exports.sliceEvents = sliceEvents;
+ exports.sortEventSegs = sortEventSegs;
+ exports.startOfDay = startOfDay;
+ exports.translateRect = translateRect;
+ exports.triggerDateSelect = triggerDateSelect;
+ exports.unmountComponentAtNode = unmountComponentAtNode;
+ exports.unpromisify = unpromisify;
+ exports.version = version;
+ exports.whenTransitionDone = whenTransitionDone;
+ exports.wholeDivideDurations = wholeDivideDurations;
+
+ Object.defineProperty(exports, '__esModule', { value: true });
+
+ return exports;
+
+}({}));
diff --git a/app/assets/javascripts/property_hire_fullcalendar.min.js b/app/assets/javascripts/property_hire_fullcalendar.min.js
index c3e0834..a85e2e0 100644
--- a/app/assets/javascripts/property_hire_fullcalendar.min.js
+++ b/app/assets/javascripts/property_hire_fullcalendar.min.js
@@ -1,7 +1,19 @@
/*!
- * FullCalendar v1.6.1
- * Docs & License: http://arshaw.com/fullcalendar/
- * (c) 2013 Adam Shaw
- */
-(function(t,e){function n(e){t.extend(!0,ye,e)}function r(n,r,l){function u(t){G?(S(),C(),R(),b(t)):f()}function f(){K=r.theme?"ui":"fc",n.addClass("fc"),r.isRTL?n.addClass("fc-rtl"):n.addClass("fc-ltr"),r.theme&&n.addClass("ui-widget"),G=t("
").prependTo(n),$=new a(Z,r),Q=$.render(),Q&&n.prepend(Q),y(r.defaultView),t(window).resize(x),m()||v()}function v(){setTimeout(function(){!te.start&&m()&&b()},0)}function h(){t(window).unbind("resize",x),$.destroy(),G.remove(),n.removeClass("fc fc-rtl ui-widget")}function g(){return 0!==se.offsetWidth}function m(){return 0!==t("body")[0].offsetWidth}function y(e){if(!te||e!=te.name){ue++,W();var n,r=te;r?((r.beforeHide||I)(),q(G,G.height()),r.element.hide()):q(G,1),G.css("overflow","hidden"),te=ce[e],te?te.element.show():te=ce[e]=new De[e](n=re=t("
").appendTo(G),Z),r&&$.deactivateButton(r.name),$.activateButton(e),b(),G.css("overflow",""),r&&q(G,1),n||(te.afterShow||I)(),ue--}}function b(t){if(g()){ue++,W(),ne===e&&S();var r=!1;!te.start||t||te.start>fe||fe>=te.end?(te.render(fe,t||0),E(!0),r=!0):te.sizeDirty?(te.clearEvents(),E(),r=!0):te.eventsDirty&&(te.clearEvents(),r=!0),te.sizeDirty=!1,te.eventsDirty=!1,T(r),ee=n.outerWidth(),$.updateTitle(te.title);var a=new Date;a>=te.start&&te.end>a?$.disableButton("today"):$.enableButton("today"),ue--,te.trigger("viewDisplay",se)}}function M(){C(),g()&&(S(),E(),W(),te.clearEvents(),te.renderEvents(de),te.sizeDirty=!1)}function C(){t.each(ce,function(t,e){e.sizeDirty=!0})}function S(){ne=r.contentHeight?r.contentHeight:r.height?r.height-(Q?Q.height():0)-L(G):Math.round(G.width()/Math.max(r.aspectRatio,.5))}function E(t){ue++,te.setHeight(ne,t),re&&(re.css("position","relative"),re=null),te.setWidth(G.width(),t),ue--}function x(){if(!ue)if(te.start){var t=++le;setTimeout(function(){t==le&&!ue&&g()&&ee!=(ee=n.outerWidth())&&(ue++,M(),te.trigger("windowResize",se),ue--)},200)}else v()}function T(t){!r.lazyFetching||oe(te.visStart,te.visEnd)?k():t&&F()}function k(){ie(te.visStart,te.visEnd)}function H(t){de=t,F()}function z(t){F(t)}function F(t){R(),g()&&(te.clearEvents(),te.renderEvents(de,t),te.eventsDirty=!1)}function R(){t.each(ce,function(t,e){e.eventsDirty=!0})}function N(t,n,r){te.select(t,n,r===e?!0:r)}function W(){te&&te.unselect()}function A(){b(-1)}function _(){b(1)}function O(){i(fe,-1),b()}function B(){i(fe,1),b()}function Y(){fe=new Date,b()}function j(t,e,n){t instanceof Date?fe=d(t):p(fe,t,e,n),b()}function P(t,n,r){t!==e&&i(fe,t),n!==e&&s(fe,n),r!==e&&c(fe,r),b()}function J(){return d(fe)}function V(){return te}function X(t,n){return n===e?r[t]:(("height"==t||"contentHeight"==t||"aspectRatio"==t)&&(r[t]=n,M()),e)}function U(t,n){return r[t]?r[t].apply(n||se,Array.prototype.slice.call(arguments,2)):e}var Z=this;Z.options=r,Z.render=u,Z.destroy=h,Z.refetchEvents=k,Z.reportEvents=H,Z.reportEventChange=z,Z.rerenderEvents=F,Z.changeView=y,Z.select=N,Z.unselect=W,Z.prev=A,Z.next=_,Z.prevYear=O,Z.nextYear=B,Z.today=Y,Z.gotoDate=j,Z.incrementDate=P,Z.formatDate=function(t,e){return w(t,e,r)},Z.formatDates=function(t,e,n){return D(t,e,n,r)},Z.getDate=J,Z.getView=V,Z.option=X,Z.trigger=U,o.call(Z,r,l);var $,Q,G,K,te,ee,ne,re,ae,oe=Z.isFetchNeeded,ie=Z.fetchEvents,se=n[0],ce={},le=0,ue=0,fe=new Date,de=[];p(fe,r.year,r.month,r.date),r.droppable&&t(document).bind("dragstart",function(e,n){var a=e.target,o=t(a);if(!o.parents(".fc").length){var i=r.dropAccept;(t.isFunction(i)?i.call(a,o):o.is(i))&&(ae=a,te.dragStart(ae,e,n))}}).bind("dragstop",function(t,e){ae&&(te.dragStop(ae,t,e),ae=null)})}function a(n,r){function a(){v=r.theme?"ui":"fc";var n=r.header;return n?h=t("").append(t(" "+(c?" ").click(function(){u.hasClass(v+"-state-disabled")||s()}).mousedown(function(){u.not("."+v+"-state-active").not("."+v+"-state-disabled").addClass(v+"-state-down")}).mouseup(function(){u.removeClass(v+"-state-down")}).hover(function(){u.not("."+v+"-state-active").not("."+v+"-state-disabled").addClass(v+"-state-hover")},function(){u.removeClass(v+"-state-hover").removeClass(v+"-state-down")}).appendTo(a);U(u),o||u.addClass(v+"-corner-left"),o=u}}}),o&&o.addClass(v+"-corner-right")}),a}function s(t){h.find("h2").html(t)}function c(t){h.find("span.fc-button-"+t).addClass(v+"-state-active")}function l(t){h.find("span.fc-button-"+t).removeClass(v+"-state-active")}function u(t){h.find("span.fc-button-"+t).addClass(v+"-state-disabled")}function f(t){h.find("span.fc-button-"+t).removeClass(v+"-state-disabled")}var d=this;d.render=a,d.destroy=o,d.updateTitle=s,d.activateButton=c,d.deactivateButton=l,d.disableButton=u,d.enableButton=f;var v,h=t([])}function o(n,r){function a(t,e){return!S||S>t||e>E}function o(t,e){S=t,E=e,W=[];var n=++F,r=z.length;R=r;for(var a=0;r>a;a++)i(z[a],n)}function i(e,r){s(e,function(a){if(r==F){if(a){n.eventDataTransform&&(a=t.map(a,n.eventDataTransform)),e.eventDataTransform&&(a=t.map(a,e.eventDataTransform));for(var o=0;a.length>o;o++)a[o].source=e,b(a[o]);W=W.concat(a)}R--,R||k(W)}})}function s(r,a){var o,i,c=we.sourceFetchers;for(o=0;c.length>o;o++){if(i=c[o](r,S,E,a),i===!0)return;if("object"==typeof i)return s(i,a),e}var l=r.events;if(l)t.isFunction(l)?(p(),l(d(S),d(E),function(t){a(t),y()})):t.isArray(l)?a(l):a();else{var u=r.url;if(u){var f=r.success,v=r.error,h=r.complete,g=t.extend({},r.data||{}),m=K(r.startParam,n.startParam),b=K(r.endParam,n.endParam);m&&(g[m]=Math.round(+S/1e3)),b&&(g[b]=Math.round(+E/1e3)),p(),t.ajax(t.extend({},Me,r,{data:g,success:function(e){e=e||[];var n=G(f,this,arguments);t.isArray(n)&&(e=n),a(e)},error:function(){G(v,this,arguments),a()},complete:function(){G(h,this,arguments),y()}}))}else a()}}function c(t){t=l(t),t&&(R++,i(t,F))}function l(n){return t.isFunction(n)||t.isArray(n)?n={events:n}:"string"==typeof n&&(n={url:n}),"object"==typeof n?(w(n),z.push(n),n):e}function u(e){z=t.grep(z,function(t){return!D(t,e)}),W=t.grep(W,function(t){return!D(t.source,e)}),k(W)}function f(t){var e,n,r=W.length,a=T().defaultEventEnd,o=t.start-t._start,i=t.end?t.end-(t._end||a(t)):0;for(e=0;r>e;e++)n=W[e],n._id==t._id&&n!=t&&(n.start=new Date(+n.start+o),n.end=t.end?n.end?new Date(+n.end+i):new Date(+a(n)+i):null,n.title=t.title,n.url=t.url,n.allDay=t.allDay,n.className=t.className,n.editable=t.editable,n.color=t.color,n.backgroudColor=t.backgroudColor,n.borderColor=t.borderColor,n.textColor=t.textColor,b(n));b(t),k(W)}function v(t,e){b(t),t.source||(e&&(H.events.push(t),t.source=H),W.push(t)),k(W)}function h(e){if(e){if(!t.isFunction(e)){var n=e+"";e=function(t){return t._id==n}}W=t.grep(W,e,!0);for(var r=0;z.length>r;r++)t.isArray(z[r].events)&&(z[r].events=t.grep(z[r].events,e,!0))}else{W=[];for(var r=0;z.length>r;r++)t.isArray(z[r].events)&&(z[r].events=[])}k(W)}function g(e){return t.isFunction(e)?t.grep(W,e):e?(e+="",t.grep(W,function(t){return t._id==e})):W}function p(){N++||x("loading",null,!0)}function y(){--N||x("loading",null,!1)}function b(t){var r=t.source||{},a=K(r.ignoreTimezone,n.ignoreTimezone);t._id=t._id||(t.id===e?"_fc"+Ce++:t.id+""),t.date&&(t.start||(t.start=t.date),delete t.date),t._start=d(t.start=m(t.start,a)),t.end=m(t.end,a),t.end&&t.end<=t.start&&(t.end=null),t._end=t.end?d(t.end):null,t.allDay===e&&(t.allDay=K(r.allDayDefault,n.allDayDefault)),t.className?"string"==typeof t.className&&(t.className=t.className.split(/\s+/)):t.className=[]}function w(t){t.className?"string"==typeof t.className&&(t.className=t.className.split(/\s+/)):t.className=[];for(var e=we.sourceNormalizers,n=0;e.length>n;n++)e[n](t)}function D(t,e){return t&&e&&M(t)==M(e)}function M(t){return("object"==typeof t?t.events||t.url:"")||t}var C=this;C.isFetchNeeded=a,C.fetchEvents=o,C.addEventSource=c,C.removeEventSource=u,C.updateEvent=f,C.renderEvent=v,C.removeEvents=h,C.clientEvents=g,C.normalizeEvent=b;for(var S,E,x=C.trigger,T=C.getView,k=C.reportEvents,H={events:[]},z=[H],F=0,R=0,N=0,W=[],A=0;r.length>A;A++)l(r[A])}function i(t,e,n){return t.setFullYear(t.getFullYear()+e),n||f(t),t}function s(t,e,n){if(+t){var r=t.getMonth()+e,a=d(t);for(a.setDate(1),a.setMonth(r),t.setMonth(r),n||f(t);t.getMonth()!=a.getMonth();)t.setDate(t.getDate()+(a>t?1:-1))}return t}function c(t,e,n){if(+t){var r=t.getDate()+e,a=d(t);a.setHours(9),a.setDate(r),t.setDate(r),n||f(t),l(t,a)}return t}function l(t,e){if(+t)for(;t.getDate()!=e.getDate();)t.setTime(+t+(e>t?1:-1)*xe)}function u(t,e){return t.setMinutes(t.getMinutes()+e),t}function f(t){return t.setHours(0),t.setMinutes(0),t.setSeconds(0),t.setMilliseconds(0),t}function d(t,e){return e?f(new Date(+t)):new Date(+t)}function v(){var t,e=0;do t=new Date(1970,e++,1);while(t.getHours());return t}function h(t,e,n){for(e=e||1;!t.getDay()||n&&1==t.getDay()||!n&&6==t.getDay();)c(t,e);return t}function g(t,e){return Math.round((d(t,!0)-d(e,!0))/Ee)}function p(t,n,r,a){n!==e&&n!=t.getFullYear()&&(t.setDate(1),t.setMonth(0),t.setFullYear(n)),r!==e&&r!=t.getMonth()&&(t.setDate(1),t.setMonth(r)),a!==e&&t.setDate(a)}function m(t,n){return"object"==typeof t?t:"number"==typeof t?new Date(1e3*t):"string"==typeof t?t.match(/^\d+(\.\d+)?$/)?new Date(1e3*parseFloat(t)):(n===e&&(n=!0),y(t,n)||(t?new Date(t):null)):null}function y(t,e){var n=t.match(/^([0-9]{4})(-([0-9]{2})(-([0-9]{2})([T ]([0-9]{2}):([0-9]{2})(:([0-9]{2})(\.([0-9]+))?)?(Z|(([-+])([0-9]{2})(:?([0-9]{2}))?))?)?)?)?$/);if(!n)return null;var r=new Date(n[1],0,1);if(e||!n[13]){var a=new Date(n[1],0,1,9,0);n[3]&&(r.setMonth(n[3]-1),a.setMonth(n[3]-1)),n[5]&&(r.setDate(n[5]),a.setDate(n[5])),l(r,a),n[7]&&r.setHours(n[7]),n[8]&&r.setMinutes(n[8]),n[10]&&r.setSeconds(n[10]),n[12]&&r.setMilliseconds(1e3*Number("0."+n[12])),l(r,a)}else if(r.setUTCFullYear(n[1],n[3]?n[3]-1:0,n[5]||1),r.setUTCHours(n[7]||0,n[8]||0,n[10]||0,n[12]?1e3*Number("0."+n[12]):0),n[14]){var o=60*Number(n[16])+(n[18]?Number(n[18]):0);o*="-"==n[15]?1:-1,r=new Date(+r+1e3*60*o)}return r}function b(t){if("number"==typeof t)return 60*t;if("object"==typeof t)return 60*t.getHours()+t.getMinutes();var e=t.match(/(\d+)(?::(\d+))?\s*(\w+)?/);if(e){var n=parseInt(e[1],10);return e[3]&&(n%=12,"p"==e[3].toLowerCase().charAt(0)&&(n+=12)),60*n+(e[2]?parseInt(e[2],10):0)}}function w(t,e,n){return D(t,null,e,n)}function D(t,e,n,r){r=r||ye;var a,o,i,s,c=t,l=e,u=n.length,f="";for(a=0;u>a;a++)if(o=n.charAt(a),"'"==o){for(i=a+1;u>i;i++)if("'"==n.charAt(i)){c&&(f+=i==a+1?"'":n.substring(a+1,i),a=i);break}}else if("("==o){for(i=a+1;u>i;i++)if(")"==n.charAt(i)){var d=w(c,n.substring(a+1,i),r);parseInt(d.replace(/\D/,""),10)&&(f+=d),a=i;break}}else if("["==o){for(i=a+1;u>i;i++)if("]"==n.charAt(i)){var v=n.substring(a+1,i),d=w(c,v,r);d!=w(l,v,r)&&(f+=d),a=i;break}}else if("{"==o)c=e,l=t;else if("}"==o)c=t,l=e;else{for(i=u;i>a;i--)if(s=ke[n.substring(a,i)]){c&&(f+=s(c,r)),a=i-1;break}i==a&&c&&(f+=o)}return f}function M(t){var e,n=new Date(t.getTime());return n.setDate(n.getDate()+4-(n.getDay()||7)),e=n.getTime(),n.setMonth(0),n.setDate(1),Math.floor(Math.round((e-n)/864e5)/7)+1}function C(t){return t.end?S(t.end,t.allDay):c(d(t.start),1)}function S(t,e){return t=d(t),e||t.getHours()||t.getMinutes()?c(t,1):f(t)}function E(t,e){return 100*(e.msLength-t.msLength)+(t.event.start-e.event.start)}function x(t,e){return t.end>e.start&&t.starta;a++)o=t[a],i=o.start,s=e[a],s>n&&r>i&&(n>i?(c=d(n),u=!1):(c=i,u=!0),s>r?(l=d(r),f=!1):(l=s,f=!0),v.push({event:o,start:c,end:l,isStart:u,isEnd:f,msLength:l-c}));return v.sort(E)}function k(t){var e,n,r,a,o,i=[],s=t.length;for(e=0;s>e;e++){for(n=t[e],r=0;;){if(a=!1,i[r])for(o=0;i[r].length>o;o++)if(x(i[r][o],n)){a=!0;break}if(!a)break;r++}i[r]?i[r].push(n):i[r]=[n]}return i}function H(n,r,a){n.unbind("mouseover").mouseover(function(n){for(var o,i,s,c=n.target;c!=this;)o=c,c=c.parentNode;(i=o._fci)!==e&&(o._fci=e,s=r[i],a(s.event,s.element,s),t(n.target).trigger(n)),n.stopPropagation()})}function z(e,n,r){for(var a,o=0;e.length>o;o++)a=t(e[o]),a.width(Math.max(0,n-R(a,r)))}function F(e,n,r){for(var a,o=0;e.length>o;o++)a=t(e[o]),a.height(Math.max(0,n-L(a,r)))}function R(t,e){return N(t)+A(t)+(e?W(t):0)}function N(e){return(parseFloat(t.css(e[0],"paddingLeft",!0))||0)+(parseFloat(t.css(e[0],"paddingRight",!0))||0)}function W(e){return(parseFloat(t.css(e[0],"marginLeft",!0))||0)+(parseFloat(t.css(e[0],"marginRight",!0))||0)}function A(e){return(parseFloat(t.css(e[0],"borderLeftWidth",!0))||0)+(parseFloat(t.css(e[0],"borderRightWidth",!0))||0)}function L(t,e){return _(t)+B(t)+(e?O(t):0)}function _(e){return(parseFloat(t.css(e[0],"paddingTop",!0))||0)+(parseFloat(t.css(e[0],"paddingBottom",!0))||0)}function O(e){return(parseFloat(t.css(e[0],"marginTop",!0))||0)+(parseFloat(t.css(e[0],"marginBottom",!0))||0)}function B(e){return(parseFloat(t.css(e[0],"borderTopWidth",!0))||0)+(parseFloat(t.css(e[0],"borderBottomWidth",!0))||0)}function q(t,e){e="number"==typeof e?e+"px":e,t.each(function(t,n){n.style.cssText+=";min-height:"+e+";_height:"+e})}function I(){}function Y(t,e){return t-e}function j(t){return Math.max.apply(Math,t)}function P(t){return(10>t?"0":"")+t}function J(t,n){if(t[n]!==e)return t[n];for(var r,a=n.split(/(?=[A-Z])/),o=a.length-1;o>=0;o--)if(r=t[a[o].toLowerCase()],r!==e)return r;return t[""]}function V(t){return t.replace(/&/g,"&").replace(//g,">").replace(/'/g,"'").replace(/"/g,""").replace(/\n/g,"
").appendTo(e)}function s(n){var r,a,o,i,s="",c=be+"-widget-header",l=be+"-widget-content",u=B.start.getMonth(),d=f(new Date);for(s+="",De&&(s+=" ",r=0;ne>r;r++){for(s+="",De&&(s+=""+"
"+" "),a=0;re>a;a++)o=F(r,a),i=["fc-day","fc-"+Se[o.getDay()],l],o.getMonth()!=u&&i.push("fc-other-month"),+o==+d&&(i.push("fc-today"),i.push(be+"-state-highlight")),s+=""+"",n&&(s+="
"+o.getDate()+"
"),s+="
";s+=" "}s+="
",_(),I&&I.remove(),I=t(s).appendTo(e),Y=I.find("thead"),j=Y.find(".fc-day-header"),P=I.find("tbody"),J=P.find("tr"),V=P.find(".fc-day"),X=J.find("td:first-child"),$=J.eq(0).find(".fc-day-content > div"),Z(Y.add(Y.find("tr"))),Z(J),J.eq(0).addClass("fc-first"),J.filter(":last").addClass("fc-last"),De&&Y.find(".fc-week-number").text(Me),j.each(function(e,n){var r=R(e);t(n).text(Fe(r,we))}),De&&P.find(".fc-week-number > div").each(function(e,n){var r=F(e,0);t(n).text(Fe(r,Ce))}),V.each(function(e,n){var r=R(e);xe("dayRender",B,r,t(n))}),v(V)}function l(e){K=e;var n,r,a,o=K-Y.height();"variable"==Ee("weekMode")?n=r=Math.floor(o/(1==ne?2:6)):(n=Math.floor(o/ne),r=o-n*(ne-1)),X.each(function(e,o){ne>e&&(a=t(o),q(a.find("> div"),(e==ne-1?r:n)-L(a)))}),O()}function u(t){G=t,se.clear(),ee=0,De&&(ee=Y.find("th.fc-week-number").outerWidth()),te=Math.floor((G-ee)/re),z(j.slice(0,-1),te)}function v(t){t.click(h).mousedown(ze)}function h(e){if(!Ee("selectable")){var n=y(t(this).data("date"));xe("dayClick",this,n,!0,e)}}function p(t,e,n){n&&oe.build();for(var r=d(B.visStart),a=c(d(r),re),o=0;ne>o;o++){var i=new Date(Math.max(r,t)),s=new Date(Math.min(a,e));if(s>i){var l,u;ce?(l=g(s,r)*le+fe+1,u=g(i,r)*le+fe+1):(l=g(i,r),u=g(s,r)),v(m(o,l,o,u-1))}c(r,7),c(a,7)}}function m(t,n,r,a){var o=oe.rect(t,n,r,a,e);return ke(o,e)}function b(t){return d(t)}function w(t,e){p(t,c(d(e),1),!0)}function D(){He()}function M(t,e,n){var r=k(t),a=V[r.row*re+r.col];xe("dayClick",a,t,e,n)}function C(t,e){ie.start(function(t){He(),t&&m(t.row,t.col,t.row,t.col)},e)}function S(t,e,n){var r=ie.stop();if(He(),r){var a=H(r);xe("drop",t,a,!0,e,n)}}function E(t){return d(t.start)}function x(t){return se.left(t)}function T(t){return se.right(t)}function k(t){return{row:Math.floor(g(t,B.visStart)/7),col:N(t.getDay())}}function H(t){return F(t.row,t.col)}function F(t,e){return c(d(B.visStart),7*t+e*le+fe)}function R(t){return F(Math.floor(t/re),t%re)}function N(t){return(t-Math.max(pe,ye)+re)%re*le+fe}function W(t){return J.eq(t)}function A(){var t=0;return De&&(t+=ee),{left:t,right:G}}function _(){q(e,e.height())}function O(){q(e,1)}var B=this;B.renderBasic=a,B.setHeight=l,B.setWidth=u,B.renderDayOverlay=p,B.defaultSelectionEnd=b,B.renderSelection=w,B.clearSelection=D,B.reportDayClick=M,B.dragStart=C,B.dragStop=S,B.defaultEventEnd=E,B.getHoverListener=function(){return ie},B.colContentLeft=x,B.colContentRight=T,B.dayOfWeekCol=N,B.dateCell=k,B.cellDate=H,B.cellIsAllDay=function(){return!0},B.allDayRow=W,B.allDayBounds=A,B.getRowCnt=function(){return ne},B.getColCnt=function(){return re},B.getColWidth=function(){return te},B.getDaySegmentContainer=function(){return Q},ue.call(B,e,n,r),ve.call(B),de.call(B),ae.call(B);var I,Y,j,P,J,V,X,$,Q,G,K,te,ee,ne,re,oe,ie,se,ce,le,fe,pe,ye,be,we,De,Me,Ce,Ee=B.opt,xe=B.trigger,Te=B.clearEvents,ke=B.renderOverlay,He=B.clearOverlays,ze=B.daySelectionMousedown,Fe=n.formatDate;U(e.addClass("fc-grid")),oe=new he(function(e,n){var r,a,o;j.each(function(e,i){r=t(i),a=r.offset().left,e&&(o[1]=a),o=[a],n[e]=o}),o[1]=a+r.outerWidth(),J.each(function(n,i){ne>n&&(r=t(i),a=r.offset().top,n&&(o[1]=a),o=[a],e[n]=o)}),o[1]=a+r.outerHeight()}),ie=new ge(oe),se=new me(function(t){return $.eq(t)})}function ae(){function e(t,e){v(t),x(r(t),e),l("eventAfterAllRender")}function n(){h(),b().empty()}function r(e){var n,r,a,o,s,l,u=S(),f=E(),v=d(i.visStart),h=c(d(v),f),g=t.map(e,C),p=[];for(n=0;u>n;n++){for(r=k(T(e,g,v,h)),a=0;r.length>a;a++)for(o=r[a],s=0;o.length>s;s++)l=o[s],l.row=n,l.level=a,p.push(l);c(v,7),c(h,7)}return p}function a(t,e,n){u(t)&&o(t,e),n.isEnd&&f(t)&&H(t,e,n),g(t,e)}function o(t,e){var n,r=w();e.draggable({zIndex:9,delay:50,opacity:s("dragOpacity"),revertDuration:s("dragRevertDuration"),start:function(a,o){l("eventDragStart",e,t,a,o),m(t,e),r.start(function(r,a,o,i){e.draggable("option","revert",!r||!o&&!i),M(),r?(n=7*o+i*(s("isRTL")?-1:1),D(c(d(t.start),n),c(C(t),n))):n=0},a,"drag")},stop:function(a,o){r.stop(),M(),l("eventDragStop",e,t,a,o),n?y(this,t,n,0,t.allDay,a,o):(e.css("filter",""),p(t,e))}})}var i=this;i.renderEvents=e,i.compileDaySegs=r,i.clearEvents=n,i.bindDaySeg=a,fe.call(i);var s=i.opt,l=i.trigger,u=i.isEventDraggable,f=i.isEventResizable,v=i.reportEvents,h=i.reportEventClear,g=i.eventElementHandlers,p=i.showEvents,m=i.hideEvents,y=i.eventDrop,b=i.getDaySegmentContainer,w=i.getHoverListener,D=i.renderDayOverlay,M=i.clearOverlays,S=i.getRowCnt,E=i.getColCnt,x=i.renderDaySegs,H=i.resizableDayEvent}function oe(t,e){function n(t,e){e&&c(t,7*e);var n=c(d(t),-((t.getDay()-a("firstDay")+7)%7)),s=c(d(n),7),l=d(n),u=d(s),f=a("weekends");f||(h(l),h(u,-1,!0)),r.title=i(l,c(d(u),-1),a("titleFormat")),r.start=n,r.end=s,r.visStart=l,r.visEnd=u,o(f?7:5)}var r=this;r.render=n,se.call(r,t,e,"agendaWeek");var a=r.opt,o=r.renderAgenda,i=e.formatDates}function ie(t,e){function n(t,e){e&&(c(t,e),a("weekends")||h(t,0>e?-1:1));var n=d(t,!0),s=c(d(n),1);r.title=i(t,a("titleFormat")),r.start=r.visStart=n,r.end=r.visEnd=s,o(1)}var r=this;r.render=n,se.call(r,t,e,"agendaDay");var a=r.opt,o=r.renderAgenda,i=e.formatDate}function se(n,r,a){function o(t){Le=t,i(),te?nn():s(),l()}function i(){Ye=tn("theme")?"ui":"fc",Pe=tn("weekends")?0:1,je=tn("firstDay"),(Je=tn("isRTL"))?(Ve=-1,Xe=Le-1):(Ve=1,Xe=0),Ue=b(tn("minTime")),Ze=b(tn("maxTime")),$e=tn("columnFormat"),Qe=tn("weekNumbers"),Ge=tn("weekNumberTitle"),Ke="iso"!=tn("weekNumberCalculation")?"w":"W",Ne=tn("snapMinutes")||tn("slotMinutes")}function s(){var e,r,a,o,i,s=Ye+"-widget-header",c=Ye+"-widget-content",l=0==tn("slotMinutes")%15;for(e="",e+=Qe?" ",r=0;Le>r;r++)e+=" "+" "+""+""+" ",r=0;Le>r;r++)e+=""+""+" ";for(e+=" "+" "+" "+"
",te=t(e).appendTo(n),ee=te.find("thead"),ne=ee.find("th").slice(1,-1),re=te.find("tbody"),ae=re.find("td").slice(0,-1),oe=ae.find("div.fc-day-content div"),ie=ae.eq(0),se=ie.find("> div"),Z(ee.add(ee.find("tr"))),Z(re.add(re.find("tr"))),Se=ee.find("th:first"),Ee=te.find(".fc-agenda-gutter"),le=t("
").appendTo(n),tn("allDaySlot")?(fe=t("
").appendTo(le),e=""+tn("allDayText")+" "+""+""+" "+" "+"
",pe=t(e).appendTo(le),ye=pe.find("tr"),D(ye.find("td")),Se=Se.add(pe.find("th:first")),Ee=Ee.add(pe.find("th.fc-agenda-gutter")),le.append("")):fe=t([]),be=t("
").appendTo(le),we=t("
").appendTo(be),De=t("
").appendTo(we),e="",a=v(),o=u(d(a),Ze),u(a,Ue),_e=0,r=0;o>a;r++)i=a.getMinutes(),e+=""+""+(l&&i?" ":un(a,tn("axisFormat")))+" "+""+"
"+" "+" ",u(a,tn("slotMinutes")),_e++;e+="
",Me=t(e).appendTo(we),Ce=Me.find("div:first"),M(Me.find("td")),Se=Se.add(Me.find("th:first"))}function l(){var t,e,n,r,a=f(new Date);if(Qe){var o=un(N(0),Ke);Je?o+=Ge:o=Ge+o,ee.find(".fc-week-number").text(o)}for(t=0;Le>t;t++)r=N(t),e=ne.eq(t),e.html(un(r,$e)),n=ae.eq(t),+r==+a?n.addClass(Ye+"-state-highlight fc-today"):n.removeClass(Ye+"-state-highlight fc-today"),$(e.add(n),r)}function h(t,n){t===e&&(t=ke),ke=t,fn={};var r=re.position().top,a=be.position().top,o=Math.min(t-r,Me.height()+a+1);se.height(o-L(ie)),le.css("top",r),be.height(o-a-1),Re=Ce.height()+1,We=tn("slotMinutes")/Ne,Ae=Re/We,n&&m()}function p(e){Te=e,qe.clear(),He=0,z(Se.width("").each(function(e,n){He=Math.max(He,t(n).outerWidth())}),He);var n=be[0].clientWidth;Fe=be.width()-n,Fe?(z(Ee,Fe),Ee.show().prev().removeClass("fc-last")):Ee.hide().prev().addClass("fc-last"),ze=Math.floor((n-He)/Le),z(ne.slice(0,-1),ze)}function m(){function t(){be.scrollTop(r)}var e=v(),n=d(e);n.setHours(tn("firstHour"));var r=_(e,n)+1;t(),setTimeout(t,0)}function y(){Ie=be.scrollTop()}function w(){be.scrollTop(Ie)}function D(t){t.click(C).mousedown(cn)}function M(t){t.click(C).mousedown(V)}function C(t){if(!tn("selectable")){var e=Math.min(Le-1,Math.floor((t.pageX-te.offset().left-He)/ze)),n=N(e),r=this.parentNode.className.match(/fc-slot(\d+)/);if(r){var a=parseInt(r[1])*tn("slotMinutes"),o=Math.floor(a/60);n.setHours(o),n.setMinutes(a%60+Ue),en("dayClick",ae[e],n,!1,t)}else en("dayClick",ae[e],n,!0,t)}}function S(t,e,n){n&&Oe.build();var r,a,o=d(K.visStart);Je?(r=g(e,o)*Ve+Xe+1,a=g(t,o)*Ve+Xe+1):(r=g(t,o),a=g(e,o)),r=Math.max(0,r),a=Math.min(Le,a),a>r&&D(E(0,r,0,a-1))}function E(t,e,n,r){var a=Oe.rect(t,e,n,r,le);return rn(a,le)}function x(t,e){for(var n=d(K.visStart),r=c(d(n),1),a=0;Le>a;a++){var o=new Date(Math.max(n,t)),i=new Date(Math.min(r,e));if(i>o){var s=a*Ve+Xe,l=Oe.rect(0,s,0,s,we),u=_(n,o),f=_(n,i);l.top=u,l.height=f-u,M(rn(l,we))}c(n,1),c(r,1)}}function T(t){return qe.left(t)}function k(t){return qe.right(t)}function H(t){return{row:Math.floor(g(t,K.visStart)/7),col:A(t.getDay())}}function R(t){var e=N(t.col),n=t.row;return tn("allDaySlot")&&n--,n>=0&&u(e,Ue+n*Ne),e}function N(t){return c(d(K.visStart),t*Ve+Xe)}function W(t){return tn("allDaySlot")&&!t.row}function A(t){return(t-Math.max(je,Pe)+Le)%Le*Ve+Xe}function _(t,n){if(t=d(t,!0),u(d(t),Ue)>n)return 0;if(n>=u(d(t),Ze))return Me.height();var r=tn("slotMinutes"),a=60*n.getHours()+n.getMinutes()-Ue,o=Math.floor(a/r),i=fn[o];return i===e&&(i=fn[o]=Me.find("tr:eq("+o+") td div")[0].offsetTop),Math.max(0,Math.round(i-1+Re*(a%r/r)))}function O(){return{left:He,right:Te-Fe}}function B(){return ye}function q(t){var e=d(t.start);return t.allDay?e:u(e,tn("defaultEventMinutes"))}function I(t,e){return e?d(t):u(d(t),tn("slotMinutes"))}function j(t,e,n){n?tn("allDaySlot")&&S(t,c(d(e),1),!0):P(t,e)}function P(e,n){var r=tn("selectHelper");if(Oe.build(),r){var a=g(e,K.visStart)*Ve+Xe;if(a>=0&&Le>a){var o=Oe.rect(0,a,0,a,we),i=_(e,e),s=_(e,n);if(s>i){if(o.top=i,o.height=s-i,o.left+=2,o.width-=5,t.isFunction(r)){var c=r(e,n);c&&(o.position="absolute",o.zIndex=8,xe=t(c).css(o).appendTo(we))}else o.isStart=!0,o.isEnd=!0,xe=t(ln({title:"",start:e,end:n,className:["fc-select-helper"],editable:!1},o)),xe.css("opacity",tn("dragOpacity"));xe&&(M(xe),we.append(xe),z(xe,o.width,!0),F(xe,o.height,!0))}}}else x(e,n)}function J(){an(),xe&&(xe.remove(),xe=null)}function V(e){if(1==e.which&&tn("selectable")){sn(e);var n;Be.start(function(t,e){if(J(),t&&t.col==e.col&&!W(t)){var r=R(e),a=R(t);n=[r,u(d(r),Ne),a,u(d(a),Ne)].sort(Y),P(n[0],n[3])}else n=null},e),t(document).one("mouseup",function(t){Be.stop(),n&&(+n[0]==+n[1]&&X(n[0],!1,t),on(n[0],n[3],!1,t))})}}function X(t,e,n){en("dayClick",ae[A(t.getDay())],t,e,n)}function Q(t,e){Be.start(function(t){if(an(),t)if(W(t))E(t.row,t.col,t.row,t.col);else{var e=R(t),n=u(d(e),tn("defaultEventMinutes"));x(e,n)}},e)}function G(t,e,n){var r=Be.stop();an(),r&&en("drop",t,R(r),W(r),e,n)}var K=this;K.renderAgenda=o,K.setWidth=p,K.setHeight=h,K.beforeHide=y,K.afterShow=w,K.defaultEventEnd=q,K.timePosition=_,K.dayOfWeekCol=A,K.dateCell=H,K.cellDate=R,K.cellIsAllDay=W,K.allDayRow=B,K.allDayBounds=O,K.getHoverListener=function(){return Be},K.colContentLeft=T,K.colContentRight=k,K.getDaySegmentContainer=function(){return fe},K.getSlotSegmentContainer=function(){return De},K.getMinMinute=function(){return Ue},K.getMaxMinute=function(){return Ze},K.getBodyContent=function(){return we},K.getRowCnt=function(){return 1},K.getColCnt=function(){return Le},K.getColWidth=function(){return ze},K.getSnapHeight=function(){return Ae},K.getSnapMinutes=function(){return Ne},K.defaultSelectionEnd=I,K.renderDayOverlay=S,K.renderSelection=j,K.clearSelection=J,K.reportDayClick=X,K.dragStart=Q,K.dragStop=G,ue.call(K,n,r,a),ve.call(K),de.call(K),ce.call(K);var te,ee,ne,re,ae,oe,ie,se,le,fe,pe,ye,be,we,De,Me,Ce,Se,Ee,xe,Te,ke,He,ze,Fe,Re,Ne,We,Ae,Le,_e,Oe,Be,qe,Ie,Ye,je,Pe,Je,Ve,Xe,Ue,Ze,$e,Qe,Ge,Ke,tn=K.opt,en=K.trigger,nn=K.clearEvents,rn=K.renderOverlay,an=K.clearOverlays,on=K.reportSelection,sn=K.unselect,cn=K.daySelectionMousedown,ln=K.slotSegHtml,un=r.formatDate,fn={};U(n.addClass("fc-agenda")),Oe=new he(function(e,n){function r(t){return Math.max(c,Math.min(l,t))}var a,o,i;ne.each(function(e,r){a=t(r),o=a.offset().left,e&&(i[1]=o),i=[o],n[e]=i}),i[1]=o+a.outerWidth(),tn("allDaySlot")&&(a=ye,o=a.offset().top,e[0]=[o,o+a.outerHeight()]);for(var s=we.offset().top,c=be.offset().top,l=c+be.outerHeight(),u=0;_e*We>u;u++)e.push([r(s+Ae*u),r(s+Ae*(u+1))])}),Be=new ge(Oe),qe=new me(function(t){return oe.eq(t)})}function ce(){function n(t,e){S(t);var n,r=t.length,i=[],c=[];for(n=0;r>n;n++)t[n].allDay?i.push(t[n]):c.push(t[n]);y("allDaySlot")&&(Y(a(i),e),z()),s(o(c),e),b("eventAfterAllRender")}function r(){E(),N().empty(),W().empty()}function a(e){var n,r,a,o,i=k(T(e,t.map(e,C),m.visStart,m.visEnd)),s=i.length,c=[];for(n=0;s>n;n++)for(r=i[n],a=0;r.length>a;a++)o=r[a],o.row=0,o.level=n,c.push(o);return c}function o(e){var n,r,a,o,s,l,f=P(),v=O(),h=_(),g=u(d(m.visStart),v),p=t.map(e,i),y=[];for(n=0;f>n;n++){for(r=k(T(e,p,g,u(d(g),h-v))),le(r),a=0;r.length>a;a++)for(o=r[a],s=0;o.length>s;s++)l=o[s],l.col=n,l.level=a,y.push(l);c(g,1,!0)}return y}function i(t){return t.end?d(t.end):u(d(t.start),y("defaultEventMinutes"))}function s(n,r){var a,o,i,s,c,u,f,d,h,g,p,m,w,D,M,C,S,E,x,T,k,z,F=n.length,N="",A={},_={},O=W(),Y=P();for((T=y("isRTL"))?(k=-1,z=Y-1):(k=1,z=0),a=0;F>a;a++)o=n[a],i=o.event,s=B(o.start,o.start),c=B(o.start,o.end),u=o.col,f=o.level,d=o.forward||0,h=q(u*k+z),g=I(u*k+z)-h,g=Math.min(g-6,.95*g),p=f?g/(f+d+1):d?2*(g/(d+1)-6):g,m=h+g/(f+d+1)*f*k+(T?g-p:0),o.top=s,o.left=m,o.outerWidth=p,o.outerHeight=c-s,N+=l(i,o);
-for(O[0].innerHTML=N,w=O.children(),a=0;F>a;a++)o=n[a],i=o.event,D=t(w[a]),M=b("eventRender",i,i,D),M===!1?D.remove():(M&&M!==!0&&(D.remove(),D=t(M).css({position:"absolute",top:o.top,left:o.left}).appendTo(O)),o.element=D,i._id===r?v(i,D,o):D[0]._fci=a,G(i,D));for(H(O,n,v),a=0;F>a;a++)o=n[a],(D=o.element)&&(S=A[C=o.key=X(D[0])],o.vsides=S===e?A[C]=L(D,!0):S,S=_[C],o.hsides=S===e?_[C]=R(D,!0):S,E=D.find(".fc-event-title"),E.length&&(o.contentTop=E[0].offsetTop));for(a=0;F>a;a++)o=n[a],(D=o.element)&&(D[0].style.width=Math.max(0,o.outerWidth-o.hsides)+"px",x=Math.max(0,o.outerHeight-o.vsides),D[0].style.height=x+"px",i=o.event,o.contentTop!==e&&10>x-o.contentTop&&(D.find("div.fc-event-time").text(ie(i.start,y("timeFormat"))+" - "+i.title),D.find("div.fc-event-title").remove()),b("eventAfterRender",i,i,D))}function l(t,e){var n="<",r=t.url,a=Q(t,y),o=["fc-event","fc-event-vert"];return w(t)&&o.push("fc-event-draggable"),e.isStart&&o.push("fc-event-start"),e.isEnd&&o.push("fc-event-end"),o=o.concat(t.className),t.source&&(o=o.concat(t.source.className||[])),n+=r?"a href='"+V(t.url)+"'":"div",n+=" class='"+o.join(" ")+"'"+" style='position:absolute;z-index:8;top:"+e.top+"px;left:"+e.left+"px;"+a+"'"+">"+""+"
"+V(se(t.start,t.end,y("timeFormat")))+"
"+"
"+V(t.title)+"
"+"
",e.isEnd&&D(t)&&(n+="=
"),n+=""}function f(t,e,n){w(t)&&h(t,e,n.isStart),n.isEnd&&D(t)&&j(t,e,n),x(t,e)}function v(t,e,n){var r=e.find("div.fc-event-time");w(t)&&g(t,e,r),n.isEnd&&D(t)&&p(t,e,r),x(t,e)}function h(t,e,n){function r(){s||(e.width(a).height("").draggable("option","grid",null),s=!0)}var a,o,i,s=!0,l=y("isRTL")?-1:1,u=A(),f=J(),v=U(),h=Z(),g=O();e.draggable({zIndex:9,opacity:y("dragOpacity","month"),revertDuration:y("dragRevertDuration"),start:function(g,p){b("eventDragStart",e,t,g,p),te(t,e),a=e.width(),u.start(function(a,u,g,p){ae(),a?(o=!1,i=p*l,a.row?n?s&&(e.width(f-10),F(e,v*Math.round((t.end?(t.end-t.start)/Te:y("defaultEventMinutes"))/h)),e.draggable("option","grid",[f,1]),s=!1):o=!0:(re(c(d(t.start),i),c(C(t),i)),r()),o=o||s&&!i):(r(),o=!0),e.draggable("option","revert",o)},g,"drag")},stop:function(n,a){if(u.stop(),ae(),b("eventDragStop",e,t,n,a),o)r(),e.css("filter",""),K(t,e);else{var c=0;s||(c=Math.round((e.offset().top-$().offset().top)/v)*h+g-(60*t.start.getHours()+t.start.getMinutes())),ee(this,t,i,c,s,n,a)}}})}function g(t,e,n){function r(e){var r,a=u(d(t.start),e);t.end&&(r=u(d(t.end),e)),n.text(se(a,r,y("timeFormat")))}function a(){f&&(n.css("display",""),e.draggable("option","grid",[p,m]),f=!1)}var o,i,s,l,f=!1,v=y("isRTL")?-1:1,h=A(),g=P(),p=J(),m=U(),w=Z();e.draggable({zIndex:9,scroll:!1,grid:[p,m],axis:1==g?"y":!1,opacity:y("dragOpacity"),revertDuration:y("dragRevertDuration"),start:function(r,u){b("eventDragStart",e,t,r,u),te(t,e),o=e.position(),s=l=0,h.start(function(r,o,s,l){e.draggable("option","revert",!r),ae(),r&&(i=l*v,y("allDaySlot")&&!r.row?(f||(f=!0,n.hide(),e.draggable("option","grid",null)),re(c(d(t.start),i),c(C(t),i))):a())},r,"drag")},drag:function(t,e){s=Math.round((e.position.top-o.top)/m)*w,s!=l&&(f||r(s),l=s)},stop:function(n,c){var l=h.stop();ae(),b("eventDragStop",e,t,n,c),l&&(i||s||f)?ee(this,t,i,f?0:s,f,n,c):(a(),e.css("filter",""),e.css(o),r(0),K(t,e))}})}function p(t,e,n){var r,a,o=U(),i=Z();e.resizable({handles:{s:".ui-resizable-handle"},grid:o,start:function(n,o){r=a=0,te(t,e),e.css("z-index",9),b("eventResizeStart",this,t,n,o)},resize:function(s,c){r=Math.round((Math.max(o,e.height())-c.originalSize.height)/o),r!=a&&(n.text(se(t.start,r||t.end?u(M(t),i*r):null,y("timeFormat"))),a=r)},stop:function(n,a){b("eventResizeStop",this,t,n,a),r?ne(this,t,0,i*r,n,a):(e.css("z-index",8),K(t,e))}})}var m=this;m.renderEvents=n,m.compileDaySegs=a,m.clearEvents=r,m.slotSegHtml=l,m.bindDaySeg=f,fe.call(m);var y=m.opt,b=m.trigger,w=m.isEventDraggable,D=m.isEventResizable,M=m.eventEnd,S=m.reportEvents,E=m.reportEventClear,x=m.eventElementHandlers,z=m.setHeight,N=m.getDaySegmentContainer,W=m.getSlotSegmentContainer,A=m.getHoverListener,_=m.getMaxMinute,O=m.getMinMinute,B=m.timePosition,q=m.colContentLeft,I=m.colContentRight,Y=m.renderDaySegs,j=m.resizableDayEvent,P=m.getColCnt,J=m.getColWidth,U=m.getSnapHeight,Z=m.getSnapMinutes,$=m.getBodyContent,G=m.reportEventElement,K=m.showEvents,te=m.hideEvents,ee=m.eventDrop,ne=m.eventResize,re=m.renderDayOverlay,ae=m.clearOverlays,oe=m.calendar,ie=oe.formatDate,se=oe.formatDates}function le(t){var e,n,r,a,o,i;for(e=t.length-1;e>0;e--)for(a=t[e],n=0;a.length>n;n++)for(o=a[n],r=0;t[e-1].length>r;r++)i=t[e-1][r],x(o,i)&&(i.forward=Math.max(i.forward||0,(o.forward||0)+1))}function ue(t,n,r){function a(t,e){var n=F[t];return"object"==typeof n?J(n,e||r):n}function o(t,e){return n.trigger.apply(n,[t,e||S].concat(Array.prototype.slice.call(arguments,2),[S]))}function i(t){return l(t)&&!a("disableDragging")}function s(t){return l(t)&&!a("disableResizing")}function l(t){return K(t.editable,(t.source||{}).editable,a("editable"))}function f(t){k={};var e,n,r=t.length;for(e=0;r>e;e++)n=t[e],k[n._id]?k[n._id].push(n):k[n._id]=[n]}function v(t){return t.end?d(t.end):E(t)}function h(t,e){H.push(e),z[t._id]?z[t._id].push(e):z[t._id]=[e]}function g(){H=[],z={}}function p(t,n){n.click(function(r){return n.hasClass("ui-draggable-dragging")||n.hasClass("ui-resizable-resizing")?e:o("eventClick",this,t,r)}).hover(function(e){o("eventMouseover",this,t,e)},function(e){o("eventMouseout",this,t,e)})}function m(t,e){b(t,e,"show")}function y(t,e){b(t,e,"hide")}function b(t,e,n){var r,a=z[t._id],o=a.length;for(r=0;o>r;r++)e&&a[r][0]==e[0]||a[r][n]()}function w(t,e,n,r,a,i,s){var c=e.allDay,l=e._id;M(k[l],n,r,a),o("eventDrop",t,e,n,r,a,function(){M(k[l],-n,-r,c),T(l)},i,s),T(l)}function D(t,e,n,r,a,i){var s=e._id;C(k[s],n,r),o("eventResize",t,e,n,r,function(){C(k[s],-n,-r),T(s)},a,i),T(s)}function M(t,n,r,a){r=r||0;for(var o,i=t.length,s=0;i>s;s++)o=t[s],a!==e&&(o.allDay=a),u(c(o.start,n,!0),r),o.end&&(o.end=u(c(o.end,n,!0),r)),x(o,F)}function C(t,e,n){n=n||0;for(var r,a=t.length,o=0;a>o;o++)r=t[o],r.end=u(c(v(r),e,!0),n),x(r,F)}var S=this;S.element=t,S.calendar=n,S.name=r,S.opt=a,S.trigger=o,S.isEventDraggable=i,S.isEventResizable=s,S.reportEvents=f,S.eventEnd=v,S.reportEventElement=h,S.reportEventClear=g,S.eventElementHandlers=p,S.showEvents=m,S.hideEvents=y,S.eventDrop=w,S.eventResize=D;var E=S.defaultEventEnd,x=n.normalizeEvent,T=n.reportEventChange,k={},H=[],z={},F=n.options}function fe(){function n(t,e){var n,r,c,d,p,m,y,b,w=B(),D=T(),M=k(),C=0,S=t.length;for(w[0].innerHTML=a(t),o(t,w.children()),i(t),s(t,w,e),l(t),u(t),f(t),n=v(),r=0;D>r;r++){for(c=0,d=[],p=0;M>p;p++)d[p]=0;for(;S>C&&(m=t[C]).row==r;){for(y=j(d.slice(m.startCol,m.endCol)),m.top=y,y+=m.outerHeight,b=m.startCol;m.endCol>b;b++)d[b]=y;C++}n[r].height(j(d))}g(t,h(n))}function r(e,n,r){var i,s,c,d=t("
"),p=B(),m=e.length;for(d[0].innerHTML=a(e),i=d.children(),p.append(i),o(e,i),l(e),u(e),f(e),g(e,h(v())),i=[],s=0;m>s;s++)c=e[s].element,c&&(e[s].row===n&&c.css("top",r),i.push(c[0]));return t(i)}function a(t){var e,n,r,a,o,i,s,c,l,u,f=y("isRTL"),d=t.length,v=F(),h=v.left,g=v.right,p="";for(e=0;d>e;e++)n=t[e],r=n.event,o=["fc-event","fc-event-hori"],w(r)&&o.push("fc-event-draggable"),n.isStart&&o.push("fc-event-start"),n.isEnd&&o.push("fc-event-end"),f?(i=A(n.end.getDay()-1),s=A(n.start.getDay()),c=n.isEnd?N(i):h,l=n.isStart?W(s):g):(i=A(n.start.getDay()),s=A(n.end.getDay()-1),c=n.isStart?N(i):h,l=n.isEnd?W(s):g),o=o.concat(r.className),r.source&&(o=o.concat(r.source.className||[])),a=r.url,u=Q(r,y),p+=a?""+"",!r.allDay&&n.isStart&&(p+=""+V(I(r.start,r.end,y("timeFormat")))+" "),p+=""+V(r.title)+" "+"
",n.isEnd&&D(r)&&(p+=""+" "+"
"),p+="",n.left=c,n.outerWidth=l-c,n.startCol=i,n.endCol=s+1;return p}function o(e,n){var r,a,o,i,s,c=e.length;for(r=0;c>r;r++)a=e[r],o=a.event,i=t(n[r]),s=b("eventRender",o,o,i),s===!1?i.remove():(s&&s!==!0&&(s=t(s).css({position:"absolute",left:a.left}),i.replaceWith(s),i=s),a.element=i)}function i(t){var e,n,r,a=t.length;for(e=0;a>e;e++)n=t[e],r=n.element,r&&C(n.event,r)}function s(t,e,n){var r,a,o,i,s=t.length;for(r=0;s>r;r++)a=t[r],o=a.element,o&&(i=a.event,i._id===n?q(i,o,a):o[0]._fci=r);H(e,t,q)}function l(t){var n,r,a,o,i,s=t.length,c={};for(n=0;s>n;n++)r=t[n],a=r.element,a&&(o=r.key=X(a[0]),i=c[o],i===e&&(i=c[o]=R(a,!0)),r.hsides=i)}function u(t){var e,n,r,a=t.length;for(e=0;a>e;e++)n=t[e],r=n.element,r&&(r[0].style.width=Math.max(0,n.outerWidth-n.hsides)+"px")}function f(t){var n,r,a,o,i,s=t.length,c={};for(n=0;s>n;n++)r=t[n],a=r.element,a&&(o=r.key,i=c[o],i===e&&(i=c[o]=O(a)),r.outerHeight=a[0].offsetHeight+i)}function v(){var t,e=T(),n=[];for(t=0;e>t;t++)n[t]=z(t).find("div.fc-day-content > div");return n}function h(t){var e,n=t.length,r=[];for(e=0;n>e;e++)r[e]=t[e][0].offsetTop;return r}function g(t,e){var n,r,a,o,i=t.length;for(n=0;i>n;n++)r=t[n],a=r.element,a&&(a[0].style.top=e[r.row]+(r.top||0)+"px",o=r.event,b("eventAfterRender",o,o,a))}function p(e,n,a){var o=y("isRTL"),i=o?"w":"e",s=n.find(".ui-resizable-"+i),l=!1;U(n),n.mousedown(function(t){t.preventDefault()}).click(function(t){l&&(t.preventDefault(),t.stopImmediatePropagation())}),s.mousedown(function(s){function u(n){b("eventResizeStop",this,e,n),t("body").css("cursor",""),h.stop(),P(),f&&x(this,e,f,0,n),setTimeout(function(){l=!1},0)}if(1==s.which){l=!0;var f,v,h=m.getHoverListener(),g=T(),p=k(),y=o?-1:1,w=o?p-1:0,D=n.css("top"),C=t.extend({},e),H=L(e.start);J(),t("body").css("cursor",i+"-resize").one("mouseup",u),b("eventResizeStart",this,e,s),h.start(function(t,n){if(t){var s=Math.max(H.row,t.row),l=t.col;1==g&&(s=0),s==H.row&&(l=o?Math.min(H.col,l):Math.max(H.col,l)),f=7*s+l*y+w-(7*n.row+n.col*y+w);var u=c(M(e),f,!0);if(f){C.end=u;var h=v;v=r(_([C]),a.row,D),v.find("*").css("cursor",i+"-resize"),h&&h.remove(),E(e)}else v&&(S(e),v.remove(),v=null);P(),Y(e.start,c(d(u),1))}},s)}})}var m=this;m.renderDaySegs=n,m.resizableDayEvent=p;var y=m.opt,b=m.trigger,w=m.isEventDraggable,D=m.isEventResizable,M=m.eventEnd,C=m.reportEventElement,S=m.showEvents,E=m.hideEvents,x=m.eventResize,T=m.getRowCnt,k=m.getColCnt;m.getColWidth;var z=m.allDayRow,F=m.allDayBounds,N=m.colContentLeft,W=m.colContentRight,A=m.dayOfWeekCol,L=m.dateCell,_=m.compileDaySegs,B=m.getDaySegmentContainer,q=m.bindDaySeg,I=m.calendar.formatDates,Y=m.renderDayOverlay,P=m.clearOverlays,J=m.clearSelection}function de(){function e(t,e,a){n(),e||(e=c(t,a)),l(t,e,a),r(t,e,a)}function n(t){f&&(f=!1,u(),s("unselect",null,t))}function r(t,e,n,r){f=!0,s("select",null,t,e,n,r)}function a(e){var a=o.cellDate,s=o.cellIsAllDay,c=o.getHoverListener(),f=o.reportDayClick;if(1==e.which&&i("selectable")){n(e);var d;c.start(function(t,e){u(),t&&s(t)?(d=[a(e),a(t)].sort(Y),l(d[0],d[1],!0)):d=null},e),t(document).one("mouseup",function(t){c.stop(),d&&(+d[0]==+d[1]&&f(d[0],!0,t),r(d[0],d[1],!0,t))})}}var o=this;o.select=e,o.unselect=n,o.reportSelection=r,o.daySelectionMousedown=a;var i=o.opt,s=o.trigger,c=o.defaultSelectionEnd,l=o.renderSelection,u=o.clearSelection,f=!1;i("selectable")&&i("unselectAuto")&&t(document).mousedown(function(e){var r=i("unselectCancel");r&&t(e.target).parents(r).length||n(e)})}function ve(){function e(e,n){var r=o.shift();return r||(r=t("
")),r[0].parentNode!=n[0]&&r.appendTo(n),a.push(r.css(e).show()),r}function n(){for(var t;t=a.shift();)o.push(t.hide().unbind())}var r=this;r.renderOverlay=e,r.clearOverlays=n;var a=[],o=[]}function he(t){var e,n,r=this;r.build=function(){e=[],n=[],t(e,n)},r.cell=function(t,r){var a,o=e.length,i=n.length,s=-1,c=-1;for(a=0;o>a;a++)if(r>=e[a][0]&&e[a][1]>r){s=a;break}for(a=0;i>a;a++)if(t>=n[a][0]&&n[a][1]>t){c=a;break}return s>=0&&c>=0?{row:s,col:c}:null},r.rect=function(t,r,a,o,i){var s=i.offset();return{top:e[t][0]-s.top,left:n[r][0]-s.left,width:n[o][1]-n[r][0],height:e[a][1]-e[t][0]}}}function ge(e){function n(t){pe(t);var n=e.cell(t.pageX,t.pageY);(!n!=!i||n&&(n.row!=i.row||n.col!=i.col))&&(n?(o||(o=n),a(n,o,n.row-o.row,n.col-o.col)):a(n,o),i=n)}var r,a,o,i,s=this;s.start=function(s,c,l){a=s,o=i=null,e.build(),n(c),r=l||"mousemove",t(document).bind(r,n)},s.stop=function(){return t(document).unbind(r,n),i}}function pe(t){t.pageX===e&&(t.pageX=t.originalEvent.pageX,t.pageY=t.originalEvent.pageY)}function me(t){function n(e){return a[e]=a[e]||t(e)}var r=this,a={},o={},i={};r.left=function(t){return o[t]=o[t]===e?n(t).position().left:o[t]},r.right=function(t){return i[t]=i[t]===e?r.left(t)+n(t).width():i[t]},r.clear=function(){a={},o={},i={}}}var ye={defaultView:"month",aspectRatio:1.35,header:{left:"title",center:"",right:"today prev,next"},weekends:!0,weekNumbers:!1,weekNumberCalculation:"iso",weekNumberTitle:"W",allDayDefault:!0,ignoreTimezone:!0,lazyFetching:!0,startParam:"start",endParam:"end",titleFormat:{month:"MMMM yyyy",week:"MMM d[ yyyy]{ '—'[ MMM] d yyyy}",day:"dddd, MMM d, yyyy"},columnFormat:{month:"ddd",week:"ddd M/d",day:"dddd M/d"},timeFormat:{"":"h(:mm)t"},isRTL:!1,firstDay:0,monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],buttonText:{prev:"‹ ",next:"› ",prevYear:"« ",nextYear:"» ",today:"today",month:"month",week:"week",day:"day"},theme:!1,buttonIcons:{prev:"circle-triangle-w",next:"circle-triangle-e"},unselectAuto:!0,dropAccept:"*"},be={header:{left:"next,prev today",center:"",right:"title"},buttonText:{prev:"› ",next:"‹ ",prevYear:"» ",nextYear:"« "},buttonIcons:{prev:"circle-triangle-e",next:"circle-triangle-w"}},we=t.fullCalendar={version:"1.6.1"},De=we.views={};t.fn.fullCalendar=function(n){if("string"==typeof n){var a,o=Array.prototype.slice.call(arguments,1);return this.each(function(){var r=t.data(this,"fullCalendar");if(r&&t.isFunction(r[n])){var i=r[n].apply(r,o);a===e&&(a=i),"destroy"==n&&t.removeData(this,"fullCalendar")}}),a!==e?a:this}var i=n.eventSources||[];return delete n.eventSources,n.events&&(i.push(n.events),delete n.events),n=t.extend(!0,{},ye,n.isRTL||n.isRTL===e&&ye.isRTL?be:{},n),this.each(function(e,a){var o=t(a),s=new r(o,n,i);o.data("fullCalendar",s),s.render()}),this},we.sourceNormalizers=[],we.sourceFetchers=[];var Me={dataType:"json",cache:!1},Ce=1;we.addDays=c,we.cloneDate=d,we.parseDate=m,we.parseISO8601=y,we.parseTime=b,we.formatDate=w,we.formatDates=D;var Se=["sun","mon","tue","wed","thu","fri","sat"],Ee=864e5,xe=36e5,Te=6e4,ke={s:function(t){return t.getSeconds()},ss:function(t){return P(t.getSeconds())},m:function(t){return t.getMinutes()},mm:function(t){return P(t.getMinutes())},h:function(t){return t.getHours()%12||12},hh:function(t){return P(t.getHours()%12||12)},H:function(t){return t.getHours()},HH:function(t){return P(t.getHours())},d:function(t){return t.getDate()},dd:function(t){return P(t.getDate())},ddd:function(t,e){return e.dayNamesShort[t.getDay()]},dddd:function(t,e){return e.dayNames[t.getDay()]},M:function(t){return t.getMonth()+1},MM:function(t){return P(t.getMonth()+1)},MMM:function(t,e){return e.monthNamesShort[t.getMonth()]},MMMM:function(t,e){return e.monthNames[t.getMonth()]},yy:function(t){return(t.getFullYear()+"").substring(2)},yyyy:function(t){return t.getFullYear()},t:function(t){return 12>t.getHours()?"a":"p"},tt:function(t){return 12>t.getHours()?"am":"pm"},T:function(t){return 12>t.getHours()?"A":"P"},TT:function(t){return 12>t.getHours()?"AM":"PM"},u:function(t){return w(t,"yyyy-MM-dd'T'HH:mm:ss'Z'")},S:function(t){var e=t.getDate();return e>10&&20>e?"th":["st","nd","rd"][e%10-1]||"th"},w:function(t,e){return e.weekNumberCalculation(t)},W:function(t){return M(t)}};we.dateFormatters=ke,we.applyAll=G,De.month=te,De.basicWeek=ee,De.basicDay=ne,n({weekMode:"fixed"}),De.agendaWeek=oe,De.agendaDay=ie,n({allDaySlot:!0,allDayText:"all-day",firstHour:6,slotMinutes:30,defaultEventMinutes:120,axisFormat:"h(:mm)tt",timeFormat:{agenda:"h:mm{ - h:mm}"},dragOpacity:{agenda:.5},minTime:0,maxTime:24})})(jQuery);
\ No newline at end of file
+FullCalendar Scheduler v5.8.0
+Docs & License: https://fullcalendar.io/scheduler
+(c) 2021 Adam Shaw
+*/
+var ie_args=navigator&&navigator.userAgent.match(/MSIE\s+(\d+)/),is_below_es6=!1,ie_ver,global,FullCalendar;ie_args&&(ie_ver=parseInt(ie_args[1]),(ie_ver<=10||!Object.__proto__)&&(Object.setPrototypeOf=function(n,t){n.prototype=Object.create(t.prototype);n.prototype.constructor=n;n.__proto__=t;var i=Object.getOwnPropertyNames(t);return i.forEach(function(i){try{if(i=="caller"||i=="length"||i=="arguments")return;n[i]=t[i]}catch(r){}}),n},global=(typeof globalThis).toLowerCase()=="undefined"?window:globalThis,(typeof DOMTokenList).toLowerCase()=="undefined"&&function(n,t){"use strict";var i="exports";typeof define=="function"&&define["amd"]?define(function(){return t(n)}):typeof module=="function"&&module[i]?module[i]=t(n):t(n)}(this,function(n){"use strict";function o(n){var t=this.prototype[n];this.prototype[n]=function(){for(var r,n=0,i=arguments.length;n-1;){if(this[t]===n)return t;t-=1}return-1}function h(){return e+=1}function u(){var n=this.classes,t=n.join(" ");this.isSVG?this.setAttribute("class",t):this.element.className=t;this.list.length=n.length}function c(n){return r.call(t[this.id].classes,n)!==-1}function l(){for(var n=0,f=t[this.id],e=f.classes,s=arguments.length,i,o=!1;n-1;)o=arguments[n],i=r.call(e,o),i!==-1&&(e.splice(i,1),s=!0),n-=1;s&&u.call(f)}function y(){var n=t[this.id];return u.call(n),n.element.className}function p(n,i){var f=r.call(t[this.id].classes,n)!==-1,u;return f?i!==!0&&(u="remove"):i!==!1&&(u="add"),u&&this[u](n),i===!0||i===!1?i:!f}function f(n){var r,i,u;if(i=n.domTokenListId,i&&i in t)return t[i].list;u=typeof n.className=="object";r=n.className;r=String(u?r.baseVal:r).replace(/^\s+|\s+$/,"");i=h();t[i]={classes:r.length!==0?r.split(/\s+/):[],element:n,list:this,isSVG:u};this.id=i;this.length=t[i].classes.length;n.domTokenListId=i}if(n.Element){var s=n.document,e=0,t={},i=s.createElement("_");"classList"in i?(i.classList.add("c1","c2"),i.classList.contains("c2")||(o.call(n.DOMTokenList,"add"),o.call(n.DOMTokenList,"remove")),i.classList.toggle("c3",!1),i.classList.contains("c3")&&(n.DOMTokenList.prototype.toggle=function(){var t=n.DOMTokenList.prototype.toggle;return function(n,i){var r=!i;return arguments.length>1&&!(this.contains(n)===r)?i:t.call(this,n)}}()),i=null):function(){function h(){var n=this.domTokenListId;return n&&n in t?t[n].list:new f(this)}for(var u=n.Element.prototype,o=[l,c,a,v,y,p],e=["add","contains","item","remove","toString","toggle"],r,s=f.prototype,i=e.length-1;i>-1;)s[e[i]]=o[i],i-=1;if(r={get:h,configurable:!0,enumerable:!0},Object.defineProperty)try{Object.defineProperty(u,"classList",r)}catch(w){w.number===-2146823252&&(r.enumerable=!1,Object.defineProperty(u,"classList",r))}else Object.prototype.__defineGetter__&&u.__defineGetter__("classList",r);n.DOMTokenList=f}()}}),is_below_es6=!0));FullCalendar=function(n){"use strict";
+/*! *****************************************************************************
+ Copyright (c) Microsoft Corporation.
+ Permission to use, copy, modify, and/or distribute this software for any
+ purpose with or without fee is hereby granted.
+ THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ PERFORMANCE OF THIS SOFTWARE.
+ ***************************************************************************** */
+function u(n,t){function i(){this.constructor=n}if(typeof t!="function"&&t!==null)throw new TypeError("Class extends value "+String(t)+" is not a constructor or null");vh(n,t);n.__proto__=t;n.prototype=t===null?Object.create(t):(i.prototype=t.prototype,new i)}function l(n,t){for(var i=0,u=t.length,r=n.length;i3)for(i=[i],r=3;r0?re(c.type,c.props,c.key,null,c.__v):c)){if(c.__=i,c.__b=i.__b+1,null===(a=v[l])||a&&c.key==a.key&&c.type===a.type)v[l]=void 0;else for(p=0;p>>1,1);t.i.removeChild(n)}}),cu(si(cft,{context:t.context},n.__v),t.l)):t.l&&t.componentWillUnmount()}function aft(n,t){return si(lft,{__v:n,i:t})}function wft(){}function bft(){return this.cancelBubble}function kft(){return this.defaultPrevented}function dft(){function i(t){n.push(t)}var t=o.debounceRendering,n=[];for(o.debounceRendering=i,cu(si(ub,{}),document.createElement("div"));n.length;)n.shift()();o.debounceRendering=t}function gft(n){var t=oft(n),i=t.Provider;return t.Provider=function(){var t=this,r=!this.getChildContext,u=i.apply(this,arguments),n;return r&&(n=[],this.shouldComponentUpdate=function(i){t.props.value!==i.value&&n.forEach(function(n){n.context=i.value;n.forceUpdate()})},this.sub=function(t){n.push(t);var i=t.componentWillUnmount;t.componentWillUnmount=function(){n.splice(n.indexOf(t),1);i&&i.call(t)}}),u},t}function net(n){cu(null,n)}function vr(n){n.parentNode&&n.parentNode.removeChild(n)}function d(n,t){if(n.closest)return n.closest(t);if(!document.documentElement.contains(n))return null;do{if(he(n,t))return n;n=n.parentElement||n.parentNode}while(n!==null&&n.nodeType===1);return null}function he(n,t){var i=n.matches||n.matchesSelector||n.msMatchesSelector;return i.call(n,t)}function dt(n,t){for(var u,i,f=n instanceof HTMLElement?[n]:n,e=[],r=0;r=1)?Math.min(u,f):u}function wc(n,t,i,r){var u=et([t,0,1+cet(t,i,r)]),f=a(n),e=Math.round(ni(u,f));return Math.floor(e/7)+1}function cet(n,t,i){var r=7+t-i,u=(7+et([n,0,r]).getUTCDay()-t)%7;return-u+r-1}function db(n){return[n.getFullYear(),n.getMonth(),n.getDate(),n.getHours(),n.getMinutes(),n.getSeconds(),n.getMilliseconds(),]}function gb(n){return new Date(n[0],n[1]||0,n[2]==null?1:n[2],n[3]||0,n[4]||0,n[5]||0)}function ai(n){return[n.getUTCFullYear(),n.getUTCMonth(),n.getUTCDate(),n.getUTCHours(),n.getUTCMinutes(),n.getUTCSeconds(),n.getUTCMilliseconds(),]}function et(n){return n.length===1&&(n=n.concat([0])),new Date(Date.UTC.apply(Date,n))}function le(n){return!isNaN(n.valueOf())}function vi(n){return n.getUTCHours()*36e5+n.getUTCMinutes()*6e4+n.getUTCSeconds()*1e3+n.getUTCMilliseconds()}function yu(n,t,i,r){return{instanceId:vt(),defId:n,range:t,forcedStartTzo:i==null?null:i,forcedEndTzo:r==null?null:r}}function bc(n,t){var u={},f,e,r,i,s,o;if(t)for(f in t){for(e=[],i=n.length-1;i>=0;i-=1)if(r=n[i][f],typeof r=="object"&&r)e.unshift(r);else if(r!==undefined){u[f]=r;break}e.length&&(u[f]=bc(e))}for(i=n.length-1;i>=0;i-=1){s=n[i];for(o in s)o in u||(u[o]=s[o])}return u}function pt(n,t){var r={};for(var i in n)t(n[i],i)&&(r[i]=n[i]);return r}function w(n,t){var r={};for(var i in n)r[i]=t(n[i],i);return r}function nk(n){for(var u,i={},t=0,r=n;t10&&(t==null?r=r.replace("Z",""):t!==0&&(r=r.replace("Z",rl(t,!0)))),r}function br(n){return n.toISOString().replace(/T.*$/,"")}function fk(n){return yt(n.getUTCHours(),2)+":"+yt(n.getUTCMinutes(),2)+":"+yt(n.getUTCSeconds(),2)}function rl(n,t){t===void 0&&(t=!1);var r=n<0?"-":"+",u=Math.abs(n),f=Math.floor(u/60),i=Math.round(u%60);return t?r+yt(f,2)+":"+yt(i,2):"GMT"+r+f+(i?":"+yt(i,2):"")}function ek(n,t){for(var r=0,i=0;i=tt(t)&&(i=p(i,1))),n.start&&(r=a(n.start),i&&i<=r&&(i=p(r,1))),{start:r,end:i}}function dk(n){var t=tf(n);return ni(t.start,t.end)>1}function tr(n,t,i,r){return r==="year"?s(i.diffWholeYears(n,t),"year"):r==="month"?s(i.diffWholeMonths(n,t),"month"):bb(n,t)}function got(n,t){var i=null,r=null;return(n.start&&(i=t.createMarker(n.start)),n.end&&(r=t.createMarker(n.end)),!i&&!r)?null:i&&r&&ri&&f.push({start:i,end:r.start}),r.end>i&&(i=r.end);return it.start)&&(n.start===null||t.end===null||n.start=n.start)&&(n.end===null||t.end!==null&&t.end<=n.end)}function wt(n,t){return(n.start===null||t>=n.start)&&(n.end===null||t=t.end?new Date(t.end.valueOf()-1):n}function ff(n,t,i,r){var h={},c={},k={},l=[],it=[],a=ro(n.defs,t),u,e,rt,d,w,g,f,y,p,b,tt,nt;for(f in n.defs)u=n.defs[f],e=a[u.defId],e.display==="inverse-background"&&(u.groupId?(h[u.groupId]=[],k[u.groupId]||(k[u.groupId]=u)):c[f]=[]);for(rt in n.instances){var v=n.instances[rt],u=n.defs[v.defId],e=a[u.defId],ut=v.range,s=!u.allDay&&r?tf(ut,r):ut,o=ui(s,i);o&&(e.display==="inverse-background"?u.groupId?h[u.groupId].push(o):c[v.defId].push(o):e.display!=="none"&&(e.display==="background"?l:it).push({def:u,ui:e,instance:v,range:o,isStart:s.start&&s.start.valueOf()===o.start.valueOf(),isEnd:s.end&&s.end.valueOf()===o.end.valueOf()}))}for(d in h)for(y=h[d],p=gk(y,i),w=0,g=p;w=(i||t.end),isToday:t&&wt(t,r.start)}}function ed(n){var t=["fc-event"];return n.isMirror&&t.push("fc-event-mirror"),n.isDraggable&&t.push("fc-event-draggable"),(n.isStartResizable||n.isEndResizable)&&t.push("fc-event-resizable"),n.isDragging&&t.push("fc-event-dragging"),n.isResizing&&t.push("fc-event-resizing"),n.isSelected&&t.push("fc-event-selected"),n.isStart&&t.push("fc-event-start"),n.isEnd&&t.push("fc-event-end"),n.isPast&&t.push("fc-event-past"),n.isToday&&t.push("fc-event-today"),n.isFuture&&t.push("fc-event-future"),t}function uo(n){return n.instance?n.instance.instanceId:n.def.defId+":"+n.range.start.toISOString()}function ist(n,t,i){var u=rst(n,t),r=u.range;if(!r.start)return null;if(!r.end){if(i==null)return null;r.end=t.add(r.start,i)}return u}function rst(n,t){var o=nr(n,od),r=o.refined,s=o.extra,u=r.start?t.createMarkerMeta(r.start):null,f=r.end?t.createMarkerMeta(r.end):null,e=r.allDay;return e==null&&(e=u&&u.isTimeUnspecified&&(!f||f.isTimeUnspecified)),i({range:{start:u?u.marker:null,end:f?f.marker:null},allDay:e},s)}function sd(n,t){return hl(n.range,t.range)&&n.allDay===t.allDay&&ust(n,t)}function ust(n,t){for(var i in t)if(i!=="range"&&i!=="allDay"&&n[i]!==t[i])return!1;for(i in n)if(!(i in t))return!1;return!0}function fst(n,t){return i(i({},cd(n.range,t,n.allDay)),{allDay:n.allDay})}function hd(n,t,r){return i(i({},cd(n,t,r)),{timeZone:t.timeZone})}function cd(n,t,i){return{start:t.toDate(n.start),end:t.toDate(n.end),startStr:t.formatIso(n.start,{omitTime:i}),endStr:t.formatIso(n.end,{omitTime:i})}}function est(n,t,i){var u=io({editable:!1},i),r=nf(u.refined,u.extra,"",n.allDay,!0,i);return{def:r,ui:td(r,t),instance:yu(r.defId,n.range),range:n.range,isStart:!0,isEnd:!0}}function ll(n,t,r){r.emitter.trigger("select",i(i({},al(n,r)),{jsEvent:t?t.origEvent:null,view:r.viewApi||r.calendarApi.view}))}function ost(n,t){t.emitter.trigger("unselect",{jsEvent:n?n.origEvent:null,view:t.viewApi||t.calendarApi.view})}function al(n,t){for(var e,r={},u=0,f=t.pluginHooks.dateSpanTransforms;u=0;i-=1)if(f=u[i],r=f.parseMeta(n),r)return{sourceDefId:i,meta:r};return null}function lst(n,t){switch(t.type){case"CHANGE_DATE":return t.dateMarker;default:return n}}function ast(n,t){var i=n.initialDate;return i!=null?t.createMarker(i):of(n.now,t)}function of(n,t){return(typeof n=="function"&&(n=n()),n==null)?t.createNowMarker():t.createMarker(n)}function yd(n){var t,i,u=n._def,r=n._instance;return{defs:(t={},t[u.defId]=u,t),instances:r?(i={},i[r.instanceId]=r,i):{}}}function wi(n,t,i){var s=n.defs,u=n.instances,f=[],h=i?i.instanceId:"",e,r,o;for(e in u)r=u[e],o=s[r.defId],r.instanceId!==h&&f.push(new v(t,o,r));return f}function vst(n,t){yl[n]=t}function yst(n){return new yl[n]}function bd(n){var t=wd.exec(n),i,r;return t&&(i=new Date(Date.UTC(Number(t[1]),t[3]?Number(t[3])-1:0,Number(t[5]||1),Number(t[7]||0),Number(t[8]||0),Number(t[10]||0),t[12]?Number("0."+t[12])*1e3:0)),le(i))?(r=null,t[13]&&(r=(t[15]==="-"?-1:1)*(Number(t[16]||0)*60+Number(t[18]||0))),{marker:i,isTimeUnspecified:!t[6],timeZoneOffset:r}):null}function dd(n){for(var i,f=n.length>0?n[0].code:"en",e=kd.concat(n),r={en:wl},t=0,u=e;t0;r-=1)if(f=u.slice(0,r).join("-"),t[f])return t[f];return null}function gd(n,t,i){var r=bc([wl,i],["buttonText"]),u;return delete r.code,u=r.week,delete r.week,{codeArg:n,codes:t,week:u,simpleNumberFormat:new Intl.NumberFormat(n),options:r}}function bst(n,t){t===void 0&&(t={});var r=ng(t),u=y(t),i=r.createMarkerMeta(n);return i?r.format(i.marker,u,{forcedTzo:i.forcedTzo}):""}function kst(n,t,i){var r=ng(typeof i=="object"&&i?i:{}),e=y(i),u=r.createMarkerMeta(n),f=r.createMarkerMeta(t);return!u||!f?"":r.formatRange(u.marker,f.marker,e,{forcedStartTzo:u.forcedTzo,forcedEndTzo:f.forcedTzo,isEndExclusive:i.isEndExclusive,defaultSeparator:ri.defaultRangeSeparator})}function ng(n){var t=bl(n.locale||"en",dd([]).map);return new pl(i(i({timeZone:ri.timeZone,calendarSystem:"gregory"},n),{locale:t}))}function kl(n,t){return de(dst(n),null,t)}function dst(n){var t;return t=n===!0?[{}]:Array.isArray(n)?n.filter(function(n){return n.daysOfWeek}):typeof n=="object"&&n?[n]:[],t.map(function(n){return i(i({},tg),n)})}function ig(n,t){return n.left>=t.left&&n.left=t.top&&n.top<\/div><\/td><\/tr><\/table>",n.querySelector("table").style.height="100px",n.querySelector("div").style.height="100%",document.body.appendChild(n),t=n.querySelector("div"),i=t.offsetHeight>0,document.body.removeChild(n),i)}function nht(n,t,r){var u=[],f;return n&&u.push(n),t&&u.push(t),f={"":no(u)},r&&i(f,r),f}function nu(n,t,i,r){return{dow:n.getUTCDay(),isDisabled:Boolean(r&&!wt(r.activeRange,n)),isOther:Boolean(r&&!wt(r.currentRange,n)),isToday:Boolean(t&&wt(t,n)),isPast:Boolean(i?n
i:t?n>=t.end:!1)}}function rr(n,t){var i=["fc-day","fc-day-"+yc[n.dow],];return n.isDisabled?i.push("fc-day-disabled"):(n.isToday&&(i.push("fc-day-today"),i.push(t.getClass("today"))),n.isPast&&i.push("fc-day-past"),n.isFuture&&i.push("fc-day-future"),n.isOther&&i.push("fc-day-other")),i}function ta(n,t){var i=["fc-slot","fc-slot-"+yc[n.dow],];return n.isDisabled?i.push("fc-slot-disabled"):(n.isToday&&(i.push("fc-slot-today"),i.push(t.getClass("today"))),n.isPast&&i.push("fc-slot-past"),n.isFuture&&i.push("fc-slot-future")),i}function ur(n,t){return t===void 0&&(t="day"),JSON.stringify({date:br(n),type:t})}function hf(){return ho===null&&(ho=tht()),ho}function tht(){var n=document.createElement("div"),t,i;return ci(n,{position:"absolute",top:-1e3,left:0,border:0,padding:0,overflow:"scroll",direction:"rtl"}),n.innerHTML="<\/div>",document.body.appendChild(n),t=n.firstChild,i=t.getBoundingClientRect().left>n.getBoundingClientRect().left,vr(n),i}function ra(){return ia||(ia=iht()),ia}function iht(){var n=document.createElement("div"),t;return n.style.overflow="scroll",n.style.position="absolute",n.style.top="-9999px",n.style.left="-9999px",document.body.appendChild(n),t=eg(n),document.body.removeChild(n),t}function eg(n){return{x:n.offsetHeight-n.clientHeight,y:n.offsetWidth-n.clientWidth}}function ua(n,t){t===void 0&&(t=!1);var i=window.getComputedStyle(n),u=parseInt(i.borderLeftWidth,10)||0,f=parseInt(i.borderRightWidth,10)||0,e=parseInt(i.borderTopWidth,10)||0,o=parseInt(i.borderBottomWidth,10)||0,s=eg(n),h=s.y-u-f,c=s.x-e-o,r={borderLeft:u,borderRight:f,borderTop:e,borderBottom:o,scrollbarBottom:c,scrollbarLeft:0,scrollbarRight:0};return hf()&&i.direction==="rtl"?r.scrollbarLeft=h:r.scrollbarRight=h,t&&(r.paddingLeft=parseInt(i.paddingLeft,10)||0,r.paddingRight=parseInt(i.paddingRight,10)||0,r.paddingTop=parseInt(i.paddingTop,10)||0,r.paddingBottom=parseInt(i.paddingBottom,10)||0),r}function fa(n,t,i){t===void 0&&(t=!1);var f=i?n.getBoundingClientRect():co(n),r=ua(n,t),u={left:f.left+r.borderLeft+r.scrollbarLeft,right:f.right-r.borderRight-r.scrollbarRight,top:f.top+r.borderTop,bottom:f.bottom-r.borderBottom-r.scrollbarBottom};return t&&(u.left+=r.paddingLeft,u.right-=r.paddingRight,u.top+=r.paddingTop,u.bottom-=r.paddingBottom),u}function co(n){var t=n.getBoundingClientRect();return{left:t.left+window.pageXOffset,top:t.top+window.pageYOffset,right:t.right+window.pageXOffset,bottom:t.bottom+window.pageYOffset}}function rht(n){for(var f,r,e=ea(n),t=n.getBoundingClientRect(),i=0,u=e;i
n.fetchRange.end:!n.latestFetchId}function la(n,t,i,r,u){var o={},f,e;for(f in n)e=n[f],o[f]=t[f]?sct(e,i,r,u):e;return o}function sct(n,t,r,u){var f=u.options,e=u.calendarApi,s=u.pluginHooks.eventSourceDefs[n.sourceDefId],o=vt();return s.fetch({eventSource:n,range:t,isRefetch:r,context:u},function(i){var r=i.rawEvents;f.eventSourceSuccess&&(r=f.eventSourceSuccess.call(e,r,i.xhr)||r);n.success&&(r=n.success.call(e,r,i.xhr)||r);u.dispatch({type:"RECEIVE_EVENTS",sourceId:n.sourceId,fetchId:o,fetchRange:t,rawEvents:r})},function(i){console.warn(i.message,i);f.eventSourceFailure&&f.eventSourceFailure.call(e,i);n.failure&&n.failure(i);u.dispatch({type:"RECEIVE_EVENT_ERROR",sourceId:n.sourceId,fetchId:o,fetchRange:t,error:i})}),i(i({},n),{isFetching:!0,latestFetchId:o})}function hct(n,t,r,u){var f,e=n[t];return e&&r===e.latestFetchId?i(i({},n),(f={},f[t]=i(i({},e),{isFetching:!1,fetchRange:u}),f)):n}function gg(n,t){return pt(n,function(n){return nn(n,t)})}function cct(n,t){var s=vd(t),r=[].concat(n.eventSources||[]),e=[],i,u,o,f;for(n.initialEvents&&r.unshift(n.initialEvents),n.events&&r.unshift(n.events),i=0,u=r;i=200&&f.status<400){var n=!1,t=void 0;try{t=JSON.parse(f.responseText);n=!0}catch(i){}n?r(t,f):u("Failure parsing JSON",f)}else u("Request failed",f)};f.onerror=function(){u("Request failed",f)};f.send(e)}function elt(n,t){return n+(n.indexOf("?")===-1?"?":"&")+fn(t)}function fn(n){var t=[];for(var i in n)t.push(encodeURIComponent(i)+"="+encodeURIComponent(n[i]));return t.join("&")}function clt(n,t,r){var f=r.dateEnv,h=r.options,e,o,s,c,u={};return e=n.startParam,e==null&&(e=h.startParam),o=n.endParam,o==null&&(o=h.endParam),s=n.timeZoneParam,s==null&&(s=h.timeZoneParam),c=typeof n.extraParams=="function"?n.extraParams():n.extraParams||{},i(u,c),u[e]=f.formatIso(t.start),u[o]=f.formatIso(t.end),f.timeZone!=="local"&&(u[s]=f.timeZone),u}function ylt(n,t,i,r){for(var e=n?nk(n):null,u=a(i.start),s=i.end,o=[],f;u1)?{year:"numeric",month:"short",day:"numeric"}:{year:"numeric",month:"long",day:"numeric"}}function nat(n,t,i,r,u,f,e,o){var s=bl(t||e.defaultCode,e.map);return new pl({calendarSystem:"gregory",timeZone:n,namedTimeZoneImpl:f.namedTimeZonedImpl,locale:s,weekNumberCalculation:i,firstDay:r,weekText:u,cmdFormatter:f.cmdFormatter,defaultSeparator:o})}function tat(n,t){var i=t.themeClasses[n.themeSystem]||ei;return new i(n)}function iat(n){var t=n.dateProfileGeneratorClass||yo;return new t(n)}function rat(n,t,i){return new vl(n,t,i)}function uat(n){return w(n,function(n){return n.ui})}function fat(n,t,i){var f={"":t},u,r;for(u in n)r=n[u],r.sourceId&&i[r.sourceId]&&(f[u]=i[r.sourceId]);return f}function eat(n){var t=n.options;return{eventUiSingleBase:dr({display:t.eventDisplay,editable:t.editable,startEditable:t.eventStartEditable,durationEditable:t.eventDurationEditable,constraint:t.eventConstraint,overlap:typeof t.eventOverlap=="boolean"?t.eventOverlap:undefined,allow:t.eventAllow,backgroundColor:t.eventBackgroundColor,borderColor:t.eventBorderColor,textColor:t.eventTextColor,color:t.eventColor},n),selectionConfig:dr({constraint:t.selectConstraint,overlap:typeof t.selectOverlap=="boolean"?t.selectOverlap:undefined,allow:t.selectAllow},n)}}function aa(n,t){for(var u,i=0,r=t.pluginHooks.isLoadingFuncs;ii(n[u-1]))return[u,0];while(re)r=f+1;else return[f,1];return[r,0]}function hat(n,t){return{component:n,el:t.el,useEventCenter:t.useEventCenter!=null?t.useEventCenter:!0,isHitComboAllowed:t.isHitComboAllowed||null}}function go(n){var t;return t={},t[n.component.uid]=n,t}function ns(n){var i=nr(n,cat),t=i.refined,r=i.extra;return{startTime:t.startTime||null,duration:t.duration||null,create:t.create!=null?t.create:!0,sourceId:t.sourceId,leftoverProps:r}}function pat(n,t,i,r,u,f){var e=i.build(u,undefined,!1),o=i.buildPrev(t,r,!1),s=i.buildNext(t,r,!1);return{title:f,activeButton:n.type,isTodayEnabled:e.isValid&&!wt(t.currentRange,u),isPrevEnabled:o.isValid,isNextEnabled:s.isValid}}function wat(n){return n.map(function(n){return new n})}function da(n,t){return!n||t>10?y({weekday:"short"}):t>1?y({weekday:"short",month:"numeric",day:"numeric",omitCommas:!0}):y({weekday:"long"})}function pn(n){return n.text}function wn(n){var t=a(n),i=p(t,1);return{start:t,end:i}}function bat(n,t,i){return n||da(t,i)}function uv(n,t){var i=n.activeRange;return t?i:{start:gt(i.start,n.slotMinTime.milliseconds),end:gt(i.end,n.slotMaxTime.milliseconds-864e5)}}function rs(n,t,i){var r=n.mutatedEvents.instances;for(var u in r)if(!uf(t.validRange,r[u].range))return!1;return kn({eventDrag:n},i)}function bn(n,t,i){return uf(t.validRange,n.range)?kn({dateSelection:n},i):!1}function kn(n,t){var r=t.getCurrentData(),u=i({businessHours:r.businessHours,dateSelection:"",eventStore:r.eventStore,eventUiBases:r.eventUiBases,eventSelection:"",eventDrag:null,eventResize:null},n);return(t.pluginHooks.isPropsValid||fv)(u,t)}function fv(n,t,i,r){return(i===void 0&&(i={}),n.eventDrag&&!kat(n,t,i,r))?!1:n.dateSelection&&!dat(n,t,i,r)?!1:!0}function kat(n,t,r,u){var g=t.getCurrentData(),o=n.eventDrag,nt=o.mutatedEvents,tt=nt.defs,it=nt.instances,c=ro(tt,o.isEvent?n.eventUiBases:{"":g.selectionConfig}),a,p,b,et,e,ot,k,h,d;u&&(c=w(c,u));var l=wct(n.eventStore,o.affectedEvents.instances),rt=l.defs,ut=l.instances,ct=ro(rt,n.eventUiBases);for(a in it){var f=it[a],ft=f.range,y=c[f.defId],s=tt[f.defId];if(!dn(y.constraints,ft,l,n.businessHours,t))return!1;p=t.options.eventOverlap;b=typeof p=="function"?p:null;for(et in ut)if(e=ut[et],rf(ft,e.range)&&((ot=ct[e.defId].overlap,ot===!1&&o.isEvent)||y.overlap===!1||b&&!b(new v(t,rt[e.defId],e),new v(t,s,f))))return!1;for(k=g.eventStore,h=0,d=y.allows;ht.eventRange.range.end?n:t}function vvt(n){return n.button===0&&!n.ctrlKey}function yvt(){bv+=1;setTimeout(function(){bv-=1},ot.touchMouseIgnoreWait)}function pvt(){ls+=1;ls===1&&window.addEventListener("touchmove",rtt,{passive:!1})}function wvt(){ls-=1;ls||window.removeEventListener("touchmove",rtt,{passive:!1})}function rtt(n){kv&&n.preventDefault()}function nyt(n){var t=n.tagName;return t==="HTML"||t==="BODY"}function vs(n,t){return!n&&!t?!0:Boolean(n)!==Boolean(t)?!1:sd(n.dateSpan,t.dateSpan)}function dv(n,t){for(var e,r={},u=0,f=t.pluginHooks.datePointTransforms;ur.start)return{endDelta:u};return null}function cyt(n,t,r){for(var s,l,a,e=i({},t.leftoverProps),f=0,o=r.pluginHooks.externalDefTransforms;f1,k=r.span.start===u;f+=r.levelCoord-e;e=r.levelCoord+r.thickness;g?(f+=r.thickness,k&&h.push({seg:fu(s,r.span.start,r.span.end,i),isVisible:!0,isAbsolute:!0,absoluteTop:r.levelCoord,marginTop:0})):k&&(h.push({seg:fu(s,r.span.start,r.span.end,i),isVisible:!0,isAbsolute:!1,absoluteTop:0,marginTop:f}),f=0)}v.push(b);y.push(h);p.push(f)}return{singleColPlacements:v,multiColPlacements:y,leftoverMargins:p}}function ipt(n,t){for(var r,e,u,f=[],i=0;i=0;t-=1)if(i=s(vy[t]),r=ti(i,n),r!==null&&r>1)return i;return n}function wy(n,t){var i=new iv(n.renderRange,t);return new rv(i,!1)}function ywt(n){var r=n.navLinkData?{"data-navlink":n.navLinkData,tabIndex:0}:{};return t(c,null,n.text&&t("a",i({className:"fc-list-day-text"},r),n.text),n.sideText&&t("a",i({className:"fc-list-day-side-text"},r),n.sideText))}function pwt(n){var r=n.event,u=r.url,f=u?{href:u}:{};return t("a",i({},f),r.title)}function wwt(n,i,r){var u=r.options,s;if(u.displayEventTime!==!1){var h=n.eventRange.def,o=n.eventRange.instance,e=!1,f=void 0;return(h.allDay?e=!0:dk(n.eventRange.range)?n.isStart?f=gr(n,i,r,null,null,o.range.start,n.end):n.isEnd?f=gr(n,i,r,null,null,n.start,o.range.end):e=!0:f=gr(n,i,r),e)?(s={text:r.options.allDayText,view:r.viewApi},t(b,{hookProps:s,classNames:u.allDayClassNames,content:u.allDayContent,defaultContent:bwt,didMount:u.allDayDidMount,willUnmount:u.allDayWillUnmount},function(n,i,r,u){return t("td",{className:["fc-list-event-time"].concat(i).join(" "),ref:n},u)})):t("td",{className:"fc-list-event-time"},f)}return null}function bwt(n){return n.text}function kwt(n){return n.text}function dwt(n){for(var t=a(n.renderRange.start),u=n.renderRange.end,i=[],r=[];t0?t="positive":(n.scrollLeft=1,t=n.scrollLeft>0?"reverse":"negative"),vr(n),t}function nkt(n,t,i,r,u){n.forEach(function(n,f){var h=t[f],c=h.naturalBound,e=h.parentBound,l=e.right-e.left,a=e.bottom-e.bottom,o,s;l>r||a>u?(o=i[f].left-c.left,s=i[f].top-c.top):(o="",s="");ci(n,{position:"relative",left:o,right:-o,top:s})})}function tkt(n,t,i){n.forEach(function(n,r){var u=t[r],o=u.textAlign,s=u.elWidth,e=u.parentBound,h=e.right-e.left,f;f=o==="center"&&h>i?(i-s)/2:"";ci(n,{left:f,right:f,top:0})})}function ikt(){var n=document.createElement("div"),t;return(n.className="fc-sticky",document.body.appendChild(n),t=window.getComputedStyle(n).position,vr(n),t.indexOf("sticky")!==-1)?t:null}function fkt(n){for(var u,i=0,t=0,r=n;t .fc-scroller")}function kkt(n){return n.map(function(n){var t=window.getComputedStyle(n);return{scrollLeft:n.scrollLeft,scrollTop:n.scrollTop,overflowX:t.overflowX,overflowY:t.overflowY,marginBottom:t.marginBottom}})}function dkt(n,t){n.forEach(function(n,i){n.style.overflowX="visible";n.style.overflowY="visible";n.style.marginBottom="";n.style.left=-t[i].scrollLeft+"px"})}function gkt(n,t){n.forEach(function(n,i){var r=t[i];n.style.overflowX=r.overflowX;n.style.overflowY=r.overflowY;n.style.marginBottom=r.marginBottom;n.style.left="";n.scrollLeft=r.scrollLeft;n.scrollTop=r.scrollTop})}function ky(n,t,i,r){var u={labelInterval:i.slotLabelInterval,slotDuration:i.slotDuration},e,g,v,w,b,c,l,k,f;rdt(u,n,t);srt(u,n,t);udt(u,n,t);e=i.slotLabelFormat;g=Array.isArray(e)?e:e!=null?[e]:fdt(u,n,t,i);u.headerFormats=g.map(function(n){return y(n)});u.isTimeScale=Boolean(u.slotDuration.milliseconds);v=null;u.isTimeScale||(w=ii(u.slotDuration).unit,/year|month|week/.test(w)&&(v=w));u.largeUnit=v;u.emphasizeWeeks=tl(u.slotDuration)===1&&ou("weeks",n,t)>=2&&!i.businessHours;b=i.snapDuration;b&&(c=s(b),l=ti(u.slotDuration,c));l==null&&(c=u.slotDuration,l=1);u.snapDuration=c;u.snapsPerSlot=l;var rt=tt(n.slotMaxTime)-tt(n.slotMinTime),o=ort(n.renderRange.start,u,t),h=ort(n.renderRange.end,u,t);for(u.isTimeScale&&(o=t.add(o,n.slotMinTime),h=t.add(p(h,-1),n.slotMaxTime)),u.timeWindowMs=rt,u.normalizedRange={start:o,end:h},k=[],f=o;fot.MAX_TIMELINE_SLOTS&&(console.warn("slotLabelInterval results in too many cells"),n.labelInterval=null));n.slotDuration&&(e=i.countDurationsBetween(r.start,r.end,n.slotDuration),e>ot.MAX_TIMELINE_SLOTS&&(console.warn("slotDuration results in too many cells"),n.slotDuration=null));n.labelInterval&&n.slotDuration&&(u=ti(n.labelInterval,n.slotDuration),(u===null||u<1)&&(console.warn("slotLabelInterval must be a multiple of slotDuration"),n.slotDuration=null))}function srt(n,t,i){var a=t.currentRange,r=n.labelInterval,u,f,o,h,c,e,l,v;if(!r){if(u=void 0,n.slotDuration){for(f=0,o=th;f=ndt)break;n.labelInterval=r}return r}function udt(n,t,i){var h=t.currentRange,r=n.slotDuration,f,u,e,l;if(!r){for(f=srt(n,t,i),u=0,e=th;u1&&o<=nh){r=c;break}}r&&(l=i.countDurationsBetween(h.start,h.end,r),l>tdt&&(r=null));r||(r=f);n.slotDuration=r}return r}function fdt(n,t,i,r){var f,e,o=n.labelInterval,s=ii(o).unit,h=r.weekNumbers,u=f=e=null;s!=="week"||h||(s="day");switch(s){case"year":u={year:"numeric"};break;case"month":ou("years",t,i)>1&&(u={year:"numeric"});f={month:"short"};break;case"week":ou("years",t,i)>1&&(u={year:"numeric"});f={week:"narrow"};break;case"day":ou("years",t,i)>1?u={year:"numeric",month:"long"}:ou("months",t,i)>1&&(u={month:"long"});h&&(f={week:"short"});e={weekday:"narrow",day:"numeric"};break;case"hour":h&&(u={week:"short"});ou("days",t,i)>1&&(f={weekday:"short",day:"numeric",month:"numeric",omitCommas:!0});e={hour:"numeric",minute:"2-digit",omitZeroMinute:!0,meridiem:"short"};break;case"minute":rk(o)/60>=nh?(u={hour:"numeric",meridiem:"short"},f=function(n){return":"+yt(n.date.minute,2)}):u={hour:"numeric",minute:"numeric",meridiem:"short"};break;case"second":uk(o)/60>=nh?(u={hour:"numeric",minute:"2-digit",meridiem:"lowercase"},f=function(n){return":"+yt(n.date.second,2)}):u={hour:"numeric",minute:"2-digit",second:"2-digit",meridiem:"lowercase"};break;case"millisecond":u={hour:"numeric",minute:"2-digit",second:"2-digit",meridiem:"lowercase"};f=function(n){return"."+yt(n.millisecond,3)}}return[].concat(u||[],f||[],e||[])}function ou(n,t,i){var r=t.currentRange,u=null;return n==="years"?u=i.diffWholeYears(r.start,r.end):n==="months"?u=i.diffWholeMonths(r.start,r.end):n==="weeks"?u=i.diffWholeMonths(r.start,r.end):n==="days"&&(u=yr(r.start,r.end)),u||0}function edt(n,t){for(var o=n.slotDates,s=n.emphasizeWeeks,i=null,u=[],r=0,f=o;r1&&!p,e=null,w=k[i]||(p?b:null);d?(o=t.format(u,y),f&&f.text===o?f.colspan+=1:e=hrt(u,o,w)):!f||li(t.countDurationsBetween(n.normalizedRange.start,u,n.labelInterval))?(o=t.format(u,y),e=hrt(u,o,w)):f.colspan+=1;e&&(e.weekStart=v,h.push(e))}return l}function hrt(n,t,i){return{date:n,text:t,rowUnit:i,colspan:1,isWeekStart:!1}}function sdt(n){return n.text}function hdt(n){return{level:n.level,date:n.dateEnv.toDate(n.dateMarker),view:n.viewApi,text:n.text}}function dy(n,t,i){var u=i.countDurationsBetween(t.normalizedRange.start,n,t.snapDuration),f,r;return u<0?0:u>=t.snapDiffToIndex.length?t.snapCnt:(f=Math.floor(u),r=t.snapDiffToIndex[f],li(r)?r+=u-f:r=Math.ceil(r),r)}function rh(n,t){return n===null?{left:"",right:""}:t?{right:n,left:""}:{left:n,right:""}}function uh(n,t){return n?t?{right:n.start,left:-n.end}:{left:n.start,right:-n.end}:{left:"",right:""}}function vdt(n,t){return t.map(function(t){var i=t.toISOString();return n[i]})}function vrt(n,t,i){var o=[],r,u;if(i)for(r=0,u=n;r=0;t-=1)if(u=r[t],i=u.parseMeta(n),i)return{meta:i,sourceDefId:t};return null}function agt(n){for(var t in n)console.warn("Unknown resource prop '"+t+"'")}function vgt(n,t,i){var r=i.options,u=i.dateProfile;if(!n||!t)return nut(r.initialResources||r.resources,u.activeRange,r.refetchResourcesOnNavigate,i);switch(t.type){case"RESET_RESOURCE_SOURCE":return nut(t.resourceSourceInput,u.activeRange,r.refetchResourcesOnNavigate,i);case"PREV":case"NEXT":case"CHANGE_DATE":case"CHANGE_VIEW_TYPE":return ygt(n,u.activeRange,r.refetchResourcesOnNavigate,i);case"RECEIVE_RESOURCES":case"RECEIVE_RESOURCE_ERROR":return wgt(n,t.fetchId,t.fetchRange);case"REFETCH_RESOURCES":return op(n,u.activeRange,i);default:return n}}function nut(n,t,i,r){if(n){var u=cgt(n);return op(u,i?t:null,r)}return null}function ygt(n,t,i,r){return i&&!pgt(n)&&(!n.fetchRange||!hl(n.fetchRange,t))?op(n,t,r):n}function pgt(n){return Boolean(drt(n.sourceDefId).ignoreRange)}function op(n,t,r){var f=drt(n.sourceDefId),u=vt();return f.fetch({resourceSource:n,range:t,context:r},function(n){r.dispatch({type:"RECEIVE_RESOURCES",fetchId:u,fetchRange:t,rawResources:n.rawResources})},function(n){r.dispatch({type:"RECEIVE_RESOURCE_ERROR",fetchId:u,fetchRange:t,error:n})}),i(i({},n),{isFetching:!0,latestFetchId:u})}function wgt(n,t,r){return t===n.latestFetchId?i(i({},n),{isFetching:!1,fetchRange:r}):n}function hp(n,t,r,u){var o,s,c;t===void 0&&(t="");var h=nr(n,tut),f=h.refined,l=h.extra,e={id:f.id||sp+vt(),parentId:f.parentId||t,title:f.title||"",businessHours:f.businessHours?kl(f.businessHours,u):null,ui:dr({editable:f.eventEditable,startEditable:f.eventStartEditable,durationEditable:f.eventDurationEditable,constraint:f.eventConstraint,overlap:f.eventOverlap,allow:f.eventAllow,classNames:f.eventClassNames,backgroundColor:f.eventBackgroundColor,borderColor:f.eventBorderColor,textColor:f.eventTextColor,color:f.eventColor},u),extendedProps:i(i({},l),f.extendedProps)};if(Object.freeze(e.ui.classNames),Object.freeze(e.extendedProps),!r[e.id]&&(r[e.id]=e,f.children))for(o=0,s=f.children;o0)break;t.splice(r,0,n)}function kp(n){var t=i(i(i({},n.extendedProps),n.ui),n);return delete t.ui,delete t.extendedProps,t}function cut(n,t){return n.spec===t.spec&&n.value===t.value}function rti(n,t,i,r,u){var f=oy(n,t);return r?new vp(f,i,u):new ap(f,i,u)}function eti(n,t,i,r,u){var f=wy(n,t);return r?new vp(f,i,u):new ap(f,i,u)}function put(n){for(var i,e=n.depth,u=n.hasChildren,o=n.isExpanded,s=n.onExpanderClick,r=[],f=0;f3;)i.pop()();if(i[1]1&&(u.year==="numeric"||u.year==="2-digit")&&(u.month==="numeric"||u.month==="2-digit")&&(u.day==="numeric"||u.day==="2-digit")&&(e=1),f=this.format(n,i),o=this.format(t,i),f===o)return f;var w=lot(u,e),a=sk(w,c,i),v=a(n),y=a(t),s=aot(f,v,o,y),p=c.separator||r||i.defaultSeparator||"";return s?s.before+v+p+y+s.after:f+p+o},n.prototype.getLargestUnit=function(){switch(this.severity){case 7:case 6:case 5:return"year";case 4:return"month";case 3:return"week";case 2:return"day";default:return"time"}},n}();ck=function(){function n(n){this.cmdStr=n}return n.prototype.format=function(n,t,i){return t.cmdFormatter(this.cmdStr,be(n,null,t,i))},n.prototype.formatRange=function(n,t,i,r){return i.cmdFormatter(this.cmdStr,be(n,t,i,r))},n}();lk=function(){function n(n){this.func=n}return n.prototype.format=function(n,t,i){return this.func(be(n,null,t,i))},n.prototype.formatRange=function(n,t,i,r){return this.func(be(n,t,i,r))},n}();var fl={navLinkDayClick:r,navLinkWeekClick:r,duration:s,bootstrapFontAwesome:r,buttonIcons:r,customButtons:r,defaultAllDayEventDuration:s,defaultTimedEventDuration:s,nextDayThreshold:s,scrollTime:s,scrollTimeReset:Boolean,slotMinTime:s,slotMaxTime:s,dayPopoverFormat:y,slotDuration:s,snapDuration:s,headerToolbar:r,footerToolbar:r,defaultRangeSeparator:String,titleRangeSeparator:String,forceEventDuration:Boolean,dayHeaders:Boolean,dayHeaderFormat:y,dayHeaderClassNames:r,dayHeaderContent:r,dayHeaderDidMount:r,dayHeaderWillUnmount:r,dayCellClassNames:r,dayCellContent:r,dayCellDidMount:r,dayCellWillUnmount:r,initialView:String,aspectRatio:Number,weekends:Boolean,weekNumberCalculation:r,weekNumbers:Boolean,weekNumberClassNames:r,weekNumberContent:r,weekNumberDidMount:r,weekNumberWillUnmount:r,editable:Boolean,viewClassNames:r,viewDidMount:r,viewWillUnmount:r,nowIndicator:Boolean,nowIndicatorClassNames:r,nowIndicatorContent:r,nowIndicatorDidMount:r,nowIndicatorWillUnmount:r,showNonCurrentDates:Boolean,lazyFetching:Boolean,startParam:String,endParam:String,timeZoneParam:String,timeZone:String,locales:r,locale:r,themeSystem:String,dragRevertDuration:Number,dragScroll:Boolean,allDayMaintainDuration:Boolean,unselectAuto:Boolean,dropAccept:r,eventOrder:ce,eventOrderStrict:Boolean,handleWindowResize:Boolean,windowResizeDelay:Number,longPressDelay:Number,eventDragMinDistance:Number,expandRows:Boolean,height:r,contentHeight:r,direction:String,weekNumberFormat:y,eventResizableFromStart:Boolean,displayEventTime:Boolean,displayEventEnd:Boolean,weekText:String,progressiveEventRendering:Boolean,businessHours:r,initialDate:r,now:r,eventDataTransform:r,stickyHeaderDates:r,stickyFooterScrollbar:r,viewHeight:r,defaultAllDay:Boolean,eventSourceFailure:r,eventSourceSuccess:r,eventDisplay:String,eventStartEditable:Boolean,eventDurationEditable:Boolean,eventOverlap:r,eventConstraint:r,eventAllow:r,eventBackgroundColor:String,eventBorderColor:String,eventTextColor:String,eventColor:String,eventClassNames:r,eventContent:r,eventDidMount:r,eventWillUnmount:r,selectConstraint:r,selectOverlap:r,selectAllow:r,droppable:Boolean,unselectCancel:String,slotLabelFormat:r,slotLaneClassNames:r,slotLaneContent:r,slotLaneDidMount:r,slotLaneWillUnmount:r,slotLabelClassNames:r,slotLabelContent:r,slotLabelDidMount:r,slotLabelWillUnmount:r,dayMaxEvents:r,dayMaxEventRows:r,dayMinWidth:Number,slotLabelInterval:s,allDayText:String,allDayClassNames:r,allDayContent:r,allDayDidMount:r,allDayWillUnmount:r,slotMinWidth:Number,navLinks:Boolean,eventTimeFormat:y,rerenderDelay:Number,moreLinkText:r,selectMinDistance:Number,selectable:Boolean,selectLongPressDelay:Number,eventLongPressDelay:Number,selectMirror:Boolean,eventMaxStack:Number,eventMinHeight:Number,eventMinWidth:Number,eventShortHeight:Number,slotEventOverlap:Boolean,plugins:r,firstDay:Number,dayCount:Number,dateAlignment:String,dateIncrement:s,hiddenDays:r,monthMode:Boolean,fixedWeekCount:Boolean,validRange:r,visibleRange:r,titleFormat:r,noEventsText:String,moreLinkClick:r,moreLinkClassNames:r,moreLinkContent:r,moreLinkDidMount:r,moreLinkWillUnmount:r},ri={eventDisplay:"auto",defaultRangeSeparator:" - ",titleRangeSeparator:" – ",defaultTimedEventDuration:"01:00:00",defaultAllDayEventDuration:{day:1},forceEventDuration:!1,nextDayThreshold:"00:00:00",dayHeaders:!0,initialView:"",aspectRatio:1.35,headerToolbar:{start:"title",center:"",end:"today prev,next"},weekends:!0,weekNumbers:!1,weekNumberCalculation:"local",editable:!1,nowIndicator:!1,scrollTime:"06:00:00",scrollTimeReset:!0,slotMinTime:"00:00:00",slotMaxTime:"24:00:00",showNonCurrentDates:!0,lazyFetching:!0,startParam:"start",endParam:"end",timeZoneParam:"timeZone",timeZone:"local",locales:[],locale:"",themeSystem:"standard",dragRevertDuration:500,dragScroll:!0,allDayMaintainDuration:!1,unselectAuto:!0,dropAccept:"*",eventOrder:"start,-duration,allDay,title",dayPopoverFormat:{month:"long",day:"numeric",year:"numeric"},handleWindowResize:!0,windowResizeDelay:100,longPressDelay:1e3,eventDragMinDistance:5,expandRows:!1,navLinks:!1,selectable:!1,eventMinHeight:15,eventMinWidth:30,eventShortHeight:30},ak={datesSet:r,eventsSet:r,eventAdd:r,eventChange:r,eventRemove:r,windowResize:r,eventClick:r,eventMouseEnter:r,eventMouseLeave:r,select:r,unselect:r,loading:r,_unmount:r,_beforeprint:r,_afterprint:r,_noEventDrop:r,_noEventResize:r,_resize:r,_scrollRequest:r},vk={buttonText:r,views:r,plugins:r,initialEvents:r,events:r,eventSources:r},el={headerToolbar:ke,footerToolbar:ke,buttonText:ke,buttonIcons:ke};yk={type:String,component:r,buttonText:String,buttonTextKey:String,dateProfileGeneratorClass:r,usesMinMaxTime:Boolean,classNames:r,content:r,didMount:r,willUnmount:r};gu={display:String,editable:Boolean,startEditable:Boolean,durationEditable:Boolean,constraint:r,overlap:r,allow:r,className:du,classNames:du,color:String,backgroundColor:String,borderColor:String,textColor:String};pk={display:null,startEditable:null,durationEditable:null,constraints:[],overlap:null,allows:[],backgroundColor:"",borderColor:"",textColor:"",classNames:[]};var to={id:String,groupId:String,title:String,url:String},wk={start:r,end:r,date:r,allDay:Boolean},bot=i(i(i({},to),wk),{extendedProps:r});od={start:r,end:r,allDay:Boolean};vl=function(){function n(n,t,i){this.type=n;this.getCurrentData=t;this.dateEnv=i}return Object.defineProperty(n.prototype,"calendar",{get:function(){return this.getCurrentData().calendarApi},enumerable:!1,configurable:!0}),Object.defineProperty(n.prototype,"title",{get:function(){return this.getCurrentData().viewTitle},enumerable:!1,configurable:!0}),Object.defineProperty(n.prototype,"activeStart",{get:function(){return this.dateEnv.toDate(this.getCurrentData().dateProfile.activeRange.start)},enumerable:!1,configurable:!0}),Object.defineProperty(n.prototype,"activeEnd",{get:function(){return this.dateEnv.toDate(this.getCurrentData().dateProfile.activeRange.end)},enumerable:!1,configurable:!0}),Object.defineProperty(n.prototype,"currentStart",{get:function(){return this.dateEnv.toDate(this.getCurrentData().dateProfile.currentRange.start)},enumerable:!1,configurable:!0}),Object.defineProperty(n.prototype,"currentEnd",{get:function(){return this.dateEnv.toDate(this.getCurrentData().dateProfile.currentRange.end)},enumerable:!1,configurable:!0}),n.prototype.getOption=function(n){return this.getCurrentData().options[n]},n}();ld={id:String,defaultAllDay:Boolean,url:String,format:String,events:r,eventDataTransform:r,success:r,failure:r};pi=function(){function n(){}return n.prototype.getCurrentData=function(){return this.currentDataManager.getCurrentData()},n.prototype.dispatch=function(n){return this.currentDataManager.dispatch(n)},Object.defineProperty(n.prototype,"view",{get:function(){return this.getCurrentData().viewApi},enumerable:!1,configurable:!0}),n.prototype.batchRendering=function(n){n()},n.prototype.updateSize=function(){this.trigger("_resize",!0)},n.prototype.setOption=function(n,t){this.dispatch({type:"SET_OPTION",optionName:n,rawOptionValue:t})},n.prototype.getOption=function(n){return this.currentDataManager.currentCalendarOptionsInput[n]},n.prototype.getAvailableLocaleCodes=function(){return Object.keys(this.getCurrentData().availableRawLocales)},n.prototype.on=function(n,t){var i=this.currentDataManager;if(i.currentCalendarOptionsRefiners[n])i.emitter.on(n,t);else console.warn("Unknown listener name '"+n+"'")},n.prototype.off=function(n,t){this.currentDataManager.emitter.off(n,t)},n.prototype.trigger=function(n){for(var i,r=[],t=1;t=r[t]&&n=r[t]&&n0},n.prototype.canScrollHorizontally=function(){return this.getMaxScrollLeft()>0},n.prototype.canScrollUp=function(){return this.getScrollTop()>0},n.prototype.canScrollDown=function(){return this.getScrollTop()0},n.prototype.canScrollRight=function(){return this.getScrollLeft()1&&(t=a(t),t=p(t,-1),t=u.add(t,e))),{start:i,end:t}},n.prototype.buildRangeFromDuration=function(n,t,i,r){function l(){u=h.startOf(n,e);c=h.add(u,i);o={start:u,end:c}}var s=this.props,h=s.dateEnv,e=s.dateAlignment,u,c,o,f;return e||(f=this.props.dateIncrement,e=f?tt(f)u.end&&(f+=this.insertEntry({index:n.index,thickness:n.thickness,span:{start:u.end,end:r.end}},e)),f)?(i.push.apply(i,l([{index:n.index,thickness:n.thickness,span:ko(u,r)}],e)),f):(i.push(n),0)},n.prototype.insertEntryAt=function(n,t){var u=this,f=u.entriesByLevel,r=u.levelCoords,i=t.level;i>=r.length||r[i]>t.levelCoord?(pa(r,i,t.levelCoord),pa(f,i,[n])):pa(f[i],t.lateralEnd,n);this.stackCnts[ki(n)]=t.stackCnt},n.prototype.findInsertion=function(n){for(var r,f=this,h=f.levelCoords,p=f.entriesByLevel,w=f.stackCnts,c=f.strictOrder,b=h.length,t=0,l=0,s=0,e=0,a=-1,o=null,i=0;i=t+n.thickness)break;var v=p[i],u=void 0,y=wa(v,n.span.start,va);for(s=y[0]+y[1],e=s;(u=v[e])&&u.span.startr)&&(t=r+u.thickness,a=i,o=u),e+=1;r1?(w=a&&o.getClass("buttonGroup")||"",t.apply(void 0,l(["div",{className:w}],f))):f[0]},r}(e),vn=function(n){function i(){return n!==null&&n.apply(this,arguments)||this}return u(i,n),i.prototype.render=function(){var f=this.props,n=f.model,o=f.extraClassName,i=!1,r,u,s=n.center,e;return n.left?(i=!0,r=n.left):r=n.start,n.right?(i=!0,u=n.right):u=n.end,e=[o||"","fc-toolbar",i?"fc-toolbar-ltr":"",],t("div",{className:e.join(" ")},this.renderSection("start",r||[]),this.renderSection("center",s||[]),this.renderSection("end",u||[]))},i.prototype.renderSection=function(n,i){var r=this.props;return t(lat,{key:n,widgetGroups:i,title:r.title,activeButton:r.activeButton,isTodayEnabled:r.isTodayEnabled,isPrevEnabled:r.isPrevEnabled,isNextEnabled:r.isNextEnabled})},i}(e),aat=function(n){function i(){var t=n!==null&&n.apply(this,arguments)||this;return t.state={availableWidth:null},t.handleEl=function(n){t.el=n;g(t.props.elRef,n);t.updateAvailableWidth()},t.handleResize=function(){t.updateAvailableWidth()},t}return u(i,n),i.prototype.render=function(){var u=this,n=u.props,f=u.state,i=n.aspectRatio,o=["fc-view-harness",i||n.liquid||n.height?"fc-view-harness-active":"fc-view-harness-passive",],r="",e="";return i?f.availableWidth!==null?r=f.availableWidth/i:e=100/i+"%":r=n.height||"",t("div",{ref:this.handleEl,onClick:n.onClick,className:o.join(" "),style:{height:r,paddingBottom:e}},n.children)},i.prototype.componentDidMount=function(){this.context.addResizeHandler(this.handleResize)},i.prototype.componentWillUnmount=function(){this.context.removeResizeHandler(this.handleResize)},i.prototype.updateAvailableWidth=function(){this.el&&this.props.aspectRatio&&this.setState({availableWidth:this.el.offsetWidth})},i}(e),vat=function(n){function t(t){var i=n.call(this,t)||this;return i.handleSegClick=function(n,t){var r=i.component,o=r.context,u=ir(t),f,e;u&&r.isValidSegDownEl(n.target)&&(f=d(n.target,".fc-event-forced-url"),e=f?f.querySelector("a[href]").href:"",o.emitter.trigger("eventClick",{el:t,event:new v(r.context,u.eventRange.def,u.eventRange.instance),jsEvent:n,view:o.viewApi}),e&&!n.defaultPrevented&&(window.location.href=e))},i.destroy=hc(t.el,"click",".fc-event",i.handleSegClick),i}return u(t,n),t}(di),yat=function(n){function t(t){var i=n.call(this,t)||this;return i.handleEventElRemove=function(n){n===i.currentSegEl&&i.handleSegLeave(null,i.currentSegEl)},i.handleSegEnter=function(n,t){ir(t)&&(i.currentSegEl=t,i.triggerEvent("eventMouseEnter",n,t))},i.handleSegLeave=function(n,t){i.currentSegEl&&(i.currentSegEl=null,i.triggerEvent("eventMouseLeave",n,t))},i.removeHoverListeners=iet(t.el,".fc-event",i.handleSegEnter,i.handleSegLeave),i}return u(t,n),t.prototype.destroy=function(){this.removeHoverListeners()},t.prototype.triggerEvent=function(n,t,i){var u=this.component,r=u.context,f=ir(i);(!t||u.isValidSegDownEl(t.target))&&r.emitter.trigger(n,{el:i,event:new v(r,f.eventRange.def,f.eventRange.instance),jsEvent:t,view:r.viewApi})},t}(di),yn=function(n){function r(){var t=n!==null&&n.apply(this,arguments)||this;return t.buildViewContext=f(sht),t.buildViewPropTransformers=f(wat),t.buildToolbarProps=f(pat),t.handleNavLinkClick=ob("a[data-navlink]",t._handleNavLinkClick.bind(t)),t.headerRef=h(),t.footerRef=h(),t.interactionsStore={},t.registerInteractiveComponent=function(n,i){var r=hat(n,i),u=[vat,yat,],f=u.concat(t.props.pluginHooks.componentInteractions),e=f.map(function(n){return new n(r)});t.interactionsStore[n.uid]=e;vf[n.uid]=r},t.unregisterInteractiveComponent=function(n){for(var u,i=0,r=t.interactionsStore[n.uid];i1?{"data-navlink":ur(u),tabIndex:0}:{},y=i(i(i({date:o.toDate(u),view:h},n.extraHookProps),{text:a}),f);return t(b,{hookProps:y,classNames:r.dayHeaderClassNames,content:r.dayHeaderContent,defaultContent:pn,didMount:r.dayHeaderDidMount,willUnmount:r.dayHeaderWillUnmount},function(r,e,o,s){return t("th",i({ref:r,className:l.concat(e).join(" "),"data-date":f.isDisabled?undefined:br(u),colSpan:n.colSpan},n.extraDataAttrs),t("div",{className:"fc-scrollgrid-sync-inner"},!f.isDisabled&&t("a",i({ref:o,className:["fc-col-header-cell-cushion",n.isSticky?"fc-sticky":"",].join(" ")},v),s)))})},r}(e),tv=function(n){function r(){return n!==null&&n.apply(this,arguments)||this}return u(r,n),r.prototype.render=function(){var n=this.props,r=this.context,o=r.dateEnv,s=r.theme,h=r.viewApi,u=r.options,f=p(new Date(2592e5),n.dow),e={dow:n.dow,isDisabled:!1,isFuture:!1,isPast:!1,isToday:!1,isOther:!1},c=[ga].concat(rr(e,s),n.extraClassNames||[]),l=o.format(f,n.dayHeaderFormat),a=i(i(i(i({date:f},e),{view:h}),n.extraHookProps),{text:l});return t(b,{hookProps:a,classNames:u.dayHeaderClassNames,content:u.dayHeaderContent,defaultContent:pn,didMount:u.dayHeaderDidMount,willUnmount:u.dayHeaderWillUnmount},function(r,u,f,e){return t("th",i({ref:r,className:c.concat(u).join(" "),colSpan:n.colSpan},n.extraDataAttrs),t("div",{className:"fc-scrollgrid-sync-inner"},t("a",{className:["fc-col-header-cell-cushion",n.isSticky?"fc-sticky":"",].join(" "),ref:f},e)))})},r}(e),at=function(n){function t(t,i){var r=n.call(this,t,i)||this;return r.initialNowDate=of(i.options.now,i.dateEnv),r.initialNowQueriedMs=(new Date).valueOf(),r.state=r.computeTiming().currentState,r}return u(t,n),t.prototype.render=function(){var n=this,i=n.props,t=n.state;return i.children(t.nowDate,t.todayRange)},t.prototype.componentDidMount=function(){this.setTimeout()},t.prototype.componentDidUpdate=function(n){n.unit!==this.props.unit&&(this.clearTimeout(),this.setTimeout())},t.prototype.componentWillUnmount=function(){this.clearTimeout()},t.prototype.computeTiming=function(){var r=this,u=r.props,f=r.context,e=gt(this.initialNowDate,(new Date).valueOf()-this.initialNowQueriedMs),n=f.dateEnv.startOf(e,u.unit),t=f.dateEnv.add(n,s(1,u.unit)),i=t.valueOf()-e.valueOf();return i=Math.min(864e5,i),{currentState:{nowDate:n,todayRange:wn(n)},nextState:{nowDate:t,todayRange:wn(t)},waitMs:i}},t.prototype.setTimeout=function(){var n=this,t=this.computeTiming(),i=t.nextState,r=t.waitMs;this.timeoutId=setTimeout(function(){n.setState(i,function(){n.setTimeout()})},r)},t.prototype.clearTimeout=function(){this.timeoutId&&clearTimeout(this.timeoutId)},t.contextType=lt,t}(ao);ts=function(n){function i(){var t=n!==null&&n.apply(this,arguments)||this;return t.createDayHeaderFormatter=f(bat),t}return u(i,n),i.prototype.render=function(){var e=this.context,n=this.props,i=n.dates,o=n.dateProfile,r=n.datesRepDistinctDays,u=n.renderIntro,f=this.createDayHeaderFormatter(e.options.dayHeaderFormat,r,i.length);return t(at,{unit:"day"},function(n,e){return t("tr",null,u&&u("day"),i.map(function(n){return r?t(nv,{key:n.toISOString(),date:n,dateProfile:o,todayRange:e,colCnt:i.length,dayHeaderFormat:f}):t(tv,{key:n.getUTCDay(),dow:n.getUTCDay(),dayHeaderFormat:f})}))})},i}(e);var iv=function(){function n(n,t){for(var i=n.start,e=n.end,r=[],u=[],f=-1;i=t.length?t[t.length-1]+1:t[i]},n}(),rv=function(){function n(n,t){var r=n.dates,i,f,u;if(t){for(f=r[0].getUTCDay(),i=1;iu)return!0;return!1},i.prototype.needsYScrolling=function(){var n,i;if(us.test(this.props.overflowY))return!1;var r=this.el,u=this.el.getBoundingClientRect().height-this.getXScrollbarWidth(),t=r.children;for(n=0;nu)return!0;return!1},i.prototype.getXScrollbarWidth=function(){return us.test(this.props.overflowX)?0:this.el.offsetHeight-this.el.clientHeight},i.prototype.getYScrollbarWidth=function(){return us.test(this.props.overflowY)?0:this.el.offsetWidth-this.el.clientWidth},i}(e),nt=function(){function n(n){var t=this;this.masterCallback=n;this.currentMap={};this.depths={};this.callbackMap={};this.handleValue=function(n,i){var e=t,r=e.depths,u=e.currentMap,f=!1,o=!1;n!==null?(f=i in u,u[i]=n,r[i]=(r[i]||0)+1,o=!0):(r[i]-=1,r[i]||(delete u[i],delete t.callbackMap[i],f=!0));t.masterCallback&&(f&&t.masterCallback(null,String(i)),o&&t.masterCallback(n,String(i)))}}return n.prototype.createRef=function(n){var i=this,t=this.callbackMap[n];return t||(t=this.callbackMap[n]=function(t){i.handleValue(t,String(n))}),t},n.prototype.collect=function(n,t,i){return gc(this.currentMap,n,t,i)},n.prototype.getAll=function(){return kc(this.currentMap)},n}();pf=function(n){function r(){var t=n!==null&&n.apply(this,arguments)||this;return t.processCols=f(function(n){return n},cv),t.renderMicroColGroup=f(lv),t.scrollerRefs=new nt,t.scrollerElRefs=new nt(t._handleScrollerEl.bind(t)),t.state={shrinkWidth:null,forceYScrollbars:!1,scrollerClientWidths:{},scrollerClientHeights:{}},t.handleSizing=function(){t.setState(i({shrinkWidth:t.computeShrinkWidth()},t.computeScrollerDims()))},t}return u(r,n),r.prototype.render=function(){var h=this,r=h.props,y=h.state,p=h.context,f=r.sections||[],w=this.processCols(r.cols),c=this.renderMicroColGroup(w,y.shrinkWidth),v=yv(r.liquid,p),u;r.collapsibleWidth&&v.push("fc-scrollgrid-collapsible");for(var a=f.length,n=0,i,e=[],o=[],s=[];n=0&&n=0&&t0&&(this.everMovedDown=!0);f<0?this.everMovedLeft=!0:f>0&&(this.everMovedRight=!0);this.pointerScreenX=i;this.pointerScreenY=r;this.isAnimating||(this.isAnimating=!0,this.requestAnimation(ett()))}},n.prototype.stop=function(){var n,t,i;if(this.isEnabled){for(this.isAnimating=!1,n=0,t=this.scrollCaches;n=0&&o>=0&&s>=0&&h>=0&&(s<=u&&this.everMovedUp&&r.canScrollUp()&&(!i||i.distance>s)&&(i={scrollCache:r,name:"top",distance:s}),h<=u&&this.everMovedDown&&r.canScrollDown()&&(!i||i.distance>h)&&(i={scrollCache:r,name:"bottom",distance:h}),e<=u&&this.everMovedLeft&&r.canScrollLeft()&&(!i||i.distance>e)&&(i={scrollCache:r,name:"left",distance:e}),o<=u&&this.everMovedRight&&r.canScrollRight()&&(!i||i.distance>o)&&(i={scrollCache:r,name:"right",distance:o}))}return i},n.prototype.buildCaches=function(){return this.queryScrollEls().map(function(n){return n===window?new kvt(!1):new ftt(n,!1)})},n.prototype.queryScrollEls=function(){for(var t,n=[],i=0,r=this.scrollQuery;i=t*t&&r.handleDistanceSurpassed(n)}r.isDragging&&(n.origEvent.type!=="scroll"&&(r.mirror.handleMove(n.pageX,n.pageY),r.autoScroller.handleMove(n.pageX,n.pageY)),r.emitter.trigger("dragmove",n))}};r.onPointerUp=function(n){r.isInteracting&&(r.isInteracting=!1,cb(document.body),ab(document.body),r.emitter.trigger("pointerup",n),r.isDragging&&(r.autoScroller.stop(),r.tryStopDrag(n)),r.delayTimeoutId&&(clearTimeout(r.delayTimeoutId),r.delayTimeoutId=null))};u=r.pointer=new as(t);u.emitter.on("pointerdown",r.onPointerDown);u.emitter.on("pointermove",r.onPointerMove);u.emitter.on("pointerup",r.onPointerUp);return i&&(u.selector=i),r.mirror=new bvt,r.autoScroller=new dvt,r}return u(t,n),t.prototype.destroy=function(){this.pointer.destroy();this.onPointerUp({})},t.prototype.startDelay=function(n){var t=this;typeof this.delay=="number"?this.delayTimeoutId=setTimeout(function(){t.delayTimeoutId=null;t.handleDelayEnd(n)},this.delay):this.handleDelayEnd(n)},t.prototype.handleDelayEnd=function(n){this.isDelayEnded=!0;this.tryStartDrag(n)},t.prototype.handleDistanceSurpassed=function(n){this.isDistanceSurpassed=!0;this.tryStartDrag(n)},t.prototype.tryStartDrag=function(n){this.isDelayEnded&&this.isDistanceSurpassed&&(!this.pointer.wasTouchScroll||this.touchScrollAllowed)&&(this.isDragging=!0,this.mirrorNeedsRevert=!1,this.autoScroller.start(n.pageX,n.pageY),this.emitter.trigger("dragstart",n),this.touchScrollAllowed===!1&&this.pointer.cancelTouchScroll())},t.prototype.tryStopDrag=function(n){this.mirror.stop(this.mirrorNeedsRevert,this.stopDrag.bind(this,n))},t.prototype.stopDrag=function(n){this.isDragging=!1;this.emitter.trigger("dragend",n)},t.prototype.setIgnoreMove=function(n){this.pointer.shouldIgnoreMove=n},t.prototype.setMirrorIsVisible=function(n){this.mirror.setIsVisible(n)},t.prototype.setMirrorNeedsRevert=function(n){this.mirrorNeedsRevert=n},t.prototype.setAutoScrollEnabled=function(n){this.autoScroller.isEnabled=n},t}(ba),gvt=function(){function n(n){this.origRect=co(n);this.scrollCaches=ea(n).map(function(n){return new ftt(n,!0)})}return n.prototype.destroy=function(){for(var i,n=0,t=this.scrollCaches;n=0&&c=0&&lu.layer)&&(i.componentId=f,i.context=o.context,i.rect.left+=s,i.rect.right+=s,i.rect.top+=h,i.rect.bottom+=h,u=i))}return u},n}();ott=function(n){function t(t){var r=n.call(this,t)||this,u;r.handlePointerDown=function(n){var t=r.dragging,i=n.origEvent.target;t.setIgnoreMove(!r.component.isValidDateDownEl(i))};r.handleDragEnd=function(n){var s=r.component,h=r.dragging.pointer,t,o;if(!h.wasTouchScroll){var f=r.hitDragging,u=f.initialHit,e=f.finalHit;u&&e&&vs(u,e)&&(t=s.context,o=i(i({},dv(u.dateSpan,t)),{dayEl:u.dayEl,jsEvent:n.origEvent,view:t.viewApi||t.calendarApi.view}),t.emitter.trigger("dateClick",o))}};r.dragging=new lr(t.el);r.dragging.autoScroller.isEnabled=!1;u=r.hitDragging=new uu(r.dragging,go(t));u.emitter.on("pointerdown",r.handlePointerDown);u.emitter.on("dragend",r.handleDragEnd);return r}return u(t,n),t.prototype.destroy=function(){this.dragging.destroy()},t}(di);stt=function(n){function t(t){var i=n.call(this,t)||this,r;i.dragSelection=null;i.handlePointerDown=function(n){var r=i,t=r.component,u=r.dragging,f=t.context.options,e=f.selectable&&t.isValidDateDownEl(n.origEvent.target);u.setIgnoreMove(!e);u.delay=n.isTouch?iyt(t):null};i.handleDragStart=function(n){i.component.context.calendarApi.unselect(n)};i.handleHitUpdate=function(n,t){var u=i.component.context,r=null,e=!1,f,o;n&&(f=i.hitDragging.initialHit,o=n.componentId===f.componentId&&i.isHitComboAllowed&&!i.isHitComboAllowed(f,n),o||(r=ryt(f,n,u.pluginHooks.dateSelectionTransformers)),r&&bn(r,n.dateProfile,u)||(e=!0,r=null));r?u.dispatch({type:"SELECT_DATES",selection:r}):t||u.dispatch({type:"UNSELECT_DATES"});e?au():vu();t||(i.dragSelection=r)};i.handlePointerUp=function(n){i.dragSelection&&(ll(i.dragSelection,n,i.component.context),i.dragSelection=null)};var e=t.component,f=e.context.options,u=i.dragging=new lr(t.el);u.touchScrollAllowed=!1;u.minDistance=f.selectMinDistance||0;u.autoScroller.isEnabled=f.dragScroll;r=i.hitDragging=new uu(i.dragging,go(t));r.emitter.on("pointerdown",i.handlePointerDown);r.emitter.on("dragstart",i.handleDragStart);r.emitter.on("hitupdate",i.handleHitUpdate);r.emitter.on("pointerup",i.handlePointerUp);return i}return u(t,n),t.prototype.destroy=function(){this.dragging.destroy()},t}(di);gv=function(n){function t(r){var u=n.call(this,r)||this,f;u.subjectEl=null;u.subjectSeg=null;u.isDragging=!1;u.eventRange=null;u.relevantEvents=null;u.receivingContext=null;u.validMutation=null;u.mutatedRelevantEvents=null;u.handlePointerDown=function(n){var f=n.origEvent.target,o=u,t=o.component,i=o.dragging,s=i.mirror,r=t.context.options,c=t.context,e;u.subjectEl=n.subjectEl;var l=u.subjectSeg=ir(n.subjectEl),a=u.eventRange=l.eventRange,h=a.instance.instanceId;u.relevantEvents=ge(c.getCurrentData().eventStore,h);i.minDistance=n.isTouch?0:r.eventDragMinDistance;i.delay=n.isTouch&&h!==t.props.eventSelection?fyt(t):null;s.parentNode=r.fixedMirrorParent?r.fixedMirrorParent:d(f,".fc");s.revertDuration=r.dragRevertDuration;e=t.isValidSegDownEl(f)&&!d(f,".fc-event-resizer");i.setIgnoreMove(!e);u.isDragging=e&&n.subjectEl.classList.contains("fc-event-draggable")};u.handleDragStart=function(n){var t=u.component.context,i=u.eventRange,r=i.instance.instanceId;n.isTouch?r!==u.component.props.eventSelection&&t.dispatch({type:"SELECT_EVENT",eventInstanceId:r}):t.dispatch({type:"UNSELECT_EVENT"});u.isDragging&&(t.calendarApi.unselect(n),t.emitter.trigger("eventDragStart",{el:u.subjectEl,event:new v(t,i.def,i.instance),jsEvent:n.origEvent,view:t.viewApi}))};u.handleHitUpdate=function(n,t){var o;if(u.isDragging){var s=u.relevantEvents,h=u.hitDragging.initialHit,c=u.component.context,i=null,r=null,f=null,l=!1,e={affectedEvents:s,mutatedEvents:it(),isEvent:!0};n&&(i=n.context,o=i.options,c===i||o.editable&&o.droppable?(r=uyt(h,n,i.getCurrentData().pluginHooks.eventDragMutationMassagers),r&&(f=eo(s,i.getCurrentData().eventUiBases,r,i),e.mutatedEvents=f,rs(e,n.dateProfile,i)||(l=!0,r=null,f=null,e.mutatedEvents=it()))):i=null);u.displayDrag(i,e);l?au():vu();t||(c===i&&vs(h,n)&&(r=null),u.dragging.setMirrorNeedsRevert(!r),u.dragging.setMirrorIsVisible(!n||!document.querySelector(".fc-event-mirror")),u.receivingContext=i,u.validMutation=r,u.mutatedRelevantEvents=f)}};u.handlePointerUp=function(){u.isDragging||u.cleanup()};u.handleDragEnd=function(n){var nt,p,w,s,b,tt,k,d;if(u.isDragging){var t=u.component.context,h=t.viewApi,g=u,r=g.receivingContext,c=g.validMutation,l=u.eventRange.def,e=u.eventRange.instance,a=new v(t,l,e),o=u.relevantEvents,f=u.mutatedRelevantEvents,y=u.hitDragging.finalHit;if(u.clearDrag(),t.emitter.trigger("eventDragStop",{el:u.subjectEl,event:a,jsEvent:n.origEvent,view:h}),c){if(r===t){for(nt=new v(t,f.defs[l.defId],e?f.instances[e.instanceId]:null),t.dispatch({type:"MERGE_EVENTS",eventStore:f}),p={oldEvent:a,event:nt,relatedEvents:wi(f,t,e),revert:function(){t.dispatch({type:"MERGE_EVENTS",eventStore:o})}},w={},s=0,b=t.getCurrentData().pluginHooks.eventDropTransformers;s=0)for(o=t.lateralStart;o1,showWeekNumbers:n.showWeekNumbers,todayRange:o,dateProfile:h,cells:f,renderIntro:n.renderRowIntro,businessHourSegs:l[e],eventSelection:n.eventSelection,bgEventSegs:a[e].filter(fpt),fgEventSegs:v[e],dateSelectionSegs:y[e],eventDrag:p[e],eventResize:w[e],dayMaxEvents:u,dayMaxEventRows:r,clientWidth:n.clientWidth,clientHeight:n.clientHeight,forPrint:n.forPrint})}))))}))},r.prototype.prepareHits=function(){this.rowPositions=new fi(this.rootEl,this.rowRefs.collect().map(function(n){return n.getCellEls()[0]}),!1,!0);this.colPositions=new fi(this.rootEl,this.rowRefs.currentMap[0].getCellEls(),!0,!1)},r.prototype.queryHit=function(n,t){var o=this,f=o.colPositions,e=o.rowPositions,r=f.leftToIndex(n),u=e.topToIndex(t),s;return u!=null&&r!=null?(s=this.props.cells[u][r],{dateProfile:this.props.dateProfile,dateSpan:i({range:this.getCellRange(u,r),allDay:!0},s.extraDateSpan),dayEl:this.getCellEl(u,r),rect:{left:f.lefts[r],right:f.rights[r],top:e.tops[u],bottom:e.bottoms[u]},layer:0}):null},r.prototype.getCellEl=function(n,t){return this.rowRefs.currentMap[n].getCellEls()[t]},r.prototype.getCellRange=function(n,t){var i=this.props.cells[n][t].date,r=p(i,1);return{start:i,end:r}},r}(rt);var fy=function(n){function t(){var t=n!==null&&n.apply(this,arguments)||this;return t.forceDayIfListItem=!0,t}return u(t,n),t.prototype.sliceRange=function(n,t){return t.sliceRange(n)},t}(is),ey=function(n){function r(){var t=n!==null&&n.apply(this,arguments)||this;return t.slicer=new fy,t.tableRef=h(),t}return u(r,n),r.prototype.render=function(){var r=this,n=r.props,u=r.context;return t(ws,i({ref:this.tableRef},this.slicer.sliceProps(n,n.dateProfile,n.nextDayThreshold,u,n.dayTableModel),{dateProfile:n.dateProfile,cells:n.dayTableModel.cells,colGroupNode:n.colGroupNode,tableMinWidth:n.tableMinWidth,renderRowIntro:n.renderRowIntro,dayMaxEvents:n.dayMaxEvents,dayMaxEventRows:n.dayMaxEventRows,showWeekNumbers:n.showWeekNumbers,expandRows:n.expandRows,headerAlignElRef:n.headerAlignElRef,clientWidth:n.clientWidth,clientHeight:n.clientHeight,forPrint:n.forPrint}))},r}(rt),ktt=function(n){function i(){var t=n!==null&&n.apply(this,arguments)||this;return t.buildDayTableModel=f(oy),t.headerRef=h(),t.tableRef=h(),t}return u(i,n),i.prototype.render=function(){var u=this,f=this.context,i=f.options,s=f.dateProfileGenerator,n=this.props,r=this.buildDayTableModel(n.dateProfile,s),e=i.dayHeaders&&t(ts,{ref:this.headerRef,dateProfile:n.dateProfile,dates:r.headerDates,datesRepDistinctDays:r.rowCnt===1}),o=function(f){return t(ey,{ref:u.tableRef,dateProfile:n.dateProfile,dayTableModel:r,businessHours:n.businessHours,dateSelection:n.dateSelection,eventStore:n.eventStore,eventUiBases:n.eventUiBases,eventSelection:n.eventSelection,eventDrag:n.eventDrag,eventResize:n.eventResize,nextDayThreshold:i.nextDayThreshold,colGroupNode:f.tableColGroupNode,tableMinWidth:f.tableMinWidth,dayMaxEvents:i.dayMaxEvents,dayMaxEventRows:i.dayMaxEventRows,showWeekNumbers:i.weekNumbers,expandRows:!n.isHeightAuto,headerAlignElRef:u.headerElRef,clientWidth:f.clientWidth,clientHeight:f.clientHeight,forPrint:n.forPrint})};return i.dayMinWidth?this.renderHScrollLayout(e,o,r.colCnt,i.dayMinWidth):this.renderSimpleLayout(e,o)},i}(ny);var ept=function(n){function t(){return n!==null&&n.apply(this,arguments)||this}return u(t,n),t.prototype.buildRenderRange=function(t,i,r){var o=this.props.dateEnv,s=n.prototype.buildRenderRange.call(this,t,i,r),f=s.start,u=s.end,e,h;return/^(year|month)$/.test(i)&&(f=o.startOfWeek(f),e=o.startOfWeek(u),e.valueOf()!==u.valueOf()&&(u=pc(e,1))),this.props.monthMode&&this.props.fixedWeekCount&&(h=Math.ceil(wb(f,u)),u=pc(u,6-h)),{start:f,end:u}},t}(yo),dtt=k({initialView:"dayGridMonth",views:{dayGrid:{component:ktt,dateProfileGeneratorClass:ept},dayGridDay:{type:"dayGrid",duration:{days:1}},dayGridWeek:{type:"dayGrid",duration:{weeks:1}},dayGridMonth:{type:"dayGrid",duration:{months:1},monthMode:!0,fixedWeekCount:!0}}}),opt=function(n){function t(){return n!==null&&n.apply(this,arguments)||this}return u(t,n),t.prototype.getKeyInfo=function(){return{allDay:{},timed:{}}},t.prototype.getKeysForDateSpan=function(n){return n.allDay?["allDay"]:["timed"]},t.prototype.getKeysForEventDef=function(n){return n.allDay?nd(n)?["timed","allDay"]:["allDay"]:["timed"]},t}(sf),spt=y({hour:"numeric",minute:"2-digit",omitZeroMinute:!0,meridiem:"short"});var cpt=function(n){function r(){return n!==null&&n.apply(this,arguments)||this}return u(r,n),r.prototype.render=function(){return this.props.slatMetas.map(function(n){return t("tr",{key:n.key},t(gtt,i({},n)))})},r}(e),lpt=y({week:"short"}),apt=5,sy=function(n){function r(){var r=n!==null&&n.apply(this,arguments)||this;return r.allDaySplitter=new opt,r.headerElRef=h(),r.rootElRef=h(),r.scrollerElRef=h(),r.state={slatCoords:null},r.handleScrollTopRequest=function(n){var t=r.scrollerElRef.current;t&&(t.scrollTop=n)},r.renderHeadAxis=function(n,u){u===void 0&&(u="");var e=r.context.options,o=r.props.dateProfile,f=o.renderRange,s=ni(f.start,f.end),h=e.navLinks&&s===1?{"data-navlink":ur(f.start,"week"),tabIndex:0}:{};return e.weekNumbers&&n==="day"?t(hs,{date:f.start,defaultFormat:lpt},function(n,r,f,e){return t("th",{ref:n,className:["fc-timegrid-axis","fc-scrollgrid-shrink",].concat(r).join(" ")},t("div",{className:"fc-timegrid-axis-frame fc-scrollgrid-shrink-frame fc-timegrid-axis-frame-liquid",style:{height:u}},t("a",i({ref:f,className:"fc-timegrid-axis-cushion fc-scrollgrid-shrink-cushion fc-scrollgrid-sync-inner"},h),e)))}):t("th",{className:"fc-timegrid-axis"},t("div",{className:"fc-timegrid-axis-frame",style:{height:u}}))},r.renderTableRowAxis=function(n){var u=r.context,i=u.options,f=u.viewApi,e={text:i.allDayText,view:f};return t(b,{hookProps:e,classNames:i.allDayClassNames,content:i.allDayContent,defaultContent:vpt,didMount:i.allDayDidMount,willUnmount:i.allDayWillUnmount},function(i,r,u,f){return t("td",{ref:i,className:["fc-timegrid-axis","fc-scrollgrid-shrink",].concat(r).join(" ")},t("div",{className:"fc-timegrid-axis-frame fc-scrollgrid-shrink-frame"+(n==null?" fc-timegrid-axis-frame-liquid":""),style:{height:n}},t("span",{className:"fc-timegrid-axis-cushion fc-scrollgrid-shrink-cushion fc-scrollgrid-sync-inner",ref:u},f)))})},r.handleSlatCoords=function(n){r.setState({slatCoords:n})},r}return u(r,n),r.prototype.renderSimpleLayout=function(n,i,r){var o=this,f=o.context,e=o.props,u=[],s=hr(f.options);return n&&u.push({type:"header",key:"header",isSticky:s,chunk:{elRef:this.headerElRef,tableClassName:"fc-col-header",rowContent:n}}),i&&(u.push({type:"body",key:"all-day",chunk:{content:i}}),u.push({type:"body",key:"all-day-divider",outerContent:t("tr",{className:"fc-scrollgrid-section"},t("td",{className:"fc-timegrid-divider "+f.theme.getClass("tableCellShaded")}))})),u.push({type:"body",key:"body",liquid:!0,expandRows:Boolean(f.options.expandRows),chunk:{scrollerElRef:this.scrollerElRef,content:r}}),t(bt,{viewSpec:f.viewSpec,elRef:this.rootElRef},function(n,i){return t("div",{className:["fc-timegrid"].concat(i).join(" "),ref:n},t(pf,{liquid:!e.isHeightAuto&&!e.forPrint,collapsibleWidth:e.forPrint,cols:[{width:"shrink"}],sections:u}))})},r.prototype.renderHScrollLayout=function(n,i,r,u,f,e,o){var a=this,v=this.context.pluginHooks.scrollGridImpl,l;if(!v)throw new Error("No ScrollGrid implementation");var y=this,s=y.context,c=y.props,p=!c.forPrint&&hr(s.options),w=!c.forPrint&&yf(s.options),h=[];return n&&h.push({type:"header",key:"header",isSticky:p,syncRowHeights:!0,chunks:[{key:"axis",rowContent:function(n){return t("tr",null,a.renderHeadAxis("day",n.rowSyncHeights[0]))}},{key:"cols",elRef:this.headerElRef,tableClassName:"fc-col-header",rowContent:n},]}),i&&(h.push({type:"body",key:"all-day",syncRowHeights:!0,chunks:[{key:"axis",rowContent:function(n){return t("tr",null,a.renderTableRowAxis(n.rowSyncHeights[0]))}},{key:"cols",content:i},]}),h.push({key:"all-day-divider",type:"body",outerContent:t("tr",{className:"fc-scrollgrid-section"},t("td",{colSpan:2,className:"fc-timegrid-divider "+s.theme.getClass("tableCellShaded")}))})),l=s.options.nowIndicator,h.push({type:"body",key:"body",liquid:!0,expandRows:Boolean(s.options.expandRows),chunks:[{key:"axis",content:function(n){return t("div",{className:"fc-timegrid-axis-chunk"},t("table",{style:{height:n.expandRows?n.clientHeight:""}},n.tableColGroupNode,t("tbody",null,t(cpt,{slatMetas:e}))),t("div",{className:"fc-timegrid-now-indicator-container"},t(at,{unit:l?"minute":"day"},function(n){var i=l&&o&&o.safeComputeTop(n);return typeof i=="number"?t(cr,{isAxis:!0,date:n},function(n,r,u,f){return t("div",{ref:n,className:["fc-timegrid-now-indicator-arrow"].concat(r).join(" "),style:{top:i}},f)}):null})))}},{key:"cols",scrollerElRef:this.scrollerElRef,content:r},]}),w&&h.push({key:"footer",type:"footer",isSticky:!0,chunks:[{key:"axis",content:sr},{key:"cols",content:sr},]}),t(bt,{viewSpec:s.viewSpec,elRef:this.rootElRef},function(n,i){return t("div",{className:["fc-timegrid"].concat(i).join(" "),ref:n},t(v,{liquid:!c.isHeightAuto&&!c.forPrint,collapsibleWidth:!1,colGroups:[{width:"shrink",cols:[{width:"shrink"}]},{cols:[{span:u,minWidth:f}]},],sections:h}))})},r.prototype.getAllDayMaxEventProps=function(){var i=this.context.options,n=i.dayMaxEvents,t=i.dayMaxEventRows;return(n===!0||t===!0)&&(n=undefined,t=apt),{dayMaxEvents:n,dayMaxEventRows:t}},r}(rt);var nit=function(){function n(n,t,i){this.positions=n;this.dateProfile=t;this.slotDuration=i}return n.prototype.safeComputeTop=function(n){var i=this.dateProfile,r,t;return wt(i.currentRange,n)&&(r=a(n),t=n.valueOf()-r.valueOf(),t>=tt(i.slotMinTime)&&t0,b=Boolean(o)&&o.span.end-o.span.start0?r.renderSegList(e,s):r.renderEmptyMessage()))})},r.prototype.renderEmptyMessage=function(){var i=this.context,n=i.options,r=i.viewApi,u={text:n.noEventsText,view:r};return t(b,{hookProps:u,classNames:n.noEventsClassNames,content:n.noEventsContent,defaultContent:kwt,didMount:n.noEventsDidMount,willUnmount:n.noEventsWillUnmount},function(n,i,r,u){return t("div",{className:["fc-list-empty"].concat(i).join(" "),ref:n},t("div",{className:"fc-list-empty-cushion",ref:r},u))})},r.prototype.renderSegList=function(n,r){var u=this.context,e=u.theme,o=u.options,f=gwt(n);return t(at,{unit:"day"},function(n,u){for(var h,v,c,y,l,a=[],s=0;sthis.lastSizingDate.valueOf()+ot.SCROLLGRID_RESIZE_INTERVAL?(this.lastSizingDate=n,this.recentSizingCnt=0,!0):(this.recentSizingCnt+=1)<=10},r.prototype.computeShrinkWidths=function(){var r=this,u=this.compileColGroupStats(this.props.colGroups.map(function(n){return[n]})),n=this.getDims(),f=n[0],t=n[1],e=f*t,i=[];return u.forEach(function(n,u){if(n.hasShrinkCol){var f=r.chunkElRefs.collect(u,e,t);i[u]=ov(f)}}),i},r.prototype.computeSectionRowMaxHeights=function(){for(var u,f,i,s,h,d,c,g,r,a,v,it,n,y=new Map,p=this.getDims(),rt=p[0],t=p[1],w=[],o=0;o1)?t(kut,{key:o,colSpec:e,fieldValue:h,rowSpan:s}):t(but,{key:o,colSpec:e,resource:i,fieldValue:h,depth:u,hasChildren:n.hasChildren,isExpanded:n.isExpanded,innerHeight:n.innerHeight})}))},i}(e);ah.addPropsEquality({rowSpans:ht});gp=function(n){function i(){var t=n!==null&&n.apply(this,arguments)||this;return t.innerInnerRef=h(),t.onExpanderClick=function(){var n=t.props;t.context.dispatch({type:"SET_RESOURCE_ENTITY_EXPANDED",id:n.id,isExpanded:!n.isExpanded})},t}return u(i,n),i.prototype.render=function(){var r=this,u=this,n=u.props,f=u.context,e={groupValue:n.group.value,view:f.viewApi},i=n.group.spec;return t("tr",null,t(b,{hookProps:e,classNames:i.labelClassNames,content:i.labelContent,defaultContent:cti,didMount:i.labelDidMount,willUnmount:i.labelWillUnmount},function(i,u,e,o){return t("td",{ref:i,colSpan:n.spreadsheetColCnt,className:["fc-datagrid-cell","fc-resource-group",f.theme.getClass("tableCellShaded"),].concat(u).join(" ")},t("div",{className:"fc-datagrid-cell-frame",style:{height:n.innerHeight}},t("div",{className:"fc-datagrid-cell-cushion fc-scrollgrid-sync-inner",ref:r.innerInnerRef},t(put,{depth:0,hasChildren:!0,isExpanded:n.isExpanded,onExpanderClick:r.onExpanderClick}),t("span",{className:"fc-datagrid-cell-main",ref:e},o))))}))},i}(e);gp.addPropsEquality({group:cut});var lti=20,ati=function(n){function i(){var t=n!==null&&n.apply(this,arguments)||this;return t.resizerElRefs=new nt(t._handleColResizerEl.bind(t)),t.colDraggings={},t}return u(i,n),i.prototype.render=function(){var h=this,r=this.props,u=r.colSpecs,n=r.superHeaderRendering,i=r.rowInnerHeights,e={view:this.context.viewApi},f=[],o,s;return i=i.slice(),n&&(o=i.shift(),f.push(t("tr",{key:"row-super"},t(b,{hookProps:e,classNames:n.headerClassNames,content:n.headerContent,didMount:n.headerDidMount,willUnmount:n.headerWillUnmount},function(n,i,r,f){return t("th",{colSpan:u.length,ref:n,className:["fc-datagrid-cell","fc-datagrid-cell-super",].concat(i).join(" ")},t("div",{className:"fc-datagrid-cell-frame",style:{height:o}},t("div",{className:"fc-datagrid-cell-cushion fc-scrollgrid-sync-inner",ref:r},f)))})))),s=i.shift(),f.push(t("tr",{key:"row"},u.map(function(n,i){var r=i===u.length-1;return t(b,{key:i,hookProps:e,classNames:n.headerClassNames,content:n.headerContent,didMount:n.headerDidMount,willUnmount:n.headerWillUnmount},function(u,f,e,o){return t("th",{ref:u,className:["fc-datagrid-cell"].concat(f).join(" ")},t("div",{className:"fc-datagrid-cell-frame",style:{height:s}},t("div",{className:"fc-datagrid-cell-cushion fc-scrollgrid-sync-inner"},n.isMain&&t("span",{className:"fc-datagrid-expander fc-datagrid-expander-placeholder"},t("span",{className:"fc-icon"})),t("span",{className:"fc-datagrid-cell-main",ref:e},o)),!r&&t("div",{className:"fc-datagrid-cell-resizer",ref:h.resizerElRefs.createRef(i)})))})}))),t(c,null,f)},i.prototype._handleColResizerEl=function(n,t){var r=this.colDraggings,i;n?(i=this.initColResizing(n,parseInt(t,10)),i&&(r[t]=i)):(i=r[t],i&&(i.destroy(),delete r[t]))},i.prototype.initColResizing=function(n,t){var u=this.context,s=u.pluginHooks,h=u.isRtl,f=this.props.onColWidthChange,e=s.elementDraggingImpl,i,o,r;if(e){i=new e(n);i.emitter.on("dragstart",function(){var i=dt(d(n,"tr"),"th");r=i.map(function(n){return n.getBoundingClientRect().width});o=r[t]});i.emitter.on("dragmove",function(n){r[t]=Math.max(o+n.deltaX*(h?-1:1),lti);f&&f(r.slice())});return i.setAutoScrollEnabled(!1),i}return null},i}(e),vti=function(n){function i(){return n!==null&&n.apply(this,arguments)||this}return u(i,n),i.prototype.render=function(){var n=this,r=n.props,i=n.context,u={resource:new ft(i,r.resource)};return t(tu,{hookProps:u,content:i.options.resourceLaneContent},function(n,i){return i&&t("div",{className:"fc-timeline-lane-misc",ref:n},i)})},i}(e),dut=function(n){function i(){var t=n!==null&&n.apply(this,arguments)||this;return t.refineHookProps=yi(yti),t.normalizeClassNames=iu(),t.handleHeightChange=function(n,i){if(t.props.onHeightChange)t.props.onHeightChange(d(n,"tr"),i)},t}return u(i,n),i.prototype.render=function(){var e=this,r=this,n=r.props,u=r.context,i=u.options,f=this.refineHookProps({resource:n.resource,context:u}),o=this.normalizeClassNames(i.resourceLaneClassNames,f);return t("tr",{ref:n.elRef},t(bi,{hookProps:f,didMount:i.resourceLaneDidMount,willUnmount:i.resourceLaneWillUnmount},function(i){return t("td",{ref:i,className:["fc-timeline-lane","fc-resource"].concat(o).join(" "),"data-resource-id":n.resource.id},t("div",{className:"fc-timeline-lane-frame",style:{height:n.innerHeight}},t(vti,{resource:n.resource}),t(fh,{dateProfile:n.dateProfile,tDateProfile:n.tDateProfile,nowDate:n.nowDate,todayRange:n.todayRange,nextDayThreshold:n.nextDayThreshold,businessHours:n.businessHours,eventStore:n.eventStore,eventUiBases:n.eventUiBases,dateSelection:n.dateSelection,eventSelection:n.eventSelection,eventDrag:n.eventDrag,eventResize:n.eventResize,timelineCoords:n.timelineCoords,onHeightChange:e.handleHeightChange,resourceId:n.resource.id})))}))},i}(e);var pti=function(n){function i(){return n!==null&&n.apply(this,arguments)||this}return u(i,n),i.prototype.render=function(){var r=this,i=this.props,n=this.props.renderingHooks,u={groupValue:i.groupValue,view:this.context.viewApi};return t("tr",{ref:i.elRef},t(b,{hookProps:u,classNames:n.laneClassNames,content:n.laneContent,didMount:n.laneDidMount,willUnmount:n.laneWillUnmount},function(n,u,f,e){return t("td",{ref:n,className:["fc-timeline-lane","fc-resource-group",r.context.theme.getClass("tableCellShaded"),].concat(u).join(" ")},t("div",{style:{height:i.innerHeight},ref:f},e))}))},i}(e),wti=function(n){function r(){return n!==null&&n.apply(this,arguments)||this}return u(r,n),r.prototype.render=function(){var r=this,n=r.props,e=r.context,u=n.rowElRefs,f=n.innerHeights;return t("tbody",null,n.rowNodes.map(function(r,o){if(r.group)return t(pti,{key:r.id,elRef:u.createRef(r.id),groupValue:r.group.value,renderingHooks:r.group.spec,innerHeight:f[o]||""});if(r.resource){var s=r.resource;return t(dut,i({key:r.id,elRef:u.createRef(r.id)},n.splitProps[s.id],{resource:s,dateProfile:n.dateProfile,tDateProfile:n.tDateProfile,nowDate:n.nowDate,todayRange:n.todayRange,nextDayThreshold:e.options.nextDayThreshold,businessHours:s.businessHours||n.fallbackBusinessHours,innerHeight:f[o]||"",timelineCoords:n.slatCoords,onHeightChange:n.onRowHeightChange}))}return null}))},r}(e),bti=function(n){function i(){var t=n!==null&&n.apply(this,arguments)||this;return t.rootElRef=h(),t.rowElRefs=new nt,t}return u(i,n),i.prototype.render=function(){var i=this,n=i.props,r=i.context;return t("table",{ref:this.rootElRef,className:"fc-scrollgrid-sync-table "+r.theme.getClass("table"),style:{minWidth:n.tableMinWidth,width:n.clientWidth,height:n.minHeight}},t(wti,{rowElRefs:this.rowElRefs,rowNodes:n.rowNodes,dateProfile:n.dateProfile,tDateProfile:n.tDateProfile,nowDate:n.nowDate,todayRange:n.todayRange,splitProps:n.splitProps,fallbackBusinessHours:n.fallbackBusinessHours,slatCoords:n.slatCoords,innerHeights:n.innerHeights,onRowHeightChange:n.onRowHeightChange}))},i.prototype.componentDidMount=function(){this.updateCoords()},i.prototype.componentDidUpdate=function(){this.updateCoords()},i.prototype.componentWillUnmount=function(){if(this.props.onRowCoords)this.props.onRowCoords(null)},i.prototype.updateCoords=function(){var n=this.props;if(n.onRowCoords&&n.clientWidth!==null)this.props.onRowCoords(new fi(this.rootElRef.current,kti(this.rowElRefs.currentMap,n.rowNodes),!1,!0))},i}(e);gut=function(n){function i(){var t=n!==null&&n.apply(this,arguments)||this;return t.computeHasResourceBusinessHours=f(dti),t.resourceSplitter=new oh,t.bgSlicer=new ip,t.slatsRef=h(),t.state={slatCoords:null},t.handleEl=function(n){n?t.context.registerInteractiveComponent(t,{el:n}):t.context.unregisterInteractiveComponent(t)},t.handleSlatCoords=function(n){if(t.setState({slatCoords:n}),t.props.onSlatCoords)t.props.onSlatCoords(n)},t.handleRowCoords=function(n){if(t.rowCoords=n,t.props.onRowCoords)t.props.onRowCoords(n)},t}return u(i,n),i.prototype.render=function(){var o=this,s=this,n=s.props,h=s.state,i=s.context,f=n.dateProfile,e=n.tDateProfile,v=ii(e.slotDuration).unit,l=this.computeHasResourceBusinessHours(n.rowNodes),a=this.resourceSplitter.splitProps(n),y=a[""],r=this.bgSlicer.sliceProps(y,f,e.isTimeScale?null:n.nextDayThreshold,i,f,i.dateProfileGenerator,e,i.dateEnv),u=h.slatCoords&&h.slatCoords.dateProfile===n.dateProfile?h.slatCoords:null;return t("div",{ref:this.handleEl,className:["fc-timeline-body",n.expandRows?"fc-timeline-body-expandrows":"",].join(" "),style:{minWidth:n.tableMinWidth}},t(at,{unit:v},function(s,h){return t(c,null,t(np,{ref:o.slatsRef,dateProfile:f,tDateProfile:e,nowDate:s,todayRange:h,clientWidth:n.clientWidth,tableColGroupNode:n.tableColGroupNode,tableMinWidth:n.tableMinWidth,onCoords:o.handleSlatCoords,onScrollLeftRequest:n.onScrollLeftRequest}),t(tp,{businessHourSegs:l?null:r.businessHourSegs,bgEventSegs:r.bgEventSegs,timelineCoords:u,eventResizeSegs:r.eventResize?r.eventResize.segs:[],dateSelectionSegs:r.dateSelectionSegs,nowDate:s,todayRange:h}),t(bti,{rowNodes:n.rowNodes,dateProfile:f,tDateProfile:n.tDateProfile,nowDate:s,todayRange:h,splitProps:a,fallbackBusinessHours:l?n.businessHours:null,clientWidth:n.clientWidth,minHeight:n.expandRows?n.clientHeight:"",tableMinWidth:n.tableMinWidth,innerHeights:n.rowInnerHeights,slatCoords:u,onRowCoords:o.handleRowCoords,onRowHeightChange:n.onRowHeightChange}),i.options.nowIndicator&&u&&u.isDateInRange(s)&&t("div",{className:"fc-timeline-now-indicator-container"},t(cr,{isAxis:!1,date:s},function(n,r,f,e){return t("div",{ref:n,className:["fc-timeline-now-indicator-line"].concat(r).join(" "),style:rh(u.dateToCoord(s),i.isRtl)},e)})))}))},i.prototype.queryHit=function(n,t){var u=this.rowCoords,r=u.topToIndex(t),f,i;return r!=null&&(f=this.props.rowNodes[r].resource,f&&(i=this.slatsRef.current.positionToHit(n),i))?{dateProfile:this.props.dateProfile,dateSpan:{range:i.dateSpan.range,allDay:i.dateSpan.allDay,resourceId:f.id},rect:{left:i.left,right:i.right,top:u.tops[r],bottom:u.bottoms[r]},dayEl:i.dayEl,layer:0}:null},i}(rt);var nft=30,gti=function(n){function i(){var t=n!==null&&n.apply(this,arguments)||this;return t.scrollGridRef=h(),t.timeBodyScrollerElRef=h(),t.spreadsheetHeaderChunkElRef=h(),t.rootElRef=h(),t.ensureScrollGridResizeId=0,t.state={resourceAreaWidthOverride:null},t.ensureScrollGridResize=function(){t.ensureScrollGridResizeId&&clearTimeout(t.ensureScrollGridResizeId);t.ensureScrollGridResizeId=setTimeout(function(){t.scrollGridRef.current.handleSizing(!1)},ot.SCROLLGRID_RESIZE_INTERVAL+1)},t}return u(i,n),i.prototype.render=function(){var u=this,n=u.props,f=u.state,i=u.context,r=i.options,s=!n.forPrint&&hr(r),h=!n.forPrint&&yf(r),e=[{type:"header",key:"header",syncRowHeights:!0,isSticky:s,chunks:[{key:"datagrid",elRef:this.spreadsheetHeaderChunkElRef,tableClassName:"fc-datagrid-header",rowContent:n.spreadsheetHeaderRows},{key:"divider",outerContent:t("td",{className:"fc-resource-timeline-divider "+i.theme.getClass("tableCellShaded")})},{key:"timeline",content:n.timeHeaderContent},]},{type:"body",key:"body",syncRowHeights:!0,liquid:!0,expandRows:Boolean(r.expandRows),chunks:[{key:"datagrid",tableClassName:"fc-datagrid-body",rowContent:n.spreadsheetBodyRows},{key:"divider",outerContent:t("td",{className:"fc-resource-timeline-divider "+i.theme.getClass("tableCellShaded")})},{key:"timeline",scrollerElRef:this.timeBodyScrollerElRef,content:n.timeBodyContent},]},],o;return h&&e.push({type:"footer",key:"footer",isSticky:!0,chunks:[{key:"datagrid",content:sr},{key:"divider",outerContent:t("td",{className:"fc-resource-timeline-divider "+i.theme.getClass("tableCellShaded")})},{key:"timeline",content:sr},]}),o=f.resourceAreaWidthOverride!=null?f.resourceAreaWidthOverride:r.resourceAreaWidth,t(ne,{ref:this.scrollGridRef,elRef:this.rootElRef,liquid:!n.isHeightAuto&&!n.forPrint,collapsibleWidth:!1,colGroups:[{cols:n.spreadsheetCols,width:o},{cols:[]},{cols:n.timeCols},],sections:e})},i.prototype.forceTimeScroll=function(n){var t=this.scrollGridRef.current;t.forceScrollLeft(2,n)},i.prototype.forceResourceScroll=function(n){var t=this.scrollGridRef.current;t.forceScrollTop(1,n)},i.prototype.getResourceScroll=function(){var n=this.timeBodyScrollerElRef.current;return n.scrollTop},i.prototype.componentDidMount=function(){this.initSpreadsheetResizing()},i.prototype.componentWillUnmount=function(){this.destroySpreadsheetResizing()},i.prototype.initSpreadsheetResizing=function(){var i=this,r=this.context,o=r.isRtl,s=r.pluginHooks,u=s.elementDraggingImpl,h=this.spreadsheetHeaderChunkElRef.current,t,n,f,e;if(u){t=this.rootElRef.current;n=this.spreadsheetResizerDragging=new u(t,".fc-resource-timeline-divider");n.emitter.on("dragstart",function(){f=h.getBoundingClientRect().width;e=t.getBoundingClientRect().width});n.emitter.on("dragmove",function(n){var t=f+n.deltaX*(o?-1:1);t=Math.max(t,nft);t=Math.min(t,e-nft);i.setState({resourceAreaWidthOverride:t},i.ensureScrollGridResize)});n.setAutoScrollEnabled(!1)}},i.prototype.destroySpreadsheetResizing=function(){this.spreadsheetResizerDragging&&this.spreadsheetResizerDragging.destroy()},i}(e),nw=function(n){function i(t,i){var r=n.call(this,t,i)||this;return r.processColOptions=f(rii),r.buildTimelineDateProfile=f(ky),r.hasNesting=f(iii),r.buildRowNodes=f(bp),r.layoutRef=h(),r.rowNodes=[],r.renderedRowNodes=[],r.buildRowIndex=f(nii),r.handleSlatCoords=function(n){r.setState({slatCoords:n})},r.handleRowCoords=function(n){r.rowCoords=n;r.scrollResponder.update(!1)},r.handleMaxCushionWidth=function(n){r.setState({slotCushionMaxWidth:Math.ceil(n)})},r.handleScrollLeftRequest=function(n){var t=r.layoutRef.current;t.forceTimeScroll(n)},r.handleScrollRequest=function(n){var i=r.rowCoords,o=r.layoutRef.current,u=n.rowId||n.resourceId,f,t,e;return i?(u&&(f=r.buildRowIndex(r.renderedRowNodes),t=f[u],t!=null&&(e=n.fromBottom!=null?i.bottoms[t]-n.fromBottom:i.tops[t],o.forceResourceScroll(e))),!0):null},r.handleColWidthChange=function(n){r.setState({spreadsheetColWidths:n})},r.state={resourceAreaWidth:i.options.resourceAreaWidth,spreadsheetColWidths:[]},r}return u(i,n),i.prototype.render=function(){var i=this,o=this,n=o.props,l=o.state,r=o.context,f=r.options,v=r.viewSpec,u=this.processColOptions(r.options),y=u.superHeaderRendering,p=u.groupSpecs,w=u.orderSpecs,b=u.isVGrouping,s=u.colSpecs,e=this.buildTimelineDateProfile(n.dateProfile,r.dateEnv,f,r.dateProfileGenerator),h=this.rowNodes=this.buildRowNodes(n.resourceStore,p,w,b,n.resourceEntityExpansions,f.resourcesInitiallyExpanded),k=["fc-resource-timeline",this.hasNesting(h)?"":"fc-resource-timeline-flat","fc-timeline",f.eventOverlap===!1?"fc-timeline-overlap-disabled":"fc-timeline-overlap-enabled",],a=f.slotMinWidth,d=up(e,a||this.computeFallbackSlotMinWidth(e));return t(bt,{viewSpec:v},function(u,f){return t("div",{ref:u,className:k.concat(f).join(" ")},t(gti,{ref:i.layoutRef,forPrint:n.forPrint,isHeightAuto:n.isHeightAuto,spreadsheetCols:tii(s,l.spreadsheetColWidths,""),spreadsheetHeaderRows:function(n){return t(ati,{superHeaderRendering:y,colSpecs:s,onColWidthChange:i.handleColWidthChange,rowInnerHeights:n.rowSyncHeights})},spreadsheetBodyRows:function(n){return t(c,null,i.renderSpreadsheetRows(h,s,n.rowSyncHeights))},timeCols:d,timeHeaderContent:function(r){return t(gy,{clientWidth:r.clientWidth,clientHeight:r.clientHeight,tableMinWidth:r.tableMinWidth,tableColGroupNode:r.tableColGroupNode,dateProfile:n.dateProfile,tDateProfile:e,slatCoords:l.slatCoords,rowInnerHeights:r.rowSyncHeights,onMaxCushionWidth:a?null:i.handleMaxCushionWidth})},timeBodyContent:function(u){return t(gut,{dateProfile:n.dateProfile,clientWidth:u.clientWidth,clientHeight:u.clientHeight,tableMinWidth:u.tableMinWidth,tableColGroupNode:u.tableColGroupNode,expandRows:u.expandRows,tDateProfile:e,rowNodes:h,businessHours:n.businessHours,dateSelection:n.dateSelection,eventStore:n.eventStore,eventUiBases:n.eventUiBases,eventSelection:n.eventSelection,eventDrag:n.eventDrag,eventResize:n.eventResize,resourceStore:n.resourceStore,nextDayThreshold:r.options.nextDayThreshold,rowInnerHeights:u.rowSyncHeights,onSlatCoords:i.handleSlatCoords,onRowCoords:i.handleRowCoords,onScrollLeftRequest:i.handleScrollLeftRequest,onRowHeightChange:u.reportRowHeightChange})}}))})},i.prototype.renderSpreadsheetRows=function(n,i,r){return n.map(function(n,u){return n.group?t(gp,{key:n.id,id:n.id,spreadsheetColCnt:i.length,isExpanded:n.isExpanded,group:n.group,innerHeight:r[u]||""}):n.resource?t(ah,{key:n.id,colSpecs:i,rowSpans:n.rowSpans,depth:n.depth,isExpanded:n.isExpanded,hasChildren:n.hasChildren,resource:n.resource,innerHeight:r[u]||""}):null})},i.prototype.componentDidMount=function(){this.renderedRowNodes=this.rowNodes;this.scrollResponder=this.context.createScrollResponder(this.handleScrollRequest)},i.prototype.getSnapshotBeforeUpdate=function(){return this.props.forPrint?{}:{resourceScroll:this.queryResourceScroll()}},i.prototype.componentDidUpdate=function(n,t,i){this.renderedRowNodes=this.rowNodes;this.scrollResponder.update(n.dateProfile!==this.props.dateProfile);i.resourceScroll&&this.handleScrollRequest(i.resourceScroll)},i.prototype.componentWillUnmount=function(){this.scrollResponder.detach()},i.prototype.computeFallbackSlotMinWidth=function(n){return Math.max(30,(this.state.slotCushionMaxWidth||0)/n.slotsPerLabel)},i.prototype.queryResourceScroll=function(){var r=this,u=r.rowCoords,o=r.renderedRowNodes,n,e,i;if(u){var s=this.layoutRef.current,f=u.bottoms,h=s.getResourceScroll(),t={};for(n=0;n0){t.rowId=e.id;t.fromBottom=i;break}return t}return null},i}(e);return nw.addStateEquality({spreadsheetColWidths:ht}),tft=k({deps:[ar,lh,fp,],initialView:"resourceTimelineDay",views:{resourceTimeline:{type:"timeline",component:nw,needsResourceData:!0,resourceAreaWidth:"30%",resourcesInitiallyExpanded:!0,eventResizableFromStart:!0},resourceTimelineDay:{type:"resourceTimeline",duration:{days:1}},resourceTimelineWeek:{type:"resourceTimeline",duration:{weeks:1}},resourceTimelineMonth:{type:"resourceTimeline",duration:{months:1}},resourceTimelineYear:{type:"resourceTimeline",duration:{years:1}}}}),wo.push(wyt,dtt,sit,vit,nbt,lbt,urt,lkt,fp,lh,uti,yut,tft),n.AbstractResourceDayTableModel=lp,n.BASE_OPTION_DEFAULTS=ri,n.BASE_OPTION_REFINERS=fl,n.BaseComponent=e,n.BgEvent=kf,n.BootstrapTheme=kt,n.Calendar=itt,n.CalendarApi=pi,n.CalendarContent=yn,n.CalendarDataManager=bo,n.CalendarDataProvider=cn,n.CalendarRoot=ka,n.Component=ao,n.ContentHook=tu,n.CustomContentRenderContext=vo,n.DEFAULT_RESOURCE_ORDER=te,n.DateComponent=rt,n.DateEnv=pl,n.DateProfileGenerator=yo,n.DayCellContent=os,n.DayCellRoot=bf,n.DayGridView=ktt,n.DayHeader=ts,n.DayResourceTableModel=vp,n.DaySeriesModel=iv,n.DayTable=ey,n.DayTableModel=rv,n.DayTableSlicer=fy,n.DayTimeCols=ly,n.DayTimeColsSlicer=ks,n.DayTimeColsView=py,n.DelayedRunner=or,n.Draggable=vyt,n.ElementDragging=ba,n.ElementScrollController=og,n.Emitter=fr,n.EventApi=v,n.EventRoot=ru,n.EventSourceApi=hi,n.FeaturefulElementDragging=lr,n.Fragment=c,n.Interaction=di,n.ListView=by,n.MoreLinkRoot=cs,n.MountHook=bi,n.NamedTimeZoneImpl=ln,n.NowIndicatorRoot=cr,n.NowTimer=at,n.PointerDragging=as,n.PositionCache=fi,n.RefMap=nt,n.RenderHook=b,n.ResourceApi=ft,n.ResourceDayHeader=hh,n.ResourceDayTable=dp,n.ResourceDayTableModel=ap,n.ResourceDayTableView=lut,n.ResourceDayTimeCols=aut,n.ResourceDayTimeColsView=vut,n.ResourceLabelRoot=eut,n.ResourceSplitter=oh,n.ResourceTimelineLane=dut,n.ResourceTimelineView=nw,n.ScrollController=lo,n.ScrollGrid=ne,n.ScrollResponder=ag,n.Scroller=fs,n.SegHierarchy=af,n.SimpleScrollGrid=pf,n.Slicer=is,n.Splitter=sf,n.SpreadsheetRow=ah,n.StandardEvent=wf,n.Table=ws,n.TableDateCell=nv,n.TableDowCell=tv,n.TableView=ny,n.Theme=er,n.ThirdPartyDraggable=pyt,n.TimeCols=bs,n.TimeColsSlatsCoords=nit,n.TimeColsView=sy,n.TimelineCoords=art,n.TimelineHeader=gy,n.TimelineHeaderRows=lrt,n.TimelineLane=fh,n.TimelineLaneBg=tp,n.TimelineLaneSlicer=ip,n.TimelineSlats=np,n.TimelineView=rp,n.VResourceJoiner=yp,n.VResourceSplitter=pp,n.ViewApi=vl,n.ViewContextType=lt,n.ViewRoot=bt,n.WeekNumberRoot=hs,n.WindowScrollController=sg,n.addDays=p,n.addDurations=ve,n.addMs=gt,n.addWeeks=pc,n.allowContextMenu=ab,n.allowSelection=cb,n.applyMutationToEventStore=eo,n.applyStyle=ci,n.applyStyleProp=sc,n.asCleanDays=tl,n.asRoughMinutes=rk,n.asRoughMs=tt,n.asRoughSeconds=uk,n.binarySearch=wa,n.buildClassNameNormalizer=iu,n.buildDayRanges=ay,n.buildDayTableModel=oy,n.buildEntryKey=ki,n.buildEventApis=wi,n.buildEventRangeKey=uo,n.buildHashFromArray=aet,n.buildIsoString=wu,n.buildNavLinkData=ur,n.buildResourceFields=kp,n.buildRowNodes=bp,n.buildSegCompareObj=id,n.buildSegTimeText=gr,n.buildSlatCols=up,n.buildSlatMetas=yy,n.buildTimeColsModel=wy,n.buildTimelineDateProfile=ky,n.collectFromHash=gc,n.combineEventUis=no,n.compareByFieldSpec=vb,n.compareByFieldSpecs=ac,n.compareNumbers=yb,n.compareObjs=ae,n.computeEarliestSegStart=df,n.computeEdges=ua,n.computeFallbackHeaderFormat=da,n.computeHeightAndMargins=uht,n.computeInnerRect=fa,n.computeRect=co,n.computeSegDraggable=rd,n.computeSegEndResizable=fd,n.computeSegStartResizable=ud,n.computeShrinkWidth=ov,n.computeSmallestCellWidth=pb,n.computeVisibleDayRange=tf,n.config=ot,n.constrainPoint=rg,n.coordToCss=rh,n.coordsToCss=uh,n.createContext=sa,n.createDuration=s,n.createElement=t,n.createEmptyEventStore=it,n.createEventInstance=yu,n.createEventUi=dr,n.createFormatter=y,n.createPlugin=k,n.createPortal=cg,n.createRef=h,n.diffDates=tr,n.diffDayAndTime=bb,n.diffDays=ni,n.diffPoints=fg,n.diffWeeks=wb,n.diffWholeDays=yr,n.diffWholeWeeks=kb,n.disableCursor=au,n.elementClosest=d,n.elementMatches=he,n.enableCursor=vu,n.eventTupleToStore=kr,n.filterEventStoreDefs=ku,n.filterHash=pt,n.findDirectChildren=fb,n.findElements=dt,n.flattenResources=wp,n.flexibleCompare=vc,n.flushToDom=cf,n.formatDate=bst,n.formatDayString=br,n.formatIsoTimeString=fk,n.formatRange=kst,n.getAllowYScrolling=sv,n.getCanVGrowWithinCell=oo,n.getClippingParents=ea,n.getDateMeta=nu,n.getDayClassNames=rr,n.getDefaultEventEnd=fo,n.getElSeg=ir,n.getEntrySpanEnd=va,n.getEventClassNames=ed,n.getIsRtlScrollbarOnLeft=hf,n.getPublicId=cp,n.getRectCenter=ug,n.getRelevantEvents=ge,n.getScrollGridClassNames=yv,n.getScrollbarWidths=ra,n.getSectionClassNames=pv,n.getSectionHasLiquidHeight=es,n.getSegMeta=st,n.getSlotClassNames=ta,n.getStickyFooterScrollbar=yf,n.getStickyHeaderDates=hr,n.getUnequalProps=dc,n.globalLocales=kd,n.globalPlugins=wo,n.greatestDurationDenominator=ii,n.groupIntersectingEntries=ya,n.guid=vt,n.hasBgRendering=nd,n.hasShrinkWidth=vv,n.identity=r,n.interactionSettingsStore=vf,n.interactionSettingsToStore=go,n.intersectRanges=ui,n.intersectRects=dl,n.intersectSpans=ko,n.isArraysEqual=ht,n.isColPropsEqual=cv,n.isDateSelectionValid=bn,n.isDateSpansEqual=sd,n.isGroupsEqual=cut,n.isInt=li,n.isInteractionValid=rs,n.isMultiDayRange=dk,n.isPropsEqual=ut,n.isPropsValid=fv,n.isValidDate=le,n.joinSpans=an,n.listenBySelector=hc,n.mapHash=w,n.memoize=f,n.memoizeArraylike=ye,n.memoizeHashlike=ul,n.memoizeObjArg=yi,n.mergeEventStores=bu,n.multiplyDuration=il,n.padStart=yt,n.parseBusinessHours=kl,n.parseClassNames=du,n.parseDragMeta=ns,n.parseEventDef=nf,n.parseFieldSpecs=ce,n.parseMarker=bd,n.pointInsideRect=ig,n.preventContextMenu=lb,n.preventDefault=lu,n.preventSelection=hb,n.rangeContainsMarker=wt,n.rangeContainsRange=uf,n.rangesEqual=hl,n.rangesIntersect=rf,n.refineEventDef=io,n.refineProps=nr,n.removeElement=vr,n.removeExact=ek,n.render=hg,n.renderChunkContent=hv,n.renderFill=ss,n.renderMicroColGroup=lv,n.renderScrollShim=sr,n.requestJson=po,n.sanitizeShrinkWidth=av,n.setElSeg=cl,n.setRef=g,n.setScrollFromLeftEdge=bit,n.sliceEventStore=ff,n.sliceEvents=sat,n.sortEventSegs=ef,n.startOfDay=a,n.translateRect=gl,n.triggerDateSelect=ll,n.unmountComponentAtNode=lg,n.unpromisify=oa,n.version=ttt,n.whenTransitionDone=sb,n.wholeDivideDurations=ti,Object.defineProperty(n,"__esModule",{value:!0}),n}({});
\ No newline at end of file
diff --git a/app/assets/stylesheets/property_hire_calendar.scss b/app/assets/stylesheets/property_hire_calendar.scss
index 1371da9..a4c85bf 100644
--- a/app/assets/stylesheets/property_hire_calendar.scss
+++ b/app/assets/stylesheets/property_hire_calendar.scss
@@ -1,3 +1,11 @@
+#calendar.active_picker .fc-scrollgrid-sync-inner,#calendar.active_picker .fc-timegrid-slot{
+ cursor: pointer;
+}
+#calendar.active_picker{
+ .fc-scrollgrid-sync-inner:hover, .fc-timegrid-slot:hover{
+ background: var(--fc-highlight-color, rgba(188, 232, 241, 0.3));
+ }
+}
/* orbit calendar */
#orbit_calendar {
transition: all 0.3s ease;
@@ -96,7 +104,9 @@
& > * {
margin: 0 5px;
}
-
+ & > select {
+ height: 3em;
+ }
@media screen and (max-width: 479px) {
margin-right: 0;
@@ -253,6 +263,9 @@
.event_list td {
padding: 0;
}
+ .event_list th {
+ width: 25%;
+ }
}
.event_holder {
@@ -627,8 +640,9 @@
}
#calendar-loading {
- position: absolute;
- top: 40%;
+ position: fixed;
+ top: 50%;
+ left: 50%;
z-index: 10;
width: 120px;
height: 120px;
@@ -641,6 +655,7 @@
background-position: center 20px;
background-size: 50%;
box-shadow: 0 0 25px 0 rgba(0, 0, 0, 0.2);
+ transform: translate(-50%, -50%);
&:after {
content: "Loading...";
@@ -691,7 +706,7 @@
.calendar-modal {
position: fixed;
- z-index: 1050;
+ z-index: 10000;
width: 300px;
margin: 0;
font-size: 12px;
diff --git a/app/assets/stylesheets/property_hire_fullcalendar.css b/app/assets/stylesheets/property_hire_fullcalendar.css
index c9add0b..a0416d0 100644
--- a/app/assets/stylesheets/property_hire_fullcalendar.css
+++ b/app/assets/stylesheets/property_hire_fullcalendar.css
@@ -1,579 +1,1811 @@
-/*!
- * FullCalendar v1.6.1 Stylesheet
- * Docs & License: http://arshaw.com/fullcalendar/
- * (c) 2013 Adam Shaw
- */
+/* classes attached to */
+.table-bordered th, .table-bordered td {
+ border: 1px solid #dee2e6;
+}
+.fc-not-allowed,
+.fc-not-allowed .fc-event { /* override events' custom cursors */
+ cursor: not-allowed;
+}
+
+.fc-unselectable {
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+ -webkit-touch-callout: none;
+ -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
+}
+.fc {
+ /* layout of immediate children */
+ display: flex;
+ flex-direction: column;
+
+ font-size: 1em
+}
+.fc,
+ .fc *,
+ .fc *:before,
+ .fc *:after {
+ box-sizing: border-box;
+ }
+.fc table {
+ border-collapse: collapse;
+ border-spacing: 0;
+ font-size: 1em; /* normalize cross-browser */
+ }
+.fc th {
+ text-align: center;
+ }
+.fc th,
+ .fc td {
+ vertical-align: top;
+ padding: 0;
+ }
+.fc a[data-navlink] {
+ cursor: pointer;
+ }
+.fc a[data-navlink]:hover {
+ text-decoration: underline;
+ }
+.fc-direction-ltr {
+ direction: ltr;
+ text-align: left;
+}
+.fc-direction-rtl {
+ direction: rtl;
+ text-align: right;
+}
+.fc-theme-standard td,
+ .fc-theme-standard th {
+ border: 1px solid #ddd;
+ border: 1px solid var(--fc-border-color, #ddd);
+ }
+/* for FF, which doesn't expand a 100% div within a table cell. use absolute positioning */
+/* inner-wrappers are responsible for being absolute */
+/* TODO: best place for this? */
+.fc-liquid-hack td,
+ .fc-liquid-hack th {
+ position: relative;
+ }
+
+@font-face {
+ font-family: 'fcicons';
+ src: url("data:application/x-font-ttf;charset=utf-8;base64,AAEAAAALAIAAAwAwT1MvMg8SBfAAAAC8AAAAYGNtYXAXVtKNAAABHAAAAFRnYXNwAAAAEAAAAXAAAAAIZ2x5ZgYydxIAAAF4AAAFNGhlYWQUJ7cIAAAGrAAAADZoaGVhB20DzAAABuQAAAAkaG10eCIABhQAAAcIAAAALGxvY2ED4AU6AAAHNAAAABhtYXhwAA8AjAAAB0wAAAAgbmFtZXsr690AAAdsAAABhnBvc3QAAwAAAAAI9AAAACAAAwPAAZAABQAAApkCzAAAAI8CmQLMAAAB6wAzAQkAAAAAAAAAAAAAAAAAAAABEAAAAAAAAAAAAAAAAAAAAABAAADpBgPA/8AAQAPAAEAAAAABAAAAAAAAAAAAAAAgAAAAAAADAAAAAwAAABwAAQADAAAAHAADAAEAAAAcAAQAOAAAAAoACAACAAIAAQAg6Qb//f//AAAAAAAg6QD//f//AAH/4xcEAAMAAQAAAAAAAAAAAAAAAQAB//8ADwABAAAAAAAAAAAAAgAANzkBAAAAAAEAAAAAAAAAAAACAAA3OQEAAAAAAQAAAAAAAAAAAAIAADc5AQAAAAABAWIAjQKeAskAEwAAJSc3NjQnJiIHAQYUFwEWMjc2NCcCnuLiDQ0MJAz/AA0NAQAMJAwNDcni4gwjDQwM/wANIwz/AA0NDCMNAAAAAQFiAI0CngLJABMAACUBNjQnASYiBwYUHwEHBhQXFjI3AZ4BAA0N/wAMJAwNDeLiDQ0MJAyNAQAMIw0BAAwMDSMM4uINIwwNDQAAAAIA4gC3Ax4CngATACcAACUnNzY0JyYiDwEGFB8BFjI3NjQnISc3NjQnJiIPAQYUHwEWMjc2NCcB87e3DQ0MIw3VDQ3VDSMMDQ0BK7e3DQ0MJAzVDQ3VDCQMDQ3zuLcMJAwNDdUNIwzWDAwNIwy4twwkDA0N1Q0jDNYMDA0jDAAAAgDiALcDHgKeABMAJwAAJTc2NC8BJiIHBhQfAQcGFBcWMjchNzY0LwEmIgcGFB8BBwYUFxYyNwJJ1Q0N1Q0jDA0Nt7cNDQwjDf7V1Q0N1QwkDA0Nt7cNDQwkDLfWDCMN1Q0NDCQMt7gMIw0MDNYMIw3VDQ0MJAy3uAwjDQwMAAADAFUAAAOrA1UAMwBoAHcAABMiBgcOAQcOAQcOARURFBYXHgEXHgEXHgEzITI2Nz4BNz4BNz4BNRE0JicuAScuAScuASMFITIWFx4BFx4BFx4BFREUBgcOAQcOAQcOASMhIiYnLgEnLgEnLgE1ETQ2Nz4BNz4BNz4BMxMhMjY1NCYjISIGFRQWM9UNGAwLFQkJDgUFBQUFBQ4JCRULDBgNAlYNGAwLFQkJDgUFBQUFBQ4JCRULDBgN/aoCVgQIBAQHAwMFAQIBAQIBBQMDBwQECAT9qgQIBAQHAwMFAQIBAQIBBQMDBwQECASAAVYRGRkR/qoRGRkRA1UFBAUOCQkVDAsZDf2rDRkLDBUJCA4FBQUFBQUOCQgVDAsZDQJVDRkLDBUJCQ4FBAVVAgECBQMCBwQECAX9qwQJAwQHAwMFAQICAgIBBQMDBwQDCQQCVQUIBAQHAgMFAgEC/oAZEhEZGRESGQAAAAADAFUAAAOrA1UAMwBoAIkAABMiBgcOAQcOAQcOARURFBYXHgEXHgEXHgEzITI2Nz4BNz4BNz4BNRE0JicuAScuAScuASMFITIWFx4BFx4BFx4BFREUBgcOAQcOAQcOASMhIiYnLgEnLgEnLgE1ETQ2Nz4BNz4BNz4BMxMzFRQWMzI2PQEzMjY1NCYrATU0JiMiBh0BIyIGFRQWM9UNGAwLFQkJDgUFBQUFBQ4JCRULDBgNAlYNGAwLFQkJDgUFBQUFBQ4JCRULDBgN/aoCVgQIBAQHAwMFAQIBAQIBBQMDBwQECAT9qgQIBAQHAwMFAQIBAQIBBQMDBwQECASAgBkSEhmAERkZEYAZEhIZgBEZGREDVQUEBQ4JCRUMCxkN/asNGQsMFQkIDgUFBQUFBQ4JCBUMCxkNAlUNGQsMFQkJDgUEBVUCAQIFAwIHBAQIBf2rBAkDBAcDAwUBAgICAgEFAwMHBAMJBAJVBQgEBAcCAwUCAQL+gIASGRkSgBkSERmAEhkZEoAZERIZAAABAOIAjQMeAskAIAAAExcHBhQXFjI/ARcWMjc2NC8BNzY0JyYiDwEnJiIHBhQX4uLiDQ0MJAzi4gwkDA0N4uINDQwkDOLiDCQMDQ0CjeLiDSMMDQ3h4Q0NDCMN4uIMIw0MDOLiDAwNIwwAAAABAAAAAQAAa5n0y18PPPUACwQAAAAAANivOVsAAAAA2K85WwAAAAADqwNVAAAACAACAAAAAAAAAAEAAAPA/8AAAAQAAAAAAAOrAAEAAAAAAAAAAAAAAAAAAAALBAAAAAAAAAAAAAAAAgAAAAQAAWIEAAFiBAAA4gQAAOIEAABVBAAAVQQAAOIAAAAAAAoAFAAeAEQAagCqAOoBngJkApoAAQAAAAsAigADAAAAAAACAAAAAAAAAAAAAAAAAAAAAAAAAA4ArgABAAAAAAABAAcAAAABAAAAAAACAAcAYAABAAAAAAADAAcANgABAAAAAAAEAAcAdQABAAAAAAAFAAsAFQABAAAAAAAGAAcASwABAAAAAAAKABoAigADAAEECQABAA4ABwADAAEECQACAA4AZwADAAEECQADAA4APQADAAEECQAEAA4AfAADAAEECQAFABYAIAADAAEECQAGAA4AUgADAAEECQAKADQApGZjaWNvbnMAZgBjAGkAYwBvAG4Ac1ZlcnNpb24gMS4wAFYAZQByAHMAaQBvAG4AIAAxAC4AMGZjaWNvbnMAZgBjAGkAYwBvAG4Ac2ZjaWNvbnMAZgBjAGkAYwBvAG4Ac1JlZ3VsYXIAUgBlAGcAdQBsAGEAcmZjaWNvbnMAZgBjAGkAYwBvAG4Ac0ZvbnQgZ2VuZXJhdGVkIGJ5IEljb01vb24uAEYAbwBuAHQAIABnAGUAbgBlAHIAYQB0AGUAZAAgAGIAeQAgAEkAYwBvAE0AbwBvAG4ALgAAAAMAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA=") format('truetype');
+ font-weight: normal;
+ font-style: normal;
+}
+
+.fc-icon {
+ /* added for fc */
+ display: inline-block;
+ width: 1em;
+ height: 1em;
+ text-align: center;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+
+ /* use !important to prevent issues with browser extensions that change fonts */
+ font-family: 'fcicons' !important;
+ speak: none;
+ font-style: normal;
+ font-weight: normal;
+ font-variant: normal;
+ text-transform: none;
+ line-height: 1;
+
+ /* Better Font Rendering =========== */
+ -webkit-font-smoothing: antialiased;
+ -moz-osx-font-smoothing: grayscale;
+}
+
+.fc-icon-chevron-left:before {
+ content: "\e900";
+}
+
+.fc-icon-chevron-right:before {
+ content: "\e901";
+}
+
+.fc-icon-chevrons-left:before {
+ content: "\e902";
+}
+
+.fc-icon-chevrons-right:before {
+ content: "\e903";
+}
+
+.fc-icon-minus-square:before {
+ content: "\e904";
+}
+
+.fc-icon-plus-square:before {
+ content: "\e905";
+}
+
+.fc-icon-x:before {
+ content: "\e906";
+}
+/*
+Lots taken from Flatly (MIT): https://bootswatch.com/4/flatly/bootstrap.css
+
+These styles only apply when the standard-theme is activated.
+When it's NOT activated, the fc-button classes won't even be in the DOM.
+*/
+.fc {
+
+ /* reset */
+
+}
+.fc .fc-button {
+ border-radius: 0;
+ overflow: visible;
+ text-transform: none;
+ margin: 0;
+ font-family: inherit;
+ font-size: inherit;
+ line-height: inherit;
+ }
+.fc .fc-button:focus {
+ outline: 1px dotted;
+ outline: 5px auto -webkit-focus-ring-color;
+ }
+.fc .fc-button {
+ -webkit-appearance: button;
+ }
+.fc .fc-button:not(:disabled) {
+ cursor: pointer;
+ }
+.fc .fc-button::-moz-focus-inner {
+ padding: 0;
+ border-style: none;
+ }
+.fc {
+
+ /* theme */
+
+}
+.fc .fc-button {
+ display: inline-block;
+ font-weight: 400;
+ text-align: center;
+ vertical-align: middle;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+ background-color: transparent;
+ border: 1px solid transparent;
+ padding: 0.4em 0.65em;
+ font-size: 1em;
+ line-height: 1.5;
+ border-radius: 0.25em;
+ }
+.fc .fc-button:hover {
+ text-decoration: none;
+ }
+.fc .fc-button:focus {
+ outline: 0;
+ box-shadow: 0 0 0 0.2rem rgba(44, 62, 80, 0.25);
+ }
+.fc .fc-button:disabled {
+ opacity: 0.65;
+ }
+.fc {
+
+ /* "primary" coloring */
+
+}
+.fc .fc-button-primary {
+ color: #fff;
+ color: var(--fc-button-text-color, #fff);
+ background-color: #2C3E50;
+ background-color: var(--fc-button-bg-color, #2C3E50);
+ border-color: #2C3E50;
+ border-color: var(--fc-button-border-color, #2C3E50);
+ }
+.fc .fc-button-primary:hover {
+ color: #fff;
+ color: var(--fc-button-text-color, #fff);
+ background-color: #1e2b37;
+ background-color: var(--fc-button-hover-bg-color, #1e2b37);
+ border-color: #1a252f;
+ border-color: var(--fc-button-hover-border-color, #1a252f);
+ }
+.fc .fc-button-primary:disabled { /* not DRY */
+ color: #fff;
+ color: var(--fc-button-text-color, #fff);
+ background-color: #2C3E50;
+ background-color: var(--fc-button-bg-color, #2C3E50);
+ border-color: #2C3E50;
+ border-color: var(--fc-button-border-color, #2C3E50); /* overrides :hover */
+ }
+.fc .fc-button-primary:focus {
+ box-shadow: 0 0 0 0.2rem rgba(76, 91, 106, 0.5);
+ }
+.fc .fc-button-primary:not(:disabled):active,
+ .fc .fc-button-primary:not(:disabled).fc-button-active {
+ color: #fff;
+ color: var(--fc-button-text-color, #fff);
+ background-color: #1a252f;
+ background-color: var(--fc-button-active-bg-color, #1a252f);
+ border-color: #151e27;
+ border-color: var(--fc-button-active-border-color, #151e27);
+ }
+.fc .fc-button-primary:not(:disabled):active:focus,
+ .fc .fc-button-primary:not(:disabled).fc-button-active:focus {
+ box-shadow: 0 0 0 0.2rem rgba(76, 91, 106, 0.5);
+ }
+.fc {
+
+ /* icons within buttons */
+
+}
+.fc .fc-button .fc-icon {
+ vertical-align: middle;
+ font-size: 1.5em; /* bump up the size (but don't make it bigger than line-height of button, which is 1.5em also) */
+ }
+.fc .fc-button-group {
+ position: relative;
+ display: inline-flex;
+ vertical-align: middle;
+ }
+.fc .fc-button-group > .fc-button {
+ position: relative;
+ flex: 1 1 auto;
+ }
+.fc .fc-button-group > .fc-button:hover {
+ z-index: 1;
+ }
+.fc .fc-button-group > .fc-button:focus,
+ .fc .fc-button-group > .fc-button:active,
+ .fc .fc-button-group > .fc-button.fc-button-active {
+ z-index: 1;
+ }
+.fc-direction-ltr .fc-button-group > .fc-button:not(:first-child) {
+ margin-left: -1px;
+ border-top-left-radius: 0;
+ border-bottom-left-radius: 0;
+ }
+.fc-direction-ltr .fc-button-group > .fc-button:not(:last-child) {
+ border-top-right-radius: 0;
+ border-bottom-right-radius: 0;
+ }
+.fc-direction-rtl .fc-button-group > .fc-button:not(:first-child) {
+ margin-right: -1px;
+ border-top-right-radius: 0;
+ border-bottom-right-radius: 0;
+ }
+.fc-direction-rtl .fc-button-group > .fc-button:not(:last-child) {
+ border-top-left-radius: 0;
+ border-bottom-left-radius: 0;
+ }
+.fc .fc-toolbar {
+ display: flex;
+ justify-content: space-between;
+ align-items: center;
+ }
+.fc .fc-toolbar.fc-header-toolbar {
+ margin-bottom: 1.5em;
+ }
+.fc .fc-toolbar.fc-footer-toolbar {
+ margin-top: 1.5em;
+ }
+.fc .fc-toolbar-title {
+ font-size: 1.75em;
+ margin: 0;
+ }
+.fc-direction-ltr .fc-toolbar > * > :not(:first-child) {
+ margin-left: .75em; /* space between */
+ }
+.fc-direction-rtl .fc-toolbar > * > :not(:first-child) {
+ margin-right: .75em; /* space between */
+ }
+.fc-direction-rtl .fc-toolbar-ltr { /* when the toolbar-chunk positioning system is explicitly left-to-right */
+ flex-direction: row-reverse;
+ }
+.fc .fc-scroller {
+ -webkit-overflow-scrolling: touch;
+ position: relative; /* for abs-positioned elements within */
+ }
+.fc .fc-scroller-liquid {
+ height: 100%;
+ }
+.fc .fc-scroller-liquid-absolute {
+ position: absolute;
+ top: 0;
+ right: 0;
+ left: 0;
+ bottom: 0;
+ }
+.fc .fc-scroller-harness {
+ position: relative;
+ overflow: hidden;
+ direction: ltr;
+ /* hack for chrome computing the scroller's right/left wrong for rtl. undone below... */
+ /* TODO: demonstrate in codepen */
+ }
+.fc .fc-scroller-harness-liquid {
+ height: 100%;
+ }
+.fc-direction-rtl .fc-scroller-harness > .fc-scroller { /* undo above hack */
+ direction: rtl;
+ }
+.fc-theme-standard .fc-scrollgrid {
+ border: 1px solid #ddd;
+ border: 1px solid var(--fc-border-color, #ddd); /* bootstrap does this. match */
+ }
+.fc .fc-scrollgrid,
+ .fc .fc-scrollgrid table { /* all tables (self included) */
+ width: 100%; /* because tables don't normally do this */
+ table-layout: fixed;
+ }
+.fc .fc-scrollgrid table { /* inner tables */
+ border-top-style: hidden;
+ border-left-style: hidden;
+ border-right-style: hidden;
+ }
+.fc .fc-scrollgrid {
+
+ border-collapse: separate;
+ border-right-width: 0;
+ border-bottom-width: 0;
+
+ }
+.fc .fc-scrollgrid-liquid {
+ height: 100%;
+ }
+.fc .fc-scrollgrid-section { /* a */
+ height: 1px /* better than 0, for firefox */
+
+ }
+.fc .fc-scrollgrid-section > td {
+ height: 1px; /* needs a height so inner div within grow. better than 0, for firefox */
+ }
+.fc .fc-scrollgrid-section table {
+ height: 1px;
+ /* for most browsers, if a height isn't set on the table, can't do liquid-height within cells */
+ /* serves as a min-height. harmless */
+ }
+.fc .fc-scrollgrid-section-liquid > td {
+ height: 100%; /* better than `auto`, for firefox */
+ }
+.fc .fc-scrollgrid-section > * {
+ border-top-width: 0;
+ border-left-width: 0;
+ }
+.fc .fc-scrollgrid-section-header > *,
+ .fc .fc-scrollgrid-section-footer > * {
+ border-bottom-width: 0;
+ }
+.fc .fc-scrollgrid-section-body table,
+ .fc .fc-scrollgrid-section-footer table {
+ border-bottom-style: hidden; /* head keeps its bottom border tho */
+ }
+.fc {
+
+ /* stickiness */
+
+}
+.fc .fc-scrollgrid-section-sticky > * {
+ background: #fff;
+ background: var(--fc-page-bg-color, #fff);
+ position: sticky;
+ z-index: 3; /* TODO: var */
+ /* TODO: box-shadow when sticking */
+ }
+.fc .fc-scrollgrid-section-header.fc-scrollgrid-section-sticky > * {
+ top: 0; /* because border-sharing causes a gap at the top */
+ /* TODO: give safari -1. has bug */
+ }
+.fc .fc-scrollgrid-section-footer.fc-scrollgrid-section-sticky > * {
+ bottom: 0; /* known bug: bottom-stickiness doesn't work in safari */
+ }
+.fc .fc-scrollgrid-sticky-shim { /* for horizontal scrollbar */
+ height: 1px; /* needs height to create scrollbars */
+ margin-bottom: -1px;
+ }
+.fc-sticky { /* no .fc wrap because used as child of body */
+ position: sticky;
+}
+.fc .fc-view-harness {
+ flex-grow: 1; /* because this harness is WITHIN the .fc's flexbox */
+ position: relative;
+ }
+.fc {
+
+ /* when the harness controls the height, make the view liquid */
+
+}
+.fc .fc-view-harness-active > .fc-view {
+ position: absolute;
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ }
+.fc .fc-col-header-cell-cushion {
+ display: inline-block; /* x-browser for when sticky (when multi-tier header) */
+ padding: 2px 4px;
+ }
+.fc .fc-bg-event,
+ .fc .fc-non-business,
+ .fc .fc-highlight {
+ /* will always have a harness with position:relative/absolute, so absolutely expand */
+ position: absolute;
+ top: 0;
+ left: 0;
+ right: 0;
+ bottom: 0;
+ }
+.fc .fc-non-business {
+ background: rgba(215, 215, 215, 0.3);
+ background: var(--fc-non-business-color, rgba(215, 215, 215, 0.3));
+ }
+.fc .fc-bg-event {
+ background: rgb(143, 223, 130);
+ background: var(--fc-bg-event-color, rgb(143, 223, 130));
+ opacity: 0.3;
+ opacity: var(--fc-bg-event-opacity, 0.3)
+ }
+.fc .fc-bg-event .fc-event-title {
+ margin: .5em;
+ font-size: .85em;
+ font-size: var(--fc-small-font-size, .85em);
+ font-style: italic;
+ }
+.fc .fc-highlight {
+ background: rgba(188, 232, 241, 0.3);
+ background: var(--fc-highlight-color, rgba(188, 232, 241, 0.3));
+ }
+.fc .fc-cell-shaded,
+ .fc .fc-day-disabled {
+ background: rgba(208, 208, 208, 0.3);
+ background: var(--fc-neutral-bg-color, rgba(208, 208, 208, 0.3));
+ }
+/* link resets */
+/* ---------------------------------------------------------------------------------------------------- */
+a.fc-event,
+a.fc-event:hover {
+ text-decoration: none;
+}
+/* cursor */
+.fc-event[href],
+.fc-event.fc-event-draggable {
+ cursor: pointer;
+}
+/* event text content */
+/* ---------------------------------------------------------------------------------------------------- */
+.fc-event .fc-event-main {
+ position: relative;
+ z-index: 2;
+ }
+/* dragging */
+/* ---------------------------------------------------------------------------------------------------- */
+.fc-event-dragging:not(.fc-event-selected) { /* MOUSE */
+ opacity: 0.75;
+ }
+.fc-event-dragging.fc-event-selected { /* TOUCH */
+ box-shadow: 0 2px 7px rgba(0, 0, 0, 0.3);
+ }
+/* resizing */
+/* ---------------------------------------------------------------------------------------------------- */
+/* (subclasses should hone positioning for touch and non-touch) */
+.fc-event .fc-event-resizer {
+ display: none;
+ position: absolute;
+ z-index: 4;
+ }
+.fc-event:hover, /* MOUSE */
+.fc-event-selected { /* TOUCH */
+
+}
+.fc-event:hover .fc-event-resizer, .fc-event-selected .fc-event-resizer {
+ display: block;
+ }
+.fc-event-selected .fc-event-resizer {
+ border-radius: 4px;
+ border-radius: calc(var(--fc-event-resizer-dot-total-width, 8px) / 2);
+ border-width: 1px;
+ border-width: var(--fc-event-resizer-dot-border-width, 1px);
+ width: 8px;
+ width: var(--fc-event-resizer-dot-total-width, 8px);
+ height: 8px;
+ height: var(--fc-event-resizer-dot-total-width, 8px);
+ border-style: solid;
+ border-color: inherit;
+ background: #fff;
+ background: var(--fc-page-bg-color, #fff)
+
+ /* expand hit area */
+
+ }
+.fc-event-selected .fc-event-resizer:before {
+ content: '';
+ position: absolute;
+ top: -20px;
+ left: -20px;
+ right: -20px;
+ bottom: -20px;
+ }
+/* selecting (always TOUCH) */
+/* ---------------------------------------------------------------------------------------------------- */
+.fc-event-selected {
+ box-shadow: 0 2px 5px rgba(0, 0, 0, 0.2)
+
+ /* expand hit area (subclasses should expand) */
+
+}
+.fc-event-selected:before {
+ content: "";
+ position: absolute;
+ z-index: 3;
+ top: 0;
+ left: 0;
+ right: 0;
+ bottom: 0;
+ }
+.fc-event-selected {
+
+ /* dimmer effect */
+
+}
+.fc-event-selected:after {
+ content: "";
+ background: rgba(0, 0, 0, 0.25);
+ background: var(--fc-event-selected-overlay-color, rgba(0, 0, 0, 0.25));
+ position: absolute;
+ z-index: 1;
+
+ /* assume there's a border on all sides. overcome it. */
+ /* sometimes there's NOT a border, in which case the dimmer will go over */
+ /* an adjacent border, which looks fine. */
+ top: -1px;
+ left: -1px;
+ right: -1px;
+ bottom: -1px;
+ }
+/*
+A HORIZONTAL event
+*/
+.fc-h-event { /* allowed to be top-level */
+ display: block;
+ border: 1px solid #3788d8;
+ border: 1px solid var(--fc-event-border-color, #3788d8);
+ background-color: #3788d8;
+ background-color: var(--fc-event-bg-color, #3788d8)
+
+}
+.fc-h-event .fc-event-main {
+ color: #fff;
+ color: var(--fc-event-text-color, #fff);
+ }
+.fc-h-event .fc-event-main-frame {
+ display: flex; /* for make fc-event-title-container expand */
+ }
+.fc-h-event .fc-event-time {
+ max-width: 100%; /* clip overflow on this element */
+ overflow: hidden;
+ }
+.fc-h-event .fc-event-title-container { /* serves as a container for the sticky cushion */
+ flex-grow: 1;
+ flex-shrink: 1;
+ min-width: 0; /* important for allowing to shrink all the way */
+ }
+.fc-h-event .fc-event-title {
+ display: inline-block; /* need this to be sticky cross-browser */
+ vertical-align: top; /* for not messing up line-height */
+ left: 0; /* for sticky */
+ right: 0; /* for sticky */
+ max-width: 100%; /* clip overflow on this element */
+ overflow: hidden;
+ }
+.fc-h-event.fc-event-selected:before {
+ /* expand hit area */
+ top: -10px;
+ bottom: -10px;
+ }
+/* adjust border and border-radius (if there is any) for non-start/end */
+.fc-direction-ltr .fc-daygrid-block-event:not(.fc-event-start),
+.fc-direction-rtl .fc-daygrid-block-event:not(.fc-event-end) {
+ border-top-left-radius: 0;
+ border-bottom-left-radius: 0;
+ border-left-width: 0;
+}
+.fc-direction-ltr .fc-daygrid-block-event:not(.fc-event-end),
+.fc-direction-rtl .fc-daygrid-block-event:not(.fc-event-start) {
+ border-top-right-radius: 0;
+ border-bottom-right-radius: 0;
+ border-right-width: 0;
+}
+/* resizers */
+.fc-h-event:not(.fc-event-selected) .fc-event-resizer {
+ top: 0;
+ bottom: 0;
+ width: 8px;
+ width: var(--fc-event-resizer-thickness, 8px);
+}
+.fc-direction-ltr .fc-h-event:not(.fc-event-selected) .fc-event-resizer-start,
+.fc-direction-rtl .fc-h-event:not(.fc-event-selected) .fc-event-resizer-end {
+ cursor: w-resize;
+ left: -4px;
+ left: calc(var(--fc-event-resizer-thickness, 8px) / -2);
+}
+.fc-direction-ltr .fc-h-event:not(.fc-event-selected) .fc-event-resizer-end,
+.fc-direction-rtl .fc-h-event:not(.fc-event-selected) .fc-event-resizer-start {
+ cursor: e-resize;
+ right: -4px;
+ right: calc(var(--fc-event-resizer-thickness, 8px) / -2);
+}
+/* resizers for TOUCH */
+.fc-h-event.fc-event-selected .fc-event-resizer {
+ top: 50%;
+ margin-top: -4px;
+ margin-top: calc(var(--fc-event-resizer-dot-total-width, 8px) / -2);
+}
+.fc-direction-ltr .fc-h-event.fc-event-selected .fc-event-resizer-start,
+.fc-direction-rtl .fc-h-event.fc-event-selected .fc-event-resizer-end {
+ left: -4px;
+ left: calc(var(--fc-event-resizer-dot-total-width, 8px) / -2);
+}
+.fc-direction-ltr .fc-h-event.fc-event-selected .fc-event-resizer-end,
+.fc-direction-rtl .fc-h-event.fc-event-selected .fc-event-resizer-start {
+ right: -4px;
+ right: calc(var(--fc-event-resizer-dot-total-width, 8px) / -2);
+}
+.fc .fc-popover {
+ position: absolute;
+ z-index: 9999;
+ box-shadow: 0 2px 6px rgba(0,0,0,.15);
+ }
+.fc .fc-popover-header {
+ display: flex;
+ flex-direction: row;
+ justify-content: space-between;
+ align-items: center;
+ padding: 3px 4px;
+ }
+.fc .fc-popover-title {
+ margin: 0 2px;
+ }
+.fc .fc-popover-close {
+ cursor: pointer;
+ opacity: 0.65;
+ font-size: 1.1em;
+ }
+.fc-theme-standard .fc-popover {
+ border: 1px solid #ddd;
+ border: 1px solid var(--fc-border-color, #ddd);
+ background: #fff;
+ background: var(--fc-page-bg-color, #fff);
+ }
+.fc-theme-standard .fc-popover-header {
+ background: rgba(208, 208, 208, 0.3);
+ background: var(--fc-neutral-bg-color, rgba(208, 208, 208, 0.3));
+ }
+
+
+:root {
+ --fc-daygrid-event-dot-width: 8px;
+}
+/* help things clear margins of inner content */
+.fc-daygrid-day-frame,
+.fc-daygrid-day-events,
+.fc-daygrid-event-harness { /* for event top/bottom margins */
+}
+.fc-daygrid-day-frame:before, .fc-daygrid-day-events:before, .fc-daygrid-event-harness:before {
+ content: "";
+ clear: both;
+ display: table; }
+.fc-daygrid-day-frame:after, .fc-daygrid-day-events:after, .fc-daygrid-event-harness:after {
+ content: "";
+ clear: both;
+ display: table; }
+.fc .fc-daygrid-body { /* a that wraps the table */
+ position: relative;
+ z-index: 1; /* container inner z-index's because
s can't do it */
+ }
+.fc .fc-daygrid-day.fc-day-today {
+ background-color: rgba(255, 220, 40, 0.15);
+ background-color: var(--fc-today-bg-color, rgba(255, 220, 40, 0.15));
+ }
+.fc .fc-daygrid-day-frame {
+ position: relative;
+ min-height: 100%; /* seems to work better than `height` because sets height after rows/cells naturally do it */
+ }
+.fc {
+
+ /* cell top */
+
+}
+.fc .fc-daygrid-day-top {
+ display: flex;
+ flex-direction: row-reverse;
+ }
+.fc .fc-day-other .fc-daygrid-day-top {
+ opacity: 0.3;
+ }
+.fc {
+
+ /* day number (within cell top) */
+
+}
+.fc .fc-daygrid-day-number {
+ position: relative;
+ z-index: 4;
+ padding: 4px;
+ }
+.fc {
+
+ /* event container */
+
+}
+.fc .fc-daygrid-day-events {
+ margin-top: 1px; /* needs to be margin, not padding, so that available cell height can be computed */
+ }
+.fc {
+
+ /* positioning for balanced vs natural */
+
+}
+.fc .fc-daygrid-body-balanced .fc-daygrid-day-events {
+ position: absolute;
+ left: 0;
+ right: 0;
+ }
+.fc .fc-daygrid-body-unbalanced .fc-daygrid-day-events {
+ position: relative; /* for containing abs positioned event harnesses */
+ min-height: 2em; /* in addition to being a min-height during natural height, equalizes the heights a little bit */
+ }
+.fc .fc-daygrid-body-natural { /* can coexist with -unbalanced */
+ }
+.fc .fc-daygrid-body-natural .fc-daygrid-day-events {
+ margin-bottom: 1em;
+ }
+.fc {
+
+ /* event harness */
+
+}
+.fc .fc-daygrid-event-harness {
+ position: relative;
+ }
+.fc .fc-daygrid-event-harness-abs {
+ position: absolute;
+ top: 0; /* fallback coords for when cannot yet be computed */
+ left: 0; /* */
+ right: 0; /* */
+ }
+.fc .fc-daygrid-bg-harness {
+ position: absolute;
+ top: 0;
+ bottom: 0;
+ }
+.fc {
+
+ /* bg content */
+
+}
+.fc .fc-daygrid-day-bg .fc-non-business { z-index: 1 }
+.fc .fc-daygrid-day-bg .fc-bg-event { z-index: 2 }
+.fc .fc-daygrid-day-bg .fc-highlight { z-index: 3 }
+.fc {
+
+ /* events */
+
+}
+.fc .fc-daygrid-event {
+ z-index: 6;
+ margin-top: 1px;
+ }
+.fc .fc-daygrid-event.fc-event-mirror {
+ z-index: 7;
+ }
+.fc {
+
+ /* cell bottom (within day-events) */
+
+}
+.fc .fc-daygrid-day-bottom {
+ font-size: .85em;
+ padding: 2px 3px 0
+ }
+.fc .fc-daygrid-day-bottom:before {
+ content: "";
+ clear: both;
+ display: table; }
+.fc .fc-daygrid-more-link {
+ position: relative;
+ z-index: 4;
+ cursor: pointer;
+ }
+.fc {
+
+ /* week number (within frame) */
+
+}
+.fc .fc-daygrid-week-number {
+ position: absolute;
+ z-index: 5;
+ top: 0;
+ padding: 2px;
+ min-width: 1.5em;
+ text-align: center;
+ background-color: rgba(208, 208, 208, 0.3);
+ background-color: var(--fc-neutral-bg-color, rgba(208, 208, 208, 0.3));
+ color: #808080;
+ color: var(--fc-neutral-text-color, #808080);
+ }
+.fc {
+
+ /* popover */
+
+}
+.fc .fc-more-popover .fc-popover-body {
+ min-width: 220px;
+ padding: 10px;
+ }
+.fc-direction-ltr .fc-daygrid-event.fc-event-start,
+.fc-direction-rtl .fc-daygrid-event.fc-event-end {
+ margin-left: 2px;
+}
+.fc-direction-ltr .fc-daygrid-event.fc-event-end,
+.fc-direction-rtl .fc-daygrid-event.fc-event-start {
+ margin-right: 2px;
+}
+.fc-direction-ltr .fc-daygrid-week-number {
+ left: 0;
+ border-radius: 0 0 3px 0;
+ }
+.fc-direction-rtl .fc-daygrid-week-number {
+ right: 0;
+ border-radius: 0 0 0 3px;
+ }
+.fc-liquid-hack .fc-daygrid-day-frame {
+ position: static; /* will cause inner absolute stuff to expand to */
+ }
+.fc-daygrid-event { /* make root-level, because will be dragged-and-dropped outside of a component root */
+ position: relative; /* for z-indexes assigned later */
+ white-space: normal;
+ border-radius: 3px; /* dot event needs this to when selected */
+ font-size: .85em;
+ font-size: var(--fc-small-font-size, .85em);
+}
+/* --- the rectangle ("block") style of event --- */
+.fc-daygrid-block-event .fc-event-time {
+ font-weight: bold;
+ }
+.fc-daygrid-block-event .fc-event-time,
+ .fc-daygrid-block-event .fc-event-title {
+ padding: 1px;
+ }
+/* --- the dot style of event --- */
+.fc-daygrid-dot-event {
+ display: flex;
+ align-items: center;
+ padding: 2px 0
+
+}
+.fc-daygrid-dot-event .fc-event-title {
+ flex-grow: 1;
+ flex-shrink: 1;
+ min-width: 0; /* important for allowing to shrink all the way */
+ overflow: hidden;
+ font-weight: bold;
+ }
+.fc-daygrid-dot-event:hover,
+ .fc-daygrid-dot-event.fc-event-mirror {
+ background: rgba(0, 0, 0, 0.1);
+ }
+.fc-daygrid-dot-event.fc-event-selected:before {
+ /* expand hit area */
+ top: -10px;
+ bottom: -10px;
+ }
+.fc-daygrid-event-dot { /* the actual dot */
+ margin: 0 4px;
+ box-sizing: content-box;
+ width: 0;
+ height: 0;
+ border: 4px solid #3788d8;
+ border: calc(var(--fc-daygrid-event-dot-width, 8px) / 2) solid var(--fc-event-border-color, #3788d8);
+ border-radius: 4px;
+ border-radius: calc(var(--fc-daygrid-event-dot-width, 8px) / 2);
+}
+/* --- spacing between time and title --- */
+.fc-direction-ltr .fc-daygrid-event .fc-event-time {
+ margin-right: 3px;
+ }
+.fc-direction-rtl .fc-daygrid-event .fc-event-time {
+ margin-left: 3px;
+ }
+
+
+/*
+A VERTICAL event
+*/
+
+.fc-v-event { /* allowed to be top-level */
+ display: block;
+ border: 1px solid #3788d8;
+ border: 1px solid var(--fc-event-border-color, #3788d8);
+ background-color: #3788d8;
+ background-color: var(--fc-event-bg-color, #3788d8)
+
+}
+
+.fc-v-event .fc-event-main {
+ color: #fff;
+ color: var(--fc-event-text-color, #fff);
+ height: 100%;
+ }
+
+.fc-v-event .fc-event-main-frame {
+ height: 100%;
+ display: flex;
+ flex-direction: column;
+ }
+
+.fc-v-event .fc-event-time {
+ flex-grow: 0;
+ flex-shrink: 0;
+ max-height: 100%;
+ overflow: hidden;
+ }
+
+.fc-v-event .fc-event-title-container { /* a container for the sticky cushion */
+ flex-grow: 1;
+ flex-shrink: 1;
+ min-height: 0; /* important for allowing to shrink all the way */
+ }
+
+.fc-v-event .fc-event-title { /* will have fc-sticky on it */
+ top: 0;
+ bottom: 0;
+ max-height: 100%; /* clip overflow */
+ overflow: hidden;
+ }
+
+.fc-v-event:not(.fc-event-start) {
+ border-top-width: 0;
+ border-top-left-radius: 0;
+ border-top-right-radius: 0;
+ }
+
+.fc-v-event:not(.fc-event-end) {
+ border-bottom-width: 0;
+ border-bottom-left-radius: 0;
+ border-bottom-right-radius: 0;
+ }
+
+.fc-v-event.fc-event-selected:before {
+ /* expand hit area */
+ left: -10px;
+ right: -10px;
+ }
+
+.fc-v-event {
+
+ /* resizer (mouse AND touch) */
+
+}
+
+.fc-v-event .fc-event-resizer-start {
+ cursor: n-resize;
+ }
+
+.fc-v-event .fc-event-resizer-end {
+ cursor: s-resize;
+ }
+
+.fc-v-event {
+
+ /* resizer for MOUSE */
+
+}
+
+.fc-v-event:not(.fc-event-selected) .fc-event-resizer {
+ height: 8px;
+ height: var(--fc-event-resizer-thickness, 8px);
+ left: 0;
+ right: 0;
+ }
+
+.fc-v-event:not(.fc-event-selected) .fc-event-resizer-start {
+ top: -4px;
+ top: calc(var(--fc-event-resizer-thickness, 8px) / -2);
+ }
+
+.fc-v-event:not(.fc-event-selected) .fc-event-resizer-end {
+ bottom: -4px;
+ bottom: calc(var(--fc-event-resizer-thickness, 8px) / -2);
+ }
+
+.fc-v-event {
+
+ /* resizer for TOUCH (when event is "selected") */
+
+}
+
+.fc-v-event.fc-event-selected .fc-event-resizer {
+ left: 50%;
+ margin-left: -4px;
+ margin-left: calc(var(--fc-event-resizer-dot-total-width, 8px) / -2);
+ }
+
+.fc-v-event.fc-event-selected .fc-event-resizer-start {
+ top: -4px;
+ top: calc(var(--fc-event-resizer-dot-total-width, 8px) / -2);
+ }
+
+.fc-v-event.fc-event-selected .fc-event-resizer-end {
+ bottom: -4px;
+ bottom: calc(var(--fc-event-resizer-dot-total-width, 8px) / -2);
+ }
+.fc .fc-timegrid .fc-daygrid-body { /* the all-day daygrid within the timegrid view */
+ z-index: 2; /* put above the timegrid-body so that more-popover is above everything. TODO: better solution */
+ }
+.fc .fc-timegrid-divider {
+ padding: 0 0 2px; /* browsers get confused when you set height. use padding instead */
+ }
+.fc .fc-timegrid-body {
+ position: relative;
+ z-index: 1; /* scope the z-indexes of slots and cols */
+ min-height: 100%; /* fill height always, even when slat table doesn't grow */
+ }
+.fc .fc-timegrid-axis-chunk { /* for advanced ScrollGrid */
+ position: relative /* offset parent for now-indicator-container */
+
+ }
+.fc .fc-timegrid-axis-chunk > table {
+ position: relative;
+ z-index: 1; /* above the now-indicator-container */
+ }
+.fc .fc-timegrid-slots {
+ position: relative;
+ z-index: 1;
+ }
+.fc .fc-timegrid-slot { /* a */
+ height: 1.5em;
+ border-bottom: 0 /* each cell owns its top border */
+ }
+.fc .fc-timegrid-slot:empty:before {
+ content: '\00a0'; /* make sure there's at least an empty space to create height for height syncing */
+ }
+.fc .fc-timegrid-slot-minor {
+ border-top-style: dotted;
+ }
+.fc .fc-timegrid-slot-label-cushion {
+ display: inline-block;
+ white-space: normal;
+ }
+.fc .fc-timegrid-slot-label {
+ vertical-align: middle; /* vertical align the slots */
+ }
+.fc {
+
+
+ /* slots AND axis cells (top-left corner of view including the "all-day" text) */
+
+}
+.fc .fc-timegrid-axis-cushion,
+ .fc .fc-timegrid-slot-label-cushion {
+ padding: 0 4px;
+ }
+.fc {
+
+
+ /* axis cells (top-left corner of view including the "all-day" text) */
+ /* vertical align is more complicated, uses flexbox */
+
+}
+.fc .fc-timegrid-axis-frame-liquid {
+ height: 100%; /* will need liquid-hack in FF */
+ }
+.fc .fc-timegrid-axis-frame {
+ overflow: hidden;
+ display: flex;
+ align-items: center; /* vertical align */
+ justify-content: flex-end; /* horizontal align. matches text-align below */
+ }
+.fc .fc-timegrid-axis-cushion {
+ max-width: 60px; /* limits the width of the "all-day" text */
+ flex-shrink: 0; /* allows text to expand how it normally would, regardless of constrained width */
+ }
+.fc-direction-ltr .fc-timegrid-slot-label-frame {
+ text-align: right;
+ }
+.fc-direction-rtl .fc-timegrid-slot-label-frame {
+ text-align: left;
+ }
+.fc-liquid-hack .fc-timegrid-axis-frame-liquid {
+ height: auto;
+ position: absolute;
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ }
+.fc .fc-timegrid-col.fc-day-today {
+ background-color: rgba(255, 220, 40, 0.15);
+ background-color: var(--fc-today-bg-color, rgba(255, 220, 40, 0.15));
+ }
+.fc .fc-timegrid-col-frame {
+ min-height: 100%; /* liquid-hack is below */
+ position: relative;
+ }
+.fc-liquid-hack .fc-timegrid-col-frame {
+ height: auto;
+ position: absolute;
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ }
+.fc-media-screen .fc-timegrid-cols {
+ position: absolute; /* no z-index. children will decide and go above slots */
+ top: 0;
+ left: 0;
+ right: 0;
+ bottom: 0
+ }
+.fc-media-screen .fc-timegrid-cols > table {
+ height: 100%;
+ }
+.fc-media-screen .fc-timegrid-col-bg,
+ .fc-media-screen .fc-timegrid-col-events,
+ .fc-media-screen .fc-timegrid-now-indicator-container {
+ position: absolute;
+ top: 0;
+ left: 0;
+ right: 0;
+ }
+.fc {
+
+ /* bg */
+
+}
+.fc .fc-timegrid-col-bg {
+ z-index: 2; /* TODO: kill */
+ }
+.fc .fc-timegrid-col-bg .fc-non-business { z-index: 1 }
+.fc .fc-timegrid-col-bg .fc-bg-event { z-index: 2 }
+.fc .fc-timegrid-col-bg .fc-highlight { z-index: 3 }
+.fc .fc-timegrid-bg-harness {
+ position: absolute; /* top/bottom will be set by JS */
+ left: 0;
+ right: 0;
+ }
+.fc {
+
+ /* fg events */
+ /* (the mirror segs are put into a separate container with same classname, */
+ /* and they must be after the normal seg container to appear at a higher z-index) */
+
+}
+.fc .fc-timegrid-col-events {
+ z-index: 3;
+ /* child event segs have z-indexes that are scoped within this div */
+ }
+.fc {
+
+ /* now indicator */
+
+}
+.fc .fc-timegrid-now-indicator-container {
+ bottom: 0;
+ overflow: hidden; /* don't let overflow of lines/arrows cause unnecessary scrolling */
+ /* z-index is set on the individual elements */
+ }
+.fc-direction-ltr .fc-timegrid-col-events {
+ margin: 0 2.5% 0 2px;
+ }
+.fc-direction-rtl .fc-timegrid-col-events {
+ margin: 0 2px 0 2.5%;
+ }
+.fc-timegrid-event-harness {
+ position: absolute /* top/left/right/bottom will all be set by JS */
+}
+.fc-timegrid-event-harness > .fc-timegrid-event {
+ position: absolute; /* absolute WITHIN the harness */
+ top: 0; /* for when not yet positioned */
+ bottom: 0; /* " */
+ left: 0;
+ right: 0;
+ }
+.fc-timegrid-event-harness-inset .fc-timegrid-event,
+.fc-timegrid-event.fc-event-mirror,
+.fc-timegrid-more-link {
+ box-shadow: 0px 0px 0px 1px #fff;
+ box-shadow: 0px 0px 0px 1px var(--fc-page-bg-color, #fff);
+}
+.fc-timegrid-event,
+.fc-timegrid-more-link { /* events need to be root */
+ font-size: .85em;
+ font-size: var(--fc-small-font-size, .85em);
+ border-radius: 3px;
+}
+.fc-timegrid-event { /* events need to be root */
+ margin-bottom: 1px /* give some space from bottom */
+}
+.fc-timegrid-event .fc-event-main {
+ padding: 1px 1px 0;
+ }
+.fc-timegrid-event .fc-event-time {
+ white-space: normal;
+ font-size: .85em;
+ font-size: var(--fc-small-font-size, .85em);
+ margin-bottom: 1px;
+ }
+.fc-timegrid-event-short .fc-event-main-frame {
+ flex-direction: row;
+ overflow: hidden;
+ }
+.fc-timegrid-event-short .fc-event-time:after {
+ content: '\00a0-\00a0'; /* dash surrounded by non-breaking spaces */
+ }
+.fc-timegrid-event-short .fc-event-title {
+ font-size: .85em;
+ font-size: var(--fc-small-font-size, .85em)
+ }
+.fc-timegrid-more-link { /* does NOT inherit from fc-timegrid-event */
+ position: absolute;
+ z-index: 9999; /* hack */
+ color: inherit;
+ color: var(--fc-more-link-text-color, inherit);
+ background: #d0d0d0;
+ background: var(--fc-more-link-bg-color, #d0d0d0);
+ cursor: pointer;
+ margin-bottom: 1px; /* match space below fc-timegrid-event */
+}
+.fc-timegrid-more-link-inner { /* has fc-sticky */
+ padding: 3px 2px;
+ top: 0;
+}
+.fc-direction-ltr .fc-timegrid-more-link {
+ right: 0;
+ }
+.fc-direction-rtl .fc-timegrid-more-link {
+ left: 0;
+ }
+.fc {
+
+ /* line */
+
+}
+.fc .fc-timegrid-now-indicator-line {
+ position: absolute;
+ z-index: 4;
+ left: 0;
+ right: 0;
+ border-style: solid;
+ border-color: red;
+ border-color: var(--fc-now-indicator-color, red);
+ border-width: 1px 0 0;
+ }
+.fc {
+
+ /* arrow */
+
+}
+.fc .fc-timegrid-now-indicator-arrow {
+ position: absolute;
+ z-index: 4;
+ margin-top: -5px; /* vertically center on top coordinate */
+ border-style: solid;
+ border-color: red;
+ border-color: var(--fc-now-indicator-color, red);
+ }
+.fc-direction-ltr .fc-timegrid-now-indicator-arrow {
+ left: 0;
+
+ /* triangle pointing right. TODO: mixin */
+ border-width: 5px 0 5px 6px;
+ border-top-color: transparent;
+ border-bottom-color: transparent;
+ }
+.fc-direction-rtl .fc-timegrid-now-indicator-arrow {
+ right: 0;
+
+ /* triangle pointing left. TODO: mixin */
+ border-width: 5px 6px 5px 0;
+ border-top-color: transparent;
+ border-bottom-color: transparent;
+ }
+
+
+:root {
+ --fc-list-event-dot-width: 10px;
+ --fc-list-event-hover-bg-color: #f5f5f5;
+}
+.fc-theme-standard .fc-list {
+ border: 1px solid #ddd;
+ border: 1px solid var(--fc-border-color, #ddd);
+ }
+.fc {
+
+ /* message when no events */
+
+}
+.fc .fc-list-empty {
+ background-color: rgba(208, 208, 208, 0.3);
+ background-color: var(--fc-neutral-bg-color, rgba(208, 208, 208, 0.3));
+ height: 100%;
+ display: flex;
+ justify-content: center;
+ align-items: center; /* vertically aligns fc-list-empty-inner */
+ }
+.fc .fc-list-empty-cushion {
+ margin: 5em 0;
+ }
+.fc {
+
+ /* table within the scroller */
+ /* ---------------------------------------------------------------------------------------------------- */
+
+}
+.fc .fc-list-table {
+ width: 100%;
+ border-style: hidden; /* kill outer border on theme */
+ }
+.fc .fc-list-table tr > * {
+ border-left: 0;
+ border-right: 0;
+ }
+.fc .fc-list-sticky .fc-list-day > * { /* the cells */
+ position: sticky;
+ top: 0;
+ background: #fff;
+ background: var(--fc-page-bg-color, #fff); /* for when headers are styled to be transparent and sticky */
+ }
+.fc .fc-list-table th {
+ padding: 0; /* uses an inner-wrapper instead... */
+ }
+.fc .fc-list-table td,
+ .fc .fc-list-day-cushion {
+ padding: 8px 14px;
+ }
+.fc {
+
+
+ /* date heading rows */
+ /* ---------------------------------------------------------------------------------------------------- */
+
+}
+.fc .fc-list-day-cushion:after {
+ content: "";
+ clear: both;
+ display: table; /* clear floating */
+ }
+.fc-theme-standard .fc-list-day-cushion {
+ background-color: rgba(208, 208, 208, 0.3);
+ background-color: var(--fc-neutral-bg-color, rgba(208, 208, 208, 0.3));
+ }
+.fc-direction-ltr .fc-list-day-text,
+.fc-direction-rtl .fc-list-day-side-text {
+ float: left;
+}
+.fc-direction-ltr .fc-list-day-side-text,
+.fc-direction-rtl .fc-list-day-text {
+ float: right;
+}
+/* make the dot closer to the event title */
+.fc-direction-ltr .fc-list-table .fc-list-event-graphic { padding-right: 0 }
+.fc-direction-rtl .fc-list-table .fc-list-event-graphic { padding-left: 0 }
+.fc .fc-list-event.fc-event-forced-url {
+ cursor: pointer; /* whole row will seem clickable */
+ }
+.fc .fc-list-event:hover td {
+ background-color: #f5f5f5;
+ background-color: var(--fc-list-event-hover-bg-color, #f5f5f5);
+ }
+.fc {
+
+ /* shrink certain cols */
+
+}
+.fc .fc-list-event-graphic,
+ .fc .fc-list-event-time {
+ white-space: normal;
+ width: 1px;
+ }
+.fc .fc-list-event-dot {
+ display: inline-block;
+ box-sizing: content-box;
+ width: 0;
+ height: 0;
+ border: 5px solid #3788d8;
+ border: calc(var(--fc-list-event-dot-width, 10px) / 2) solid var(--fc-event-border-color, #3788d8);
+ border-radius: 5px;
+ border-radius: calc(var(--fc-list-event-dot-width, 10px) / 2);
+ }
+.fc {
+
+ /* reset styling */
+
+}
+.fc .fc-list-event-title a {
+ color: inherit;
+ text-decoration: none;
+ }
+.fc {
+
+ /* underline link when hovering over any part of row */
+
+}
+.fc .fc-list-event.fc-event-forced-url:hover a {
+ text-decoration: underline;
+ }
+
+
+
+ .fc-theme-bootstrap a:not([href]) {
+ color: inherit; /* natural color for navlinks */
+ }
+
+
+
+ .fc .fc-event,
+ .fc .fc-scrollgrid table tr {
+ -moz-column-break-inside: avoid;
+ break-inside: avoid;
+ }
+
+.fc-media-print {
+ display: block; /* undo flexbox. FF doesn't know how to flow */
+ max-width: 100% /* width will be hardcoded too */
+}
+
+.fc-media-print .fc-timegrid-slots,
+ .fc-media-print .fc-timegrid-axis-chunk,
+ .fc-media-print .fc-timeline-slots,
+ .fc-media-print .fc-non-business,
+ .fc-media-print .fc-bg-event {
+ display: none;
+ }
+
+.fc-media-print .fc-toolbar button,
+ .fc-media-print .fc-h-event,
+ .fc-media-print .fc-v-event {
+ color: #000 !important;
+ background: #fff !important;
+ }
+
+.fc-media-print .fc-event,
+ .fc-media-print .fc-event-main { /* often controls the text-color */
+ color: #000 !important;
+ }
+
+.fc-media-print .fc-timegrid-event {
+ margin: 0.5em 0;
+ }
+
+
+
+ .fc .fc-timeline-body {
+ min-height: 100%;
+ position: relative;
+ z-index: 1; /* scope slots, bg, etc */
+ }
+/*
+vertical slots in both the header AND the body
+*/
+.fc .fc-timeline-slots {
+ position: absolute;
+ z-index: 1;
+ top: 0;
+ bottom: 0
+ }
+.fc .fc-timeline-slots > table {
+ height: 100%;
+ }
+.fc {
+
+ /* border for both header AND body cells */
+
+}
+.fc .fc-timeline-slot-minor {
+ border-style: dotted;
+ }
+.fc {
+
+ /* header cells (aka "label") */
+
+}
+.fc .fc-timeline-slot-frame {
+ display: flex;
+ align-items: center; /* vertical align */
+ justify-content: center; /* horizontal align */
+ overflow: hidden; /* important so text doesn't bleed out and cause extra scroll */
+ }
+.fc .fc-timeline-header-row-chrono { /* a row of times */
+ }
+.fc .fc-timeline-header-row-chrono .fc-timeline-slot-frame {
+ justify-content: flex-start; /* horizontal align left or right */
+ }
+.fc .fc-timeline-slot-cushion {
+ padding: 4px 5px; /* TODO: unify with fc-col-header? */
+ white-space: normal;
+ }
+.fc {
+
+ /* NOTE: how does the top row of cells get horizontally centered? */
+ /* for the non-chrono-row, the fc-sticky system looks for text-align center, */
+ /* and it's a fluke that the default browser stylesheet already does this for */
+ /* TODO: have StickyScrolling look at natural left coord to detect centeredness. */
+
+}
+/* only owns one side, so can do dotted */
+.fc-direction-ltr .fc-timeline-slot { border-right: 0 !important }
+.fc-direction-rtl .fc-timeline-slot { border-left: 0 !important }
+.fc .fc-timeline-now-indicator-container {
+ position: absolute;
+ z-index: 4;
+ top: 0;
+ bottom: 0;
+ left: 0;
+ right: 0;
+ width: 0;
+ }
+.fc .fc-timeline-now-indicator-arrow,
+ .fc .fc-timeline-now-indicator-line {
+ position: absolute;
+ top: 0;
+ border-style: solid;
+ border-color: red;
+ border-color: var(--fc-now-indicator-color, red);
+ }
+.fc .fc-timeline-now-indicator-arrow {
+ margin: 0 -6px; /* 5, then one more to counteract scroller's negative margins */
+
+ /* triangle pointing down. TODO: mixin */
+ border-width: 6px 5px 0 5px;
+ border-left-color: transparent;
+ border-right-color: transparent;
+ }
+.fc .fc-timeline-now-indicator-line {
+ margin: 0 -1px; /* counteract scroller's negative margins */
+ bottom: 0;
+ border-width: 0 0 0 1px;
+ }
+.fc {
+
+ /* container */
+
+}
+.fc .fc-timeline-events {
+ position: relative;
+ z-index: 3;
+ width: 0; /* for event positioning. will end up on correct side based on dir */
+ }
+.fc {
+
+ /* harness */
+
+}
+.fc .fc-timeline-event-harness,
+ .fc .fc-timeline-more-link {
+ position: absolute;
+ top: 0; /* for when when top can't be computed yet */
+ /* JS will set tht left/right */
+ }
+/* z-index, scoped within fc-timeline-events */
+.fc-timeline-event { z-index: 1 }
+.fc-timeline-event.fc-event-mirror { z-index: 2 }
+.fc-timeline-event {
+ position: relative; /* contains things. TODO: make part of fc-h-event and fc-v-event */
+ display: flex; /* for v-aligning start/end arrows and making fc-event-main stretch all the way */
+ align-items: center;
+ border-radius: 0;
+ padding: 2px 1px;
+ margin-bottom: 1px;
+ font-size: .85em;
+ font-size: var(--fc-small-font-size, .85em)
+
+ /* time and title spacing */
+ /* ---------------------------------------------------------------------------------------------------- */
+}
+.fc-timeline-event .fc-event-main {
+ flex-grow: 1;
+ flex-shrink: 1;
+ min-width: 0; /* important for allowing to shrink all the way */
+ }
+.fc-timeline-event .fc-event-time {
+ font-weight: bold;
+ }
+.fc-timeline-event .fc-event-time,
+ .fc-timeline-event .fc-event-title {
+ white-space: normal;
+ padding: 0 2px;
+ }
+/* move 1px away from slot line */
+.fc-direction-ltr .fc-timeline-event.fc-event-end,
+ .fc-direction-ltr .fc-timeline-more-link {
+ margin-right: 1px;
+ }
+.fc-direction-rtl .fc-timeline-event.fc-event-end,
+ .fc-direction-rtl .fc-timeline-more-link {
+ margin-left: 1px;
+ }
+/* make event beefier when overlap not allowed */
+.fc-timeline-overlap-disabled .fc-timeline-event {
+ padding-top: 5px;
+ padding-bottom: 5px;
+ margin-bottom: 0;
+}
+/* arrows indicating the event continues into past/future */
+/* ---------------------------------------------------------------------------------------------------- */
+/* part of the flexbox flow */
+.fc-timeline-event:not(.fc-event-start):before,
+.fc-timeline-event:not(.fc-event-end):after {
+ content: "";
+ flex-grow: 0;
+ flex-shrink: 0;
+ opacity: .5;
+
+ /* triangle. TODO: mixin */
+ width: 0;
+ height: 0;
+ margin: 0 1px;
+ border: 5px solid #000; /* TODO: var */
+ border-top-color: transparent;
+ border-bottom-color: transparent;
+}
+/* pointing left */
+.fc-direction-ltr .fc-timeline-event:not(.fc-event-start):before,
+.fc-direction-rtl .fc-timeline-event:not(.fc-event-end):after {
+ border-left: 0;
+}
+/* pointing right */
+.fc-direction-ltr .fc-timeline-event:not(.fc-event-end):after,
+.fc-direction-rtl .fc-timeline-event:not(.fc-event-start):before {
+ border-right: 0;
+}
+/* +more events indicator */
+/* ---------------------------------------------------------------------------------------------------- */
+.fc-timeline-more-link {
+ font-size: .85em;
+ font-size: var(--fc-small-font-size, .85em);
+ color: inherit;
+ color: var(--fc-more-link-text-color, inherit);
+ background: #d0d0d0;
+ background: var(--fc-more-link-bg-color, #d0d0d0);
+ padding: 1px;
+ cursor: pointer;
+}
+.fc-timeline-more-link-inner { /* has fc-sticky */
+ display: inline-block;
+ left: 0;
+ right: 0;
+ padding: 2px;
+}
+.fc .fc-timeline-bg { /* a container for bg content */
+ position: absolute;
+ z-index: 2;
+ top: 0;
+ bottom: 0;
+ width: 0;
+ left: 0; /* will take precedence when LTR */
+ right: 0; /* will take precedence when RTL */ /* TODO: kill */
+ }
+.fc .fc-timeline-bg .fc-non-business { z-index: 1 }
+.fc .fc-timeline-bg .fc-bg-event { z-index: 2 }
+.fc .fc-timeline-bg .fc-highlight { z-index: 3 }
+.fc .fc-timeline-bg-harness {
+ position: absolute;
+ top: 0;
+ bottom: 0;
+ }
+
+
+
+
+ .fc .fc-resource-timeline-divider {
+ width: 3px; /* important to have width to shrink this cell. no cross-browser problems */
+ cursor: col-resize;
+ }
.fc {
- direction: ltr;
- text-align: left;
- }
-
-.fc table {
- border-collapse: collapse;
- border-spacing: 0;
- }
-
-html .fc,
-.fc table {
- font-size: 1em;
- }
-
-.fc td,
-.fc th {
- padding: 0;
- vertical-align: top;
- }
+ /* will match horizontal groups in the datagrid AND group lanes in the timeline area */
-/* Header
-------------------------------------------------------------------------*/
+}
-.fc-header td {
- white-space: nowrap;
- }
+.fc .fc-resource-timeline .fc-resource-group:not([rowspan]) {
+ background: rgba(208, 208, 208, 0.3);
+ background: var(--fc-neutral-bg-color, rgba(208, 208, 208, 0.3));
+ }
-.fc-header-left {
- width: 25%;
- text-align: left;
- }
-
-.fc-header-center {
- text-align: center;
- }
-
-.fc-header-right {
- width: 25%;
- text-align: right;
- }
-
-.fc-header-title {
- display: inline-block;
- vertical-align: top;
- }
-
-.fc-header-title h2 {
- margin-top: 0;
- white-space: nowrap;
- }
-
-.fc .fc-header-space {
- padding-left: 10px;
- }
-
-.fc-header .fc-button {
- margin-bottom: 1em;
- vertical-align: top;
- }
-
-/* buttons edges butting together */
+.fc .fc-timeline-lane-frame {
+ position: relative; /* contains the fc-timeline-bg container, which liquidly expands */
+ /* the height is explicitly set by row-height-sync */
+ }
-.fc-header .fc-button {
- margin-right: -1px;
- }
-
-.fc-header .fc-corner-right, /* non-theme */
-.fc-header .ui-corner-right { /* theme */
- margin-right: 0; /* back to normal */
- }
-
-/* button layering (for border precedence) */
-
-.fc-header .fc-state-hover,
-.fc-header .ui-state-hover {
- z-index: 2;
- }
-
-.fc-header .fc-state-down {
- z-index: 3;
- }
+.fc .fc-timeline-overlap-enabled .fc-timeline-lane-frame .fc-timeline-events { /* has height set on it */
+ box-sizing: content-box; /* padding no longer part of height */
+ padding-bottom: 10px; /* give extra spacing underneath for selecting */
+ }
-.fc-header .fc-state-active,
-.fc-header .ui-state-active {
- z-index: 4;
- }
-
-
-
-/* Content
-------------------------------------------------------------------------*/
-
-.fc-content {
- clear: both;
- }
-
-.fc-view {
- width: 100%; /* needed for view switching (when view is absolute) */
- overflow: hidden;
- }
-
-
+/* hack to make bg expand to lane's full height in resource-timeline with expandRows (#6134) */
+.fc-timeline-body-expandrows td.fc-timeline-lane {
+ position: relative;
+ }
+.fc-timeline-body-expandrows .fc-timeline-lane-frame {
+ position: static;
+ }
+/* the "frame" */
+.fc-datagrid-cell-frame-liquid {
+ height: 100%; /* needs liquid hack */
+}
+.fc-liquid-hack .fc-datagrid-cell-frame-liquid {
+ height: auto;
+ position: absolute;
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ }
+.fc {
-/* Cell Styles
-------------------------------------------------------------------------*/
+ /* the "frame" in a HEADER */
+ /* needs to position the column resizer */
+ /* needs to vertically center content */
-.fc-widget-header, /* , usually */
-.fc-widget-content { /* , usually */
- border: 1px solid #ddd;
- }
-
-.fc-state-highlight { /* today cell */ /* TODO: add .fc-today to */
- background: #fcf8e3;
- }
-
-.fc-cell-overlay { /* semi-transparent rectangle while dragging */
- background: #bce8f1;
- opacity: .3;
- filter: alpha(opacity=30); /* for IE */
- }
-
+}
+.fc .fc-datagrid-header .fc-datagrid-cell-frame {
+ position: relative; /* for resizer */
+ display: flex;
+ justify-content: flex-start; /* horizontal align (natural left/right) */
+ align-items: center; /* vertical align */
+ }
+.fc {
+ /* the column resizer (only in HEADER) */
-/* Buttons
-------------------------------------------------------------------------*/
+}
+.fc .fc-datagrid-cell-resizer {
+ position: absolute;
+ z-index: 1;
+ top: 0;
+ bottom: 0;
+ width: 5px;
+ cursor: col-resize;
+ }
+.fc {
-.fc-button {
- position: relative;
- display: inline-block;
- padding: 0 .6em;
- overflow: hidden;
- height: 1.9em;
- line-height: 1.9em;
- white-space: nowrap;
- cursor: pointer;
- }
-
-.fc-state-default { /* non-theme */
- border: 1px solid;
- }
+ /* the cushion */
-.fc-state-default.fc-corner-left { /* non-theme */
- border-top-left-radius: 4px;
- border-bottom-left-radius: 4px;
- }
+}
+.fc .fc-datagrid-cell-cushion {
+ padding: 8px;
+ white-space: normal;
+ overflow: hidden; /* problem for col resizer :( */
+ }
+.fc {
-.fc-state-default.fc-corner-right { /* non-theme */
- border-top-right-radius: 4px;
- border-bottom-right-radius: 4px;
- }
+ /* expander icons */
-/*
- Our default prev/next buttons use HTML entities like ‹ › « »
- and we'll try to make them look good cross-browser.
-*/
+}
+.fc .fc-datagrid-expander {
+ cursor: pointer;
+ opacity: 0.65
-.fc-text-arrow {
- margin: 0 .1em;
- font-size: 2em;
- font-family: "Courier New", Courier, monospace;
- vertical-align: baseline; /* for IE7 */
- }
+ }
+.fc .fc-datagrid-expander .fc-icon { /* the expander and spacers before the expander */
+ display: inline-block;
+ width: 1em; /* ensure constant width, esp for empty icons */
+ }
+.fc .fc-datagrid-expander-placeholder {
+ cursor: auto;
+ }
+.fc .fc-resource-timeline-flat .fc-datagrid-expander-placeholder {
+ display: none;
+ }
+.fc-direction-ltr .fc-datagrid-cell-resizer { right: -3px }
+.fc-direction-rtl .fc-datagrid-cell-resizer { left: -3px }
+.fc-direction-ltr .fc-datagrid-expander { margin-right: 3px }
+.fc-direction-rtl .fc-datagrid-expander { margin-left: 3px }
-.fc-button-prev .fc-text-arrow,
-.fc-button-next .fc-text-arrow { /* for ‹ › */
- font-weight: bold;
- }
-
-/* icon (for jquery ui) */
-
-.fc-button .fc-icon-wrap {
- position: relative;
- float: left;
- top: 50%;
- }
-
-.fc-button .ui-icon {
- position: relative;
- float: left;
- margin-top: -50%;
- *margin-top: 0;
- *top: -50%;
- }
-
-/*
- button states
- borrowed from twitter bootstrap (http://twitter.github.com/bootstrap/)
-*/
-
-.fc-state-default {
- background-color: #f5f5f5;
- background-image: -moz-linear-gradient(top, #ffffff, #e6e6e6);
- background-image: -webkit-gradient(linear, 0 0, 0 100%, from(#ffffff), to(#e6e6e6));
- background-image: -webkit-linear-gradient(top, #ffffff, #e6e6e6);
- background-image: -o-linear-gradient(top, #ffffff, #e6e6e6);
- background-image: linear-gradient(to bottom, #ffffff, #e6e6e6);
- background-repeat: repeat-x;
- border-color: #e6e6e6 #e6e6e6 #bfbfbf;
- border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
- color: #333;
- text-shadow: 0 1px 1px rgba(255, 255, 255, 0.75);
- box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
- }
-
-.fc-state-hover,
-.fc-state-down,
-.fc-state-active,
-.fc-state-disabled {
- color: #333333;
- background-color: #e6e6e6;
- }
-
-.fc-state-hover {
- color: #333333;
- text-decoration: none;
- background-position: 0 -15px;
- -webkit-transition: background-position 0.1s linear;
- -moz-transition: background-position 0.1s linear;
- -o-transition: background-position 0.1s linear;
- transition: background-position 0.1s linear;
- }
-
-.fc-state-down,
-.fc-state-active {
- background-color: #cccccc;
- background-image: none;
- outline: 0;
- box-shadow: inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);
- }
-
-.fc-state-disabled {
- cursor: default;
- background-image: none;
- opacity: 0.65;
- filter: alpha(opacity=65);
- box-shadow: none;
- }
-
-
-
-/* Global Event Styles
-------------------------------------------------------------------------*/
-
-.fc-event {
- border: 1px solid #3a87ad; /* default BORDER color */
- background-color: #3a87ad; /* default BACKGROUND color */
- color: #fff; /* default TEXT color */
- font-size: .85em;
- cursor: default;
- }
-
-a.fc-event {
- text-decoration: none;
- }
-
-a.fc-event,
-.fc-event-draggable {
- cursor: pointer;
- }
-
-.fc-rtl .fc-event {
- text-align: right;
- }
-
-.fc-event-inner {
- width: 100%;
- height: 100%;
- overflow: hidden;
- }
-
-.fc-event-time,
-.fc-event-title {
- padding: 0 1px;
- }
-
-.fc .ui-resizable-handle {
- display: block;
- position: absolute;
- z-index: 99999;
- overflow: hidden; /* hacky spaces (IE6/7) */
- font-size: 300%; /* */
- line-height: 50%; /* */
- }
-
-
-
-/* Horizontal Events
-------------------------------------------------------------------------*/
-
-.fc-event-hori {
- border-width: 1px 0;
- margin-bottom: 1px;
- }
-
-.fc-ltr .fc-event-hori.fc-event-start,
-.fc-rtl .fc-event-hori.fc-event-end {
- border-left-width: 1px;
- border-top-left-radius: 3px;
- border-bottom-left-radius: 3px;
- }
-
-.fc-ltr .fc-event-hori.fc-event-end,
-.fc-rtl .fc-event-hori.fc-event-start {
- border-right-width: 1px;
- border-top-right-radius: 3px;
- border-bottom-right-radius: 3px;
- }
-
-/* resizable */
-
-.fc-event-hori .ui-resizable-e {
- top: 0 !important; /* importants override pre jquery ui 1.7 styles */
- right: -3px !important;
- width: 7px !important;
- height: 100% !important;
- cursor: e-resize;
- }
-
-.fc-event-hori .ui-resizable-w {
- top: 0 !important;
- left: -3px !important;
- width: 7px !important;
- height: 100% !important;
- cursor: w-resize;
- }
-
-.fc-event-hori .ui-resizable-handle {
- _padding-bottom: 14px; /* IE6 had 0 height */
- }
-
-
-
-/* Reusable Separate-border Table
-------------------------------------------------------------*/
-
-table.fc-border-separate {
- border-collapse: separate;
- }
-
-.fc-border-separate th,
-.fc-border-separate td {
- border-width: 1px 0 0 1px;
- }
-
-.fc-border-separate th.fc-last,
-.fc-border-separate td.fc-last {
- border-right-width: 1px;
- }
-
-.fc-border-separate tr.fc-last th,
-.fc-border-separate tr.fc-last td {
- border-bottom-width: 1px;
- }
-
-.fc-border-separate tbody tr.fc-first td,
-.fc-border-separate tbody tr.fc-first th {
- border-top-width: 0;
- }
-
-
-
-/* Month View, Basic Week View, Basic Day View
-------------------------------------------------------------------------*/
-
-.fc-grid th {
- text-align: center;
- }
-
-.fc .fc-week-number {
- width: 22px;
- text-align: center;
- }
-
-.fc .fc-week-number div {
- padding: 0 2px;
- }
-
-.fc-grid .fc-day-number {
- float: right;
- padding: 0 2px;
- }
-
-.fc-grid .fc-other-month .fc-day-number {
- opacity: 0.3;
- filter: alpha(opacity=30); /* for IE */
- /* opacity with small font can sometimes look too faded
- might want to set the 'color' property instead
- making day-numbers bold also fixes the problem */
- }
-
-.fc-grid .fc-day-content {
- clear: both;
- padding: 2px 2px 1px; /* distance between events and day edges */
- }
-
-/* event styles */
-
-.fc-grid .fc-event-time {
- font-weight: bold;
- }
-
-/* right-to-left */
-
-.fc-rtl .fc-grid .fc-day-number {
- float: left;
- }
-
-.fc-rtl .fc-grid .fc-event-time {
- float: right;
- }
-
-
-
-/* Agenda Week View, Agenda Day View
-------------------------------------------------------------------------*/
-
-.fc-agenda table {
- border-collapse: separate;
- }
-
-.fc-agenda-days th {
- text-align: center;
- }
-
-.fc-agenda .fc-agenda-axis {
- width: 50px;
- padding: 0 4px;
- vertical-align: middle;
- text-align: right;
- white-space: nowrap;
- font-weight: normal;
- }
-
-.fc-agenda .fc-week-number {
- font-weight: bold;
- }
-
-.fc-agenda .fc-day-content {
- padding: 2px 2px 1px;
- }
-
-/* make axis border take precedence */
-
-.fc-agenda-days .fc-agenda-axis {
- border-right-width: 1px;
- }
-
-.fc-agenda-days .fc-col0 {
- border-left-width: 0;
- }
-
-/* all-day area */
-
-.fc-agenda-allday th {
- border-width: 0 1px;
- }
-
-.fc-agenda-allday .fc-day-content {
- /*min-height: 34px; *//* TODO: doesnt work well in quirksmode */
- _height: 34px;
- }
-
-/* divider (between all-day and slots) */
-
-.fc-agenda-divider-inner {
- height: 2px;
- overflow: hidden;
- }
-
-.fc-widget-header .fc-agenda-divider-inner {
- background: #eee;
- }
-
-/* slot rows */
-
-.fc-agenda-slots th {
- border-width: 1px 1px 0;
- }
-
-.fc-agenda-slots td {
- border-width: 1px 0 0;
- background: none;
- }
-
-.fc-agenda-slots td div {
- height: 20px;
- }
-
-.fc-agenda-slots tr.fc-slot0 th,
-.fc-agenda-slots tr.fc-slot0 td {
- border-top-width: 0;
- }
-
-.fc-agenda-slots tr.fc-minor th,
-.fc-agenda-slots tr.fc-minor td {
- border-top-style: dotted;
- }
-
-.fc-agenda-slots tr.fc-minor th.ui-widget-header {
- *border-top-style: solid; /* doesn't work with background in IE6/7 */
- }
-
-
-
-/* Vertical Events
-------------------------------------------------------------------------*/
-
-.fc-event-vert {
- border-width: 0 1px;
- }
-
-.fc-event-vert.fc-event-start {
- border-top-width: 1px;
- border-top-left-radius: 3px;
- border-top-right-radius: 3px;
- }
-
-.fc-event-vert.fc-event-end {
- border-bottom-width: 1px;
- border-bottom-left-radius: 3px;
- border-bottom-right-radius: 3px;
- }
-
-.fc-event-vert .fc-event-time {
- white-space: nowrap;
- font-size: 10px;
- }
-
-.fc-event-vert .fc-event-inner {
- position: relative;
- z-index: 2;
- }
-
-.fc-event-vert .fc-event-bg { /* makes the event lighter w/ a semi-transparent overlay */
- position: absolute;
- z-index: 1;
- top: 0;
- left: 0;
- width: 100%;
- height: 100%;
- background: #fff;
- opacity: .25;
- filter: alpha(opacity=25);
- }
-
-.fc .ui-draggable-dragging .fc-event-bg, /* TODO: something nicer like .fc-opacity */
-.fc-select-helper .fc-event-bg {
- display: none\9; /* for IE6/7/8. nested opacity filters while dragging don't work */
- }
-
-/* resizable */
-
-.fc-event-vert .ui-resizable-s {
- bottom: 0 !important; /* importants override pre jquery ui 1.7 styles */
- width: 100% !important;
- height: 8px !important;
- overflow: hidden !important;
- line-height: 8px !important;
- font-size: 11px !important;
- font-family: monospace;
- text-align: center;
- cursor: s-resize;
- }
-
-.fc-agenda .ui-resizable-resizing { /* TODO: better selector */
- _overflow: hidden;
- }
-
-
diff --git a/app/controllers/admin/property_hires_controller.rb b/app/controllers/admin/property_hires_controller.rb
index 40a1736..f984d5f 100644
--- a/app/controllers/admin/property_hires_controller.rb
+++ b/app/controllers/admin/property_hires_controller.rb
@@ -24,7 +24,14 @@ class Admin::PropertyHiresController < OrbitAdminController
@locations = PropertyLocation.all.desc(:created_at).collect{|loc| [loc.title, loc.id.to_s]}
@locations << ["Other", "other_location"]
end
-
+ def edit_hire
+ @phire = PHire.find(params[:id])
+ end
+ def update_hire
+ @phire = PHire.find(params[:id])
+ @phire.update_attributes(phire_params)
+ redirect_to admin_property_hire_path(:id=>@phire.property)
+ end
def edit
@property = Property.where(:uid => params[:id].split("-").last).first rescue nil
create_set (true)
@@ -178,7 +185,9 @@ class Admin::PropertyHiresController < OrbitAdminController
def location_params
params.require(:property_location).permit!
end
-
+ def phire_params
+ params.require(:p_hire).permit!
+ end
def property_params
prop = params.require(:property).permit!
prop.delete(:property_location) if prop[:property_location] == "other"
diff --git a/app/controllers/property_hires_controller.rb b/app/controllers/property_hires_controller.rb
index b2bffdc..9a31955 100644
--- a/app/controllers/property_hires_controller.rb
+++ b/app/controllers/property_hires_controller.rb
@@ -214,7 +214,7 @@ class PropertyHiresController < ApplicationController
end
end
respond_to do |format|
- format.html # index.html.erb
+ format.html { render json: allevents.to_json }# index.html.erb
format.json { render json: allevents.to_json }
end
end
diff --git a/app/helpers/admin/property_hires_helper.rb b/app/helpers/admin/property_hires_helper.rb
index bf07c87..78d05a1 100644
--- a/app/helpers/admin/property_hires_helper.rb
+++ b/app/helpers/admin/property_hires_helper.rb
@@ -2,32 +2,63 @@ module Admin::PropertyHiresHelper
def check_for_availability(stime, etime, pid, interval=nil, recurring_end_date=nil)
property = Property.find(pid)
- return {"success" => false, "msg" => "Values are not ok."} if property.nil? || stime.blank? || etime.blank?
+ return {"success" => false, "msg" => I18n.t("property_hire.values_are_not_ok",:default=>"Values are not ok.")} if property.nil? || stime.blank? || etime.blank?
+ timezone = (params[:timezone] rescue nil)
+ timezone = timezone ? timezone : Time.zone.to_s
if !stime.blank?
- stime = DateTime.parse(stime + Time.zone.to_s) rescue nil
+ stime = DateTime.parse(stime + timezone) rescue nil
else
stime = nil
end
if !etime.blank?
- etime = DateTime.parse(etime + Time.zone.to_s) rescue nil
+ etime = DateTime.parse(etime + timezone) rescue nil
else
etime = nil
end
if !recurring_end_date.blank?
- recurring_end_date = DateTime.parse(recurring_end_date + Time.zone.to_s) rescue nil
+ recurring_end_date = DateTime.parse(recurring_end_date + timezone) rescue nil
+ begin
+ interval_time = 1.send(interval)
+ tmp_date = recurring_end_date - interval_time
+ if tmp_date < etime
+ I18n.with_locale(params[:locale]) do
+ interval_str= I18n.t("property_hire.1_#{interval}","1 #{interval}")
+ default_msg = "Recurring end date must exceed hire end time than #{interval_str}!"
+ msg = I18n.t("property_hire.recurring_end_date_must_exceed_time",{:time=>interval_str,:default=>default_msg})
+ return {"success" => false, "msg" => msg}
+ end
+ end
+ rescue
+ end
else
recurring_end_date = nil
end
data = {}
- return {"success" => false, "msg" => "Starting time cannot be greater than ending time."} if stime > etime
- if property.is_available_for_hire?(stime, etime, interval, recurring_end_date)
- if property.not_yet_hired?(stime, etime, interval, recurring_end_date)
+ if stime > etime
+ I18n.with_locale(params[:locale]) do
+ return {"success" => false, "msg" => I18n.t("property_hire.starting_time_cannot_be_greater_than_ending_time")}
+ end
+ end
+ available_flag = property.is_available_for_hire?(stime, etime, interval, recurring_end_date)
+ if available_flag
+ if property.not_yet_hired?(stime, etime, interval, recurring_end_date,params[:phire_id])
data = {"success" => true}
else
- data = {"success" => false, "msg" => "Property is already hired during this time."}
+ I18n.with_locale(params[:locale]) do
+ data = {"success" => false, "msg" => I18n.t("property_hire.property_is_already_hired_during_this_time")}
+ end
end
else
- data = {"success" => false, "msg" => "Property is unavailable during this time."}
+ I18n.with_locale(params[:locale]) do
+ msg = I18n.t("property_hire.property_is_unavailable_during_this_time")
+ if available_flag.nil?
+ can_hire_date = stime - (property.can_hire_before_months).month
+ msg += ("
<% end %>
- <%= f.label :start_time, t("property_hire.start_time"), :class => "control-label muted" %>
+ <%= f.label :can_hire_before_months, t("property_hire.how_many_months_ago_can_be_hired"), :class => "control-label muted" %>
- <%= f.datetime_picker :start_time, :picker_type => "time", :no_label => true, :new_record => @property.new_record?, :value => (Time.parse(@property.start_time) rescue "") %>
+ <%= f.select :can_hire_before_months, options_for_select([[t("property_hire.no_limit"),0]] + (1..12).to_a.map{|month| [t("property_hire.month", month: month), month]},f.object.can_hire_before_months) %>
- <%= f.label :end_time, t("property_hire.end_time"), :class => "control-label muted" %>
-
- <%= f.datetime_picker :end_time, :picker_type => "time", :no_label => true, :new_record => @property.new_record?, :value => (Time.parse(@property.end_time) rescue "") %>
-
-
-
@@ -295,6 +273,18 @@
<%= f.datetime_picker :end_date, :picker_type => "date", :no_label => true, :new_record => @property.new_record?, :data=>{"picker-type" => "range", "range" => "end"}, :format => "yyyy/MM/dd" %>
+ <%= f.label :start_time, t("property_hire.limit_start_time"), :class => "control-label muted" %>
+
+ <%= f.datetime_picker :start_time, :picker_type => "time", :no_label => true, :new_record => @property.new_record?, :value => (Time.parse(@property.start_time) rescue "") %>
+
+
+ <%= f.label :end_time, t("property_hire.limit_end_time"), :class => "control-label muted" %>
+
+ <%= f.datetime_picker :end_time, :picker_type => "time", :no_label => true, :new_record => @property.new_record?, :value => (Time.parse(@property.end_time) rescue "") %>
+
+
diff --git a/app/views/admin/property_hires/edit_hire.html.erb b/app/views/admin/property_hires/edit_hire.html.erb
new file mode 100644
index 0000000..6f16ee6
--- /dev/null
+++ b/app/views/admin/property_hires/edit_hire.html.erb
@@ -0,0 +1,496 @@
+
+<%= content_for :page_specific_css do %>
+ <% ["basic/bootstrap-datetimepicker.css","property_hire_fullcalendar.css","property_hire_calendar"].each do |css| %>
+ <%= stylesheet_link_tag css %>
+ <% end %>
+<% end %>
+
+
+
+
+<%
+ hire = @phire
+ property = @phire.property
+%>
+
<%= property.title %>
+<% if session["hire-save-msg"].present? %>
+
Sorry! <%= session["hire-save-msg"] %>
+ <% session.delete("hire-save-msg") %>
+<% end %>
+
+
+
+
+
+
+
+
+ <%= fields_for :timepicker do |f|%>
+ <%= f.time_picker :timepicker, :no_label => true, :new_record => hire.new_record?,:format=>"HH:mm", :class => "pull-left", :data=>{"picker-type" => "range", "range" => "end", "fv-validation" => "required;", "fv-messages" => "Cannot be empty;"} %>
+ <% end %>
+
+ <%=t("property_hire.confirm")%>
+ <%=t("property_hire.cancel")%>
+
+
+
+
+
+<%= form_for hire, :url => update_hire_admin_property_hire_path(hire), html: { class: "form-horizontal" } do |f| %>
+
+
+
+
+
+
+
+
+
+
+
+
+
+ <% if(property.enable_notes_selector rescue false) %>
+ <% property.notes_selector.each do |index,sub_hash| %>
+ <% name = sub_hash["name"][I18n.locale.to_s] %>
+ <% name = sub_hash["name"].values.select{|v| v.present?}.first.to_s if name.blank? %>
+ <% values = sub_hash["value"][I18n.locale.to_s] %>
+ <% values = sub_hash["value"].values.select{|v| v.present?}.first.to_s if values.blank? %>
+ <% type = sub_hash["type"] %>
+
+ <% end %>
+ <% else %>
+
+ <% end %>
+ <% fields_name = ["organization" ,"person_in_charge" , "tel_of_person_in_charge" , "department" , "contact_person" , "tel_of_contact_person" , "mobile_phone_of_contact_person" , "contact_person_Email" , "contact_person_department"] %>
+ <% fields_name.each do |field_name| %>
+ <% if(property[field_name]["enable"] == "1" rescue false) %>
+ <% required = (property[field_name]["required"] == "true" rescue false) %>
+
+ <% end %>
+ <% end %>
+
+<% end %>
+
+
+
+
+
+
+
+
diff --git a/app/views/admin/property_hires/show.html.erb b/app/views/admin/property_hires/show.html.erb
index 1aa72b3..e2c6be0 100644
--- a/app/views/admin/property_hires/show.html.erb
+++ b/app/views/admin/property_hires/show.html.erb
@@ -1,4 +1,80 @@
<%= csrf_meta_tag %>
+
+
+<% if params[:type] == "Calendar" %>
+
+ <%= content_for :page_specific_css do %>
+ <% ["basic/bootstrap-datetimepicker.css","property_hire_fullcalendar.css","property_hire_calendar"].each do |css| %>
+ <%= stylesheet_link_tag css %>
+ <% end %>
+ <% end %>
+
+
+
+
+
+
+
+<% else %>
Back
<% if can_edit_or_delete?(@booking.property) %>
+
Edit
<% if @booking.passed %>
" class="btn btn-warning">Reject
<% else %>
diff --git a/app/views/property_hires/hire.html.erb b/app/views/property_hires/hire.html.erb
index 4eba779..122928d 100644
--- a/app/views/property_hires/hire.html.erb
+++ b/app/views/property_hires/hire.html.erb
@@ -1,7 +1,8 @@
-<% OrbitHelper.render_css_in_head(["basic/bootstrap-datetimepicker.css"]) %>
-<%= javascript_include_tag "lib/bootstrap-datetimepicker" %>
-<%= javascript_include_tag "lib/datetimepicker/datetimepicker.js" %>
+<% OrbitHelper.render_css_in_head(["basic/bootstrap-datetimepicker.css","property_hire_fullcalendar.css","property_hire_calendar.scss"]) %>
<%= javascript_include_tag "validator.js" %>
+
+
+
<%
data = action_data
hire = data["hire"]
@@ -26,17 +27,159 @@
Sorry! <%= session["hire-save-msg"] %>
<% session.delete("hire-save-msg") %>
<% end %>
+
+
+
+
+
+
+
+
+ <%= fields_for :timepicker do |f|%>
+ <%= f.time_picker :timepicker, :no_label => true, :new_record => hire.new_record?,:format=>"HH:mm", :class => "pull-left", :data=>{"picker-type" => "range", "range" => "end", "fv-validation" => "required;", "fv-messages" => "Cannot be empty;"} %>
+ <% end %>
+
+ <%=t("property_hire.confirm")%>
+ <%=t("property_hire.cancel")%>
+
+
+
+
+
<%= form_for hire, :url => "/xhr/property_hires/make_booking", html: { class: "form-horizontal" } do |f| %>
@@ -57,7 +200,8 @@
Hooray! This property is available.
Sorry! This property is available.
-
Please! Select an interval time and recurring event end date.
+
+ <% hint1 = t("property_hire.please_select_recurring_interval_and_recurring_end_time",:default=>"") %>
+ <% if hint1 == ""%>
+ Please! Select an interval time and recurring event end date.
+ <% else %>
+ <%=hint1%>
<% if property.set_unavailibility %>
<%= t("property_hire.Unavailibility_Schedule") %>
- This property is unavaliable <%= !property.start_date.nil? ? " from " + property.start_date.strftime("%Y-%m-%d") : "" %> <%= !property.end_date.nil? ? " to " + property.end_date.strftime("%Y-%m-%d") : "" %> every
- <% property.weekdays.each_with_index do |d,i| %>
- <% if i < (property.weekdays.count - 1) %>
- <%= Property::WEEKDAYS[d.to_i] + ", " %>
- <% else %>
- <%= Property::WEEKDAYS[d.to_i] %>
- <% end %>
- <% end %>
- between <%= property.start_time %> & <%= property.end_time %>.
+ <%= property.render_unavailable_message%>
<% end %>
@@ -176,45 +319,76 @@
@@ -33,9 +34,9 @@
+